@charset "UTF-8";
/************************************************************************************
RESET CSS
*************************************************************************************/
* {
  box-sizing: border-box;
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
}

html, body, address, blockquote, div, dl, form, h1, h2, h3, h4, h5, h6, ol, p, pre, table, ul a,
em, i, img, span, strong, sub, sup, li {
  margin: 0;
  padding: 0;
}

img, fieldset {
  border: 0;
}

img {
  border: 0;
  margin: 0;
  max-width: 100%;
  width: auto;
  height: auto;
  box-sizing: border-box;
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
}

tbody {
  width: 100%;
}

p {
  margin: 0px;
  padding: 0px;
}

img {
  border: 0px;
  margin: 0px;
  max-width: 100%;
  width: auto;
  height: auto;
}

h1 {
  margin: 0px;
}

form {
  margin: 0px;
}

ul {
  list-style-position: inside;
  padding-left: 0px;
  margin-left: 0px;
}

hr {
  background-color: #cccccc;
  height: 1px;
  border: 0;
  color: #cccccc;
}

/* 
html5doctor.com Reset Stylesheet
v1.6.1
Last Updated: 2010-09-17
Author: Richard Clark - http://richclarkdesign.com 
Twitter: @rich_clark
*/
html, body, div, span, object, iframe,
h1, h2, h3, h4, h5, h6, p, blockquote, pre,
abbr, address, cite, code,
del, dfn, em, img, ins, kbd, q, samp,
small, strong, sub, sup, var,
b, i,
dl, dt, dd, ol, ul, li,
fieldset, form, label, legend,
table, caption, tbody, tfoot, thead, tr, th, td,
article, aside, canvas, details, figcaption, figure,
footer, header, hgroup, menu, nav, section, summary,
time, mark, audio, video {
  margin: 0;
  padding: 0;
  border: 0;
  outline: 0;
  font-size: 100%;
  vertical-align: baseline;
  background: transparent;
}

article, aside, details, figcaption, figure,
footer, header, hgroup, menu, nav, section {
  display: block;
}

nav ul {
  list-style: none;
}

blockquote, q {
  quotes: none;
}

blockquote:before, blockquote:after,
q:before, q:after {
  content: "";
  content: none;
}

a {
  margin: 0;
  padding: 0;
  font-size: 100%;
  vertical-align: baseline;
  background: transparent;
  text-decoration: none;
}

/* change colours to suit your needs */
ins {
  background-color: #ff9;
  color: #000;
  text-decoration: none;
}

/* change colours to suit your needs */
mark {
  background-color: #ff9;
  color: #000;
  font-style: italic;
  font-weight: bold;
}

del {
  text-decoration: line-through;
}

abbr[title], dfn[title] {
  border-bottom: 1px dotted;
  cursor: help;
}

table {
  border-collapse: collapse;
  border-spacing: 0;
}

/* change border colour to suit your needs */
hr {
  display: block;
  height: 1px;
  border: 0;
  border-top: 1px solid #cccccc;
  margin: 1em 0;
  padding: 0;
}

input, select {
  vertical-align: middle;
}

/*///////////////////////////////////////////////////////////////////////*/
/* FORMULARIO */
/*///////////////////////////////////////////////////////////////////////*/
input, select, textarea {
  height: 50px;
  width: 100%;
  padding: 15px;
  font-size: 18px;
  border-radius: 4px;
  line-height: normal;
  border: 1px solid #7b7b7b;
  background-color: #ffffff;
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
  -ms-box-sizing: border-box;
  box-sizing: border-box;
}

input:focus, select:focus, textarea:focus {
  box-shadow: 0 0 2px 0 #afd5ef;
  border-color: #afd5ef;
  outline-color: #afd5ef;
}

input[type=button],
input[type=image],
input[type=submit] {
  width: auto;
  height: auto;
  border: 0;
  outline: 0;
  -webkit-appearance: none;
  box-shadow: none;
}

select[multiple], input[type=file], textarea {
  height: auto;
}

select {
  -webkit-appearance: menulist-button;
}

@media screen and (-webkit-min-device-pixel-ratio: 0) {
  /* Safari only override */
  ::i-block-chrome, select {
    appearance: initial;
    -moz-appearance: initial;
    -webkit-appearance: initial;
  }
}
textarea {
  resize: none;
  font-family: "Open Sans", sans-serif;
}

input[type=radio], input[type=checkbox] {
  height: auto;
  width: auto;
  vertical-align: bottom;
  outline: none;
}

input[type=radio]:focus, input[type=checkbox]:focus {
  box-shadow: none;
}

input::-webkit-input-placeholder {
  color: #696969;
  font-size: 18px;
  font-family: "Open Sans", sans-serif;
}

input:-moz-placeholder {
  color: #696969;
  font-size: 18px;
  font-family: "Open Sans", sans-serif;
  opacity: 1;
}

input::-moz-placeholder {
  color: #696969;
  font-size: 18px;
  font-family: "Open Sans", sans-serif;
  opacity: 1;
}

input:-ms-input-placeholder {
  color: #696969;
  font-size: 18px;
  font-family: "Open Sans", sans-serif;
}

/*///////////////////////////////////*/
/* CODIGO DE SEGURIDAD */
/*///////////////////////////////////*/
.codigo_form {
  padding-right: 84px;
}

.img_codigo {
  position: absolute;
  top: 1px;
  right: 1px;
  bottom: auto;
  left: auto;
}

.texto-base {
  font-size: 10px;
}

.texto-xs {
  font-size: 14px;
}

.texto-sm {
  font-size: 15px;
}

.texto-md {
  font-size: 17px;
}

.texto-lg {
  font-size: 18px;
}

.texto-xl {
  font-size: 20px;
}

.titulo-xs {
  font-size: 30px;
}

.titulo-sm {
  font-size: 36px;
}

.titulo-md {
  font-size: 45px;
}

.titulo-lg {
  font-size: 50px;
}

.titulo-xl {
  font-size: 100px;
}

@media only screen and (max-width: 1300px) {
  .texto-base-xlg {
    font-size: 10px;
  }
}
@media only screen and (max-width: 1300px) {
  .texto-xs-xlg {
    font-size: 14px;
  }
}
@media only screen and (max-width: 1300px) {
  .texto-sm-xlg {
    font-size: 15px;
  }
}
@media only screen and (max-width: 1300px) {
  .texto-md-xlg {
    font-size: 17px;
  }
}
@media only screen and (max-width: 1300px) {
  .texto-lg-xlg {
    font-size: 18px;
  }
}
@media only screen and (max-width: 1300px) {
  .texto-xl-xlg {
    font-size: 20px;
  }
}
@media only screen and (max-width: 1300px) {
  .titulo-xs-xlg {
    font-size: 30px;
  }
}
@media only screen and (max-width: 1300px) {
  .titulo-sm-xlg {
    font-size: 36px;
  }
}
@media only screen and (max-width: 1300px) {
  .titulo-md-xlg {
    font-size: 45px;
  }
}
@media only screen and (max-width: 1300px) {
  .titulo-lg-xlg {
    font-size: 50px;
  }
}
@media only screen and (max-width: 1300px) {
  .titulo-xl-xlg {
    font-size: 100px;
  }
}
@media only screen and (max-width: 1200px) {
  .texto-base-lg {
    font-size: 10px;
  }
}
@media only screen and (max-width: 1200px) {
  .texto-xs-lg {
    font-size: 14px;
  }
}
@media only screen and (max-width: 1200px) {
  .texto-sm-lg {
    font-size: 15px;
  }
}
@media only screen and (max-width: 1200px) {
  .texto-md-lg {
    font-size: 17px;
  }
}
@media only screen and (max-width: 1200px) {
  .texto-lg-lg {
    font-size: 18px;
  }
}
@media only screen and (max-width: 1200px) {
  .texto-xl-lg {
    font-size: 20px;
  }
}
@media only screen and (max-width: 1200px) {
  .titulo-xs-lg {
    font-size: 30px;
  }
}
@media only screen and (max-width: 1200px) {
  .titulo-sm-lg {
    font-size: 36px;
  }
}
@media only screen and (max-width: 1200px) {
  .titulo-md-lg {
    font-size: 45px;
  }
}
@media only screen and (max-width: 1200px) {
  .titulo-lg-lg {
    font-size: 50px;
  }
}
@media only screen and (max-width: 1200px) {
  .titulo-xl-lg {
    font-size: 100px;
  }
}
@media only screen and (max-width: 1024px) {
  .texto-base-md {
    font-size: 10px;
  }
}
@media only screen and (max-width: 1024px) {
  .texto-xs-md {
    font-size: 14px;
  }
}
@media only screen and (max-width: 1024px) {
  .texto-sm-md {
    font-size: 15px;
  }
}
@media only screen and (max-width: 1024px) {
  .texto-md-md {
    font-size: 17px;
  }
}
@media only screen and (max-width: 1024px) {
  .texto-lg-md {
    font-size: 18px;
  }
}
@media only screen and (max-width: 1024px) {
  .texto-xl-md {
    font-size: 20px;
  }
}
@media only screen and (max-width: 1024px) {
  .titulo-xs-md {
    font-size: 30px;
  }
}
@media only screen and (max-width: 1024px) {
  .titulo-sm-md {
    font-size: 36px;
  }
}
@media only screen and (max-width: 1024px) {
  .titulo-md-md {
    font-size: 45px;
  }
}
@media only screen and (max-width: 1024px) {
  .titulo-lg-md {
    font-size: 50px;
  }
}
@media only screen and (max-width: 1024px) {
  .titulo-xl-md {
    font-size: 100px;
  }
}
@media only screen and (max-width: 768px) {
  .texto-base-sm {
    font-size: 10px;
  }
}
@media only screen and (max-width: 768px) {
  .texto-xs-sm {
    font-size: 14px;
  }
}
@media only screen and (max-width: 768px) {
  .texto-sm-sm {
    font-size: 15px;
  }
}
@media only screen and (max-width: 768px) {
  .texto-md-sm {
    font-size: 17px;
  }
}
@media only screen and (max-width: 768px) {
  .texto-lg-sm {
    font-size: 18px;
  }
}
@media only screen and (max-width: 768px) {
  .texto-xl-sm {
    font-size: 20px;
  }
}
@media only screen and (max-width: 768px) {
  .titulo-xs-sm {
    font-size: 30px;
  }
}
@media only screen and (max-width: 768px) {
  .titulo-sm-sm {
    font-size: 36px;
  }
}
@media only screen and (max-width: 768px) {
  .titulo-md-sm {
    font-size: 45px;
  }
}
@media only screen and (max-width: 768px) {
  .titulo-lg-sm {
    font-size: 50px;
  }
}
@media only screen and (max-width: 768px) {
  .titulo-xl-sm {
    font-size: 100px;
  }
}
@media only screen and (max-width: 480px) {
  .texto-base-xs {
    font-size: 10px;
  }
}
@media only screen and (max-width: 480px) {
  .texto-xs-xs {
    font-size: 14px;
  }
}
@media only screen and (max-width: 480px) {
  .texto-sm-xs {
    font-size: 15px;
  }
}
@media only screen and (max-width: 480px) {
  .texto-md-xs {
    font-size: 17px;
  }
}
@media only screen and (max-width: 480px) {
  .texto-lg-xs {
    font-size: 18px;
  }
}
@media only screen and (max-width: 480px) {
  .texto-xl-xs {
    font-size: 20px;
  }
}
@media only screen and (max-width: 480px) {
  .titulo-xs-xs {
    font-size: 30px;
  }
}
@media only screen and (max-width: 480px) {
  .titulo-sm-xs {
    font-size: 36px;
  }
}
@media only screen and (max-width: 480px) {
  .titulo-md-xs {
    font-size: 45px;
  }
}
@media only screen and (max-width: 480px) {
  .titulo-lg-xs {
    font-size: 50px;
  }
}
@media only screen and (max-width: 480px) {
  .titulo-xl-xs {
    font-size: 100px;
  }
}
.light {
  font-weight: 300;
}

.regular {
  font-weight: 400;
}

.bold {
  font-weight: 700;
}

.semibold {
  font-weight: 600;
}

.extra {
  font-weight: 800;
}

.familia1 {
  font-family: "Open Sans", sans-serif;
}

.texto-der {
  text-align: right;
}

.texto-izq {
  text-align: left;
}

.texto-centro {
  text-align: center;
}

/*////////////////*/
/* LINE HEIGHT */
/*////////////////*/
.line-height-min {
  line-height: 14px;
}

.line-height-xs {
  line-height: 15px;
}

.line-height-sm {
  line-height: 17px;
}

.line-height-md {
  line-height: 18px;
}

.line-height-lg {
  line-height: 20px;
}

.line-height-1 {
  line-height: 1;
}

.line-height-1-5 {
  line-height: 1.5;
}

.line-height-1-8 {
  line-height: 1.8;
}

.line-height-2 {
  line-height: 2;
}

.line-height-2-5 {
  line-height: 2.5;
}

.line-height-3 {
  line-height: 3;
}

.line-height-normal {
  line-height: normal;
}

/*///////////////////*/
/* LETTERENG SPACING */
/*///////////////////*/
.spa-letra-min {
  letter-spacing: 0.1px;
}

.spa-letra-xs {
  letter-spacing: 0.2px;
}

.spa-letra-sm {
  letter-spacing: 0.5px;
}

.spa-letra-md {
  letter-spacing: 0.8px;
}

.spa-letra-lg {
  letter-spacing: 1px;
}

.no-underline, .no-underline-hover:hover {
  text-decoration: none;
}

.under-line, .underline:hover {
  text-decoration: underline;
}

/*////////////////*/
/* VARIANTES */
/*////////////////*/
.may {
  text-transform: uppercase;
}

.min {
  text-transform: lowercase;
}

.cap {
  text-transform: capitalize;
}

.italic {
  font-style: italic;
}

.tachado {
  text-decoration: line-through;
}

blockquote {
  padding: 10px 20px;
  margin: 0 0 20px;
  font-size: 18px;
  border-left: 5px solid #42b6e5;
  line-height: normal;
}

blockquote .small, blockquote footer, blockquote small {
  display: block;
  font-size: 80%;
  line-height: 1.42857143;
  color: #777;
}

@font-face {
  font-family: "iconos";
  src: url("../fonts/iconos.eot?jp1dum");
  src: url("../fonts/iconos.eot?jp1dum#iefix") format("embedded-opentype"), url("../fonts/iconos.ttf?jp1dum") format("truetype"), url("../fonts/iconos.woff?jp1dum") format("woff"), url("../fonts/iconos.svg?jp1dum#iconos") format("svg");
  font-weight: normal;
  font-style: normal;
  font-display: fallback;
}
[class^=icono-], [class*=" icono-"] {
  /* use !important to prevent issues with browser extensions that change fonts */
  font-family: "iconos" !important;
  speak: none;
  font-style: normal;
  font-weight: normal;
  font-variant: normal;
  text-transform: none;
  line-height: 1;
  /* Better Font Rendering =========== */
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.icono-goles_minutos:before {
  content: "\e930";
}

.icono-radio_play:before {
  content: "\e92d";
}

.icono-radio_pause:before {
  content: "\e92e";
}

.icono-cake:before {
  content: "\e92b";
}

.icono-grid-world:before {
  content: "\e92c";
}

.icono-info_simple:before {
  content: "\e92a";
}

.icono-red-what:before {
  content: "\e929";
}

.icono-calendario:before {
  content: "\e900";
}

.icono-capitan .path1:before {
  content: "\e926";
  color: #264a6d;
}

.icono-capitan .path2:before {
  content: "\e927";
  margin-left: -1em;
  color: #3a658f;
}

.icono-capitan .path3:before {
  content: "\e928";
  margin-left: -1em;
  color: white;
}

.icono-cerrar:before {
  content: "\e901";
}

.icono-compartir:before {
  content: "\e902";
}

.icono-contacto:before {
  content: "\e903";
}

.icono-descargar:before {
  content: "\e904";
}

.icono-direccion:before {
  content: "\e905";
}

.icono-entrada:before {
  content: "\e906";
}

.icono-escudo:before {
  content: "\e907";
}

.icono-escudo-mas:before {
  content: "\e908";
}

.icono-estrella:before {
  content: "\e909";
}

.icono-filtro:before {
  content: "\e90a";
}

.icono-flecha-bot:before {
  content: "\e90b";
}

.icono-flecha-completa-abajo:before {
  content: "\e90c";
}

.icono-flecha-der:before {
  content: "\e90d";
}

.icono-flecha-izq:before {
  content: "\e90e";
}

.icono-flecha-top:before {
  content: "\e90f";
}

.icono-flecha-triangulo-abajo:before {
  content: "\e910";
}

.icono-galeria:before {
  content: "\e911";
}

.icono-goles:before {
  content: "\e912";
}

.icono-google-map:before {
  content: "\e913";
}

.icono-info:before {
  content: "\e925";
}

.icono-lupa:before {
  content: "\e915";
}

.icono-menu:before {
  content: "\e916";
}

.icono-menu-4-lineas:before {
  content: "\e917";
}

.icono-minutos:before {
  content: "\e918";
}

.icono-partidos:before {
  content: "\e919";
}

.icono-play:before {
  content: "\e91a";
}

.icono-red-face:before {
  content: "\e91b";
}

.icono-red-goog:before {
  content: "\e91c";
}

.icono-red-inst:before {
  content: "\e91d";
}

.icono-red-twit:before {
  content: "\e91e";
}

.icono-red-yout:before {
  content: "\e91f";
}

.icono-salida:before {
  content: "\e920";
}

.icono-tarjeta:before {
  content: "\e921";
}

.icono-telefono:before {
  content: "\e922";
}

.icono-tick:before {
  content: "\e923";
}

.icono-video:before {
  content: "\e924";
}

.icono-auf:before {
  content: "\e92f";
}

.icono-i2es:before {
  content: "\e914";
}

/*!
 * Bootstrap Reboot v4.1.3 (https://getbootstrap.com/)
 * Copyright 2011-2018 The Bootstrap Authors
 * Copyright 2011-2018 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
 * Forked from Normalize.css, licensed MIT (https://github.com/necolas/normalize.css/blob/master/LICENSE.md)
 */
*,
*::before,
*::after {
  box-sizing: border-box;
}

html {
  font-family: sans-serif;
  line-height: 1.15;
  -webkit-text-size-adjust: 100%;
  -ms-text-size-adjust: 100%;
  -ms-overflow-style: scrollbar;
  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
}

@-ms-viewport {
  width: device-width;
}
article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
  display: block;
}

body {
  margin: 0;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #212529;
  text-align: left;
  background-color: #fff;
}

[tabindex="-1"]:focus {
  outline: 0 !important;
}

hr {
  box-sizing: content-box;
  height: 0;
  overflow: visible;
}

h1, h2, h3, h4, h5, h6 {
  margin-top: 0;
  margin-bottom: 0.5rem;
}

p {
  margin-top: 0;
  margin-bottom: 1rem;
}

abbr[title],
abbr[data-original-title] {
  text-decoration: underline;
  -webkit-text-decoration: underline dotted;
  text-decoration: underline dotted;
  cursor: help;
  border-bottom: 0;
}

address {
  margin-bottom: 1rem;
  font-style: normal;
  line-height: inherit;
}

ol,
ul,
dl {
  margin-top: 0;
  margin-bottom: 1rem;
}

ol ol,
ul ul,
ol ul,
ul ol {
  margin-bottom: 0;
}

dt {
  font-weight: 700;
}

dd {
  margin-bottom: 0.5rem;
  margin-left: 0;
}

blockquote {
  margin: 0 0 1rem;
}

dfn {
  font-style: italic;
}

b,
strong {
  font-weight: bolder;
}

small {
  font-size: 80%;
}

sub,
sup {
  position: relative;
  font-size: 75%;
  line-height: 0;
  vertical-align: baseline;
}

sub {
  bottom: -0.25em;
}

sup {
  top: -0.5em;
}

a {
  color: #007bff;
  text-decoration: none;
  background-color: transparent;
  -webkit-text-decoration-skip: objects;
}

a:hover {
  color: #0056b3;
  text-decoration: underline;
}

a:not([href]):not([tabindex]) {
  color: inherit;
  text-decoration: none;
}

a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus {
  color: inherit;
  text-decoration: none;
}

a:not([href]):not([tabindex]):focus {
  outline: 0;
}

pre,
code,
kbd,
samp {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
  font-size: 1em;
}

pre {
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto;
  -ms-overflow-style: scrollbar;
}

figure {
  margin: 0 0 1rem;
}

img {
  vertical-align: middle;
  border-style: none;
}

svg {
  overflow: hidden;
  vertical-align: middle;
}

table {
  border-collapse: collapse;
}

caption {
  padding-top: 0.75rem;
  padding-bottom: 0.75rem;
  color: #6c757d;
  text-align: left;
  caption-side: bottom;
}

th {
  text-align: inherit;
}

label {
  display: inline-block;
  margin-bottom: 0.5rem;
}

button {
  border-radius: 0;
}

button:focus {
  outline: 1px dotted;
  outline: 5px auto -webkit-focus-ring-color;
}

input,
button,
select,
optgroup,
textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
}

button,
input {
  overflow: visible;
}

button,
select {
  text-transform: none;
}

button,
html [type=button],
[type=reset],
[type=submit] {
  -webkit-appearance: button;
}

button::-moz-focus-inner,
[type=button]::-moz-focus-inner,
[type=reset]::-moz-focus-inner,
[type=submit]::-moz-focus-inner {
  padding: 0;
  border-style: none;
}

input[type=radio],
input[type=checkbox] {
  box-sizing: border-box;
  padding: 0;
}

input[type=date],
input[type=time],
input[type=datetime-local],
input[type=month] {
  -webkit-appearance: listbox;
}

textarea {
  overflow: auto;
  resize: vertical;
}

fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0;
}

legend {
  display: block;
  width: 100%;
  max-width: 100%;
  padding: 0;
  margin-bottom: 0.5rem;
  font-size: 1.5rem;
  line-height: inherit;
  color: inherit;
  white-space: normal;
}

progress {
  vertical-align: baseline;
}

[type=number]::-webkit-inner-spin-button,
[type=number]::-webkit-outer-spin-button {
  height: auto;
}

[type=search] {
  outline-offset: -2px;
  -webkit-appearance: none;
}

[type=search]::-webkit-search-cancel-button,
[type=search]::-webkit-search-decoration {
  -webkit-appearance: none;
}

::-webkit-file-upload-button {
  font: inherit;
  -webkit-appearance: button;
}

output {
  display: inline-block;
}

summary {
  display: list-item;
  cursor: pointer;
}

template {
  display: none;
}

[hidden] {
  display: none !important;
}

/*# sourceMappingURL=bootstrap-reboot.css.map */
/*!
 * Bootstrap Grid v4.1.3 (https://getbootstrap.com/)
 * Copyright 2011-2018 The Bootstrap Authors
 * Copyright 2011-2018 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
 */
@-ms-viewport {
  width: device-width;
}
html {
  box-sizing: border-box;
  -ms-overflow-style: scrollbar;
}

*,
*::before,
*::after {
  box-sizing: inherit;
}

.container {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto;
}

@media (min-width: 576px) {
  .container {
    max-width: 540px;
  }
}
@media (min-width: 768px) {
  .container {
    max-width: 720px;
  }
}
@media (min-width: 992px) {
  .container {
    max-width: 960px;
  }
}
@media (min-width: 1200px) {
  .container {
    max-width: 1140px;
  }
}
.container-fluid {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto;
}

.row {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  margin-right: -15px;
  margin-left: -15px;
}

.no-gutters {
  margin-right: 0;
  margin-left: 0;
}

.no-gutters > .col,
.no-gutters > [class*=col-] {
  padding-right: 0;
  padding-left: 0;
}

.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col,
.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm,
.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md,
.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg,
.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl,
.col-xl-auto {
  position: relative;
  width: 100%;
  min-height: 1px;
  padding-right: 15px;
  padding-left: 15px;
}

.col {
  -ms-flex-preferred-size: 0;
  flex-basis: 0;
  -ms-flex-positive: 1;
  flex-grow: 1;
  max-width: 100%;
}

.col-auto {
  -ms-flex: 0 0 auto;
  flex: 0 0 auto;
  width: auto;
  max-width: none;
}

.col-1 {
  -ms-flex: 0 0 8.333333%;
  flex: 0 0 8.333333%;
  max-width: 8.333333%;
}

.col-2 {
  -ms-flex: 0 0 16.666667%;
  flex: 0 0 16.666667%;
  max-width: 16.666667%;
}

.col-3 {
  -ms-flex: 0 0 25%;
  flex: 0 0 25%;
  max-width: 25%;
}

.col-4 {
  -ms-flex: 0 0 33.333333%;
  flex: 0 0 33.333333%;
  max-width: 33.333333%;
}

.col-5 {
  -ms-flex: 0 0 41.666667%;
  flex: 0 0 41.666667%;
  max-width: 41.666667%;
}

.col-6 {
  -ms-flex: 0 0 50%;
  flex: 0 0 50%;
  max-width: 50%;
}

.col-7 {
  -ms-flex: 0 0 58.333333%;
  flex: 0 0 58.333333%;
  max-width: 58.333333%;
}

.col-8 {
  -ms-flex: 0 0 66.666667%;
  flex: 0 0 66.666667%;
  max-width: 66.666667%;
}

.col-9 {
  -ms-flex: 0 0 75%;
  flex: 0 0 75%;
  max-width: 75%;
}

.col-10 {
  -ms-flex: 0 0 83.333333%;
  flex: 0 0 83.333333%;
  max-width: 83.333333%;
}

.col-11 {
  -ms-flex: 0 0 91.666667%;
  flex: 0 0 91.666667%;
  max-width: 91.666667%;
}

.col-12 {
  -ms-flex: 0 0 100%;
  flex: 0 0 100%;
  max-width: 100%;
}

.order-first {
  -ms-flex-order: -1;
  order: -1;
}

.order-last {
  -ms-flex-order: 13;
  order: 13;
}

.order-0 {
  -ms-flex-order: 0;
  order: 0;
}

.order-1 {
  -ms-flex-order: 1;
  order: 1;
}

.order-2 {
  -ms-flex-order: 2;
  order: 2;
}

.order-3 {
  -ms-flex-order: 3;
  order: 3;
}

.order-4 {
  -ms-flex-order: 4;
  order: 4;
}

.order-5 {
  -ms-flex-order: 5;
  order: 5;
}

.order-6 {
  -ms-flex-order: 6;
  order: 6;
}

.order-7 {
  -ms-flex-order: 7;
  order: 7;
}

.order-8 {
  -ms-flex-order: 8;
  order: 8;
}

.order-9 {
  -ms-flex-order: 9;
  order: 9;
}

.order-10 {
  -ms-flex-order: 10;
  order: 10;
}

.order-11 {
  -ms-flex-order: 11;
  order: 11;
}

.order-12 {
  -ms-flex-order: 12;
  order: 12;
}

.offset-1 {
  margin-left: 8.333333%;
}

.offset-2 {
  margin-left: 16.666667%;
}

.offset-3 {
  margin-left: 25%;
}

.offset-4 {
  margin-left: 33.333333%;
}

.offset-5 {
  margin-left: 41.666667%;
}

.offset-6 {
  margin-left: 50%;
}

.offset-7 {
  margin-left: 58.333333%;
}

.offset-8 {
  margin-left: 66.666667%;
}

.offset-9 {
  margin-left: 75%;
}

.offset-10 {
  margin-left: 83.333333%;
}

.offset-11 {
  margin-left: 91.666667%;
}

@media (min-width: 576px) {
  .col-sm {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-sm-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-sm-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-sm-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-sm-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-sm-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-sm-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-sm-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-sm-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-sm-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-sm-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-sm-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-sm-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-sm-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-sm-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-sm-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-sm-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-sm-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-sm-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-sm-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-sm-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-sm-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-sm-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-sm-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-sm-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-sm-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-sm-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-sm-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-sm-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-sm-0 {
    margin-left: 0;
  }

  .offset-sm-1 {
    margin-left: 8.333333%;
  }

  .offset-sm-2 {
    margin-left: 16.666667%;
  }

  .offset-sm-3 {
    margin-left: 25%;
  }

  .offset-sm-4 {
    margin-left: 33.333333%;
  }

  .offset-sm-5 {
    margin-left: 41.666667%;
  }

  .offset-sm-6 {
    margin-left: 50%;
  }

  .offset-sm-7 {
    margin-left: 58.333333%;
  }

  .offset-sm-8 {
    margin-left: 66.666667%;
  }

  .offset-sm-9 {
    margin-left: 75%;
  }

  .offset-sm-10 {
    margin-left: 83.333333%;
  }

  .offset-sm-11 {
    margin-left: 91.666667%;
  }
}
@media (min-width: 768px) {
  .col-md {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-md-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-md-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-md-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-md-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-md-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-md-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-md-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-md-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-md-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-md-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-md-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-md-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-md-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-md-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-md-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-md-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-md-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-md-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-md-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-md-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-md-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-md-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-md-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-md-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-md-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-md-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-md-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-md-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-md-0 {
    margin-left: 0;
  }

  .offset-md-1 {
    margin-left: 8.333333%;
  }

  .offset-md-2 {
    margin-left: 16.666667%;
  }

  .offset-md-3 {
    margin-left: 25%;
  }

  .offset-md-4 {
    margin-left: 33.333333%;
  }

  .offset-md-5 {
    margin-left: 41.666667%;
  }

  .offset-md-6 {
    margin-left: 50%;
  }

  .offset-md-7 {
    margin-left: 58.333333%;
  }

  .offset-md-8 {
    margin-left: 66.666667%;
  }

  .offset-md-9 {
    margin-left: 75%;
  }

  .offset-md-10 {
    margin-left: 83.333333%;
  }

  .offset-md-11 {
    margin-left: 91.666667%;
  }
}
@media (min-width: 992px) {
  .col-lg {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-lg-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-lg-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-lg-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-lg-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-lg-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-lg-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-lg-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-lg-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-lg-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-lg-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-lg-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-lg-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-lg-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-lg-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-lg-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-lg-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-lg-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-lg-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-lg-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-lg-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-lg-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-lg-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-lg-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-lg-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-lg-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-lg-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-lg-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-lg-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-lg-0 {
    margin-left: 0;
  }

  .offset-lg-1 {
    margin-left: 8.333333%;
  }

  .offset-lg-2 {
    margin-left: 16.666667%;
  }

  .offset-lg-3 {
    margin-left: 25%;
  }

  .offset-lg-4 {
    margin-left: 33.333333%;
  }

  .offset-lg-5 {
    margin-left: 41.666667%;
  }

  .offset-lg-6 {
    margin-left: 50%;
  }

  .offset-lg-7 {
    margin-left: 58.333333%;
  }

  .offset-lg-8 {
    margin-left: 66.666667%;
  }

  .offset-lg-9 {
    margin-left: 75%;
  }

  .offset-lg-10 {
    margin-left: 83.333333%;
  }

  .offset-lg-11 {
    margin-left: 91.666667%;
  }
}
@media (min-width: 1200px) {
  .col-xl {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-xl-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-xl-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-xl-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-xl-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-xl-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-xl-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-xl-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-xl-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-xl-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-xl-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-xl-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-xl-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-xl-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-xl-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-xl-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-xl-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-xl-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-xl-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-xl-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-xl-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-xl-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-xl-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-xl-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-xl-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-xl-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-xl-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-xl-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-xl-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-xl-0 {
    margin-left: 0;
  }

  .offset-xl-1 {
    margin-left: 8.333333%;
  }

  .offset-xl-2 {
    margin-left: 16.666667%;
  }

  .offset-xl-3 {
    margin-left: 25%;
  }

  .offset-xl-4 {
    margin-left: 33.333333%;
  }

  .offset-xl-5 {
    margin-left: 41.666667%;
  }

  .offset-xl-6 {
    margin-left: 50%;
  }

  .offset-xl-7 {
    margin-left: 58.333333%;
  }

  .offset-xl-8 {
    margin-left: 66.666667%;
  }

  .offset-xl-9 {
    margin-left: 75%;
  }

  .offset-xl-10 {
    margin-left: 83.333333%;
  }

  .offset-xl-11 {
    margin-left: 91.666667%;
  }
}
.d-none {
  display: none !important;
}

.d-inline {
  display: inline !important;
}

.d-inline-block {
  display: inline-block !important;
}

.d-block {
  display: block !important;
}

.d-table {
  display: table !important;
}

.d-table-row {
  display: table-row !important;
}

.d-table-cell {
  display: table-cell !important;
}

.d-flex {
  display: -ms-flexbox !important;
  display: flex !important;
}

.d-inline-flex {
  display: -ms-inline-flexbox !important;
  display: inline-flex !important;
}

@media (min-width: 576px) {
  .d-sm-none {
    display: none !important;
  }

  .d-sm-inline {
    display: inline !important;
  }

  .d-sm-inline-block {
    display: inline-block !important;
  }

  .d-sm-block {
    display: block !important;
  }

  .d-sm-table {
    display: table !important;
  }

  .d-sm-table-row {
    display: table-row !important;
  }

  .d-sm-table-cell {
    display: table-cell !important;
  }

  .d-sm-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-sm-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 768px) {
  .d-md-none {
    display: none !important;
  }

  .d-md-inline {
    display: inline !important;
  }

  .d-md-inline-block {
    display: inline-block !important;
  }

  .d-md-block {
    display: block !important;
  }

  .d-md-table {
    display: table !important;
  }

  .d-md-table-row {
    display: table-row !important;
  }

  .d-md-table-cell {
    display: table-cell !important;
  }

  .d-md-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-md-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 992px) {
  .d-lg-none {
    display: none !important;
  }

  .d-lg-inline {
    display: inline !important;
  }

  .d-lg-inline-block {
    display: inline-block !important;
  }

  .d-lg-block {
    display: block !important;
  }

  .d-lg-table {
    display: table !important;
  }

  .d-lg-table-row {
    display: table-row !important;
  }

  .d-lg-table-cell {
    display: table-cell !important;
  }

  .d-lg-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-lg-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 1200px) {
  .d-xl-none {
    display: none !important;
  }

  .d-xl-inline {
    display: inline !important;
  }

  .d-xl-inline-block {
    display: inline-block !important;
  }

  .d-xl-block {
    display: block !important;
  }

  .d-xl-table {
    display: table !important;
  }

  .d-xl-table-row {
    display: table-row !important;
  }

  .d-xl-table-cell {
    display: table-cell !important;
  }

  .d-xl-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-xl-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media print {
  .d-print-none {
    display: none !important;
  }

  .d-print-inline {
    display: inline !important;
  }

  .d-print-inline-block {
    display: inline-block !important;
  }

  .d-print-block {
    display: block !important;
  }

  .d-print-table {
    display: table !important;
  }

  .d-print-table-row {
    display: table-row !important;
  }

  .d-print-table-cell {
    display: table-cell !important;
  }

  .d-print-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-print-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
.flex-row {
  -ms-flex-direction: row !important;
  flex-direction: row !important;
}

.flex-column {
  -ms-flex-direction: column !important;
  flex-direction: column !important;
}

.flex-row-reverse {
  -ms-flex-direction: row-reverse !important;
  flex-direction: row-reverse !important;
}

.flex-column-reverse {
  -ms-flex-direction: column-reverse !important;
  flex-direction: column-reverse !important;
}

.flex-wrap {
  -ms-flex-wrap: wrap !important;
  flex-wrap: wrap !important;
}

.flex-nowrap {
  -ms-flex-wrap: nowrap !important;
  flex-wrap: nowrap !important;
}

.flex-wrap-reverse {
  -ms-flex-wrap: wrap-reverse !important;
  flex-wrap: wrap-reverse !important;
}

.flex-fill {
  -ms-flex: 1 1 auto !important;
  flex: 1 1 auto !important;
}

.flex-grow-0 {
  -ms-flex-positive: 0 !important;
  flex-grow: 0 !important;
}

.flex-grow-1 {
  -ms-flex-positive: 1 !important;
  flex-grow: 1 !important;
}

.flex-shrink-0 {
  -ms-flex-negative: 0 !important;
  flex-shrink: 0 !important;
}

.flex-shrink-1 {
  -ms-flex-negative: 1 !important;
  flex-shrink: 1 !important;
}

.justify-content-start {
  -ms-flex-pack: start !important;
  justify-content: flex-start !important;
}

.justify-content-end {
  -ms-flex-pack: end !important;
  justify-content: flex-end !important;
}

.justify-content-center {
  -ms-flex-pack: center !important;
  justify-content: center !important;
}

.justify-content-between {
  -ms-flex-pack: justify !important;
  justify-content: space-between !important;
}

.justify-content-around {
  -ms-flex-pack: distribute !important;
  justify-content: space-around !important;
}

.align-items-start {
  -ms-flex-align: start !important;
  align-items: flex-start !important;
}

.align-items-end {
  -ms-flex-align: end !important;
  align-items: flex-end !important;
}

.align-items-center {
  -ms-flex-align: center !important;
  align-items: center !important;
}

.align-items-baseline {
  -ms-flex-align: baseline !important;
  align-items: baseline !important;
}

.align-items-stretch {
  -ms-flex-align: stretch !important;
  align-items: stretch !important;
}

.align-content-start {
  -ms-flex-line-pack: start !important;
  align-content: flex-start !important;
}

.align-content-end {
  -ms-flex-line-pack: end !important;
  align-content: flex-end !important;
}

.align-content-center {
  -ms-flex-line-pack: center !important;
  align-content: center !important;
}

.align-content-between {
  -ms-flex-line-pack: justify !important;
  align-content: space-between !important;
}

.align-content-around {
  -ms-flex-line-pack: distribute !important;
  align-content: space-around !important;
}

.align-content-stretch {
  -ms-flex-line-pack: stretch !important;
  align-content: stretch !important;
}

.align-self-auto {
  -ms-flex-item-align: auto !important;
  align-self: auto !important;
}

.align-self-start {
  -ms-flex-item-align: start !important;
  align-self: flex-start !important;
}

.align-self-end {
  -ms-flex-item-align: end !important;
  align-self: flex-end !important;
}

.align-self-center {
  -ms-flex-item-align: center !important;
  align-self: center !important;
}

.align-self-baseline {
  -ms-flex-item-align: baseline !important;
  align-self: baseline !important;
}

.align-self-stretch {
  -ms-flex-item-align: stretch !important;
  align-self: stretch !important;
}

@media (min-width: 576px) {
  .flex-sm-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-sm-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-sm-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-sm-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-sm-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-sm-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-sm-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-sm-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-sm-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-sm-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-sm-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-sm-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-sm-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-sm-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-sm-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-sm-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-sm-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-sm-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-sm-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-sm-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-sm-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-sm-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-sm-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-sm-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-sm-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-sm-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-sm-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-sm-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-sm-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-sm-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-sm-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-sm-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-sm-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-sm-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
@media (min-width: 768px) {
  .flex-md-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-md-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-md-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-md-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-md-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-md-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-md-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-md-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-md-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-md-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-md-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-md-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-md-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-md-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-md-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-md-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-md-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-md-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-md-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-md-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-md-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-md-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-md-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-md-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-md-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-md-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-md-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-md-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-md-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-md-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-md-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-md-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-md-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-md-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
@media (min-width: 992px) {
  .flex-lg-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-lg-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-lg-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-lg-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-lg-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-lg-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-lg-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-lg-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-lg-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-lg-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-lg-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-lg-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-lg-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-lg-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-lg-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-lg-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-lg-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-lg-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-lg-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-lg-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-lg-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-lg-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-lg-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-lg-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-lg-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-lg-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-lg-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-lg-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-lg-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-lg-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-lg-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-lg-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-lg-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-lg-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
@media (min-width: 1200px) {
  .flex-xl-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-xl-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-xl-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-xl-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-xl-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-xl-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-xl-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-xl-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-xl-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-xl-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-xl-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-xl-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-xl-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-xl-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-xl-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-xl-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-xl-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-xl-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-xl-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-xl-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-xl-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-xl-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-xl-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-xl-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-xl-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-xl-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-xl-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-xl-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-xl-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-xl-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-xl-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-xl-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-xl-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-xl-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
/*# sourceMappingURL=bootstrap-grid.css.map */
/*!
 * Bootstrap v4.1.3 (https://getbootstrap.com/)
 * Copyright 2011-2018 The Bootstrap Authors
 * Copyright 2011-2018 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
 */
:root {
  --blue:#007bff;
  --indigo:#6610f2;
  --purple:#6f42c1;
  --pink:#e83e8c;
  --red:#dc3545;
  --orange:#fd7e14;
  --yellow:#ffc107;
  --green:#28a745;
  --teal:#20c997;
  --cyan:#17a2b8;
  --white:#fff;
  --gray:#6c757d;
  --gray-dark:#343a40;
  --primary:#007bff;
  --secondary:#6c757d;
  --success:#28a745;
  --info:#17a2b8;
  --warning:#ffc107;
  --danger:#dc3545;
  --light:#f8f9fa;
  --dark:#343a40;
  --breakpoint-xs:0;
  --breakpoint-sm:576px;
  --breakpoint-md:768px;
  --breakpoint-lg:992px;
  --breakpoint-xl:1200px;
  --font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";
  --font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;
}

*, ::after, ::before {
  box-sizing: border-box;
}

html {
  font-family: sans-serif;
  line-height: 1.15;
  -webkit-text-size-adjust: 100%;
  -ms-text-size-adjust: 100%;
  -ms-overflow-style: scrollbar;
  -webkit-tap-highlight-color: transparent;
}

@-ms-viewport {
  width: device-width;
}
article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
  display: block;
}

body {
  margin: 0;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #212529;
  text-align: left;
  background-color: #fff;
}

[tabindex="-1"]:focus {
  outline: 0 !important;
}

hr {
  box-sizing: content-box;
  height: 0;
  overflow: visible;
}

h1, h2, h3, h4, h5, h6 {
  margin-top: 0;
  margin-bottom: 0.5rem;
}

p {
  margin-top: 0;
  margin-bottom: 1rem;
}

abbr[data-original-title], abbr[title] {
  text-decoration: underline;
  -webkit-text-decoration: underline dotted;
  text-decoration: underline dotted;
  cursor: help;
  border-bottom: 0;
}

address {
  margin-bottom: 1rem;
  font-style: normal;
  line-height: inherit;
}

dl, ol, ul {
  margin-top: 0;
  margin-bottom: 1rem;
}

ol ol, ol ul, ul ol, ul ul {
  margin-bottom: 0;
}

dt {
  font-weight: 700;
}

dd {
  margin-bottom: 0.5rem;
  margin-left: 0;
}

blockquote {
  margin: 0 0 1rem;
}

dfn {
  font-style: italic;
}

b, strong {
  font-weight: bolder;
}

small {
  font-size: 80%;
}

sub, sup {
  position: relative;
  font-size: 75%;
  line-height: 0;
  vertical-align: baseline;
}

sub {
  bottom: -0.25em;
}

sup {
  top: -0.5em;
}

a {
  color: #007bff;
  text-decoration: none;
  background-color: transparent;
  -webkit-text-decoration-skip: objects;
}

a:hover {
  color: #0056b3;
  text-decoration: underline;
}

a:not([href]):not([tabindex]) {
  color: inherit;
  text-decoration: none;
}

a:not([href]):not([tabindex]):focus, a:not([href]):not([tabindex]):hover {
  color: inherit;
  text-decoration: none;
}

a:not([href]):not([tabindex]):focus {
  outline: 0;
}

code, kbd, pre, samp {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
  font-size: 1em;
}

pre {
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto;
  -ms-overflow-style: scrollbar;
}

figure {
  margin: 0 0 1rem;
}

img {
  vertical-align: middle;
  border-style: none;
}

svg {
  overflow: hidden;
  vertical-align: middle;
}

table {
  border-collapse: collapse;
}

caption {
  padding-top: 0.75rem;
  padding-bottom: 0.75rem;
  color: #6c757d;
  text-align: left;
  caption-side: bottom;
}

th {
  text-align: inherit;
}

label {
  display: inline-block;
  margin-bottom: 0.5rem;
}

button {
  border-radius: 0;
}

button:focus {
  outline: 1px dotted;
  outline: 5px auto -webkit-focus-ring-color;
}

button, input, optgroup, select, textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
}

button, input {
  overflow: visible;
}

button, select {
  text-transform: none;
}

[type=reset], [type=submit], button, html [type=button] {
  -webkit-appearance: button;
}

[type=button]::-moz-focus-inner, [type=reset]::-moz-focus-inner, [type=submit]::-moz-focus-inner, button::-moz-focus-inner {
  padding: 0;
  border-style: none;
}

input[type=checkbox], input[type=radio] {
  box-sizing: border-box;
  padding: 0;
}

input[type=date], input[type=datetime-local], input[type=month], input[type=time] {
  -webkit-appearance: listbox;
}

textarea {
  overflow: auto;
  resize: vertical;
}

fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0;
}

legend {
  display: block;
  width: 100%;
  max-width: 100%;
  padding: 0;
  margin-bottom: 0.5rem;
  font-size: 1.5rem;
  line-height: inherit;
  color: inherit;
  white-space: normal;
}

progress {
  vertical-align: baseline;
}

[type=number]::-webkit-inner-spin-button, [type=number]::-webkit-outer-spin-button {
  height: auto;
}

[type=search] {
  outline-offset: -2px;
  -webkit-appearance: none;
}

[type=search]::-webkit-search-cancel-button, [type=search]::-webkit-search-decoration {
  -webkit-appearance: none;
}

::-webkit-file-upload-button {
  font: inherit;
  -webkit-appearance: button;
}

output {
  display: inline-block;
}

summary {
  display: list-item;
  cursor: pointer;
}

template {
  display: none;
}

[hidden] {
  display: none !important;
}

.h1, .h2, .h3, .h4, .h5, .h6, h1, h2, h3, h4, h5, h6 {
  margin-bottom: 0.5rem;
  font-family: inherit;
  font-weight: 500;
  line-height: 1.2;
  color: inherit;
}

.h1, h1 {
  font-size: 2.5rem;
}

.h2, h2 {
  font-size: 2rem;
}

.h3, h3 {
  font-size: 1.75rem;
}

.h4, h4 {
  font-size: 1.5rem;
}

.h5, h5 {
  font-size: 1.25rem;
}

.h6, h6 {
  font-size: 1rem;
}

.lead {
  font-size: 1.25rem;
  font-weight: 300;
}

.display-1 {
  font-size: 6rem;
  font-weight: 300;
  line-height: 1.2;
}

.display-2 {
  font-size: 5.5rem;
  font-weight: 300;
  line-height: 1.2;
}

.display-3 {
  font-size: 4.5rem;
  font-weight: 300;
  line-height: 1.2;
}

.display-4 {
  font-size: 3.5rem;
  font-weight: 300;
  line-height: 1.2;
}

hr {
  margin-top: 1rem;
  margin-bottom: 1rem;
  border: 0;
  border-top: 1px solid rgba(0, 0, 0, 0.1);
}

.small, small {
  font-size: 80%;
  font-weight: 400;
}

.mark, mark {
  padding: 0.2em;
  background-color: #fcf8e3;
}

.list-unstyled {
  padding-left: 0;
  list-style: none;
}

.list-inline {
  padding-left: 0;
  list-style: none;
}

.list-inline-item {
  display: inline-block;
}

.list-inline-item:not(:last-child) {
  margin-right: 0.5rem;
}

.initialism {
  font-size: 90%;
  text-transform: uppercase;
}

.blockquote {
  margin-bottom: 1rem;
  font-size: 1.25rem;
}

.blockquote-footer {
  display: block;
  font-size: 80%;
  color: #6c757d;
}

.blockquote-footer::before {
  content: "— ";
}

.img-fluid {
  max-width: 100%;
  height: auto;
}

.img-thumbnail {
  padding: 0.25rem;
  background-color: #fff;
  border: 1px solid #dee2e6;
  border-radius: 0.25rem;
  max-width: 100%;
  height: auto;
}

.figure {
  display: inline-block;
}

.figure-img {
  margin-bottom: 0.5rem;
  line-height: 1;
}

.figure-caption {
  font-size: 90%;
  color: #6c757d;
}

code {
  font-size: 87.5%;
  color: #e83e8c;
  word-break: break-word;
}

a > code {
  color: inherit;
}

kbd {
  padding: 0.2rem 0.4rem;
  font-size: 87.5%;
  color: #fff;
  background-color: #212529;
  border-radius: 0.2rem;
}

kbd kbd {
  padding: 0;
  font-size: 100%;
  font-weight: 700;
}

pre {
  display: block;
  font-size: 87.5%;
  color: #212529;
}

pre code {
  font-size: inherit;
  color: inherit;
  word-break: normal;
}

.pre-scrollable {
  max-height: 340px;
  overflow-y: scroll;
}

.container {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto;
}

@media (min-width: 576px) {
  .container {
    max-width: 540px;
  }
}
@media (min-width: 768px) {
  .container {
    max-width: 720px;
  }
}
@media (min-width: 992px) {
  .container {
    max-width: 960px;
  }
}
@media (min-width: 1200px) {
  .container {
    max-width: 1200px;
  }
}
.container-fluid {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto;
}

.row {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  margin-right: -15px;
  margin-left: -15px;
}

.no-gutters {
  margin-right: 0;
  margin-left: 0;
}

.no-gutters > .col, .no-gutters > [class*=col-] {
  padding-right: 0;
  padding-left: 0;
}

.col, .col-1, .col-10, .col-11, .col-12, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-auto, .col-lg, .col-lg-1, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-auto, .col-md, .col-md-1, .col-md-10, .col-md-11, .col-md-12, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-auto, .col-sm, .col-sm-1, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-auto, .col-xl, .col-xl-1, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-auto {
  position: relative;
  width: 100%;
  min-height: 1px;
  padding-right: 15px;
  padding-left: 15px;
}

.col {
  -ms-flex-preferred-size: 0;
  flex-basis: 0;
  -ms-flex-positive: 1;
  flex-grow: 1;
  max-width: 100%;
}

.col-auto {
  -ms-flex: 0 0 auto;
  flex: 0 0 auto;
  width: auto;
  max-width: none;
}

.col-1 {
  -ms-flex: 0 0 8.333333%;
  flex: 0 0 8.333333%;
  max-width: 8.333333%;
}

.col-2 {
  -ms-flex: 0 0 16.666667%;
  flex: 0 0 16.666667%;
  max-width: 16.666667%;
}

.col-3 {
  -ms-flex: 0 0 25%;
  flex: 0 0 25%;
  max-width: 25%;
}

.col-4 {
  -ms-flex: 0 0 33.333333%;
  flex: 0 0 33.333333%;
  max-width: 33.333333%;
}

.col-5 {
  -ms-flex: 0 0 41.666667%;
  flex: 0 0 41.666667%;
  max-width: 41.666667%;
}

.col-6 {
  -ms-flex: 0 0 50%;
  flex: 0 0 50%;
  max-width: 50%;
}

.col-7 {
  -ms-flex: 0 0 58.333333%;
  flex: 0 0 58.333333%;
  max-width: 58.333333%;
}

.col-8 {
  -ms-flex: 0 0 66.666667%;
  flex: 0 0 66.666667%;
  max-width: 66.666667%;
}

.col-9 {
  -ms-flex: 0 0 75%;
  flex: 0 0 75%;
  max-width: 75%;
}

.col-10 {
  -ms-flex: 0 0 83.333333%;
  flex: 0 0 83.333333%;
  max-width: 83.333333%;
}

.col-11 {
  -ms-flex: 0 0 91.666667%;
  flex: 0 0 91.666667%;
  max-width: 91.666667%;
}

.col-12 {
  -ms-flex: 0 0 100%;
  flex: 0 0 100%;
  max-width: 100%;
}

.order-first {
  -ms-flex-order: -1;
  order: -1;
}

.order-last {
  -ms-flex-order: 13;
  order: 13;
}

.order-0 {
  -ms-flex-order: 0;
  order: 0;
}

.order-1 {
  -ms-flex-order: 1;
  order: 1;
}

.order-2 {
  -ms-flex-order: 2;
  order: 2;
}

.order-3 {
  -ms-flex-order: 3;
  order: 3;
}

.order-4 {
  -ms-flex-order: 4;
  order: 4;
}

.order-5 {
  -ms-flex-order: 5;
  order: 5;
}

.order-6 {
  -ms-flex-order: 6;
  order: 6;
}

.order-7 {
  -ms-flex-order: 7;
  order: 7;
}

.order-8 {
  -ms-flex-order: 8;
  order: 8;
}

.order-9 {
  -ms-flex-order: 9;
  order: 9;
}

.order-10 {
  -ms-flex-order: 10;
  order: 10;
}

.order-11 {
  -ms-flex-order: 11;
  order: 11;
}

.order-12 {
  -ms-flex-order: 12;
  order: 12;
}

.offset-1 {
  margin-left: 8.333333%;
}

.offset-2 {
  margin-left: 16.666667%;
}

.offset-3 {
  margin-left: 25%;
}

.offset-4 {
  margin-left: 33.333333%;
}

.offset-5 {
  margin-left: 41.666667%;
}

.offset-6 {
  margin-left: 50%;
}

.offset-7 {
  margin-left: 58.333333%;
}

.offset-8 {
  margin-left: 66.666667%;
}

.offset-9 {
  margin-left: 75%;
}

.offset-10 {
  margin-left: 83.333333%;
}

.offset-11 {
  margin-left: 91.666667%;
}

@media (min-width: 576px) {
  .col-sm {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-sm-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-sm-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-sm-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-sm-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-sm-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-sm-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-sm-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-sm-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-sm-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-sm-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-sm-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-sm-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-sm-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-sm-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-sm-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-sm-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-sm-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-sm-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-sm-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-sm-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-sm-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-sm-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-sm-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-sm-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-sm-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-sm-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-sm-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-sm-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-sm-0 {
    margin-left: 0;
  }

  .offset-sm-1 {
    margin-left: 8.333333%;
  }

  .offset-sm-2 {
    margin-left: 16.666667%;
  }

  .offset-sm-3 {
    margin-left: 25%;
  }

  .offset-sm-4 {
    margin-left: 33.333333%;
  }

  .offset-sm-5 {
    margin-left: 41.666667%;
  }

  .offset-sm-6 {
    margin-left: 50%;
  }

  .offset-sm-7 {
    margin-left: 58.333333%;
  }

  .offset-sm-8 {
    margin-left: 66.666667%;
  }

  .offset-sm-9 {
    margin-left: 75%;
  }

  .offset-sm-10 {
    margin-left: 83.333333%;
  }

  .offset-sm-11 {
    margin-left: 91.666667%;
  }
}
@media (min-width: 768px) {
  .col-md {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-md-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-md-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-md-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-md-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-md-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-md-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-md-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-md-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-md-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-md-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-md-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-md-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-md-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-md-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-md-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-md-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-md-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-md-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-md-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-md-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-md-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-md-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-md-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-md-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-md-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-md-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-md-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-md-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-md-0 {
    margin-left: 0;
  }

  .offset-md-1 {
    margin-left: 8.333333%;
  }

  .offset-md-2 {
    margin-left: 16.666667%;
  }

  .offset-md-3 {
    margin-left: 25%;
  }

  .offset-md-4 {
    margin-left: 33.333333%;
  }

  .offset-md-5 {
    margin-left: 41.666667%;
  }

  .offset-md-6 {
    margin-left: 50%;
  }

  .offset-md-7 {
    margin-left: 58.333333%;
  }

  .offset-md-8 {
    margin-left: 66.666667%;
  }

  .offset-md-9 {
    margin-left: 75%;
  }

  .offset-md-10 {
    margin-left: 83.333333%;
  }

  .offset-md-11 {
    margin-left: 91.666667%;
  }
}
@media (min-width: 992px) {
  .col-lg {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-lg-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-lg-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-lg-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-lg-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-lg-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-lg-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-lg-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-lg-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-lg-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-lg-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-lg-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-lg-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-lg-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-lg-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-lg-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-lg-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-lg-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-lg-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-lg-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-lg-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-lg-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-lg-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-lg-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-lg-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-lg-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-lg-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-lg-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-lg-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-lg-0 {
    margin-left: 0;
  }

  .offset-lg-1 {
    margin-left: 8.333333%;
  }

  .offset-lg-2 {
    margin-left: 16.666667%;
  }

  .offset-lg-3 {
    margin-left: 25%;
  }

  .offset-lg-4 {
    margin-left: 33.333333%;
  }

  .offset-lg-5 {
    margin-left: 41.666667%;
  }

  .offset-lg-6 {
    margin-left: 50%;
  }

  .offset-lg-7 {
    margin-left: 58.333333%;
  }

  .offset-lg-8 {
    margin-left: 66.666667%;
  }

  .offset-lg-9 {
    margin-left: 75%;
  }

  .offset-lg-10 {
    margin-left: 83.333333%;
  }

  .offset-lg-11 {
    margin-left: 91.666667%;
  }
}
@media (min-width: 1200px) {
  .col-xl {
    -ms-flex-preferred-size: 0;
    flex-basis: 0;
    -ms-flex-positive: 1;
    flex-grow: 1;
    max-width: 100%;
  }

  .col-xl-auto {
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    width: auto;
    max-width: none;
  }

  .col-xl-1 {
    -ms-flex: 0 0 8.333333%;
    flex: 0 0 8.333333%;
    max-width: 8.333333%;
  }

  .col-xl-2 {
    -ms-flex: 0 0 16.666667%;
    flex: 0 0 16.666667%;
    max-width: 16.666667%;
  }

  .col-xl-3 {
    -ms-flex: 0 0 25%;
    flex: 0 0 25%;
    max-width: 25%;
  }

  .col-xl-4 {
    -ms-flex: 0 0 33.333333%;
    flex: 0 0 33.333333%;
    max-width: 33.333333%;
  }

  .col-xl-5 {
    -ms-flex: 0 0 41.666667%;
    flex: 0 0 41.666667%;
    max-width: 41.666667%;
  }

  .col-xl-6 {
    -ms-flex: 0 0 50%;
    flex: 0 0 50%;
    max-width: 50%;
  }

  .col-xl-7 {
    -ms-flex: 0 0 58.333333%;
    flex: 0 0 58.333333%;
    max-width: 58.333333%;
  }

  .col-xl-8 {
    -ms-flex: 0 0 66.666667%;
    flex: 0 0 66.666667%;
    max-width: 66.666667%;
  }

  .col-xl-9 {
    -ms-flex: 0 0 75%;
    flex: 0 0 75%;
    max-width: 75%;
  }

  .col-xl-10 {
    -ms-flex: 0 0 83.333333%;
    flex: 0 0 83.333333%;
    max-width: 83.333333%;
  }

  .col-xl-11 {
    -ms-flex: 0 0 91.666667%;
    flex: 0 0 91.666667%;
    max-width: 91.666667%;
  }

  .col-xl-12 {
    -ms-flex: 0 0 100%;
    flex: 0 0 100%;
    max-width: 100%;
  }

  .order-xl-first {
    -ms-flex-order: -1;
    order: -1;
  }

  .order-xl-last {
    -ms-flex-order: 13;
    order: 13;
  }

  .order-xl-0 {
    -ms-flex-order: 0;
    order: 0;
  }

  .order-xl-1 {
    -ms-flex-order: 1;
    order: 1;
  }

  .order-xl-2 {
    -ms-flex-order: 2;
    order: 2;
  }

  .order-xl-3 {
    -ms-flex-order: 3;
    order: 3;
  }

  .order-xl-4 {
    -ms-flex-order: 4;
    order: 4;
  }

  .order-xl-5 {
    -ms-flex-order: 5;
    order: 5;
  }

  .order-xl-6 {
    -ms-flex-order: 6;
    order: 6;
  }

  .order-xl-7 {
    -ms-flex-order: 7;
    order: 7;
  }

  .order-xl-8 {
    -ms-flex-order: 8;
    order: 8;
  }

  .order-xl-9 {
    -ms-flex-order: 9;
    order: 9;
  }

  .order-xl-10 {
    -ms-flex-order: 10;
    order: 10;
  }

  .order-xl-11 {
    -ms-flex-order: 11;
    order: 11;
  }

  .order-xl-12 {
    -ms-flex-order: 12;
    order: 12;
  }

  .offset-xl-0 {
    margin-left: 0;
  }

  .offset-xl-1 {
    margin-left: 8.333333%;
  }

  .offset-xl-2 {
    margin-left: 16.666667%;
  }

  .offset-xl-3 {
    margin-left: 25%;
  }

  .offset-xl-4 {
    margin-left: 33.333333%;
  }

  .offset-xl-5 {
    margin-left: 41.666667%;
  }

  .offset-xl-6 {
    margin-left: 50%;
  }

  .offset-xl-7 {
    margin-left: 58.333333%;
  }

  .offset-xl-8 {
    margin-left: 66.666667%;
  }

  .offset-xl-9 {
    margin-left: 75%;
  }

  .offset-xl-10 {
    margin-left: 83.333333%;
  }

  .offset-xl-11 {
    margin-left: 91.666667%;
  }
}
.table, .cont-noticias .texto {
  width: 100%;
  margin-bottom: 1rem;
  background-color: transparent;
}

.table td, .cont-noticias .texto td, .table th, .cont-noticias .texto th {
  padding: 0.75rem;
  vertical-align: top;
  border-top: 1px solid #dee2e6;
}

.table thead th, .cont-noticias .texto thead th {
  vertical-align: bottom;
  border-bottom: 2px solid #dee2e6;
}

.table tbody + tbody, .cont-noticias .texto tbody + tbody {
  border-top: 2px solid #dee2e6;
}

.table .table, .cont-noticias .texto .table, .table .cont-noticias .texto, .cont-noticias .table .texto, .cont-noticias .texto .texto {
  background-color: #fff;
}

.table-sm td, .table-sm th {
  padding: 0.3rem;
}

.table-bordered {
  border: 1px solid #dee2e6;
}

.table-bordered td, .table-bordered th {
  border: 1px solid #dee2e6;
}

.table-bordered thead td, .table-bordered thead th {
  border-bottom-width: 2px;
}

.table-borderless tbody + tbody, .table-borderless td, .table-borderless th, .table-borderless thead th {
  border: 0;
}

.table-striped tbody tr:nth-of-type(odd), .cont-noticias .texto tbody tr:nth-of-type(odd) {
  background-color: rgba(0, 0, 0, 0.05);
}

.table-hover tbody tr:hover, .cont-noticias .texto tbody tr:hover {
  background-color: rgba(0, 0, 0, 0.075);
}

.table-primary, .table-primary > td, .table-primary > th {
  background-color: #b8daff;
}

.table-hover .table-primary:hover, .cont-noticias .texto .table-primary:hover {
  background-color: #9fcdff;
}

.table-hover .table-primary:hover > td, .cont-noticias .texto .table-primary:hover > td, .table-hover .table-primary:hover > th, .cont-noticias .texto .table-primary:hover > th {
  background-color: #9fcdff;
}

.table-secondary, .table-secondary > td, .table-secondary > th {
  background-color: #d6d8db;
}

.table-hover .table-secondary:hover, .cont-noticias .texto .table-secondary:hover {
  background-color: #c8cbcf;
}

.table-hover .table-secondary:hover > td, .cont-noticias .texto .table-secondary:hover > td, .table-hover .table-secondary:hover > th, .cont-noticias .texto .table-secondary:hover > th {
  background-color: #c8cbcf;
}

.table-success, .table-success > td, .table-success > th {
  background-color: #c3e6cb;
}

.table-hover .table-success:hover, .cont-noticias .texto .table-success:hover {
  background-color: #b1dfbb;
}

.table-hover .table-success:hover > td, .cont-noticias .texto .table-success:hover > td, .table-hover .table-success:hover > th, .cont-noticias .texto .table-success:hover > th {
  background-color: #b1dfbb;
}

.table-info, .table-info > td, .table-info > th {
  background-color: #bee5eb;
}

.table-hover .table-info:hover, .cont-noticias .texto .table-info:hover {
  background-color: #abdde5;
}

.table-hover .table-info:hover > td, .cont-noticias .texto .table-info:hover > td, .table-hover .table-info:hover > th, .cont-noticias .texto .table-info:hover > th {
  background-color: #abdde5;
}

.table-warning, .table-warning > td, .table-warning > th {
  background-color: #ffeeba;
}

.table-hover .table-warning:hover, .cont-noticias .texto .table-warning:hover {
  background-color: #ffe8a1;
}

.table-hover .table-warning:hover > td, .cont-noticias .texto .table-warning:hover > td, .table-hover .table-warning:hover > th, .cont-noticias .texto .table-warning:hover > th {
  background-color: #ffe8a1;
}

.table-danger, .table-danger > td, .table-danger > th {
  background-color: #f5c6cb;
}

.table-hover .table-danger:hover, .cont-noticias .texto .table-danger:hover {
  background-color: #f1b0b7;
}

.table-hover .table-danger:hover > td, .cont-noticias .texto .table-danger:hover > td, .table-hover .table-danger:hover > th, .cont-noticias .texto .table-danger:hover > th {
  background-color: #f1b0b7;
}

.table-light, .table-light > td, .table-light > th {
  background-color: #fdfdfe;
}

.table-hover .table-light:hover, .cont-noticias .texto .table-light:hover {
  background-color: #ececf6;
}

.table-hover .table-light:hover > td, .cont-noticias .texto .table-light:hover > td, .table-hover .table-light:hover > th, .cont-noticias .texto .table-light:hover > th {
  background-color: #ececf6;
}

.table-dark, .table-dark > td, .table-dark > th {
  background-color: #c6c8ca;
}

.table-hover .table-dark:hover, .cont-noticias .texto .table-dark:hover {
  background-color: #b9bbbe;
}

.table-hover .table-dark:hover > td, .cont-noticias .texto .table-dark:hover > td, .table-hover .table-dark:hover > th, .cont-noticias .texto .table-dark:hover > th {
  background-color: #b9bbbe;
}

.table-active, .table-active > td, .table-active > th {
  background-color: rgba(0, 0, 0, 0.075);
}

.table-hover .table-active:hover, .cont-noticias .texto .table-active:hover {
  background-color: rgba(0, 0, 0, 0.075);
}

.table-hover .table-active:hover > td, .cont-noticias .texto .table-active:hover > td, .table-hover .table-active:hover > th, .cont-noticias .texto .table-active:hover > th {
  background-color: rgba(0, 0, 0, 0.075);
}

.table .thead-dark th, .cont-noticias .texto .thead-dark th {
  color: #fff;
  background-color: #212529;
  border-color: #32383e;
}

.table .thead-light th, .cont-noticias .texto .thead-light th {
  color: #495057;
  background-color: #e9ecef;
  border-color: #dee2e6;
}

.table-dark {
  color: #fff;
  background-color: #212529;
}

.table-dark td, .table-dark th, .table-dark thead th {
  border-color: #32383e;
}

.table-dark.table-bordered {
  border: 0;
}

.table-dark.table-striped tbody tr:nth-of-type(odd), .cont-noticias .table-dark.texto tbody tr:nth-of-type(odd) {
  background-color: rgba(255, 255, 255, 0.05);
}

.table-dark.table-hover tbody tr:hover, .cont-noticias .table-dark.texto tbody tr:hover {
  background-color: rgba(255, 255, 255, 0.075);
}

@media (max-width: 575.98px) {
  .table-responsive-sm {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
    -ms-overflow-style: -ms-autohiding-scrollbar;
  }

  .table-responsive-sm > .table-bordered {
    border: 0;
  }
}
@media (max-width: 767.98px) {
  .table-responsive-md {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
    -ms-overflow-style: -ms-autohiding-scrollbar;
  }

  .table-responsive-md > .table-bordered {
    border: 0;
  }
}
@media (max-width: 991.98px) {
  .table-responsive-lg {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
    -ms-overflow-style: -ms-autohiding-scrollbar;
  }

  .table-responsive-lg > .table-bordered {
    border: 0;
  }
}
@media (max-width: 1199.98px) {
  .table-responsive-xl {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
    -ms-overflow-style: -ms-autohiding-scrollbar;
  }

  .table-responsive-xl > .table-bordered {
    border: 0;
  }
}
.table-responsive {
  display: block;
  width: 100%;
  overflow-x: auto;
  -webkit-overflow-scrolling: touch;
  -ms-overflow-style: -ms-autohiding-scrollbar;
}

.table-responsive > .table-bordered {
  border: 0;
}

.form-control {
  display: block;
  width: 100%;
  height: calc(2.25rem + 2px);
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  line-height: 1.5;
  color: #495057;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid #ced4da;
  border-radius: 0.25rem;
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}

@media screen and (prefers-reduced-motion: reduce) {
  .form-control {
    transition: none;
  }
}
.form-control::-ms-expand {
  background-color: transparent;
  border: 0;
}

.form-control:focus {
  color: #495057;
  background-color: #fff;
  border-color: #80bdff;
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.form-control::-webkit-input-placeholder {
  color: #6c757d;
  opacity: 1;
}

.form-control::-moz-placeholder {
  color: #6c757d;
  opacity: 1;
}

.form-control:-ms-input-placeholder {
  color: #6c757d;
  opacity: 1;
}

.form-control::-ms-input-placeholder {
  color: #6c757d;
  opacity: 1;
}

.form-control::placeholder {
  color: #6c757d;
  opacity: 1;
}

.form-control:disabled, .form-control[readonly] {
  background-color: #e9ecef;
  opacity: 1;
}

select.form-control:focus::-ms-value {
  color: #495057;
  background-color: #fff;
}

.form-control-file, .form-control-range {
  display: block;
  width: 100%;
}

.col-form-label {
  padding-top: calc(0.375rem + 1px);
  padding-bottom: calc(0.375rem + 1px);
  margin-bottom: 0;
  font-size: inherit;
  line-height: 1.5;
}

.col-form-label-lg {
  padding-top: calc(0.5rem + 1px);
  padding-bottom: calc(0.5rem + 1px);
  font-size: 1.25rem;
  line-height: 1.5;
}

.col-form-label-sm {
  padding-top: calc(0.25rem + 1px);
  padding-bottom: calc(0.25rem + 1px);
  font-size: 0.875rem;
  line-height: 1.5;
}

.form-control-plaintext {
  display: block;
  width: 100%;
  padding-top: 0.375rem;
  padding-bottom: 0.375rem;
  margin-bottom: 0;
  line-height: 1.5;
  color: #212529;
  background-color: transparent;
  border: solid transparent;
  border-width: 1px 0;
}

.form-control-plaintext.form-control-lg, .form-control-plaintext.form-control-sm {
  padding-right: 0;
  padding-left: 0;
}

.form-control-sm {
  height: calc(1.8125rem + 2px);
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
  border-radius: 0.2rem;
}

.form-control-lg {
  height: calc(2.875rem + 2px);
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 0.3rem;
}

select.form-control[multiple], select.form-control[size] {
  height: auto;
}

textarea.form-control {
  height: auto;
}

.form-group {
  margin-bottom: 1rem;
}

.form-text {
  display: block;
  margin-top: 0.25rem;
}

.form-row {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  margin-right: -5px;
  margin-left: -5px;
}

.form-row > .col, .form-row > [class*=col-] {
  padding-right: 5px;
  padding-left: 5px;
}

.form-check {
  position: relative;
  display: block;
  padding-left: 1.25rem;
}

.form-check-input {
  position: absolute;
  margin-top: 0.3rem;
  margin-left: -1.25rem;
}

.form-check-input:disabled ~ .form-check-label {
  color: #6c757d;
}

.form-check-label {
  margin-bottom: 0;
}

.form-check-inline {
  display: -ms-inline-flexbox;
  display: inline-flex;
  -ms-flex-align: center;
  align-items: center;
  padding-left: 0;
  margin-right: 0.75rem;
}

.form-check-inline .form-check-input {
  position: static;
  margin-top: 0;
  margin-right: 0.3125rem;
  margin-left: 0;
}

.valid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 80%;
  color: #28a745;
}

.valid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  line-height: 1.5;
  color: #fff;
  background-color: rgba(40, 167, 69, 0.9);
  border-radius: 0.25rem;
}

.custom-select.is-valid, .form-control.is-valid, .was-validated .custom-select:valid, .was-validated .form-control:valid {
  border-color: #28a745;
}

.custom-select.is-valid:focus, .form-control.is-valid:focus, .was-validated .custom-select:valid:focus, .was-validated .form-control:valid:focus {
  border-color: #28a745;
  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
}

.custom-select.is-valid ~ .valid-feedback, .custom-select.is-valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback, .form-control.is-valid ~ .valid-tooltip, .was-validated .custom-select:valid ~ .valid-feedback, .was-validated .custom-select:valid ~ .valid-tooltip, .was-validated .form-control:valid ~ .valid-feedback, .was-validated .form-control:valid ~ .valid-tooltip {
  display: block;
}

.form-control-file.is-valid ~ .valid-feedback, .form-control-file.is-valid ~ .valid-tooltip, .was-validated .form-control-file:valid ~ .valid-feedback, .was-validated .form-control-file:valid ~ .valid-tooltip {
  display: block;
}

.form-check-input.is-valid ~ .form-check-label, .was-validated .form-check-input:valid ~ .form-check-label {
  color: #28a745;
}

.form-check-input.is-valid ~ .valid-feedback, .form-check-input.is-valid ~ .valid-tooltip, .was-validated .form-check-input:valid ~ .valid-feedback, .was-validated .form-check-input:valid ~ .valid-tooltip {
  display: block;
}

.custom-control-input.is-valid ~ .custom-control-label, .was-validated .custom-control-input:valid ~ .custom-control-label {
  color: #28a745;
}

.custom-control-input.is-valid ~ .custom-control-label::before, .was-validated .custom-control-input:valid ~ .custom-control-label::before {
  background-color: #71dd8a;
}

.custom-control-input.is-valid ~ .valid-feedback, .custom-control-input.is-valid ~ .valid-tooltip, .was-validated .custom-control-input:valid ~ .valid-feedback, .was-validated .custom-control-input:valid ~ .valid-tooltip {
  display: block;
}

.custom-control-input.is-valid:checked ~ .custom-control-label::before, .was-validated .custom-control-input:valid:checked ~ .custom-control-label::before {
  background-color: #34ce57;
}

.custom-control-input.is-valid:focus ~ .custom-control-label::before, .was-validated .custom-control-input:valid:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
}

.custom-file-input.is-valid ~ .custom-file-label, .was-validated .custom-file-input:valid ~ .custom-file-label {
  border-color: #28a745;
}

.custom-file-input.is-valid ~ .custom-file-label::after, .was-validated .custom-file-input:valid ~ .custom-file-label::after {
  border-color: inherit;
}

.custom-file-input.is-valid ~ .valid-feedback, .custom-file-input.is-valid ~ .valid-tooltip, .was-validated .custom-file-input:valid ~ .valid-feedback, .was-validated .custom-file-input:valid ~ .valid-tooltip {
  display: block;
}

.custom-file-input.is-valid:focus ~ .custom-file-label, .was-validated .custom-file-input:valid:focus ~ .custom-file-label {
  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
}

.invalid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 80%;
  color: #dc3545;
}

.invalid-tooltip {
  position: absolute;
  top: 100%;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  line-height: 1.5;
  color: #fff;
  background-color: rgba(220, 53, 69, 0.9);
  border-radius: 0.25rem;
}

.custom-select.is-invalid, .form-control.is-invalid, .was-validated .custom-select:invalid, .was-validated .form-control:invalid {
  border-color: #dc3545;
}

.custom-select.is-invalid:focus, .form-control.is-invalid:focus, .was-validated .custom-select:invalid:focus, .was-validated .form-control:invalid:focus {
  border-color: #dc3545;
  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
}

.custom-select.is-invalid ~ .invalid-feedback, .custom-select.is-invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback, .form-control.is-invalid ~ .invalid-tooltip, .was-validated .custom-select:invalid ~ .invalid-feedback, .was-validated .custom-select:invalid ~ .invalid-tooltip, .was-validated .form-control:invalid ~ .invalid-feedback, .was-validated .form-control:invalid ~ .invalid-tooltip {
  display: block;
}

.form-control-file.is-invalid ~ .invalid-feedback, .form-control-file.is-invalid ~ .invalid-tooltip, .was-validated .form-control-file:invalid ~ .invalid-feedback, .was-validated .form-control-file:invalid ~ .invalid-tooltip {
  display: block;
}

.form-check-input.is-invalid ~ .form-check-label, .was-validated .form-check-input:invalid ~ .form-check-label {
  color: #dc3545;
}

.form-check-input.is-invalid ~ .invalid-feedback, .form-check-input.is-invalid ~ .invalid-tooltip, .was-validated .form-check-input:invalid ~ .invalid-feedback, .was-validated .form-check-input:invalid ~ .invalid-tooltip {
  display: block;
}

.custom-control-input.is-invalid ~ .custom-control-label, .was-validated .custom-control-input:invalid ~ .custom-control-label {
  color: #dc3545;
}

.custom-control-input.is-invalid ~ .custom-control-label::before, .was-validated .custom-control-input:invalid ~ .custom-control-label::before {
  background-color: #efa2a9;
}

.custom-control-input.is-invalid ~ .invalid-feedback, .custom-control-input.is-invalid ~ .invalid-tooltip, .was-validated .custom-control-input:invalid ~ .invalid-feedback, .was-validated .custom-control-input:invalid ~ .invalid-tooltip {
  display: block;
}

.custom-control-input.is-invalid:checked ~ .custom-control-label::before, .was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before {
  background-color: #e4606d;
}

.custom-control-input.is-invalid:focus ~ .custom-control-label::before, .was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
}

.custom-file-input.is-invalid ~ .custom-file-label, .was-validated .custom-file-input:invalid ~ .custom-file-label {
  border-color: #dc3545;
}

.custom-file-input.is-invalid ~ .custom-file-label::after, .was-validated .custom-file-input:invalid ~ .custom-file-label::after {
  border-color: inherit;
}

.custom-file-input.is-invalid ~ .invalid-feedback, .custom-file-input.is-invalid ~ .invalid-tooltip, .was-validated .custom-file-input:invalid ~ .invalid-feedback, .was-validated .custom-file-input:invalid ~ .invalid-tooltip {
  display: block;
}

.custom-file-input.is-invalid:focus ~ .custom-file-label, .was-validated .custom-file-input:invalid:focus ~ .custom-file-label {
  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
}

.form-inline {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-flow: row wrap;
  flex-flow: row wrap;
  -ms-flex-align: center;
  align-items: center;
}

.form-inline .form-check {
  width: 100%;
}

@media (min-width: 576px) {
  .form-inline label {
    display: -ms-flexbox;
    display: flex;
    -ms-flex-align: center;
    align-items: center;
    -ms-flex-pack: center;
    justify-content: center;
    margin-bottom: 0;
  }

  .form-inline .form-group {
    display: -ms-flexbox;
    display: flex;
    -ms-flex: 0 0 auto;
    flex: 0 0 auto;
    -ms-flex-flow: row wrap;
    flex-flow: row wrap;
    -ms-flex-align: center;
    align-items: center;
    margin-bottom: 0;
  }

  .form-inline .form-control {
    display: inline-block;
    width: auto;
    vertical-align: middle;
  }

  .form-inline .form-control-plaintext {
    display: inline-block;
  }

  .form-inline .custom-select, .form-inline .input-group {
    width: auto;
  }

  .form-inline .form-check {
    display: -ms-flexbox;
    display: flex;
    -ms-flex-align: center;
    align-items: center;
    -ms-flex-pack: center;
    justify-content: center;
    width: auto;
    padding-left: 0;
  }

  .form-inline .form-check-input {
    position: relative;
    margin-top: 0;
    margin-right: 0.25rem;
    margin-left: 0;
  }

  .form-inline .custom-control {
    -ms-flex-align: center;
    align-items: center;
    -ms-flex-pack: center;
    justify-content: center;
  }

  .form-inline .custom-control-label {
    margin-bottom: 0;
  }
}
.btn {
  display: inline-block;
  font-weight: 400;
  text-align: center;
  white-space: nowrap;
  vertical-align: middle;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  border: 1px solid transparent;
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  line-height: 1.5;
  border-radius: 0.25rem;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}

@media screen and (prefers-reduced-motion: reduce) {
  .btn {
    transition: none;
  }
}
.btn:focus, .btn:hover {
  text-decoration: none;
}

.btn.focus, .btn:focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.btn.disabled, .btn:disabled {
  opacity: 0.65;
}

.btn:not(:disabled):not(.disabled) {
  cursor: pointer;
}

a.btn.disabled, fieldset:disabled a.btn {
  pointer-events: none;
}

.btn-primary {
  color: #fff;
  background-color: #007bff;
  border-color: #007bff;
}

.btn-primary:hover {
  color: #fff;
  background-color: #0069d9;
  border-color: #0062cc;
}

.btn-primary.focus, .btn-primary:focus {
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
}

.btn-primary.disabled, .btn-primary:disabled {
  color: #fff;
  background-color: #007bff;
  border-color: #007bff;
}

.btn-primary:not(:disabled):not(.disabled).active, .btn-primary:not(:disabled):not(.disabled):active, .show > .btn-primary.dropdown-toggle {
  color: #fff;
  background-color: #0062cc;
  border-color: #005cbf;
}

.btn-primary:not(:disabled):not(.disabled).active:focus, .btn-primary:not(:disabled):not(.disabled):active:focus, .show > .btn-primary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
}

.btn-secondary {
  color: #fff;
  background-color: #6c757d;
  border-color: #6c757d;
}

.btn-secondary:hover {
  color: #fff;
  background-color: #5a6268;
  border-color: #545b62;
}

.btn-secondary.focus, .btn-secondary:focus {
  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
}

.btn-secondary.disabled, .btn-secondary:disabled {
  color: #fff;
  background-color: #6c757d;
  border-color: #6c757d;
}

.btn-secondary:not(:disabled):not(.disabled).active, .btn-secondary:not(:disabled):not(.disabled):active, .show > .btn-secondary.dropdown-toggle {
  color: #fff;
  background-color: #545b62;
  border-color: #4e555b;
}

.btn-secondary:not(:disabled):not(.disabled).active:focus, .btn-secondary:not(:disabled):not(.disabled):active:focus, .show > .btn-secondary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
}

.btn-success {
  color: #fff;
  background-color: #28a745;
  border-color: #28a745;
}

.btn-success:hover {
  color: #fff;
  background-color: #218838;
  border-color: #1e7e34;
}

.btn-success.focus, .btn-success:focus {
  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
}

.btn-success.disabled, .btn-success:disabled {
  color: #fff;
  background-color: #28a745;
  border-color: #28a745;
}

.btn-success:not(:disabled):not(.disabled).active, .btn-success:not(:disabled):not(.disabled):active, .show > .btn-success.dropdown-toggle {
  color: #fff;
  background-color: #1e7e34;
  border-color: #1c7430;
}

.btn-success:not(:disabled):not(.disabled).active:focus, .btn-success:not(:disabled):not(.disabled):active:focus, .show > .btn-success.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
}

.btn-info {
  color: #fff;
  background-color: #17a2b8;
  border-color: #17a2b8;
}

.btn-info:hover {
  color: #fff;
  background-color: #138496;
  border-color: #117a8b;
}

.btn-info.focus, .btn-info:focus {
  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
}

.btn-info.disabled, .btn-info:disabled {
  color: #fff;
  background-color: #17a2b8;
  border-color: #17a2b8;
}

.btn-info:not(:disabled):not(.disabled).active, .btn-info:not(:disabled):not(.disabled):active, .show > .btn-info.dropdown-toggle {
  color: #fff;
  background-color: #117a8b;
  border-color: #10707f;
}

.btn-info:not(:disabled):not(.disabled).active:focus, .btn-info:not(:disabled):not(.disabled):active:focus, .show > .btn-info.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
}

.btn-warning {
  color: #212529;
  background-color: #ffc107;
  border-color: #ffc107;
}

.btn-warning:hover {
  color: #212529;
  background-color: #e0a800;
  border-color: #d39e00;
}

.btn-warning.focus, .btn-warning:focus {
  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
}

.btn-warning.disabled, .btn-warning:disabled {
  color: #212529;
  background-color: #ffc107;
  border-color: #ffc107;
}

.btn-warning:not(:disabled):not(.disabled).active, .btn-warning:not(:disabled):not(.disabled):active, .show > .btn-warning.dropdown-toggle {
  color: #212529;
  background-color: #d39e00;
  border-color: #c69500;
}

.btn-warning:not(:disabled):not(.disabled).active:focus, .btn-warning:not(:disabled):not(.disabled):active:focus, .show > .btn-warning.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
}

.btn-danger {
  color: #fff;
  background-color: #dc3545;
  border-color: #dc3545;
}

.btn-danger:hover {
  color: #fff;
  background-color: #c82333;
  border-color: #bd2130;
}

.btn-danger.focus, .btn-danger:focus {
  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
}

.btn-danger.disabled, .btn-danger:disabled {
  color: #fff;
  background-color: #dc3545;
  border-color: #dc3545;
}

.btn-danger:not(:disabled):not(.disabled).active, .btn-danger:not(:disabled):not(.disabled):active, .show > .btn-danger.dropdown-toggle {
  color: #fff;
  background-color: #bd2130;
  border-color: #b21f2d;
}

.btn-danger:not(:disabled):not(.disabled).active:focus, .btn-danger:not(:disabled):not(.disabled):active:focus, .show > .btn-danger.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
}

.btn-light {
  color: #212529;
  background-color: #f8f9fa;
  border-color: #f8f9fa;
}

.btn-light:hover {
  color: #212529;
  background-color: #e2e6ea;
  border-color: #dae0e5;
}

.btn-light.focus, .btn-light:focus {
  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
}

.btn-light.disabled, .btn-light:disabled {
  color: #212529;
  background-color: #f8f9fa;
  border-color: #f8f9fa;
}

.btn-light:not(:disabled):not(.disabled).active, .btn-light:not(:disabled):not(.disabled):active, .show > .btn-light.dropdown-toggle {
  color: #212529;
  background-color: #dae0e5;
  border-color: #d3d9df;
}

.btn-light:not(:disabled):not(.disabled).active:focus, .btn-light:not(:disabled):not(.disabled):active:focus, .show > .btn-light.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
}

.btn-dark {
  color: #fff;
  background-color: #343a40;
  border-color: #343a40;
}

.btn-dark:hover {
  color: #fff;
  background-color: #23272b;
  border-color: #1d2124;
}

.btn-dark.focus, .btn-dark:focus {
  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
}

.btn-dark.disabled, .btn-dark:disabled {
  color: #fff;
  background-color: #343a40;
  border-color: #343a40;
}

.btn-dark:not(:disabled):not(.disabled).active, .btn-dark:not(:disabled):not(.disabled):active, .show > .btn-dark.dropdown-toggle {
  color: #fff;
  background-color: #1d2124;
  border-color: #171a1d;
}

.btn-dark:not(:disabled):not(.disabled).active:focus, .btn-dark:not(:disabled):not(.disabled):active:focus, .show > .btn-dark.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
}

.btn-outline-primary {
  color: #007bff;
  background-color: transparent;
  background-image: none;
  border-color: #007bff;
}

.btn-outline-primary:hover {
  color: #fff;
  background-color: #007bff;
  border-color: #007bff;
}

.btn-outline-primary.focus, .btn-outline-primary:focus {
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
}

.btn-outline-primary.disabled, .btn-outline-primary:disabled {
  color: #007bff;
  background-color: transparent;
}

.btn-outline-primary:not(:disabled):not(.disabled).active, .btn-outline-primary:not(:disabled):not(.disabled):active, .show > .btn-outline-primary.dropdown-toggle {
  color: #fff;
  background-color: #007bff;
  border-color: #007bff;
}

.btn-outline-primary:not(:disabled):not(.disabled).active:focus, .btn-outline-primary:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-primary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
}

.btn-outline-secondary {
  color: #6c757d;
  background-color: transparent;
  background-image: none;
  border-color: #6c757d;
}

.btn-outline-secondary:hover {
  color: #fff;
  background-color: #6c757d;
  border-color: #6c757d;
}

.btn-outline-secondary.focus, .btn-outline-secondary:focus {
  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
}

.btn-outline-secondary.disabled, .btn-outline-secondary:disabled {
  color: #6c757d;
  background-color: transparent;
}

.btn-outline-secondary:not(:disabled):not(.disabled).active, .btn-outline-secondary:not(:disabled):not(.disabled):active, .show > .btn-outline-secondary.dropdown-toggle {
  color: #fff;
  background-color: #6c757d;
  border-color: #6c757d;
}

.btn-outline-secondary:not(:disabled):not(.disabled).active:focus, .btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-secondary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
}

.btn-outline-success {
  color: #28a745;
  background-color: transparent;
  background-image: none;
  border-color: #28a745;
}

.btn-outline-success:hover {
  color: #fff;
  background-color: #28a745;
  border-color: #28a745;
}

.btn-outline-success.focus, .btn-outline-success:focus {
  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
}

.btn-outline-success.disabled, .btn-outline-success:disabled {
  color: #28a745;
  background-color: transparent;
}

.btn-outline-success:not(:disabled):not(.disabled).active, .btn-outline-success:not(:disabled):not(.disabled):active, .show > .btn-outline-success.dropdown-toggle {
  color: #fff;
  background-color: #28a745;
  border-color: #28a745;
}

.btn-outline-success:not(:disabled):not(.disabled).active:focus, .btn-outline-success:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-success.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
}

.btn-outline-info {
  color: #17a2b8;
  background-color: transparent;
  background-image: none;
  border-color: #17a2b8;
}

.btn-outline-info:hover {
  color: #fff;
  background-color: #17a2b8;
  border-color: #17a2b8;
}

.btn-outline-info.focus, .btn-outline-info:focus {
  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
}

.btn-outline-info.disabled, .btn-outline-info:disabled {
  color: #17a2b8;
  background-color: transparent;
}

.btn-outline-info:not(:disabled):not(.disabled).active, .btn-outline-info:not(:disabled):not(.disabled):active, .show > .btn-outline-info.dropdown-toggle {
  color: #fff;
  background-color: #17a2b8;
  border-color: #17a2b8;
}

.btn-outline-info:not(:disabled):not(.disabled).active:focus, .btn-outline-info:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-info.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
}

.btn-outline-warning {
  color: #ffc107;
  background-color: transparent;
  background-image: none;
  border-color: #ffc107;
}

.btn-outline-warning:hover {
  color: #212529;
  background-color: #ffc107;
  border-color: #ffc107;
}

.btn-outline-warning.focus, .btn-outline-warning:focus {
  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
}

.btn-outline-warning.disabled, .btn-outline-warning:disabled {
  color: #ffc107;
  background-color: transparent;
}

.btn-outline-warning:not(:disabled):not(.disabled).active, .btn-outline-warning:not(:disabled):not(.disabled):active, .show > .btn-outline-warning.dropdown-toggle {
  color: #212529;
  background-color: #ffc107;
  border-color: #ffc107;
}

.btn-outline-warning:not(:disabled):not(.disabled).active:focus, .btn-outline-warning:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-warning.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
}

.btn-outline-danger {
  color: #dc3545;
  background-color: transparent;
  background-image: none;
  border-color: #dc3545;
}

.btn-outline-danger:hover {
  color: #fff;
  background-color: #dc3545;
  border-color: #dc3545;
}

.btn-outline-danger.focus, .btn-outline-danger:focus {
  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
}

.btn-outline-danger.disabled, .btn-outline-danger:disabled {
  color: #dc3545;
  background-color: transparent;
}

.btn-outline-danger:not(:disabled):not(.disabled).active, .btn-outline-danger:not(:disabled):not(.disabled):active, .show > .btn-outline-danger.dropdown-toggle {
  color: #fff;
  background-color: #dc3545;
  border-color: #dc3545;
}

.btn-outline-danger:not(:disabled):not(.disabled).active:focus, .btn-outline-danger:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-danger.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
}

.btn-outline-light {
  color: #f8f9fa;
  background-color: transparent;
  background-image: none;
  border-color: #f8f9fa;
}

.btn-outline-light:hover {
  color: #212529;
  background-color: #f8f9fa;
  border-color: #f8f9fa;
}

.btn-outline-light.focus, .btn-outline-light:focus {
  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
}

.btn-outline-light.disabled, .btn-outline-light:disabled {
  color: #f8f9fa;
  background-color: transparent;
}

.btn-outline-light:not(:disabled):not(.disabled).active, .btn-outline-light:not(:disabled):not(.disabled):active, .show > .btn-outline-light.dropdown-toggle {
  color: #212529;
  background-color: #f8f9fa;
  border-color: #f8f9fa;
}

.btn-outline-light:not(:disabled):not(.disabled).active:focus, .btn-outline-light:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-light.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
}

.btn-outline-dark {
  color: #343a40;
  background-color: transparent;
  background-image: none;
  border-color: #343a40;
}

.btn-outline-dark:hover {
  color: #fff;
  background-color: #343a40;
  border-color: #343a40;
}

.btn-outline-dark.focus, .btn-outline-dark:focus {
  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
}

.btn-outline-dark.disabled, .btn-outline-dark:disabled {
  color: #343a40;
  background-color: transparent;
}

.btn-outline-dark:not(:disabled):not(.disabled).active, .btn-outline-dark:not(:disabled):not(.disabled):active, .show > .btn-outline-dark.dropdown-toggle {
  color: #fff;
  background-color: #343a40;
  border-color: #343a40;
}

.btn-outline-dark:not(:disabled):not(.disabled).active:focus, .btn-outline-dark:not(:disabled):not(.disabled):active:focus, .show > .btn-outline-dark.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
}

.btn-link {
  font-weight: 400;
  color: #007bff;
  background-color: transparent;
}

.btn-link:hover {
  color: #0056b3;
  text-decoration: underline;
  background-color: transparent;
  border-color: transparent;
}

.btn-link.focus, .btn-link:focus {
  text-decoration: underline;
  border-color: transparent;
  box-shadow: none;
}

.btn-link.disabled, .btn-link:disabled {
  color: #6c757d;
  pointer-events: none;
}

.btn-group-lg > .btn, .btn-lg {
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 0.3rem;
}

.btn-group-sm > .btn, .btn-sm {
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
  border-radius: 0.2rem;
}

.btn-block {
  display: block;
  width: 100%;
}

.btn-block + .btn-block {
  margin-top: 0.5rem;
}

input[type=button].btn-block, input[type=reset].btn-block, input[type=submit].btn-block {
  width: 100%;
}

.fade {
  transition: opacity 0.15s linear;
}

@media screen and (prefers-reduced-motion: reduce) {
  .fade {
    transition: none;
  }
}
.fade:not(.show) {
  opacity: 0;
}

.collapse:not(.show) {
  display: none;
}

.collapsing {
  position: relative;
  height: 0;
  overflow: hidden;
  transition: height 0.35s ease;
}

@media screen and (prefers-reduced-motion: reduce) {
  .collapsing {
    transition: none;
  }
}
.dropdown, .dropleft, .dropright, .dropup {
  position: relative;
}

.dropdown-toggle::after {
  display: inline-block;
  width: 0;
  height: 0;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid;
  border-right: 0.3em solid transparent;
  border-bottom: 0;
  border-left: 0.3em solid transparent;
}

.dropdown-toggle:empty::after {
  margin-left: 0;
}

.dropdown-menu {
  position: absolute;
  top: 100%;
  left: 0;
  z-index: 1000;
  display: none;
  float: left;
  min-width: 10rem;
  padding: 0.5rem 0;
  margin: 0.125rem 0 0;
  font-size: 1rem;
  color: #212529;
  text-align: left;
  list-style: none;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid rgba(0, 0, 0, 0.15);
  border-radius: 0.25rem;
}

.dropdown-menu-right {
  right: 0;
  left: auto;
}

.dropup .dropdown-menu {
  top: auto;
  bottom: 100%;
  margin-top: 0;
  margin-bottom: 0.125rem;
}

.dropup .dropdown-toggle::after {
  display: inline-block;
  width: 0;
  height: 0;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0;
  border-right: 0.3em solid transparent;
  border-bottom: 0.3em solid;
  border-left: 0.3em solid transparent;
}

.dropup .dropdown-toggle:empty::after {
  margin-left: 0;
}

.dropright .dropdown-menu {
  top: 0;
  right: auto;
  left: 100%;
  margin-top: 0;
  margin-left: 0.125rem;
}

.dropright .dropdown-toggle::after {
  display: inline-block;
  width: 0;
  height: 0;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0;
  border-bottom: 0.3em solid transparent;
  border-left: 0.3em solid;
}

.dropright .dropdown-toggle:empty::after {
  margin-left: 0;
}

.dropright .dropdown-toggle::after {
  vertical-align: 0;
}

.dropleft .dropdown-menu {
  top: 0;
  right: 100%;
  left: auto;
  margin-top: 0;
  margin-right: 0.125rem;
}

.dropleft .dropdown-toggle::after {
  display: inline-block;
  width: 0;
  height: 0;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
}

.dropleft .dropdown-toggle::after {
  display: none;
}

.dropleft .dropdown-toggle::before {
  display: inline-block;
  width: 0;
  height: 0;
  margin-right: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0.3em solid;
  border-bottom: 0.3em solid transparent;
}

.dropleft .dropdown-toggle:empty::after {
  margin-left: 0;
}

.dropleft .dropdown-toggle::before {
  vertical-align: 0;
}

.dropdown-menu[x-placement^=bottom], .dropdown-menu[x-placement^=left], .dropdown-menu[x-placement^=right], .dropdown-menu[x-placement^=top] {
  right: auto;
  bottom: auto;
}

.dropdown-divider {
  height: 0;
  margin: 0.5rem 0;
  overflow: hidden;
  border-top: 1px solid #e9ecef;
}

.dropdown-item {
  display: block;
  width: 100%;
  padding: 0.25rem 1.5rem;
  clear: both;
  font-weight: 400;
  color: #212529;
  text-align: inherit;
  white-space: nowrap;
  background-color: transparent;
  border: 0;
}

.dropdown-item:focus, .dropdown-item:hover {
  color: #16181b;
  text-decoration: none;
  background-color: #f8f9fa;
}

.dropdown-item.active, .dropdown-item:active {
  color: #fff;
  text-decoration: none;
  background-color: #007bff;
}

.dropdown-item.disabled, .dropdown-item:disabled {
  color: #6c757d;
  background-color: transparent;
}

.dropdown-menu.show {
  display: block;
}

.dropdown-header {
  display: block;
  padding: 0.5rem 1.5rem;
  margin-bottom: 0;
  font-size: 0.875rem;
  color: #6c757d;
  white-space: nowrap;
}

.dropdown-item-text {
  display: block;
  padding: 0.25rem 1.5rem;
  color: #212529;
}

.btn-group, .btn-group-vertical {
  position: relative;
  display: -ms-inline-flexbox;
  display: inline-flex;
  vertical-align: middle;
}

.btn-group-vertical > .btn, .btn-group > .btn {
  position: relative;
  -ms-flex: 0 1 auto;
  flex: 0 1 auto;
}

.btn-group-vertical > .btn:hover, .btn-group > .btn:hover {
  z-index: 1;
}

.btn-group-vertical > .btn.active, .btn-group-vertical > .btn:active, .btn-group-vertical > .btn:focus, .btn-group > .btn.active, .btn-group > .btn:active, .btn-group > .btn:focus {
  z-index: 1;
}

.btn-group .btn + .btn, .btn-group .btn + .btn-group, .btn-group .btn-group + .btn, .btn-group .btn-group + .btn-group, .btn-group-vertical .btn + .btn, .btn-group-vertical .btn + .btn-group, .btn-group-vertical .btn-group + .btn, .btn-group-vertical .btn-group + .btn-group {
  margin-left: -1px;
}

.btn-toolbar {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  -ms-flex-pack: start;
  justify-content: flex-start;
}

.btn-toolbar .input-group {
  width: auto;
}

.btn-group > .btn:first-child {
  margin-left: 0;
}

.btn-group > .btn-group:not(:last-child) > .btn, .btn-group > .btn:not(:last-child):not(.dropdown-toggle) {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}

.btn-group > .btn-group:not(:first-child) > .btn, .btn-group > .btn:not(:first-child) {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}

.dropdown-toggle-split {
  padding-right: 0.5625rem;
  padding-left: 0.5625rem;
}

.dropdown-toggle-split::after, .dropright .dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after {
  margin-left: 0;
}

.dropleft .dropdown-toggle-split::before {
  margin-right: 0;
}

.btn-group-sm > .btn + .dropdown-toggle-split, .btn-sm + .dropdown-toggle-split {
  padding-right: 0.375rem;
  padding-left: 0.375rem;
}

.btn-group-lg > .btn + .dropdown-toggle-split, .btn-lg + .dropdown-toggle-split {
  padding-right: 0.75rem;
  padding-left: 0.75rem;
}

.btn-group-vertical {
  -ms-flex-direction: column;
  flex-direction: column;
  -ms-flex-align: start;
  align-items: flex-start;
  -ms-flex-pack: center;
  justify-content: center;
}

.btn-group-vertical .btn, .btn-group-vertical .btn-group {
  width: 100%;
}

.btn-group-vertical > .btn + .btn, .btn-group-vertical > .btn + .btn-group, .btn-group-vertical > .btn-group + .btn, .btn-group-vertical > .btn-group + .btn-group {
  margin-top: -1px;
  margin-left: 0;
}

.btn-group-vertical > .btn-group:not(:last-child) > .btn, .btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle) {
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0;
}

.btn-group-vertical > .btn-group:not(:first-child) > .btn, .btn-group-vertical > .btn:not(:first-child) {
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.btn-group-toggle > .btn, .btn-group-toggle > .btn-group > .btn {
  margin-bottom: 0;
}

.btn-group-toggle > .btn input[type=checkbox], .btn-group-toggle > .btn input[type=radio], .btn-group-toggle > .btn-group > .btn input[type=checkbox], .btn-group-toggle > .btn-group > .btn input[type=radio] {
  position: absolute;
  clip: rect(0, 0, 0, 0);
  pointer-events: none;
}

.input-group {
  position: relative;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  -ms-flex-align: stretch;
  align-items: stretch;
  width: 100%;
}

.input-group > .custom-file, .input-group > .custom-select, .input-group > .form-control {
  position: relative;
  -ms-flex: 1 1 auto;
  flex: 1 1 auto;
  width: 1%;
  margin-bottom: 0;
}

.input-group > .custom-file + .custom-file, .input-group > .custom-file + .custom-select, .input-group > .custom-file + .form-control, .input-group > .custom-select + .custom-file, .input-group > .custom-select + .custom-select, .input-group > .custom-select + .form-control, .input-group > .form-control + .custom-file, .input-group > .form-control + .custom-select, .input-group > .form-control + .form-control {
  margin-left: -1px;
}

.input-group > .custom-file .custom-file-input:focus ~ .custom-file-label, .input-group > .custom-select:focus, .input-group > .form-control:focus {
  z-index: 3;
}

.input-group > .custom-file .custom-file-input:focus {
  z-index: 4;
}

.input-group > .custom-select:not(:last-child), .input-group > .form-control:not(:last-child) {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}

.input-group > .custom-select:not(:first-child), .input-group > .form-control:not(:first-child) {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}

.input-group > .custom-file {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-align: center;
  align-items: center;
}

.input-group > .custom-file:not(:last-child) .custom-file-label, .input-group > .custom-file:not(:last-child) .custom-file-label::after {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}

.input-group > .custom-file:not(:first-child) .custom-file-label {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}

.input-group-append, .input-group-prepend {
  display: -ms-flexbox;
  display: flex;
}

.input-group-append .btn, .input-group-prepend .btn {
  position: relative;
  z-index: 2;
}

.input-group-append .btn + .btn, .input-group-append .btn + .input-group-text, .input-group-append .input-group-text + .btn, .input-group-append .input-group-text + .input-group-text, .input-group-prepend .btn + .btn, .input-group-prepend .btn + .input-group-text, .input-group-prepend .input-group-text + .btn, .input-group-prepend .input-group-text + .input-group-text {
  margin-left: -1px;
}

.input-group-prepend {
  margin-right: -1px;
}

.input-group-append {
  margin-left: -1px;
}

.input-group-text {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-align: center;
  align-items: center;
  padding: 0.375rem 0.75rem;
  margin-bottom: 0;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #495057;
  text-align: center;
  white-space: nowrap;
  background-color: #e9ecef;
  border: 1px solid #ced4da;
  border-radius: 0.25rem;
}

.input-group-text input[type=checkbox], .input-group-text input[type=radio] {
  margin-top: 0;
}

.input-group-lg > .form-control, .input-group-lg > .input-group-append > .btn, .input-group-lg > .input-group-append > .input-group-text, .input-group-lg > .input-group-prepend > .btn, .input-group-lg > .input-group-prepend > .input-group-text {
  height: calc(2.875rem + 2px);
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 0.3rem;
}

.input-group-sm > .form-control, .input-group-sm > .input-group-append > .btn, .input-group-sm > .input-group-append > .input-group-text, .input-group-sm > .input-group-prepend > .btn, .input-group-sm > .input-group-prepend > .input-group-text {
  height: calc(1.8125rem + 2px);
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
  border-radius: 0.2rem;
}

.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), .input-group > .input-group-append:last-child > .input-group-text:not(:last-child), .input-group > .input-group-append:not(:last-child) > .btn, .input-group > .input-group-append:not(:last-child) > .input-group-text, .input-group > .input-group-prepend > .btn, .input-group > .input-group-prepend > .input-group-text {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}

.input-group > .input-group-append > .btn, .input-group > .input-group-append > .input-group-text, .input-group > .input-group-prepend:first-child > .btn:not(:first-child), .input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child), .input-group > .input-group-prepend:not(:first-child) > .btn, .input-group > .input-group-prepend:not(:first-child) > .input-group-text {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}

.custom-control {
  position: relative;
  display: block;
  min-height: 1.5rem;
  padding-left: 1.5rem;
}

.custom-control-inline {
  display: -ms-inline-flexbox;
  display: inline-flex;
  margin-right: 1rem;
}

.custom-control-input {
  position: absolute;
  z-index: -1;
  opacity: 0;
}

.custom-control-input:checked ~ .custom-control-label::before {
  color: #fff;
  background-color: #007bff;
}

.custom-control-input:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.custom-control-input:active ~ .custom-control-label::before {
  color: #fff;
  background-color: #b3d7ff;
}

.custom-control-input:disabled ~ .custom-control-label {
  color: #6c757d;
}

.custom-control-input:disabled ~ .custom-control-label::before {
  background-color: #e9ecef;
}

.custom-control-label {
  position: relative;
  margin-bottom: 0;
}

.custom-control-label::before {
  position: absolute;
  top: 0.25rem;
  left: -1.5rem;
  display: block;
  width: 1rem;
  height: 1rem;
  pointer-events: none;
  content: "";
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  background-color: #dee2e6;
}

.custom-control-label::after {
  position: absolute;
  top: 0.25rem;
  left: -1.5rem;
  display: block;
  width: 1rem;
  height: 1rem;
  content: "";
  background-repeat: no-repeat;
  background-position: center center;
  background-size: 50% 50%;
}

.custom-checkbox .custom-control-label::before {
  border-radius: 0.25rem;
}

.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before {
  background-color: #007bff;
}

.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E");
}

.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before {
  background-color: #007bff;
}

.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E");
}

.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: rgba(0, 123, 255, 0.5);
}

.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before {
  background-color: rgba(0, 123, 255, 0.5);
}

.custom-radio .custom-control-label::before {
  border-radius: 50%;
}

.custom-radio .custom-control-input:checked ~ .custom-control-label::before {
  background-color: #007bff;
}

.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E");
}

.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: rgba(0, 123, 255, 0.5);
}

.custom-select {
  display: inline-block;
  width: 100%;
  height: calc(2.25rem + 2px);
  padding: 0.375rem 1.75rem 0.375rem 0.75rem;
  line-height: 1.5;
  color: #495057;
  vertical-align: middle;
  background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right 0.75rem center;
  background-size: 8px 10px;
  border: 1px solid #ced4da;
  border-radius: 0.25rem;
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
}

.custom-select:focus {
  border-color: #80bdff;
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(128, 189, 255, 0.5);
}

.custom-select:focus::-ms-value {
  color: #495057;
  background-color: #fff;
}

.custom-select[multiple], .custom-select[size]:not([size="1"]) {
  height: auto;
  padding-right: 0.75rem;
  background-image: none;
}

.custom-select:disabled {
  color: #6c757d;
  background-color: #e9ecef;
}

.custom-select::-ms-expand {
  opacity: 0;
}

.custom-select-sm {
  height: calc(1.8125rem + 2px);
  padding-top: 0.375rem;
  padding-bottom: 0.375rem;
  font-size: 75%;
}

.custom-select-lg {
  height: calc(2.875rem + 2px);
  padding-top: 0.375rem;
  padding-bottom: 0.375rem;
  font-size: 125%;
}

.custom-file {
  position: relative;
  display: inline-block;
  width: 100%;
  height: calc(2.25rem + 2px);
  margin-bottom: 0;
}

.custom-file-input {
  position: relative;
  z-index: 2;
  width: 100%;
  height: calc(2.25rem + 2px);
  margin: 0;
  opacity: 0;
}

.custom-file-input:focus ~ .custom-file-label {
  border-color: #80bdff;
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.custom-file-input:focus ~ .custom-file-label::after {
  border-color: #80bdff;
}

.custom-file-input:disabled ~ .custom-file-label {
  background-color: #e9ecef;
}

.custom-file-input:lang(en) ~ .custom-file-label::after {
  content: "Elegir";
}

.custom-file-label {
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1;
  height: calc(2.25rem + 2px);
  padding: 0.375rem 0.75rem;
  line-height: 1.5;
  color: #495057;
  background-color: #fff;
  border: 1px solid #ced4da;
  border-radius: 0.25rem;
}

.custom-file-label::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  z-index: 3;
  display: block;
  height: 2.25rem;
  padding: 0.375rem 0.75rem;
  line-height: 1.5;
  color: #495057;
  content: "Elegir";
  background-color: #e9ecef;
  border-left: 1px solid #ced4da;
  border-radius: 0 0.25rem 0.25rem 0;
}

.custom-range {
  width: 100%;
  padding-left: 0;
  background-color: transparent;
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
}

.custom-range:focus {
  outline: 0;
}

.custom-range:focus::-webkit-slider-thumb {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.custom-range:focus::-moz-range-thumb {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.custom-range:focus::-ms-thumb {
  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.custom-range::-moz-focus-outer {
  border: 0;
}

.custom-range::-webkit-slider-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: -0.25rem;
  background-color: #007bff;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  -webkit-appearance: none;
  appearance: none;
}

@media screen and (prefers-reduced-motion: reduce) {
  .custom-range::-webkit-slider-thumb {
    transition: none;
  }
}
.custom-range::-webkit-slider-thumb:active {
  background-color: #b3d7ff;
}

.custom-range::-webkit-slider-runnable-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: #dee2e6;
  border-color: transparent;
  border-radius: 1rem;
}

.custom-range::-moz-range-thumb {
  width: 1rem;
  height: 1rem;
  background-color: #007bff;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  -moz-appearance: none;
  appearance: none;
}

@media screen and (prefers-reduced-motion: reduce) {
  .custom-range::-moz-range-thumb {
    transition: none;
  }
}
.custom-range::-moz-range-thumb:active {
  background-color: #b3d7ff;
}

.custom-range::-moz-range-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: #dee2e6;
  border-color: transparent;
  border-radius: 1rem;
}

.custom-range::-ms-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: 0;
  margin-right: 0.2rem;
  margin-left: 0.2rem;
  background-color: #007bff;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  appearance: none;
}

@media screen and (prefers-reduced-motion: reduce) {
  .custom-range::-ms-thumb {
    transition: none;
  }
}
.custom-range::-ms-thumb:active {
  background-color: #b3d7ff;
}

.custom-range::-ms-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: transparent;
  border-color: transparent;
  border-width: 0.5rem;
}

.custom-range::-ms-fill-lower {
  background-color: #dee2e6;
  border-radius: 1rem;
}

.custom-range::-ms-fill-upper {
  margin-right: 15px;
  background-color: #dee2e6;
  border-radius: 1rem;
}

.custom-control-label::before, .custom-file-label, .custom-select {
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}

@media screen and (prefers-reduced-motion: reduce) {
  .custom-control-label::before, .custom-file-label, .custom-select {
    transition: none;
  }
}
.nav {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}

.nav-link {
  display: block;
  padding: 0.5rem 1rem;
}

.nav-link:focus, .nav-link:hover {
  text-decoration: none;
}

.nav-link.disabled {
  color: #6c757d;
}

.nav-tabs {
  border-bottom: 1px solid #dee2e6;
}

.nav-tabs .nav-item {
  margin-bottom: -1px;
}

.nav-tabs .nav-link {
  border: 1px solid transparent;
  border-top-left-radius: 0.25rem;
  border-top-right-radius: 0.25rem;
}

.nav-tabs .nav-link:focus, .nav-tabs .nav-link:hover {
  border-color: #e9ecef #e9ecef #dee2e6;
}

.nav-tabs .nav-link.disabled {
  color: #6c757d;
  background-color: transparent;
  border-color: transparent;
}

.nav-tabs .nav-item.show .nav-link, .nav-tabs .nav-link.active {
  color: #495057;
  background-color: #fff;
  border-color: #dee2e6 #dee2e6 #fff;
}

.nav-tabs .dropdown-menu {
  margin-top: -1px;
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.nav-pills .nav-link {
  border-radius: 0.25rem;
}

.nav-pills .nav-link.active, .nav-pills .show > .nav-link {
  color: #fff;
  background-color: #007bff;
}

.nav-fill .nav-item {
  -ms-flex: 1 1 auto;
  flex: 1 1 auto;
  text-align: center;
}

.nav-justified .nav-item {
  -ms-flex-preferred-size: 0;
  flex-basis: 0;
  -ms-flex-positive: 1;
  flex-grow: 1;
  text-align: center;
}

.tab-content > .tab-pane {
  display: none;
}

.tab-content > .active {
  display: block;
}

.navbar {
  position: relative;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  -ms-flex-align: center;
  align-items: center;
  -ms-flex-pack: justify;
  justify-content: space-between;
  padding: 0.5rem 1rem;
}

.navbar > .container, .navbar > .container-fluid {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  -ms-flex-align: center;
  align-items: center;
  -ms-flex-pack: justify;
  justify-content: space-between;
}

.navbar-brand {
  display: inline-block;
  padding-top: 0.3125rem;
  padding-bottom: 0.3125rem;
  margin-right: 1rem;
  font-size: 1.25rem;
  line-height: inherit;
  white-space: nowrap;
}

.navbar-brand:focus, .navbar-brand:hover {
  text-decoration: none;
}

.navbar-nav {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-direction: column;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}

.navbar-nav .nav-link {
  padding-right: 0;
  padding-left: 0;
}

.navbar-nav .dropdown-menu {
  position: static;
  float: none;
}

.navbar-text {
  display: inline-block;
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
}

.navbar-collapse {
  -ms-flex-preferred-size: 100%;
  flex-basis: 100%;
  -ms-flex-positive: 1;
  flex-grow: 1;
  -ms-flex-align: center;
  align-items: center;
}

.navbar-toggler {
  padding: 0.25rem 0.75rem;
  font-size: 1.25rem;
  line-height: 1;
  background-color: transparent;
  border: 1px solid transparent;
  border-radius: 0.25rem;
}

.navbar-toggler:focus, .navbar-toggler:hover {
  text-decoration: none;
}

.navbar-toggler:not(:disabled):not(.disabled) {
  cursor: pointer;
}

.navbar-toggler-icon {
  display: inline-block;
  width: 1.5em;
  height: 1.5em;
  vertical-align: middle;
  content: "";
  background: no-repeat center center;
  background-size: 100% 100%;
}

@media (max-width: 575.98px) {
  .navbar-expand-sm > .container, .navbar-expand-sm > .container-fluid {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 576px) {
  .navbar-expand-sm {
    -ms-flex-flow: row nowrap;
    flex-flow: row nowrap;
    -ms-flex-pack: start;
    justify-content: flex-start;
  }

  .navbar-expand-sm .navbar-nav {
    -ms-flex-direction: row;
    flex-direction: row;
  }

  .navbar-expand-sm .navbar-nav .dropdown-menu {
    position: absolute;
  }

  .navbar-expand-sm .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }

  .navbar-expand-sm > .container, .navbar-expand-sm > .container-fluid {
    -ms-flex-wrap: nowrap;
    flex-wrap: nowrap;
  }

  .navbar-expand-sm .navbar-collapse {
    display: -ms-flexbox !important;
    display: flex !important;
    -ms-flex-preferred-size: auto;
    flex-basis: auto;
  }

  .navbar-expand-sm .navbar-toggler {
    display: none;
  }
}
@media (max-width: 767.98px) {
  .navbar-expand-md > .container, .navbar-expand-md > .container-fluid {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 768px) {
  .navbar-expand-md {
    -ms-flex-flow: row nowrap;
    flex-flow: row nowrap;
    -ms-flex-pack: start;
    justify-content: flex-start;
  }

  .navbar-expand-md .navbar-nav {
    -ms-flex-direction: row;
    flex-direction: row;
  }

  .navbar-expand-md .navbar-nav .dropdown-menu {
    position: absolute;
  }

  .navbar-expand-md .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }

  .navbar-expand-md > .container, .navbar-expand-md > .container-fluid {
    -ms-flex-wrap: nowrap;
    flex-wrap: nowrap;
  }

  .navbar-expand-md .navbar-collapse {
    display: -ms-flexbox !important;
    display: flex !important;
    -ms-flex-preferred-size: auto;
    flex-basis: auto;
  }

  .navbar-expand-md .navbar-toggler {
    display: none;
  }
}
@media (max-width: 991.98px) {
  .navbar-expand-lg > .container, .navbar-expand-lg > .container-fluid {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 992px) {
  .navbar-expand-lg {
    -ms-flex-flow: row nowrap;
    flex-flow: row nowrap;
    -ms-flex-pack: start;
    justify-content: flex-start;
  }

  .navbar-expand-lg .navbar-nav {
    -ms-flex-direction: row;
    flex-direction: row;
  }

  .navbar-expand-lg .navbar-nav .dropdown-menu {
    position: absolute;
  }

  .navbar-expand-lg .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }

  .navbar-expand-lg > .container, .navbar-expand-lg > .container-fluid {
    -ms-flex-wrap: nowrap;
    flex-wrap: nowrap;
  }

  .navbar-expand-lg .navbar-collapse {
    display: -ms-flexbox !important;
    display: flex !important;
    -ms-flex-preferred-size: auto;
    flex-basis: auto;
  }

  .navbar-expand-lg .navbar-toggler {
    display: none;
  }
}
@media (max-width: 1199.98px) {
  .navbar-expand-xl > .container, .navbar-expand-xl > .container-fluid {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 1200px) {
  .navbar-expand-xl {
    -ms-flex-flow: row nowrap;
    flex-flow: row nowrap;
    -ms-flex-pack: start;
    justify-content: flex-start;
  }

  .navbar-expand-xl .navbar-nav {
    -ms-flex-direction: row;
    flex-direction: row;
  }

  .navbar-expand-xl .navbar-nav .dropdown-menu {
    position: absolute;
  }

  .navbar-expand-xl .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }

  .navbar-expand-xl > .container, .navbar-expand-xl > .container-fluid {
    -ms-flex-wrap: nowrap;
    flex-wrap: nowrap;
  }

  .navbar-expand-xl .navbar-collapse {
    display: -ms-flexbox !important;
    display: flex !important;
    -ms-flex-preferred-size: auto;
    flex-basis: auto;
  }

  .navbar-expand-xl .navbar-toggler {
    display: none;
  }
}
.navbar-expand {
  -ms-flex-flow: row nowrap;
  flex-flow: row nowrap;
  -ms-flex-pack: start;
  justify-content: flex-start;
}

.navbar-expand > .container, .navbar-expand > .container-fluid {
  padding-right: 0;
  padding-left: 0;
}

.navbar-expand .navbar-nav {
  -ms-flex-direction: row;
  flex-direction: row;
}

.navbar-expand .navbar-nav .dropdown-menu {
  position: absolute;
}

.navbar-expand .navbar-nav .nav-link {
  padding-right: 0.5rem;
  padding-left: 0.5rem;
}

.navbar-expand > .container, .navbar-expand > .container-fluid {
  -ms-flex-wrap: nowrap;
  flex-wrap: nowrap;
}

.navbar-expand .navbar-collapse {
  display: -ms-flexbox !important;
  display: flex !important;
  -ms-flex-preferred-size: auto;
  flex-basis: auto;
}

.navbar-expand .navbar-toggler {
  display: none;
}

.navbar-light .navbar-brand {
  color: rgba(0, 0, 0, 0.9);
}

.navbar-light .navbar-brand:focus, .navbar-light .navbar-brand:hover {
  color: rgba(0, 0, 0, 0.9);
}

.navbar-light .navbar-nav .nav-link {
  color: rgba(0, 0, 0, 0.5);
}

.navbar-light .navbar-nav .nav-link:focus, .navbar-light .navbar-nav .nav-link:hover {
  color: rgba(0, 0, 0, 0.7);
}

.navbar-light .navbar-nav .nav-link.disabled {
  color: rgba(0, 0, 0, 0.3);
}

.navbar-light .navbar-nav .active > .nav-link, .navbar-light .navbar-nav .nav-link.active, .navbar-light .navbar-nav .nav-link.show, .navbar-light .navbar-nav .show > .nav-link {
  color: rgba(0, 0, 0, 0.9);
}

.navbar-light .navbar-toggler {
  color: rgba(0, 0, 0, 0.5);
  border-color: rgba(0, 0, 0, 0.1);
}

.navbar-light .navbar-toggler-icon {
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
}

.navbar-light .navbar-text {
  color: rgba(0, 0, 0, 0.5);
}

.navbar-light .navbar-text a {
  color: rgba(0, 0, 0, 0.9);
}

.navbar-light .navbar-text a:focus, .navbar-light .navbar-text a:hover {
  color: rgba(0, 0, 0, 0.9);
}

.navbar-dark .navbar-brand {
  color: #fff;
}

.navbar-dark .navbar-brand:focus, .navbar-dark .navbar-brand:hover {
  color: #fff;
}

.navbar-dark .navbar-nav .nav-link {
  color: rgba(255, 255, 255, 0.5);
}

.navbar-dark .navbar-nav .nav-link:focus, .navbar-dark .navbar-nav .nav-link:hover {
  color: rgba(255, 255, 255, 0.75);
}

.navbar-dark .navbar-nav .nav-link.disabled {
  color: rgba(255, 255, 255, 0.25);
}

.navbar-dark .navbar-nav .active > .nav-link, .navbar-dark .navbar-nav .nav-link.active, .navbar-dark .navbar-nav .nav-link.show, .navbar-dark .navbar-nav .show > .nav-link {
  color: #fff;
}

.navbar-dark .navbar-toggler {
  color: rgba(255, 255, 255, 0.5);
  border-color: rgba(255, 255, 255, 0.1);
}

.navbar-dark .navbar-toggler-icon {
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
}

.navbar-dark .navbar-text {
  color: rgba(255, 255, 255, 0.5);
}

.navbar-dark .navbar-text a {
  color: #fff;
}

.navbar-dark .navbar-text a:focus, .navbar-dark .navbar-text a:hover {
  color: #fff;
}

.card {
  position: relative;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-direction: column;
  flex-direction: column;
  min-width: 0;
  word-wrap: break-word;
  background-color: #fff;
  background-clip: border-box;
  border: 1px solid rgba(0, 0, 0, 0.125);
  border-radius: 0.25rem;
}

.card > hr {
  margin-right: 0;
  margin-left: 0;
}

.card > .list-group:first-child .list-group-item:first-child {
  border-top-left-radius: 0.25rem;
  border-top-right-radius: 0.25rem;
}

.card > .list-group:last-child .list-group-item:last-child {
  border-bottom-right-radius: 0.25rem;
  border-bottom-left-radius: 0.25rem;
}

.card-body {
  -ms-flex: 1 1 auto;
  flex: 1 1 auto;
  padding: 1.25rem;
}

.card-title {
  margin-bottom: 0.75rem;
}

.card-subtitle {
  margin-top: -0.375rem;
  margin-bottom: 0;
}

.card-text:last-child {
  margin-bottom: 0;
}

.card-link:hover {
  text-decoration: none;
}

.card-link + .card-link {
  margin-left: 1.25rem;
}

.card-header {
  padding: 0.75rem 1.25rem;
  margin-bottom: 0;
  background-color: rgba(0, 0, 0, 0.03);
  border-bottom: 1px solid rgba(0, 0, 0, 0.125);
}

.card-header:first-child {
  border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0;
}

.card-header + .list-group .list-group-item:first-child {
  border-top: 0;
}

.card-footer {
  padding: 0.75rem 1.25rem;
  background-color: rgba(0, 0, 0, 0.03);
  border-top: 1px solid rgba(0, 0, 0, 0.125);
}

.card-footer:last-child {
  border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px);
}

.card-header-tabs {
  margin-right: -0.625rem;
  margin-bottom: -0.75rem;
  margin-left: -0.625rem;
  border-bottom: 0;
}

.card-header-pills {
  margin-right: -0.625rem;
  margin-left: -0.625rem;
}

.card-img-overlay {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  padding: 1.25rem;
}

.card-img {
  width: 100%;
  border-radius: calc(0.25rem - 1px);
}

.card-img-top {
  width: 100%;
  border-top-left-radius: calc(0.25rem - 1px);
  border-top-right-radius: calc(0.25rem - 1px);
}

.card-img-bottom {
  width: 100%;
  border-bottom-right-radius: calc(0.25rem - 1px);
  border-bottom-left-radius: calc(0.25rem - 1px);
}

.card-deck {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-direction: column;
  flex-direction: column;
}

.card-deck .card {
  margin-bottom: 15px;
}

@media (min-width: 576px) {
  .card-deck {
    -ms-flex-flow: row wrap;
    flex-flow: row wrap;
    margin-right: -15px;
    margin-left: -15px;
  }

  .card-deck .card {
    display: -ms-flexbox;
    display: flex;
    -ms-flex: 1 0 0%;
    flex: 1 0 0%;
    -ms-flex-direction: column;
    flex-direction: column;
    margin-right: 15px;
    margin-bottom: 0;
    margin-left: 15px;
  }
}
.card-group {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-direction: column;
  flex-direction: column;
}

.card-group > .card {
  margin-bottom: 15px;
}

@media (min-width: 576px) {
  .card-group {
    -ms-flex-flow: row wrap;
    flex-flow: row wrap;
  }

  .card-group > .card {
    -ms-flex: 1 0 0%;
    flex: 1 0 0%;
    margin-bottom: 0;
  }

  .card-group > .card + .card {
    margin-left: 0;
    border-left: 0;
  }

  .card-group > .card:first-child {
    border-top-right-radius: 0;
    border-bottom-right-radius: 0;
  }

  .card-group > .card:first-child .card-header, .card-group > .card:first-child .card-img-top {
    border-top-right-radius: 0;
  }

  .card-group > .card:first-child .card-footer, .card-group > .card:first-child .card-img-bottom {
    border-bottom-right-radius: 0;
  }

  .card-group > .card:last-child {
    border-top-left-radius: 0;
    border-bottom-left-radius: 0;
  }

  .card-group > .card:last-child .card-header, .card-group > .card:last-child .card-img-top {
    border-top-left-radius: 0;
  }

  .card-group > .card:last-child .card-footer, .card-group > .card:last-child .card-img-bottom {
    border-bottom-left-radius: 0;
  }

  .card-group > .card:only-child {
    border-radius: 0.25rem;
  }

  .card-group > .card:only-child .card-header, .card-group > .card:only-child .card-img-top {
    border-top-left-radius: 0.25rem;
    border-top-right-radius: 0.25rem;
  }

  .card-group > .card:only-child .card-footer, .card-group > .card:only-child .card-img-bottom {
    border-bottom-right-radius: 0.25rem;
    border-bottom-left-radius: 0.25rem;
  }

  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) {
    border-radius: 0;
  }

  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer, .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header, .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom, .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top {
    border-radius: 0;
  }
}
.card-columns .card {
  margin-bottom: 0.75rem;
}

@media (min-width: 576px) {
  .card-columns {
    -webkit-column-count: 3;
    -moz-column-count: 3;
    column-count: 3;
    -webkit-column-gap: 1.25rem;
    -moz-column-gap: 1.25rem;
    column-gap: 1.25rem;
    orphans: 1;
    widows: 1;
  }

  .card-columns .card {
    display: inline-block;
    width: 100%;
  }
}
.accordion .card:not(:first-of-type):not(:last-of-type) {
  border-bottom: 0;
  border-radius: 0;
}

.accordion .card:not(:first-of-type) .card-header:first-child {
  border-radius: 0;
}

.accordion .card:first-of-type {
  border-bottom: 0;
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0;
}

.accordion .card:last-of-type {
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.breadcrumb {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  padding: 0.75rem 1rem;
  margin-bottom: 1rem;
  list-style: none;
  background-color: #e9ecef;
  border-radius: 0.25rem;
}

.breadcrumb-item + .breadcrumb-item {
  padding-left: 0.5rem;
}

.breadcrumb-item + .breadcrumb-item::before {
  display: inline-block;
  padding-right: 0.5rem;
  color: #6c757d;
  content: "/";
}

.breadcrumb-item + .breadcrumb-item:hover::before {
  text-decoration: underline;
}

.breadcrumb-item + .breadcrumb-item:hover::before {
  text-decoration: none;
}

.breadcrumb-item.active {
  color: #6c757d;
}

.pagination {
  display: -ms-flexbox;
  display: flex;
  padding-left: 0;
  list-style: none;
  border-radius: 0.25rem;
}

.page-link {
  position: relative;
  display: block;
  padding: 0.5rem 0.75rem;
  margin-left: -1px;
  line-height: 1.25;
  color: #007bff;
  background-color: #fff;
  border: 1px solid #dee2e6;
}

.page-link:hover {
  z-index: 2;
  color: #0056b3;
  text-decoration: none;
  background-color: #e9ecef;
  border-color: #dee2e6;
}

.page-link:focus {
  z-index: 2;
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
}

.page-link:not(:disabled):not(.disabled) {
  cursor: pointer;
}

.page-item:first-child .page-link {
  margin-left: 0;
  border-top-left-radius: 0.25rem;
  border-bottom-left-radius: 0.25rem;
}

.page-item:last-child .page-link {
  border-top-right-radius: 0.25rem;
  border-bottom-right-radius: 0.25rem;
}

.page-item.active .page-link {
  z-index: 1;
  color: #fff;
  background-color: #007bff;
  border-color: #007bff;
}

.page-item.disabled .page-link {
  color: #6c757d;
  pointer-events: none;
  cursor: auto;
  background-color: #fff;
  border-color: #dee2e6;
}

.pagination-lg .page-link {
  padding: 0.75rem 1.5rem;
  font-size: 1.25rem;
  line-height: 1.5;
}

.pagination-lg .page-item:first-child .page-link {
  border-top-left-radius: 0.3rem;
  border-bottom-left-radius: 0.3rem;
}

.pagination-lg .page-item:last-child .page-link {
  border-top-right-radius: 0.3rem;
  border-bottom-right-radius: 0.3rem;
}

.pagination-sm .page-link {
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
}

.pagination-sm .page-item:first-child .page-link {
  border-top-left-radius: 0.2rem;
  border-bottom-left-radius: 0.2rem;
}

.pagination-sm .page-item:last-child .page-link {
  border-top-right-radius: 0.2rem;
  border-bottom-right-radius: 0.2rem;
}

.badge {
  display: inline-block;
  padding: 0.25em 0.4em;
  font-size: 75%;
  font-weight: 700;
  line-height: 1;
  text-align: center;
  white-space: nowrap;
  vertical-align: baseline;
  border-radius: 0.25rem;
}

.badge:empty {
  display: none;
}

.btn .badge {
  position: relative;
  top: -1px;
}

.badge-pill {
  padding-right: 0.6em;
  padding-left: 0.6em;
  border-radius: 10rem;
}

.badge-primary {
  color: #fff;
  background-color: #007bff;
}

.badge-primary[href]:focus, .badge-primary[href]:hover {
  color: #fff;
  text-decoration: none;
  background-color: #0062cc;
}

.badge-secondary {
  color: #fff;
  background-color: #6c757d;
}

.badge-secondary[href]:focus, .badge-secondary[href]:hover {
  color: #fff;
  text-decoration: none;
  background-color: #545b62;
}

.badge-success {
  color: #fff;
  background-color: #28a745;
}

.badge-success[href]:focus, .badge-success[href]:hover {
  color: #fff;
  text-decoration: none;
  background-color: #1e7e34;
}

.badge-info {
  color: #fff;
  background-color: #17a2b8;
}

.badge-info[href]:focus, .badge-info[href]:hover {
  color: #fff;
  text-decoration: none;
  background-color: #117a8b;
}

.badge-warning {
  color: #212529;
  background-color: #ffc107;
}

.badge-warning[href]:focus, .badge-warning[href]:hover {
  color: #212529;
  text-decoration: none;
  background-color: #d39e00;
}

.badge-danger {
  color: #fff;
  background-color: #dc3545;
}

.badge-danger[href]:focus, .badge-danger[href]:hover {
  color: #fff;
  text-decoration: none;
  background-color: #bd2130;
}

.badge-light {
  color: #212529;
  background-color: #f8f9fa;
}

.badge-light[href]:focus, .badge-light[href]:hover {
  color: #212529;
  text-decoration: none;
  background-color: #dae0e5;
}

.badge-dark {
  color: #fff;
  background-color: #343a40;
}

.badge-dark[href]:focus, .badge-dark[href]:hover {
  color: #fff;
  text-decoration: none;
  background-color: #1d2124;
}

.jumbotron {
  padding: 2rem 1rem;
  margin-bottom: 2rem;
  background-color: #e9ecef;
  border-radius: 0.3rem;
}

@media (min-width: 576px) {
  .jumbotron {
    padding: 4rem 2rem;
  }
}
.jumbotron-fluid {
  padding-right: 0;
  padding-left: 0;
  border-radius: 0;
}

.alert {
  position: relative;
  padding: 0.75rem 1.25rem;
  margin-bottom: 1rem;
  border: 1px solid transparent;
  border-radius: 0.25rem;
}

.alert-heading {
  color: inherit;
}

.alert-link {
  font-weight: 700;
}

.alert-dismissible {
  padding-right: 4rem;
}

.alert-dismissible .close {
  position: absolute;
  top: 0;
  right: 0;
  padding: 0.75rem 1.25rem;
  color: inherit;
}

.alert-primary {
  color: #004085;
  background-color: #cce5ff;
  border-color: #b8daff;
}

.alert-primary hr {
  border-top-color: #9fcdff;
}

.alert-primary .alert-link {
  color: #002752;
}

.alert-secondary {
  color: #383d41;
  background-color: #e2e3e5;
  border-color: #d6d8db;
}

.alert-secondary hr {
  border-top-color: #c8cbcf;
}

.alert-secondary .alert-link {
  color: #202326;
}

.alert-success {
  color: #155724;
  background-color: #d4edda;
  border-color: #c3e6cb;
}

.alert-success hr {
  border-top-color: #b1dfbb;
}

.alert-success .alert-link {
  color: #0b2e13;
}

.alert-info {
  color: #0c5460;
  background-color: #d1ecf1;
  border-color: #bee5eb;
}

.alert-info hr {
  border-top-color: #abdde5;
}

.alert-info .alert-link {
  color: #062c33;
}

.alert-warning {
  color: #856404;
  background-color: #fff3cd;
  border-color: #ffeeba;
}

.alert-warning hr {
  border-top-color: #ffe8a1;
}

.alert-warning .alert-link {
  color: #533f03;
}

.alert-danger {
  color: #721c24;
  background-color: #f8d7da;
  border-color: #f5c6cb;
}

.alert-danger hr {
  border-top-color: #f1b0b7;
}

.alert-danger .alert-link {
  color: #491217;
}

.alert-light {
  color: #818182;
  background-color: #fefefe;
  border-color: #fdfdfe;
}

.alert-light hr {
  border-top-color: #ececf6;
}

.alert-light .alert-link {
  color: #686868;
}

.alert-dark {
  color: #1b1e21;
  background-color: #d6d8d9;
  border-color: #c6c8ca;
}

.alert-dark hr {
  border-top-color: #b9bbbe;
}

.alert-dark .alert-link {
  color: #040505;
}

@-webkit-keyframes progress-bar-stripes {
  from {
    background-position: 1rem 0;
  }
  to {
    background-position: 0 0;
  }
}
@keyframes progress-bar-stripes {
  from {
    background-position: 1rem 0;
  }
  to {
    background-position: 0 0;
  }
}
.progress {
  display: -ms-flexbox;
  display: flex;
  height: 1rem;
  overflow: hidden;
  font-size: 0.75rem;
  background-color: #e9ecef;
  border-radius: 0.25rem;
}

.progress-bar {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-direction: column;
  flex-direction: column;
  -ms-flex-pack: center;
  justify-content: center;
  color: #fff;
  text-align: center;
  white-space: nowrap;
  background-color: #007bff;
  transition: width 0.6s ease;
}

@media screen and (prefers-reduced-motion: reduce) {
  .progress-bar {
    transition: none;
  }
}
.progress-bar-striped {
  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
  background-size: 1rem 1rem;
}

.progress-bar-animated {
  -webkit-animation: progress-bar-stripes 1s linear infinite;
  animation: progress-bar-stripes 1s linear infinite;
}

.media {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-align: start;
  align-items: flex-start;
}

.media-body {
  -ms-flex: 1;
  flex: 1;
}

.list-group {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-direction: column;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
}

.list-group-item-action {
  width: 100%;
  color: #495057;
  text-align: inherit;
}

.list-group-item-action:focus, .list-group-item-action:hover {
  color: #495057;
  text-decoration: none;
  background-color: #f8f9fa;
}

.list-group-item-action:active {
  color: #212529;
  background-color: #e9ecef;
}

.list-group-item {
  position: relative;
  display: block;
  padding: 0.75rem 1.25rem;
  margin-bottom: -1px;
  background-color: #fff;
  border: 1px solid rgba(0, 0, 0, 0.125);
}

.list-group-item:first-child {
  border-top-left-radius: 0.25rem;
  border-top-right-radius: 0.25rem;
}

.list-group-item:last-child {
  margin-bottom: 0;
  border-bottom-right-radius: 0.25rem;
  border-bottom-left-radius: 0.25rem;
}

.list-group-item:focus, .list-group-item:hover {
  z-index: 1;
  text-decoration: none;
}

.list-group-item.disabled, .list-group-item:disabled {
  color: #6c757d;
  background-color: #fff;
}

.list-group-item.active {
  z-index: 2;
  color: #fff;
  background-color: #007bff;
  border-color: #007bff;
}

.list-group-flush .list-group-item {
  border-right: 0;
  border-left: 0;
  border-radius: 0;
}

.list-group-flush:first-child .list-group-item:first-child {
  border-top: 0;
}

.list-group-flush:last-child .list-group-item:last-child {
  border-bottom: 0;
}

.list-group-item-primary {
  color: #004085;
  background-color: #b8daff;
}

.list-group-item-primary.list-group-item-action:focus, .list-group-item-primary.list-group-item-action:hover {
  color: #004085;
  background-color: #9fcdff;
}

.list-group-item-primary.list-group-item-action.active {
  color: #fff;
  background-color: #004085;
  border-color: #004085;
}

.list-group-item-secondary {
  color: #383d41;
  background-color: #d6d8db;
}

.list-group-item-secondary.list-group-item-action:focus, .list-group-item-secondary.list-group-item-action:hover {
  color: #383d41;
  background-color: #c8cbcf;
}

.list-group-item-secondary.list-group-item-action.active {
  color: #fff;
  background-color: #383d41;
  border-color: #383d41;
}

.list-group-item-success {
  color: #155724;
  background-color: #c3e6cb;
}

.list-group-item-success.list-group-item-action:focus, .list-group-item-success.list-group-item-action:hover {
  color: #155724;
  background-color: #b1dfbb;
}

.list-group-item-success.list-group-item-action.active {
  color: #fff;
  background-color: #155724;
  border-color: #155724;
}

.list-group-item-info {
  color: #0c5460;
  background-color: #bee5eb;
}

.list-group-item-info.list-group-item-action:focus, .list-group-item-info.list-group-item-action:hover {
  color: #0c5460;
  background-color: #abdde5;
}

.list-group-item-info.list-group-item-action.active {
  color: #fff;
  background-color: #0c5460;
  border-color: #0c5460;
}

.list-group-item-warning {
  color: #856404;
  background-color: #ffeeba;
}

.list-group-item-warning.list-group-item-action:focus, .list-group-item-warning.list-group-item-action:hover {
  color: #856404;
  background-color: #ffe8a1;
}

.list-group-item-warning.list-group-item-action.active {
  color: #fff;
  background-color: #856404;
  border-color: #856404;
}

.list-group-item-danger {
  color: #721c24;
  background-color: #f5c6cb;
}

.list-group-item-danger.list-group-item-action:focus, .list-group-item-danger.list-group-item-action:hover {
  color: #721c24;
  background-color: #f1b0b7;
}

.list-group-item-danger.list-group-item-action.active {
  color: #fff;
  background-color: #721c24;
  border-color: #721c24;
}

.list-group-item-light {
  color: #818182;
  background-color: #fdfdfe;
}

.list-group-item-light.list-group-item-action:focus, .list-group-item-light.list-group-item-action:hover {
  color: #818182;
  background-color: #ececf6;
}

.list-group-item-light.list-group-item-action.active {
  color: #fff;
  background-color: #818182;
  border-color: #818182;
}

.list-group-item-dark {
  color: #1b1e21;
  background-color: #c6c8ca;
}

.list-group-item-dark.list-group-item-action:focus, .list-group-item-dark.list-group-item-action:hover {
  color: #1b1e21;
  background-color: #b9bbbe;
}

.list-group-item-dark.list-group-item-action.active {
  color: #fff;
  background-color: #1b1e21;
  border-color: #1b1e21;
}

.close {
  float: right;
  font-size: 1.5rem;
  font-weight: 700;
  line-height: 1;
  color: #000;
  text-shadow: 0 1px 0 #fff;
  opacity: 0.5;
}

.close:not(:disabled):not(.disabled) {
  cursor: pointer;
}

.close:not(:disabled):not(.disabled):focus, .close:not(:disabled):not(.disabled):hover {
  color: #000;
  text-decoration: none;
  opacity: 0.75;
}

button.close {
  padding: 0;
  background-color: transparent;
  border: 0;
  -webkit-appearance: none;
}

.modal-open {
  overflow: hidden;
}

.modal-open .modal {
  overflow-x: hidden;
  overflow-y: auto;
}

.modal {
  position: fixed;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1050;
  display: none;
  overflow: hidden;
  outline: 0;
}

.modal-dialog {
  position: relative;
  width: auto;
  margin: 0.5rem;
  pointer-events: none;
}

.modal.fade .modal-dialog {
  transition: -webkit-transform 0.3s ease-out;
  transition: transform 0.3s ease-out;
  transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out;
  -webkit-transform: translate(0, -25%);
  transform: translate(0, -25%);
}

@media screen and (prefers-reduced-motion: reduce) {
  .modal.fade .modal-dialog {
    transition: none;
  }
}
.modal.show .modal-dialog {
  -webkit-transform: translate(0, 0);
  transform: translate(0, 0);
}

.modal-dialog-centered {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-align: center;
  align-items: center;
  min-height: calc(100% - 1rem);
}

.modal-dialog-centered::before {
  display: block;
  height: calc(100vh - 1rem);
  content: "";
}

.modal-content {
  position: relative;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-direction: column;
  flex-direction: column;
  width: 100%;
  pointer-events: auto;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid rgba(0, 0, 0, 0.2);
  border-radius: 0.3rem;
  outline: 0;
}

.modal-backdrop {
  position: fixed;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1040;
  background-color: #000;
}

.modal-backdrop.fade {
  opacity: 0;
}

.modal-backdrop.show {
  opacity: 0.5;
}

.modal-header {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-align: start;
  align-items: flex-start;
  -ms-flex-pack: justify;
  justify-content: space-between;
  padding: 1rem;
  border-bottom: 1px solid #e9ecef;
  border-top-left-radius: 0.3rem;
  border-top-right-radius: 0.3rem;
}

.modal-header .close {
  padding: 1rem;
  margin: -1rem -1rem -1rem auto;
}

.modal-title {
  margin-bottom: 0;
  line-height: 1.5;
}

.modal-body {
  position: relative;
  -ms-flex: 1 1 auto;
  flex: 1 1 auto;
  padding: 1rem;
}

.modal-footer {
  display: -ms-flexbox;
  display: flex;
  -ms-flex-align: center;
  align-items: center;
  -ms-flex-pack: end;
  justify-content: flex-end;
  padding: 1rem;
  border-top: 1px solid #e9ecef;
}

.modal-footer > :not(:first-child) {
  margin-left: 0.25rem;
}

.modal-footer > :not(:last-child) {
  margin-right: 0.25rem;
}

.modal-scrollbar-measure {
  position: absolute;
  top: -9999px;
  width: 50px;
  height: 50px;
  overflow: scroll;
}

@media (min-width: 576px) {
  .modal-dialog {
    max-width: 500px;
    margin: 1.75rem auto;
  }

  .modal-dialog-centered {
    min-height: calc(100% - 3.5rem);
  }

  .modal-dialog-centered::before {
    height: calc(100vh - 3.5rem);
  }

  .modal-sm {
    max-width: 300px;
  }
}
@media (min-width: 992px) {
  .modal-lg {
    max-width: 800px;
  }
}
.tooltip {
  position: absolute;
  z-index: 1070;
  display: block;
  margin: 0;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  word-spacing: normal;
  white-space: normal;
  line-break: auto;
  font-size: 0.875rem;
  word-wrap: break-word;
  opacity: 0;
}

.tooltip.show {
  opacity: 0.9;
}

.tooltip .arrow {
  position: absolute;
  display: block;
  width: 0.8rem;
  height: 0.4rem;
}

.tooltip .arrow::before {
  position: absolute;
  content: "";
  border-color: transparent;
  border-style: solid;
}

.bs-tooltip-auto[x-placement^=top], .bs-tooltip-top {
  padding: 0.4rem 0;
}

.bs-tooltip-auto[x-placement^=top] .arrow, .bs-tooltip-top .arrow {
  bottom: 0;
}

.bs-tooltip-auto[x-placement^=top] .arrow::before, .bs-tooltip-top .arrow::before {
  top: 0;
  border-width: 0.4rem 0.4rem 0;
  border-top-color: #000;
}

.bs-tooltip-auto[x-placement^=right], .bs-tooltip-right {
  padding: 0 0.4rem;
}

.bs-tooltip-auto[x-placement^=right] .arrow, .bs-tooltip-right .arrow {
  left: 0;
  width: 0.4rem;
  height: 0.8rem;
}

.bs-tooltip-auto[x-placement^=right] .arrow::before, .bs-tooltip-right .arrow::before {
  right: 0;
  border-width: 0.4rem 0.4rem 0.4rem 0;
  border-right-color: #000;
}

.bs-tooltip-auto[x-placement^=bottom], .bs-tooltip-bottom {
  padding: 0.4rem 0;
}

.bs-tooltip-auto[x-placement^=bottom] .arrow, .bs-tooltip-bottom .arrow {
  top: 0;
}

.bs-tooltip-auto[x-placement^=bottom] .arrow::before, .bs-tooltip-bottom .arrow::before {
  bottom: 0;
  border-width: 0 0.4rem 0.4rem;
  border-bottom-color: #000;
}

.bs-tooltip-auto[x-placement^=left], .bs-tooltip-left {
  padding: 0 0.4rem;
}

.bs-tooltip-auto[x-placement^=left] .arrow, .bs-tooltip-left .arrow {
  right: 0;
  width: 0.4rem;
  height: 0.8rem;
}

.bs-tooltip-auto[x-placement^=left] .arrow::before, .bs-tooltip-left .arrow::before {
  left: 0;
  border-width: 0.4rem 0 0.4rem 0.4rem;
  border-left-color: #000;
}

.tooltip-inner {
  max-width: 200px;
  padding: 0.25rem 0.5rem;
  color: #fff;
  text-align: center;
  background-color: #000;
  border-radius: 0.25rem;
}

.popover {
  position: absolute;
  top: 0;
  left: 0;
  z-index: 1060;
  display: block;
  max-width: 276px;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  word-spacing: normal;
  white-space: normal;
  line-break: auto;
  font-size: 0.875rem;
  word-wrap: break-word;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid rgba(0, 0, 0, 0.2);
  border-radius: 0.3rem;
}

.popover .arrow {
  position: absolute;
  display: block;
  width: 1rem;
  height: 0.5rem;
  margin: 0 0.3rem;
}

.popover .arrow::after, .popover .arrow::before {
  position: absolute;
  display: block;
  content: "";
  border-color: transparent;
  border-style: solid;
}

.bs-popover-auto[x-placement^=top], .bs-popover-top {
  margin-bottom: 0.5rem;
}

.bs-popover-auto[x-placement^=top] .arrow, .bs-popover-top .arrow {
  bottom: calc((0.5rem + 1px) * -1);
}

.bs-popover-auto[x-placement^=top] .arrow::after, .bs-popover-auto[x-placement^=top] .arrow::before, .bs-popover-top .arrow::after, .bs-popover-top .arrow::before {
  border-width: 0.5rem 0.5rem 0;
}

.bs-popover-auto[x-placement^=top] .arrow::before, .bs-popover-top .arrow::before {
  bottom: 0;
  border-top-color: rgba(0, 0, 0, 0.25);
}

.bs-popover-auto[x-placement^=top] .arrow::after, .bs-popover-top .arrow::after {
  bottom: 1px;
  border-top-color: #fff;
}

.bs-popover-auto[x-placement^=right], .bs-popover-right {
  margin-left: 0.5rem;
}

.bs-popover-auto[x-placement^=right] .arrow, .bs-popover-right .arrow {
  left: calc((0.5rem + 1px) * -1);
  width: 0.5rem;
  height: 1rem;
  margin: 0.3rem 0;
}

.bs-popover-auto[x-placement^=right] .arrow::after, .bs-popover-auto[x-placement^=right] .arrow::before, .bs-popover-right .arrow::after, .bs-popover-right .arrow::before {
  border-width: 0.5rem 0.5rem 0.5rem 0;
}

.bs-popover-auto[x-placement^=right] .arrow::before, .bs-popover-right .arrow::before {
  left: 0;
  border-right-color: rgba(0, 0, 0, 0.25);
}

.bs-popover-auto[x-placement^=right] .arrow::after, .bs-popover-right .arrow::after {
  left: 1px;
  border-right-color: #fff;
}

.bs-popover-auto[x-placement^=bottom], .bs-popover-bottom {
  margin-top: 0.5rem;
}

.bs-popover-auto[x-placement^=bottom] .arrow, .bs-popover-bottom .arrow {
  top: calc((0.5rem + 1px) * -1);
}

.bs-popover-auto[x-placement^=bottom] .arrow::after, .bs-popover-auto[x-placement^=bottom] .arrow::before, .bs-popover-bottom .arrow::after, .bs-popover-bottom .arrow::before {
  border-width: 0 0.5rem 0.5rem 0.5rem;
}

.bs-popover-auto[x-placement^=bottom] .arrow::before, .bs-popover-bottom .arrow::before {
  top: 0;
  border-bottom-color: rgba(0, 0, 0, 0.25);
}

.bs-popover-auto[x-placement^=bottom] .arrow::after, .bs-popover-bottom .arrow::after {
  top: 1px;
  border-bottom-color: #fff;
}

.bs-popover-auto[x-placement^=bottom] .popover-header::before, .bs-popover-bottom .popover-header::before {
  position: absolute;
  top: 0;
  left: 50%;
  display: block;
  width: 1rem;
  margin-left: -0.5rem;
  content: "";
  border-bottom: 1px solid #f7f7f7;
}

.bs-popover-auto[x-placement^=left], .bs-popover-left {
  margin-right: 0.5rem;
}

.bs-popover-auto[x-placement^=left] .arrow, .bs-popover-left .arrow {
  right: calc((0.5rem + 1px) * -1);
  width: 0.5rem;
  height: 1rem;
  margin: 0.3rem 0;
}

.bs-popover-auto[x-placement^=left] .arrow::after, .bs-popover-auto[x-placement^=left] .arrow::before, .bs-popover-left .arrow::after, .bs-popover-left .arrow::before {
  border-width: 0.5rem 0 0.5rem 0.5rem;
}

.bs-popover-auto[x-placement^=left] .arrow::before, .bs-popover-left .arrow::before {
  right: 0;
  border-left-color: rgba(0, 0, 0, 0.25);
}

.bs-popover-auto[x-placement^=left] .arrow::after, .bs-popover-left .arrow::after {
  right: 1px;
  border-left-color: #fff;
}

.popover-header {
  padding: 0.5rem 0.75rem;
  margin-bottom: 0;
  font-size: 1rem;
  color: inherit;
  background-color: #f7f7f7;
  border-bottom: 1px solid #ebebeb;
  border-top-left-radius: calc(0.3rem - 1px);
  border-top-right-radius: calc(0.3rem - 1px);
}

.popover-header:empty {
  display: none;
}

.popover-body {
  padding: 0.5rem 0.75rem;
  color: #212529;
}

.carousel {
  position: relative;
}

.carousel-inner {
  position: relative;
  width: 100%;
  overflow: hidden;
}

.carousel-item {
  position: relative;
  display: none;
  -ms-flex-align: center;
  align-items: center;
  width: 100%;
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
  -webkit-perspective: 1000px;
  perspective: 1000px;
}

.carousel-item-next, .carousel-item-prev, .carousel-item.active {
  display: block;
  transition: -webkit-transform 0.6s ease;
  transition: transform 0.6s ease;
  transition: transform 0.6s ease, -webkit-transform 0.6s ease;
}

@media screen and (prefers-reduced-motion: reduce) {
  .carousel-item-next, .carousel-item-prev, .carousel-item.active {
    transition: none;
  }
}
.carousel-item-next, .carousel-item-prev {
  position: absolute;
  top: 0;
}

.carousel-item-next.carousel-item-left, .carousel-item-prev.carousel-item-right {
  -webkit-transform: translateX(0);
  transform: translateX(0);
}

@supports (-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d) {
  .carousel-item-next.carousel-item-left, .carousel-item-prev.carousel-item-right {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}
.active.carousel-item-right, .carousel-item-next {
  -webkit-transform: translateX(100%);
  transform: translateX(100%);
}

@supports (-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d) {
  .active.carousel-item-right, .carousel-item-next {
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}
.active.carousel-item-left, .carousel-item-prev {
  -webkit-transform: translateX(-100%);
  transform: translateX(-100%);
}

@supports (-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d) {
  .active.carousel-item-left, .carousel-item-prev {
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}
.carousel-fade .carousel-item {
  opacity: 0;
  transition-duration: 0.6s;
  transition-property: opacity;
}

.carousel-fade .carousel-item-next.carousel-item-left, .carousel-fade .carousel-item-prev.carousel-item-right, .carousel-fade .carousel-item.active {
  opacity: 1;
}

.carousel-fade .active.carousel-item-left, .carousel-fade .active.carousel-item-right {
  opacity: 0;
}

.carousel-fade .active.carousel-item-left, .carousel-fade .active.carousel-item-prev, .carousel-fade .carousel-item-next, .carousel-fade .carousel-item-prev, .carousel-fade .carousel-item.active {
  -webkit-transform: translateX(0);
  transform: translateX(0);
}

@supports (-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d) {
  .carousel-fade .active.carousel-item-left, .carousel-fade .active.carousel-item-prev, .carousel-fade .carousel-item-next, .carousel-fade .carousel-item-prev, .carousel-fade .carousel-item.active {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}
.carousel-control-next, .carousel-control-prev {
  position: absolute;
  top: 0;
  bottom: 0;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-align: center;
  align-items: center;
  -ms-flex-pack: center;
  justify-content: center;
  width: 15%;
  color: #fff;
  text-align: center;
  opacity: 0.5;
}

.carousel-control-next:focus, .carousel-control-next:hover, .carousel-control-prev:focus, .carousel-control-prev:hover {
  color: #fff;
  text-decoration: none;
  outline: 0;
  opacity: 0.9;
}

.carousel-control-prev {
  left: 0;
}

.carousel-control-next {
  right: 0;
}

.carousel-control-next-icon, .carousel-control-prev-icon {
  display: inline-block;
  width: 20px;
  height: 20px;
  background: transparent no-repeat center center;
  background-size: 100% 100%;
}

.carousel-control-prev-icon {
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E");
}

.carousel-control-next-icon {
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E");
}

.carousel-indicators {
  position: absolute;
  right: 0;
  bottom: 10px;
  left: 0;
  z-index: 15;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-pack: center;
  justify-content: center;
  padding-left: 0;
  margin-right: 15%;
  margin-left: 15%;
  list-style: none;
}

.carousel-indicators li {
  position: relative;
  -ms-flex: 0 1 auto;
  flex: 0 1 auto;
  width: 30px;
  height: 3px;
  margin-right: 3px;
  margin-left: 3px;
  text-indent: -999px;
  cursor: pointer;
  background-color: rgba(255, 255, 255, 0.5);
}

.carousel-indicators li::before {
  position: absolute;
  top: -10px;
  left: 0;
  display: inline-block;
  width: 100%;
  height: 10px;
  content: "";
}

.carousel-indicators li::after {
  position: absolute;
  bottom: -10px;
  left: 0;
  display: inline-block;
  width: 100%;
  height: 10px;
  content: "";
}

.carousel-indicators .active {
  background-color: #fff;
}

.carousel-caption {
  position: absolute;
  right: 15%;
  bottom: 20px;
  left: 15%;
  z-index: 10;
  padding-top: 20px;
  padding-bottom: 20px;
  color: #fff;
  text-align: center;
}

.align-baseline {
  vertical-align: baseline !important;
}

.align-top {
  vertical-align: top !important;
}

.align-middle {
  vertical-align: middle !important;
}

.align-bottom {
  vertical-align: bottom !important;
}

.align-text-bottom {
  vertical-align: text-bottom !important;
}

.align-text-top {
  vertical-align: text-top !important;
}

.bg-primary {
  background-color: #007bff !important;
}

a.bg-primary:focus, a.bg-primary:hover, button.bg-primary:focus, button.bg-primary:hover {
  background-color: #0062cc !important;
}

.bg-secondary {
  background-color: #6c757d !important;
}

a.bg-secondary:focus, a.bg-secondary:hover, button.bg-secondary:focus, button.bg-secondary:hover {
  background-color: #545b62 !important;
}

.bg-success {
  background-color: #28a745 !important;
}

a.bg-success:focus, a.bg-success:hover, button.bg-success:focus, button.bg-success:hover {
  background-color: #1e7e34 !important;
}

.bg-info {
  background-color: #17a2b8 !important;
}

a.bg-info:focus, a.bg-info:hover, button.bg-info:focus, button.bg-info:hover {
  background-color: #117a8b !important;
}

.bg-warning {
  background-color: #ffc107 !important;
}

a.bg-warning:focus, a.bg-warning:hover, button.bg-warning:focus, button.bg-warning:hover {
  background-color: #d39e00 !important;
}

.bg-danger {
  background-color: #dc3545 !important;
}

a.bg-danger:focus, a.bg-danger:hover, button.bg-danger:focus, button.bg-danger:hover {
  background-color: #bd2130 !important;
}

.bg-light {
  background-color: #f8f9fa !important;
}

a.bg-light:focus, a.bg-light:hover, button.bg-light:focus, button.bg-light:hover {
  background-color: #dae0e5 !important;
}

.bg-dark {
  background-color: #343a40 !important;
}

a.bg-dark:focus, a.bg-dark:hover, button.bg-dark:focus, button.bg-dark:hover {
  background-color: #1d2124 !important;
}

.bg-white {
  background-color: #fff !important;
}

.bg-transparent {
  background-color: transparent !important;
}

.border {
  border: 1px solid #dee2e6 !important;
}

.border-top {
  border-top: 1px solid #dee2e6 !important;
}

.border-right {
  border-right: 1px solid #dee2e6 !important;
}

.border-bottom {
  border-bottom: 1px solid #dee2e6 !important;
}

.border-left {
  border-left: 1px solid #dee2e6 !important;
}

.border-0 {
  border: 0 !important;
}

.border-top-0 {
  border-top: 0 !important;
}

.border-right-0 {
  border-right: 0 !important;
}

.border-bottom-0 {
  border-bottom: 0 !important;
}

.border-left-0 {
  border-left: 0 !important;
}

.border-primary {
  border-color: #007bff !important;
}

.border-secondary {
  border-color: #6c757d !important;
}

.border-success {
  border-color: #28a745 !important;
}

.border-info {
  border-color: #17a2b8 !important;
}

.border-warning {
  border-color: #ffc107 !important;
}

.border-danger {
  border-color: #dc3545 !important;
}

.border-light {
  border-color: #f8f9fa !important;
}

.border-dark {
  border-color: #343a40 !important;
}

.border-white {
  border-color: #fff !important;
}

.rounded {
  border-radius: 0.25rem !important;
}

.rounded-top {
  border-top-left-radius: 0.25rem !important;
  border-top-right-radius: 0.25rem !important;
}

.rounded-right {
  border-top-right-radius: 0.25rem !important;
  border-bottom-right-radius: 0.25rem !important;
}

.rounded-bottom {
  border-bottom-right-radius: 0.25rem !important;
  border-bottom-left-radius: 0.25rem !important;
}

.rounded-left {
  border-top-left-radius: 0.25rem !important;
  border-bottom-left-radius: 0.25rem !important;
}

.rounded-circle {
  border-radius: 50% !important;
}

.rounded-0 {
  border-radius: 0 !important;
}

.clearfix::after {
  display: block;
  clear: both;
  content: "";
}

.d-none {
  display: none !important;
}

.d-inline {
  display: inline !important;
}

.d-inline-block {
  display: inline-block !important;
}

.d-block {
  display: block !important;
}

.d-table {
  display: table !important;
}

.d-table-row {
  display: table-row !important;
}

.d-table-cell {
  display: table-cell !important;
}

.d-flex {
  display: -ms-flexbox !important;
  display: flex !important;
}

.d-inline-flex {
  display: -ms-inline-flexbox !important;
  display: inline-flex !important;
}

@media (min-width: 576px) {
  .d-sm-none {
    display: none !important;
  }

  .d-sm-inline {
    display: inline !important;
  }

  .d-sm-inline-block {
    display: inline-block !important;
  }

  .d-sm-block {
    display: block !important;
  }

  .d-sm-table {
    display: table !important;
  }

  .d-sm-table-row {
    display: table-row !important;
  }

  .d-sm-table-cell {
    display: table-cell !important;
  }

  .d-sm-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-sm-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 768px) {
  .d-md-none {
    display: none !important;
  }

  .d-md-inline {
    display: inline !important;
  }

  .d-md-inline-block {
    display: inline-block !important;
  }

  .d-md-block {
    display: block !important;
  }

  .d-md-table {
    display: table !important;
  }

  .d-md-table-row {
    display: table-row !important;
  }

  .d-md-table-cell {
    display: table-cell !important;
  }

  .d-md-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-md-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 992px) {
  .d-lg-none {
    display: none !important;
  }

  .d-lg-inline {
    display: inline !important;
  }

  .d-lg-inline-block {
    display: inline-block !important;
  }

  .d-lg-block {
    display: block !important;
  }

  .d-lg-table {
    display: table !important;
  }

  .d-lg-table-row {
    display: table-row !important;
  }

  .d-lg-table-cell {
    display: table-cell !important;
  }

  .d-lg-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-lg-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 1200px) {
  .d-xl-none {
    display: none !important;
  }

  .d-xl-inline {
    display: inline !important;
  }

  .d-xl-inline-block {
    display: inline-block !important;
  }

  .d-xl-block {
    display: block !important;
  }

  .d-xl-table {
    display: table !important;
  }

  .d-xl-table-row {
    display: table-row !important;
  }

  .d-xl-table-cell {
    display: table-cell !important;
  }

  .d-xl-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-xl-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media print {
  .d-print-none {
    display: none !important;
  }

  .d-print-inline {
    display: inline !important;
  }

  .d-print-inline-block {
    display: inline-block !important;
  }

  .d-print-block {
    display: block !important;
  }

  .d-print-table {
    display: table !important;
  }

  .d-print-table-row {
    display: table-row !important;
  }

  .d-print-table-cell {
    display: table-cell !important;
  }

  .d-print-flex {
    display: -ms-flexbox !important;
    display: flex !important;
  }

  .d-print-inline-flex {
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
.embed-responsive {
  position: relative;
  display: block;
  width: 100%;
  padding: 0;
  overflow: hidden;
}

.embed-responsive::before {
  display: block;
  content: "";
}

.embed-responsive .embed-responsive-item, .embed-responsive embed, .embed-responsive iframe, .embed-responsive object, .embed-responsive video {
  position: absolute;
  top: 0;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  border: 0;
}

.embed-responsive-21by9::before {
  padding-top: 42.857143%;
}

.embed-responsive-16by9::before {
  padding-top: 56.25%;
}

.embed-responsive-4by3::before {
  padding-top: 75%;
}

.embed-responsive-1by1::before {
  padding-top: 100%;
}

.flex-row {
  -ms-flex-direction: row !important;
  flex-direction: row !important;
}

.flex-column {
  -ms-flex-direction: column !important;
  flex-direction: column !important;
}

.flex-row-reverse {
  -ms-flex-direction: row-reverse !important;
  flex-direction: row-reverse !important;
}

.flex-column-reverse {
  -ms-flex-direction: column-reverse !important;
  flex-direction: column-reverse !important;
}

.flex-wrap {
  -ms-flex-wrap: wrap !important;
  flex-wrap: wrap !important;
}

.flex-nowrap {
  -ms-flex-wrap: nowrap !important;
  flex-wrap: nowrap !important;
}

.flex-wrap-reverse {
  -ms-flex-wrap: wrap-reverse !important;
  flex-wrap: wrap-reverse !important;
}

.flex-fill {
  -ms-flex: 1 1 auto !important;
  flex: 1 1 auto !important;
}

.flex-grow-0 {
  -ms-flex-positive: 0 !important;
  flex-grow: 0 !important;
}

.flex-grow-1 {
  -ms-flex-positive: 1 !important;
  flex-grow: 1 !important;
}

.flex-shrink-0 {
  -ms-flex-negative: 0 !important;
  flex-shrink: 0 !important;
}

.flex-shrink-1 {
  -ms-flex-negative: 1 !important;
  flex-shrink: 1 !important;
}

.justify-content-start {
  -ms-flex-pack: start !important;
  justify-content: flex-start !important;
}

.justify-content-end {
  -ms-flex-pack: end !important;
  justify-content: flex-end !important;
}

.justify-content-center {
  -ms-flex-pack: center !important;
  justify-content: center !important;
}

.justify-content-between {
  -ms-flex-pack: justify !important;
  justify-content: space-between !important;
}

.justify-content-around {
  -ms-flex-pack: distribute !important;
  justify-content: space-around !important;
}

.align-items-start {
  -ms-flex-align: start !important;
  align-items: flex-start !important;
}

.align-items-end {
  -ms-flex-align: end !important;
  align-items: flex-end !important;
}

.align-items-center {
  -ms-flex-align: center !important;
  align-items: center !important;
}

.align-items-baseline {
  -ms-flex-align: baseline !important;
  align-items: baseline !important;
}

.align-items-stretch {
  -ms-flex-align: stretch !important;
  align-items: stretch !important;
}

.align-content-start {
  -ms-flex-line-pack: start !important;
  align-content: flex-start !important;
}

.align-content-end {
  -ms-flex-line-pack: end !important;
  align-content: flex-end !important;
}

.align-content-center {
  -ms-flex-line-pack: center !important;
  align-content: center !important;
}

.align-content-between {
  -ms-flex-line-pack: justify !important;
  align-content: space-between !important;
}

.align-content-around {
  -ms-flex-line-pack: distribute !important;
  align-content: space-around !important;
}

.align-content-stretch {
  -ms-flex-line-pack: stretch !important;
  align-content: stretch !important;
}

.align-self-auto {
  -ms-flex-item-align: auto !important;
  align-self: auto !important;
}

.align-self-start {
  -ms-flex-item-align: start !important;
  align-self: flex-start !important;
}

.align-self-end {
  -ms-flex-item-align: end !important;
  align-self: flex-end !important;
}

.align-self-center {
  -ms-flex-item-align: center !important;
  align-self: center !important;
}

.align-self-baseline {
  -ms-flex-item-align: baseline !important;
  align-self: baseline !important;
}

.align-self-stretch {
  -ms-flex-item-align: stretch !important;
  align-self: stretch !important;
}

@media (min-width: 576px) {
  .flex-sm-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-sm-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-sm-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-sm-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-sm-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-sm-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-sm-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-sm-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-sm-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-sm-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-sm-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-sm-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-sm-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-sm-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-sm-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-sm-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-sm-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-sm-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-sm-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-sm-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-sm-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-sm-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-sm-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-sm-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-sm-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-sm-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-sm-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-sm-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-sm-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-sm-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-sm-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-sm-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-sm-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-sm-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
@media (min-width: 768px) {
  .flex-md-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-md-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-md-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-md-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-md-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-md-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-md-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-md-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-md-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-md-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-md-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-md-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-md-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-md-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-md-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-md-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-md-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-md-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-md-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-md-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-md-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-md-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-md-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-md-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-md-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-md-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-md-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-md-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-md-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-md-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-md-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-md-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-md-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-md-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
@media (min-width: 992px) {
  .flex-lg-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-lg-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-lg-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-lg-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-lg-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-lg-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-lg-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-lg-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-lg-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-lg-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-lg-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-lg-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-lg-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-lg-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-lg-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-lg-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-lg-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-lg-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-lg-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-lg-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-lg-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-lg-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-lg-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-lg-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-lg-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-lg-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-lg-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-lg-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-lg-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-lg-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-lg-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-lg-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-lg-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-lg-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
@media (min-width: 1200px) {
  .flex-xl-row {
    -ms-flex-direction: row !important;
    flex-direction: row !important;
  }

  .flex-xl-column {
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }

  .flex-xl-row-reverse {
    -ms-flex-direction: row-reverse !important;
    flex-direction: row-reverse !important;
  }

  .flex-xl-column-reverse {
    -ms-flex-direction: column-reverse !important;
    flex-direction: column-reverse !important;
  }

  .flex-xl-wrap {
    -ms-flex-wrap: wrap !important;
    flex-wrap: wrap !important;
  }

  .flex-xl-nowrap {
    -ms-flex-wrap: nowrap !important;
    flex-wrap: nowrap !important;
  }

  .flex-xl-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
    flex-wrap: wrap-reverse !important;
  }

  .flex-xl-fill {
    -ms-flex: 1 1 auto !important;
    flex: 1 1 auto !important;
  }

  .flex-xl-grow-0 {
    -ms-flex-positive: 0 !important;
    flex-grow: 0 !important;
  }

  .flex-xl-grow-1 {
    -ms-flex-positive: 1 !important;
    flex-grow: 1 !important;
  }

  .flex-xl-shrink-0 {
    -ms-flex-negative: 0 !important;
    flex-shrink: 0 !important;
  }

  .flex-xl-shrink-1 {
    -ms-flex-negative: 1 !important;
    flex-shrink: 1 !important;
  }

  .justify-content-xl-start {
    -ms-flex-pack: start !important;
    justify-content: flex-start !important;
  }

  .justify-content-xl-end {
    -ms-flex-pack: end !important;
    justify-content: flex-end !important;
  }

  .justify-content-xl-center {
    -ms-flex-pack: center !important;
    justify-content: center !important;
  }

  .justify-content-xl-between {
    -ms-flex-pack: justify !important;
    justify-content: space-between !important;
  }

  .justify-content-xl-around {
    -ms-flex-pack: distribute !important;
    justify-content: space-around !important;
  }

  .align-items-xl-start {
    -ms-flex-align: start !important;
    align-items: flex-start !important;
  }

  .align-items-xl-end {
    -ms-flex-align: end !important;
    align-items: flex-end !important;
  }

  .align-items-xl-center {
    -ms-flex-align: center !important;
    align-items: center !important;
  }

  .align-items-xl-baseline {
    -ms-flex-align: baseline !important;
    align-items: baseline !important;
  }

  .align-items-xl-stretch {
    -ms-flex-align: stretch !important;
    align-items: stretch !important;
  }

  .align-content-xl-start {
    -ms-flex-line-pack: start !important;
    align-content: flex-start !important;
  }

  .align-content-xl-end {
    -ms-flex-line-pack: end !important;
    align-content: flex-end !important;
  }

  .align-content-xl-center {
    -ms-flex-line-pack: center !important;
    align-content: center !important;
  }

  .align-content-xl-between {
    -ms-flex-line-pack: justify !important;
    align-content: space-between !important;
  }

  .align-content-xl-around {
    -ms-flex-line-pack: distribute !important;
    align-content: space-around !important;
  }

  .align-content-xl-stretch {
    -ms-flex-line-pack: stretch !important;
    align-content: stretch !important;
  }

  .align-self-xl-auto {
    -ms-flex-item-align: auto !important;
    align-self: auto !important;
  }

  .align-self-xl-start {
    -ms-flex-item-align: start !important;
    align-self: flex-start !important;
  }

  .align-self-xl-end {
    -ms-flex-item-align: end !important;
    align-self: flex-end !important;
  }

  .align-self-xl-center {
    -ms-flex-item-align: center !important;
    align-self: center !important;
  }

  .align-self-xl-baseline {
    -ms-flex-item-align: baseline !important;
    align-self: baseline !important;
  }

  .align-self-xl-stretch {
    -ms-flex-item-align: stretch !important;
    align-self: stretch !important;
  }
}
.float-left {
  float: left !important;
}

.float-right {
  float: right !important;
}

.float-none {
  float: none !important;
}

@media (min-width: 576px) {
  .float-sm-left {
    float: left !important;
  }

  .float-sm-right {
    float: right !important;
  }

  .float-sm-none {
    float: none !important;
  }
}
@media (min-width: 768px) {
  .float-md-left {
    float: left !important;
  }

  .float-md-right {
    float: right !important;
  }

  .float-md-none {
    float: none !important;
  }
}
@media (min-width: 992px) {
  .float-lg-left {
    float: left !important;
  }

  .float-lg-right {
    float: right !important;
  }

  .float-lg-none {
    float: none !important;
  }
}
@media (min-width: 1200px) {
  .float-xl-left {
    float: left !important;
  }

  .float-xl-right {
    float: right !important;
  }

  .float-xl-none {
    float: none !important;
  }
}
.position-static {
  position: static !important;
}

.position-relative {
  position: relative !important;
}

.position-absolute {
  position: absolute !important;
}

.position-fixed {
  position: fixed !important;
}

.position-sticky {
  position: -webkit-sticky !important;
  position: sticky !important;
}

.fixed-top {
  position: fixed;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1030;
}

.fixed-bottom {
  position: fixed;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1030;
}

@supports (position: -webkit-sticky) or (position: sticky) {
  .sticky-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020;
  }
}
.sr-only {
  position: absolute;
  width: 1px;
  height: 1px;
  padding: 0;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  white-space: nowrap;
  border: 0;
}

.sr-only-focusable:active, .sr-only-focusable:focus {
  position: static;
  width: auto;
  height: auto;
  overflow: visible;
  clip: auto;
  white-space: normal;
}

.shadow-sm {
  box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important;
}

.shadow, .cont-login .cuerpo {
  box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important;
}

.shadow-lg {
  box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important;
}

.shadow-none {
  box-shadow: none !important;
}

.w-25 {
  width: 25% !important;
}

.w-50 {
  width: 50% !important;
}

.w-75 {
  width: 75% !important;
}

.w-100 {
  width: 100% !important;
}

.w-auto {
  width: auto !important;
}

.h-25 {
  height: 25% !important;
}

.h-50 {
  height: 50% !important;
}

.h-75 {
  height: 75% !important;
}

.h-100 {
  height: 100% !important;
}

.h-auto {
  height: auto !important;
}

.mw-100 {
  max-width: 100% !important;
}

.mh-100 {
  max-height: 100% !important;
}

.m-0 {
  margin: 0 !important;
}

.mt-0, .my-0 {
  margin-top: 0 !important;
}

.mr-0, .mx-0 {
  margin-right: 0 !important;
}

.mb-0, .my-0 {
  margin-bottom: 0 !important;
}

.ml-0, .mx-0 {
  margin-left: 0 !important;
}

.m-1 {
  margin: 0.25rem !important;
}

.mt-1, .my-1 {
  margin-top: 0.25rem !important;
}

.mr-1, .mx-1 {
  margin-right: 0.25rem !important;
}

.mb-1, .my-1 {
  margin-bottom: 0.25rem !important;
}

.ml-1, .mx-1 {
  margin-left: 0.25rem !important;
}

.m-2 {
  margin: 0.5rem !important;
}

.mt-2, .my-2 {
  margin-top: 0.5rem !important;
}

.mr-2, .mx-2 {
  margin-right: 0.5rem !important;
}

.mb-2, .my-2 {
  margin-bottom: 0.5rem !important;
}

.ml-2, .mx-2 {
  margin-left: 0.5rem !important;
}

.m-3 {
  margin: 1rem !important;
}

.mt-3, .my-3 {
  margin-top: 1rem !important;
}

.mr-3, .mx-3 {
  margin-right: 1rem !important;
}

.mb-3, .my-3 {
  margin-bottom: 1rem !important;
}

.ml-3, .mx-3 {
  margin-left: 1rem !important;
}

.m-4 {
  margin: 1.5rem !important;
}

.mt-4, .my-4 {
  margin-top: 1.5rem !important;
}

.mr-4, .mx-4 {
  margin-right: 1.5rem !important;
}

.mb-4, .my-4 {
  margin-bottom: 1.5rem !important;
}

.ml-4, .mx-4 {
  margin-left: 1.5rem !important;
}

.m-5 {
  margin: 3rem !important;
}

.mt-5, .my-5 {
  margin-top: 3rem !important;
}

.mr-5, .mx-5 {
  margin-right: 3rem !important;
}

.mb-5, .my-5 {
  margin-bottom: 3rem !important;
}

.ml-5, .mx-5 {
  margin-left: 3rem !important;
}

.p-0 {
  padding: 0 !important;
}

.pt-0, .py-0 {
  padding-top: 0 !important;
}

.pr-0, .px-0 {
  padding-right: 0 !important;
}

.pb-0, .py-0 {
  padding-bottom: 0 !important;
}

.pl-0, .px-0 {
  padding-left: 0 !important;
}

.p-1 {
  padding: 0.25rem !important;
}

.pt-1, .py-1 {
  padding-top: 0.25rem !important;
}

.pr-1, .px-1 {
  padding-right: 0.25rem !important;
}

.pb-1, .py-1 {
  padding-bottom: 0.25rem !important;
}

.pl-1, .px-1 {
  padding-left: 0.25rem !important;
}

.p-2 {
  padding: 0.5rem !important;
}

.pt-2, .py-2 {
  padding-top: 0.5rem !important;
}

.pr-2, .px-2 {
  padding-right: 0.5rem !important;
}

.pb-2, .py-2 {
  padding-bottom: 0.5rem !important;
}

.pl-2, .px-2 {
  padding-left: 0.5rem !important;
}

.p-3 {
  padding: 1rem !important;
}

.pt-3, .py-3 {
  padding-top: 1rem !important;
}

.pr-3, .px-3 {
  padding-right: 1rem !important;
}

.pb-3, .py-3 {
  padding-bottom: 1rem !important;
}

.pl-3, .px-3 {
  padding-left: 1rem !important;
}

.p-4 {
  padding: 1.5rem !important;
}

.pt-4, .py-4 {
  padding-top: 1.5rem !important;
}

.pr-4, .px-4 {
  padding-right: 1.5rem !important;
}

.pb-4, .py-4 {
  padding-bottom: 1.5rem !important;
}

.pl-4, .px-4 {
  padding-left: 1.5rem !important;
}

.p-5 {
  padding: 3rem !important;
}

.pt-5, .py-5 {
  padding-top: 3rem !important;
}

.pr-5, .px-5 {
  padding-right: 3rem !important;
}

.pb-5, .py-5 {
  padding-bottom: 3rem !important;
}

.pl-5, .px-5 {
  padding-left: 3rem !important;
}

.m-auto {
  margin: auto !important;
}

.mt-auto, .my-auto {
  margin-top: auto !important;
}

.mr-auto, .mx-auto {
  margin-right: auto !important;
}

.mb-auto, .my-auto {
  margin-bottom: auto !important;
}

.ml-auto, .mx-auto {
  margin-left: auto !important;
}

@media (min-width: 576px) {
  .m-sm-0 {
    margin: 0 !important;
  }

  .mt-sm-0, .my-sm-0 {
    margin-top: 0 !important;
  }

  .mr-sm-0, .mx-sm-0 {
    margin-right: 0 !important;
  }

  .mb-sm-0, .my-sm-0 {
    margin-bottom: 0 !important;
  }

  .ml-sm-0, .mx-sm-0 {
    margin-left: 0 !important;
  }

  .m-sm-1 {
    margin: 0.25rem !important;
  }

  .mt-sm-1, .my-sm-1 {
    margin-top: 0.25rem !important;
  }

  .mr-sm-1, .mx-sm-1 {
    margin-right: 0.25rem !important;
  }

  .mb-sm-1, .my-sm-1 {
    margin-bottom: 0.25rem !important;
  }

  .ml-sm-1, .mx-sm-1 {
    margin-left: 0.25rem !important;
  }

  .m-sm-2 {
    margin: 0.5rem !important;
  }

  .mt-sm-2, .my-sm-2 {
    margin-top: 0.5rem !important;
  }

  .mr-sm-2, .mx-sm-2 {
    margin-right: 0.5rem !important;
  }

  .mb-sm-2, .my-sm-2 {
    margin-bottom: 0.5rem !important;
  }

  .ml-sm-2, .mx-sm-2 {
    margin-left: 0.5rem !important;
  }

  .m-sm-3 {
    margin: 1rem !important;
  }

  .mt-sm-3, .my-sm-3 {
    margin-top: 1rem !important;
  }

  .mr-sm-3, .mx-sm-3 {
    margin-right: 1rem !important;
  }

  .mb-sm-3, .my-sm-3 {
    margin-bottom: 1rem !important;
  }

  .ml-sm-3, .mx-sm-3 {
    margin-left: 1rem !important;
  }

  .m-sm-4 {
    margin: 1.5rem !important;
  }

  .mt-sm-4, .my-sm-4 {
    margin-top: 1.5rem !important;
  }

  .mr-sm-4, .mx-sm-4 {
    margin-right: 1.5rem !important;
  }

  .mb-sm-4, .my-sm-4 {
    margin-bottom: 1.5rem !important;
  }

  .ml-sm-4, .mx-sm-4 {
    margin-left: 1.5rem !important;
  }

  .m-sm-5 {
    margin: 3rem !important;
  }

  .mt-sm-5, .my-sm-5 {
    margin-top: 3rem !important;
  }

  .mr-sm-5, .mx-sm-5 {
    margin-right: 3rem !important;
  }

  .mb-sm-5, .my-sm-5 {
    margin-bottom: 3rem !important;
  }

  .ml-sm-5, .mx-sm-5 {
    margin-left: 3rem !important;
  }

  .p-sm-0 {
    padding: 0 !important;
  }

  .pt-sm-0, .py-sm-0 {
    padding-top: 0 !important;
  }

  .pr-sm-0, .px-sm-0 {
    padding-right: 0 !important;
  }

  .pb-sm-0, .py-sm-0 {
    padding-bottom: 0 !important;
  }

  .pl-sm-0, .px-sm-0 {
    padding-left: 0 !important;
  }

  .p-sm-1 {
    padding: 0.25rem !important;
  }

  .pt-sm-1, .py-sm-1 {
    padding-top: 0.25rem !important;
  }

  .pr-sm-1, .px-sm-1 {
    padding-right: 0.25rem !important;
  }

  .pb-sm-1, .py-sm-1 {
    padding-bottom: 0.25rem !important;
  }

  .pl-sm-1, .px-sm-1 {
    padding-left: 0.25rem !important;
  }

  .p-sm-2 {
    padding: 0.5rem !important;
  }

  .pt-sm-2, .py-sm-2 {
    padding-top: 0.5rem !important;
  }

  .pr-sm-2, .px-sm-2 {
    padding-right: 0.5rem !important;
  }

  .pb-sm-2, .py-sm-2 {
    padding-bottom: 0.5rem !important;
  }

  .pl-sm-2, .px-sm-2 {
    padding-left: 0.5rem !important;
  }

  .p-sm-3 {
    padding: 1rem !important;
  }

  .pt-sm-3, .py-sm-3 {
    padding-top: 1rem !important;
  }

  .pr-sm-3, .px-sm-3 {
    padding-right: 1rem !important;
  }

  .pb-sm-3, .py-sm-3 {
    padding-bottom: 1rem !important;
  }

  .pl-sm-3, .px-sm-3 {
    padding-left: 1rem !important;
  }

  .p-sm-4 {
    padding: 1.5rem !important;
  }

  .pt-sm-4, .py-sm-4 {
    padding-top: 1.5rem !important;
  }

  .pr-sm-4, .px-sm-4 {
    padding-right: 1.5rem !important;
  }

  .pb-sm-4, .py-sm-4 {
    padding-bottom: 1.5rem !important;
  }

  .pl-sm-4, .px-sm-4 {
    padding-left: 1.5rem !important;
  }

  .p-sm-5 {
    padding: 3rem !important;
  }

  .pt-sm-5, .py-sm-5 {
    padding-top: 3rem !important;
  }

  .pr-sm-5, .px-sm-5 {
    padding-right: 3rem !important;
  }

  .pb-sm-5, .py-sm-5 {
    padding-bottom: 3rem !important;
  }

  .pl-sm-5, .px-sm-5 {
    padding-left: 3rem !important;
  }

  .m-sm-auto {
    margin: auto !important;
  }

  .mt-sm-auto, .my-sm-auto {
    margin-top: auto !important;
  }

  .mr-sm-auto, .mx-sm-auto {
    margin-right: auto !important;
  }

  .mb-sm-auto, .my-sm-auto {
    margin-bottom: auto !important;
  }

  .ml-sm-auto, .mx-sm-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 768px) {
  .m-md-0 {
    margin: 0 !important;
  }

  .mt-md-0, .my-md-0 {
    margin-top: 0 !important;
  }

  .mr-md-0, .mx-md-0 {
    margin-right: 0 !important;
  }

  .mb-md-0, .my-md-0 {
    margin-bottom: 0 !important;
  }

  .ml-md-0, .mx-md-0 {
    margin-left: 0 !important;
  }

  .m-md-1 {
    margin: 0.25rem !important;
  }

  .mt-md-1, .my-md-1 {
    margin-top: 0.25rem !important;
  }

  .mr-md-1, .mx-md-1 {
    margin-right: 0.25rem !important;
  }

  .mb-md-1, .my-md-1 {
    margin-bottom: 0.25rem !important;
  }

  .ml-md-1, .mx-md-1 {
    margin-left: 0.25rem !important;
  }

  .m-md-2 {
    margin: 0.5rem !important;
  }

  .mt-md-2, .my-md-2 {
    margin-top: 0.5rem !important;
  }

  .mr-md-2, .mx-md-2 {
    margin-right: 0.5rem !important;
  }

  .mb-md-2, .my-md-2 {
    margin-bottom: 0.5rem !important;
  }

  .ml-md-2, .mx-md-2 {
    margin-left: 0.5rem !important;
  }

  .m-md-3 {
    margin: 1rem !important;
  }

  .mt-md-3, .my-md-3 {
    margin-top: 1rem !important;
  }

  .mr-md-3, .mx-md-3 {
    margin-right: 1rem !important;
  }

  .mb-md-3, .my-md-3 {
    margin-bottom: 1rem !important;
  }

  .ml-md-3, .mx-md-3 {
    margin-left: 1rem !important;
  }

  .m-md-4 {
    margin: 1.5rem !important;
  }

  .mt-md-4, .my-md-4 {
    margin-top: 1.5rem !important;
  }

  .mr-md-4, .mx-md-4 {
    margin-right: 1.5rem !important;
  }

  .mb-md-4, .my-md-4 {
    margin-bottom: 1.5rem !important;
  }

  .ml-md-4, .mx-md-4 {
    margin-left: 1.5rem !important;
  }

  .m-md-5 {
    margin: 3rem !important;
  }

  .mt-md-5, .my-md-5 {
    margin-top: 3rem !important;
  }

  .mr-md-5, .mx-md-5 {
    margin-right: 3rem !important;
  }

  .mb-md-5, .my-md-5 {
    margin-bottom: 3rem !important;
  }

  .ml-md-5, .mx-md-5 {
    margin-left: 3rem !important;
  }

  .p-md-0 {
    padding: 0 !important;
  }

  .pt-md-0, .py-md-0 {
    padding-top: 0 !important;
  }

  .pr-md-0, .px-md-0 {
    padding-right: 0 !important;
  }

  .pb-md-0, .py-md-0 {
    padding-bottom: 0 !important;
  }

  .pl-md-0, .px-md-0 {
    padding-left: 0 !important;
  }

  .p-md-1 {
    padding: 0.25rem !important;
  }

  .pt-md-1, .py-md-1 {
    padding-top: 0.25rem !important;
  }

  .pr-md-1, .px-md-1 {
    padding-right: 0.25rem !important;
  }

  .pb-md-1, .py-md-1 {
    padding-bottom: 0.25rem !important;
  }

  .pl-md-1, .px-md-1 {
    padding-left: 0.25rem !important;
  }

  .p-md-2 {
    padding: 0.5rem !important;
  }

  .pt-md-2, .py-md-2 {
    padding-top: 0.5rem !important;
  }

  .pr-md-2, .px-md-2 {
    padding-right: 0.5rem !important;
  }

  .pb-md-2, .py-md-2 {
    padding-bottom: 0.5rem !important;
  }

  .pl-md-2, .px-md-2 {
    padding-left: 0.5rem !important;
  }

  .p-md-3 {
    padding: 1rem !important;
  }

  .pt-md-3, .py-md-3 {
    padding-top: 1rem !important;
  }

  .pr-md-3, .px-md-3 {
    padding-right: 1rem !important;
  }

  .pb-md-3, .py-md-3 {
    padding-bottom: 1rem !important;
  }

  .pl-md-3, .px-md-3 {
    padding-left: 1rem !important;
  }

  .p-md-4 {
    padding: 1.5rem !important;
  }

  .pt-md-4, .py-md-4 {
    padding-top: 1.5rem !important;
  }

  .pr-md-4, .px-md-4 {
    padding-right: 1.5rem !important;
  }

  .pb-md-4, .py-md-4 {
    padding-bottom: 1.5rem !important;
  }

  .pl-md-4, .px-md-4 {
    padding-left: 1.5rem !important;
  }

  .p-md-5 {
    padding: 3rem !important;
  }

  .pt-md-5, .py-md-5 {
    padding-top: 3rem !important;
  }

  .pr-md-5, .px-md-5 {
    padding-right: 3rem !important;
  }

  .pb-md-5, .py-md-5 {
    padding-bottom: 3rem !important;
  }

  .pl-md-5, .px-md-5 {
    padding-left: 3rem !important;
  }

  .m-md-auto {
    margin: auto !important;
  }

  .mt-md-auto, .my-md-auto {
    margin-top: auto !important;
  }

  .mr-md-auto, .mx-md-auto {
    margin-right: auto !important;
  }

  .mb-md-auto, .my-md-auto {
    margin-bottom: auto !important;
  }

  .ml-md-auto, .mx-md-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 992px) {
  .m-lg-0 {
    margin: 0 !important;
  }

  .mt-lg-0, .my-lg-0 {
    margin-top: 0 !important;
  }

  .mr-lg-0, .mx-lg-0 {
    margin-right: 0 !important;
  }

  .mb-lg-0, .my-lg-0 {
    margin-bottom: 0 !important;
  }

  .ml-lg-0, .mx-lg-0 {
    margin-left: 0 !important;
  }

  .m-lg-1 {
    margin: 0.25rem !important;
  }

  .mt-lg-1, .my-lg-1 {
    margin-top: 0.25rem !important;
  }

  .mr-lg-1, .mx-lg-1 {
    margin-right: 0.25rem !important;
  }

  .mb-lg-1, .my-lg-1 {
    margin-bottom: 0.25rem !important;
  }

  .ml-lg-1, .mx-lg-1 {
    margin-left: 0.25rem !important;
  }

  .m-lg-2 {
    margin: 0.5rem !important;
  }

  .mt-lg-2, .my-lg-2 {
    margin-top: 0.5rem !important;
  }

  .mr-lg-2, .mx-lg-2 {
    margin-right: 0.5rem !important;
  }

  .mb-lg-2, .my-lg-2 {
    margin-bottom: 0.5rem !important;
  }

  .ml-lg-2, .mx-lg-2 {
    margin-left: 0.5rem !important;
  }

  .m-lg-3 {
    margin: 1rem !important;
  }

  .mt-lg-3, .my-lg-3 {
    margin-top: 1rem !important;
  }

  .mr-lg-3, .mx-lg-3 {
    margin-right: 1rem !important;
  }

  .mb-lg-3, .my-lg-3 {
    margin-bottom: 1rem !important;
  }

  .ml-lg-3, .mx-lg-3 {
    margin-left: 1rem !important;
  }

  .m-lg-4 {
    margin: 1.5rem !important;
  }

  .mt-lg-4, .my-lg-4 {
    margin-top: 1.5rem !important;
  }

  .mr-lg-4, .mx-lg-4 {
    margin-right: 1.5rem !important;
  }

  .mb-lg-4, .my-lg-4 {
    margin-bottom: 1.5rem !important;
  }

  .ml-lg-4, .mx-lg-4 {
    margin-left: 1.5rem !important;
  }

  .m-lg-5 {
    margin: 3rem !important;
  }

  .mt-lg-5, .my-lg-5 {
    margin-top: 3rem !important;
  }

  .mr-lg-5, .mx-lg-5 {
    margin-right: 3rem !important;
  }

  .mb-lg-5, .my-lg-5 {
    margin-bottom: 3rem !important;
  }

  .ml-lg-5, .mx-lg-5 {
    margin-left: 3rem !important;
  }

  .p-lg-0 {
    padding: 0 !important;
  }

  .pt-lg-0, .py-lg-0 {
    padding-top: 0 !important;
  }

  .pr-lg-0, .px-lg-0 {
    padding-right: 0 !important;
  }

  .pb-lg-0, .py-lg-0 {
    padding-bottom: 0 !important;
  }

  .pl-lg-0, .px-lg-0 {
    padding-left: 0 !important;
  }

  .p-lg-1 {
    padding: 0.25rem !important;
  }

  .pt-lg-1, .py-lg-1 {
    padding-top: 0.25rem !important;
  }

  .pr-lg-1, .px-lg-1 {
    padding-right: 0.25rem !important;
  }

  .pb-lg-1, .py-lg-1 {
    padding-bottom: 0.25rem !important;
  }

  .pl-lg-1, .px-lg-1 {
    padding-left: 0.25rem !important;
  }

  .p-lg-2 {
    padding: 0.5rem !important;
  }

  .pt-lg-2, .py-lg-2 {
    padding-top: 0.5rem !important;
  }

  .pr-lg-2, .px-lg-2 {
    padding-right: 0.5rem !important;
  }

  .pb-lg-2, .py-lg-2 {
    padding-bottom: 0.5rem !important;
  }

  .pl-lg-2, .px-lg-2 {
    padding-left: 0.5rem !important;
  }

  .p-lg-3 {
    padding: 1rem !important;
  }

  .pt-lg-3, .py-lg-3 {
    padding-top: 1rem !important;
  }

  .pr-lg-3, .px-lg-3 {
    padding-right: 1rem !important;
  }

  .pb-lg-3, .py-lg-3 {
    padding-bottom: 1rem !important;
  }

  .pl-lg-3, .px-lg-3 {
    padding-left: 1rem !important;
  }

  .p-lg-4 {
    padding: 1.5rem !important;
  }

  .pt-lg-4, .py-lg-4 {
    padding-top: 1.5rem !important;
  }

  .pr-lg-4, .px-lg-4 {
    padding-right: 1.5rem !important;
  }

  .pb-lg-4, .py-lg-4 {
    padding-bottom: 1.5rem !important;
  }

  .pl-lg-4, .px-lg-4 {
    padding-left: 1.5rem !important;
  }

  .p-lg-5 {
    padding: 3rem !important;
  }

  .pt-lg-5, .py-lg-5 {
    padding-top: 3rem !important;
  }

  .pr-lg-5, .px-lg-5 {
    padding-right: 3rem !important;
  }

  .pb-lg-5, .py-lg-5 {
    padding-bottom: 3rem !important;
  }

  .pl-lg-5, .px-lg-5 {
    padding-left: 3rem !important;
  }

  .m-lg-auto {
    margin: auto !important;
  }

  .mt-lg-auto, .my-lg-auto {
    margin-top: auto !important;
  }

  .mr-lg-auto, .mx-lg-auto {
    margin-right: auto !important;
  }

  .mb-lg-auto, .my-lg-auto {
    margin-bottom: auto !important;
  }

  .ml-lg-auto, .mx-lg-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 1200px) {
  .m-xl-0 {
    margin: 0 !important;
  }

  .mt-xl-0, .my-xl-0 {
    margin-top: 0 !important;
  }

  .mr-xl-0, .mx-xl-0 {
    margin-right: 0 !important;
  }

  .mb-xl-0, .my-xl-0 {
    margin-bottom: 0 !important;
  }

  .ml-xl-0, .mx-xl-0 {
    margin-left: 0 !important;
  }

  .m-xl-1 {
    margin: 0.25rem !important;
  }

  .mt-xl-1, .my-xl-1 {
    margin-top: 0.25rem !important;
  }

  .mr-xl-1, .mx-xl-1 {
    margin-right: 0.25rem !important;
  }

  .mb-xl-1, .my-xl-1 {
    margin-bottom: 0.25rem !important;
  }

  .ml-xl-1, .mx-xl-1 {
    margin-left: 0.25rem !important;
  }

  .m-xl-2 {
    margin: 0.5rem !important;
  }

  .mt-xl-2, .my-xl-2 {
    margin-top: 0.5rem !important;
  }

  .mr-xl-2, .mx-xl-2 {
    margin-right: 0.5rem !important;
  }

  .mb-xl-2, .my-xl-2 {
    margin-bottom: 0.5rem !important;
  }

  .ml-xl-2, .mx-xl-2 {
    margin-left: 0.5rem !important;
  }

  .m-xl-3 {
    margin: 1rem !important;
  }

  .mt-xl-3, .my-xl-3 {
    margin-top: 1rem !important;
  }

  .mr-xl-3, .mx-xl-3 {
    margin-right: 1rem !important;
  }

  .mb-xl-3, .my-xl-3 {
    margin-bottom: 1rem !important;
  }

  .ml-xl-3, .mx-xl-3 {
    margin-left: 1rem !important;
  }

  .m-xl-4 {
    margin: 1.5rem !important;
  }

  .mt-xl-4, .my-xl-4 {
    margin-top: 1.5rem !important;
  }

  .mr-xl-4, .mx-xl-4 {
    margin-right: 1.5rem !important;
  }

  .mb-xl-4, .my-xl-4 {
    margin-bottom: 1.5rem !important;
  }

  .ml-xl-4, .mx-xl-4 {
    margin-left: 1.5rem !important;
  }

  .m-xl-5 {
    margin: 3rem !important;
  }

  .mt-xl-5, .my-xl-5 {
    margin-top: 3rem !important;
  }

  .mr-xl-5, .mx-xl-5 {
    margin-right: 3rem !important;
  }

  .mb-xl-5, .my-xl-5 {
    margin-bottom: 3rem !important;
  }

  .ml-xl-5, .mx-xl-5 {
    margin-left: 3rem !important;
  }

  .p-xl-0 {
    padding: 0 !important;
  }

  .pt-xl-0, .py-xl-0 {
    padding-top: 0 !important;
  }

  .pr-xl-0, .px-xl-0 {
    padding-right: 0 !important;
  }

  .pb-xl-0, .py-xl-0 {
    padding-bottom: 0 !important;
  }

  .pl-xl-0, .px-xl-0 {
    padding-left: 0 !important;
  }

  .p-xl-1 {
    padding: 0.25rem !important;
  }

  .pt-xl-1, .py-xl-1 {
    padding-top: 0.25rem !important;
  }

  .pr-xl-1, .px-xl-1 {
    padding-right: 0.25rem !important;
  }

  .pb-xl-1, .py-xl-1 {
    padding-bottom: 0.25rem !important;
  }

  .pl-xl-1, .px-xl-1 {
    padding-left: 0.25rem !important;
  }

  .p-xl-2 {
    padding: 0.5rem !important;
  }

  .pt-xl-2, .py-xl-2 {
    padding-top: 0.5rem !important;
  }

  .pr-xl-2, .px-xl-2 {
    padding-right: 0.5rem !important;
  }

  .pb-xl-2, .py-xl-2 {
    padding-bottom: 0.5rem !important;
  }

  .pl-xl-2, .px-xl-2 {
    padding-left: 0.5rem !important;
  }

  .p-xl-3 {
    padding: 1rem !important;
  }

  .pt-xl-3, .py-xl-3 {
    padding-top: 1rem !important;
  }

  .pr-xl-3, .px-xl-3 {
    padding-right: 1rem !important;
  }

  .pb-xl-3, .py-xl-3 {
    padding-bottom: 1rem !important;
  }

  .pl-xl-3, .px-xl-3 {
    padding-left: 1rem !important;
  }

  .p-xl-4 {
    padding: 1.5rem !important;
  }

  .pt-xl-4, .py-xl-4 {
    padding-top: 1.5rem !important;
  }

  .pr-xl-4, .px-xl-4 {
    padding-right: 1.5rem !important;
  }

  .pb-xl-4, .py-xl-4 {
    padding-bottom: 1.5rem !important;
  }

  .pl-xl-4, .px-xl-4 {
    padding-left: 1.5rem !important;
  }

  .p-xl-5 {
    padding: 3rem !important;
  }

  .pt-xl-5, .py-xl-5 {
    padding-top: 3rem !important;
  }

  .pr-xl-5, .px-xl-5 {
    padding-right: 3rem !important;
  }

  .pb-xl-5, .py-xl-5 {
    padding-bottom: 3rem !important;
  }

  .pl-xl-5, .px-xl-5 {
    padding-left: 3rem !important;
  }

  .m-xl-auto {
    margin: auto !important;
  }

  .mt-xl-auto, .my-xl-auto {
    margin-top: auto !important;
  }

  .mr-xl-auto, .mx-xl-auto {
    margin-right: auto !important;
  }

  .mb-xl-auto, .my-xl-auto {
    margin-bottom: auto !important;
  }

  .ml-xl-auto, .mx-xl-auto {
    margin-left: auto !important;
  }
}
.text-monospace {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
}

.text-justify {
  text-align: justify !important;
}

.text-nowrap {
  white-space: nowrap !important;
}

.text-truncate {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.text-left {
  text-align: left !important;
}

.text-right {
  text-align: right !important;
}

.text-center {
  text-align: center !important;
}

@media (min-width: 576px) {
  .text-sm-left {
    text-align: left !important;
  }

  .text-sm-right {
    text-align: right !important;
  }

  .text-sm-center {
    text-align: center !important;
  }
}
@media (min-width: 768px) {
  .text-md-left {
    text-align: left !important;
  }

  .text-md-right {
    text-align: right !important;
  }

  .text-md-center {
    text-align: center !important;
  }
}
@media (min-width: 992px) {
  .text-lg-left {
    text-align: left !important;
  }

  .text-lg-right {
    text-align: right !important;
  }

  .text-lg-center {
    text-align: center !important;
  }
}
@media (min-width: 1200px) {
  .text-xl-left {
    text-align: left !important;
  }

  .text-xl-right {
    text-align: right !important;
  }

  .text-xl-center {
    text-align: center !important;
  }
}
.text-lowercase {
  text-transform: lowercase !important;
}

.text-uppercase {
  text-transform: uppercase !important;
}

.text-capitalize {
  text-transform: capitalize !important;
}

.font-weight-light {
  font-weight: 300 !important;
}

.font-weight-normal {
  font-weight: 400 !important;
}

.font-weight-bold {
  font-weight: 700 !important;
}

.font-italic {
  font-style: italic !important;
}

.text-white {
  color: #fff !important;
}

.text-primary {
  color: #007bff !important;
}

a.text-primary:focus, a.text-primary:hover {
  color: #0062cc !important;
}

.text-secondary {
  color: #6c757d !important;
}

a.text-secondary:focus, a.text-secondary:hover {
  color: #545b62 !important;
}

.text-success {
  color: #28a745 !important;
}

a.text-success:focus, a.text-success:hover {
  color: #1e7e34 !important;
}

.text-info {
  color: #17a2b8 !important;
}

a.text-info:focus, a.text-info:hover {
  color: #117a8b !important;
}

.text-warning {
  color: #ffc107 !important;
}

a.text-warning:focus, a.text-warning:hover {
  color: #d39e00 !important;
}

.text-danger {
  color: #dc3545 !important;
}

a.text-danger:focus, a.text-danger:hover {
  color: #bd2130 !important;
}

.text-light {
  color: #f8f9fa !important;
}

a.text-light:focus, a.text-light:hover {
  color: #dae0e5 !important;
}

.text-dark {
  color: #343a40 !important;
}

a.text-dark:focus, a.text-dark:hover {
  color: #1d2124 !important;
}

.text-body {
  color: #212529 !important;
}

.text-muted {
  color: #6c757d !important;
}

.text-black-50 {
  color: rgba(0, 0, 0, 0.5) !important;
}

.text-white-50 {
  color: rgba(255, 255, 255, 0.5) !important;
}

.text-hide {
  font: 0/0 a;
  color: transparent;
  text-shadow: none;
  background-color: transparent;
  border: 0;
}

.visible {
  visibility: visible !important;
}

.invisible {
  visibility: hidden !important;
}

@media print {
  *, ::after, ::before {
    text-shadow: none !important;
    box-shadow: none !important;
  }

  a:not(.btn) {
    text-decoration: underline;
  }

  abbr[title]::after {
    content: " (" attr(title) ")";
  }

  pre {
    white-space: pre-wrap !important;
  }

  blockquote, pre {
    border: 1px solid #adb5bd;
    page-break-inside: avoid;
  }

  thead {
    display: table-header-group;
  }

  img, tr {
    page-break-inside: avoid;
  }

  h2, h3, p {
    orphans: 3;
    widows: 3;
  }

  h2, h3 {
    page-break-after: avoid;
  }

  @page {
    size: a3;
  }
  body {
    min-width: 992px !important;
  }

  .container {
    min-width: 992px !important;
  }

  .navbar {
    display: none;
  }

  .badge {
    border: 1px solid #000;
  }

  .table, .cont-noticias .texto {
    border-collapse: collapse !important;
  }

  .table td, .cont-noticias .texto td, .table th, .cont-noticias .texto th {
    background-color: #fff !important;
  }

  .table-bordered td, .table-bordered th {
    border: 1px solid #dee2e6 !important;
  }

  .table-dark {
    color: inherit;
  }

  .table-dark tbody + tbody, .table-dark td, .table-dark th, .table-dark thead th {
    border-color: #dee2e6;
  }

  .table .thead-dark th, .cont-noticias .texto .thead-dark th {
    color: inherit;
    border-color: #dee2e6;
  }
}
/*# sourceMappingURL=bootstrap.min.css.map */
body {
  font-family: "Open Sans", sans-serif;
  font-size: 10px;
}

::selection {
  background: #afd5ef;
  color: #ffffff;
}

::-moz-selection {
  background: #afd5ef;
  color: #ffffff;
}

.clearfix:after {
  content: ".";
  display: block;
  clear: both;
  visibility: hidden;
  line-height: 0;
  height: 0;
}

.clearfix {
  display: inline-block;
}

html[xmlns] .clearfix {
  display: block;
}

* html .clearfix {
  height: 1%;
}

.imagenIz {
  margin-right: 20px;
}

.imagenDer {
  margin-left: 20px;
}

.imagenCen {
  margin-bottom: 20px;
}

.cont_img img.imagenIz {
  margin-right: 0;
}

.display-inline,
.di {
  display: inline-block;
  vertical-align: top;
}

.flex {
  -webkit-display: flex;
  -moz-display: flex;
  -ms-display: flex;
  display: flex;
}

.flex-align-center {
  -webkit-align-items: center;
  -moz-align-items: center;
  -ms-align-items: center;
  align-items: center;
}

.flex-justify-content-space-between {
  -webkit-justify-content: space-between;
  -moz-justify-content: space-between;
  -ms-justify-content: space-between;
  justify-content: space-between;
}

.flex-auto {
  -webkit-flex: auto;
  -moz-flex: auto;
  -ms-flex: auto;
  flex: auto;
}

.bloque {
  display: block;
}

.pointer {
  cursor: pointer;
}

.salto {
  clear: both;
}

.centro-bloque {
  margin-left: auto;
  margin-right: auto;
}

.text-center,
.t-c {
  text-align: center;
}

.text-left,
.t-l {
  text-align: left;
}

.text-right,
.t-r {
  text-align: right;
}

.der {
  float: right;
}

.izq {
  float: left;
}

.valign-bot {
  vertical-align: bottom !important;
}

.valign-medio {
  vertical-align: middle !important;
}

.valign-sub {
  vertical-align: sub !important;
}

.valign-super {
  vertical-align: super !important;
}

.valign-top {
  vertical-align: top !important;
}

.valign-ini {
  vertical-align: initial !important;
}

.valign-text-bottom {
  vertical-align: text-bottom !important;
}

.fijar {
  position: fixed;
}

.relative {
  position: relative;
}

.position {
  position: absolute;
}

.position-top-right {
  top: 0;
  right: 0;
}

.position-top-left {
  top: 0;
  left: 0;
}

.position-top-center {
  top: 50%;
}

.position-top {
  top: 0;
}

.position-right {
  right: 0;
}

.position-left {
  left: 0;
}

.position-bot,
.position-bottom {
  bottom: 0;
}

.position-bot-right,
.position-bottom-right {
  bottom: 0;
  right: 0;
}

.position-bot-left,
.position-bottom-left {
  bottom: 0;
  left: 0;
}

.centerCenter {
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
}

.centrarHorizontal {
  position: absolute;
  left: 50%;
  transform: translate(-50%, 0);
}

.centrarVertical {
  position: absolute;
  top: 50%;
  transform: translate(0, -50%);
}

.radius {
  border-radius: 4px;
}

.radius50 {
  border-radius: 50%;
}

.centrar {
  margin: 0 auto;
}

.transition {
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}

.break-word {
  word-wrap: break-word;
}

.hidden {
  display: none;
}

.visible {
  display: block;
}

.overflow-hidden,
.oh {
  overflow: hidden;
}

.overflow-auto,
.oa {
  overflow: auto;
}

.overflow-auto-y,
.oa-y {
  overflow-y: auto;
}

.overflow-auto-x,
.oa-x {
  overflow-x: auto;
}

.rotar-90 {
  -ms-transform: rotate(-90deg);
  -webkit-transform: rotate(-90deg);
  transform: rotate(-90deg);
}

.rotar-180 {
  -ms-transform: rotate(-180deg);
  -webkit-transform: rotate(-180deg);
  transform: rotate(-180deg);
}

.rotar-270 {
  -ms-transform: rotate(-270deg);
  -webkit-transform: rotate(-270deg);
  transform: rotate(-270deg);
}

.medio,
.mitad {
  width: 48%;
}

.tercio {
  width: 32%;
}

.full {
  width: 100% !important;
}

.full-hw {
  height: 100%;
}

.full-img img {
  width: 100%;
}

.z1 {
  z-index: 1;
}

.z3 {
  z-index: 3;
}

.z5 {
  z-index: 5;
}

.z20 {
  z-index: 20;
}

.columnas-txt {
  column-count: 2;
  column-gap: 50px;
}

.ul-reset ul {
  padding-left: 20px;
  list-style-type: disc;
}

.ul-reset ol {
  list-style-type: decimal;
}

.ul-reset ul li {
  list-style-type: disc;
  margin-left: 15px;
}

.ul-reset ol li {
  list-style-type: decimal;
  margin-left: 15px;
}

.cont-aparecer:hover .aparecer {
  position: absolute;
  opacity: 1;
  visibility: visible;
}

.aparecer {
  position: absolute;
  opacity: 0;
  visibility: hidden;
}

/* CENTRAR IMAGENES */
.centrar_img img,
.centrar_img .imagenIz,
.centrar_img .imagenDer {
  margin: 0 auto;
}

.centrar_img div[align] {
  float: none;
  text-align: center;
}

.centrar_img div[align] img {
  float: none;
  margin: 0 auto;
}

/* VIDEOS DE YOUTUBE RESPONSIVOS */
.video-container {
  position: relative;
  padding-bottom: 56.25%;
  padding-top: 30px;
  height: 0;
}

.video-container iframe,
.video-container object,
.video-container embed {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}

.color-primario, a.color-primario {
  color: #42b6e5;
}

.link-primario:hover {
  color: #42b6e5;
}

.focus-primario:focus {
  color: #42b6e5;
}

.bg-primario {
  background-color: #42b6e5;
}

.bg-primario-hover:hover {
  background-color: #42b6e5;
}

hr.linea-primario {
  border: 0;
  height: 1px;
  background: #42b6e5;
}

.borde-primario, input[type=submit].borde-primario {
  border: 1px solid #42b6e5;
}

.borde-primario-hover:hover, input[type=submit].borde-primario-hover:hover {
  border: 1px solid #42b6e5;
}

.borde-2-primario, input[type=submit].borde-2-primario {
  border: 2px solid #42b6e5;
}

.borde-2-primario-hover:hover, input[type=submit].borde-2-primario-hover:hover {
  border: 2px solid #42b6e5;
}

.borde-3-primario, input[type=submit].borde-3-primario {
  border: 3px solid #42b6e5;
}

.borde-3-primario-hover:hover, input[type=submit].borde-3-primario-hover:hover {
  border: 3px solid #42b6e5;
}

.bt-primario {
  border-top: 1px solid #42b6e5;
}

.bl-primario {
  border-left: 1px solid #42b6e5;
}

.br-primario {
  border-right: 1px solid #42b6e5;
}

.bb-primario {
  border-bottom: 1px solid #42b6e5;
}

.borde-img-primario img {
  border: 1px solid #42b6e5;
}

.color-primario-alterno, a.color-primario-alterno {
  color: #3b6ea5;
}

.link-primario-alterno:hover {
  color: #3b6ea5;
}

.focus-primario-alterno:focus {
  color: #3b6ea5;
}

.bg-primario-alterno {
  background-color: #3b6ea5;
}

.bg-primario-alterno-hover:hover {
  background-color: #3b6ea5;
}

hr.linea-primario-alterno {
  border: 0;
  height: 1px;
  background: #3b6ea5;
}

.borde-primario-alterno, input[type=submit].borde-primario-alterno {
  border: 1px solid #3b6ea5;
}

.borde-primario-alterno-hover:hover, input[type=submit].borde-primario-alterno-hover:hover {
  border: 1px solid #3b6ea5;
}

.borde-2-primario-alterno, input[type=submit].borde-2-primario-alterno {
  border: 2px solid #3b6ea5;
}

.borde-2-primario-alterno-hover:hover, input[type=submit].borde-2-primario-alterno-hover:hover {
  border: 2px solid #3b6ea5;
}

.borde-3-primario-alterno, input[type=submit].borde-3-primario-alterno {
  border: 3px solid #3b6ea5;
}

.borde-3-primario-alterno-hover:hover, input[type=submit].borde-3-primario-alterno-hover:hover {
  border: 3px solid #3b6ea5;
}

.bt-primario-alterno {
  border-top: 1px solid #3b6ea5;
}

.bl-primario-alterno {
  border-left: 1px solid #3b6ea5;
}

.br-primario-alterno {
  border-right: 1px solid #3b6ea5;
}

.bb-primario-alterno {
  border-bottom: 1px solid #3b6ea5;
}

.borde-img-primario-alterno img {
  border: 1px solid #3b6ea5;
}

.color-secundario, a.color-secundario {
  color: #076694;
}

.link-secundario:hover {
  color: #076694;
}

.focus-secundario:focus {
  color: #076694;
}

.bg-secundario {
  background-color: #076694;
}

.bg-secundario-hover:hover {
  background-color: #076694;
}

hr.linea-secundario {
  border: 0;
  height: 1px;
  background: #076694;
}

.borde-secundario, input[type=submit].borde-secundario {
  border: 1px solid #076694;
}

.borde-secundario-hover:hover, input[type=submit].borde-secundario-hover:hover {
  border: 1px solid #076694;
}

.borde-2-secundario, input[type=submit].borde-2-secundario {
  border: 2px solid #076694;
}

.borde-2-secundario-hover:hover, input[type=submit].borde-2-secundario-hover:hover {
  border: 2px solid #076694;
}

.borde-3-secundario, input[type=submit].borde-3-secundario {
  border: 3px solid #076694;
}

.borde-3-secundario-hover:hover, input[type=submit].borde-3-secundario-hover:hover {
  border: 3px solid #076694;
}

.bt-secundario {
  border-top: 1px solid #076694;
}

.bl-secundario {
  border-left: 1px solid #076694;
}

.br-secundario {
  border-right: 1px solid #076694;
}

.bb-secundario {
  border-bottom: 1px solid #076694;
}

.borde-img-secundario img {
  border: 1px solid #076694;
}

.color-terciario, a.color-terciario {
  color: #00b370;
}

.link-terciario:hover {
  color: #00b370;
}

.focus-terciario:focus {
  color: #00b370;
}

.bg-terciario {
  background-color: #00b370;
}

.bg-terciario-hover:hover {
  background-color: #00b370;
}

hr.linea-terciario {
  border: 0;
  height: 1px;
  background: #00b370;
}

.borde-terciario, input[type=submit].borde-terciario {
  border: 1px solid #00b370;
}

.borde-terciario-hover:hover, input[type=submit].borde-terciario-hover:hover {
  border: 1px solid #00b370;
}

.borde-2-terciario, input[type=submit].borde-2-terciario {
  border: 2px solid #00b370;
}

.borde-2-terciario-hover:hover, input[type=submit].borde-2-terciario-hover:hover {
  border: 2px solid #00b370;
}

.borde-3-terciario, input[type=submit].borde-3-terciario {
  border: 3px solid #00b370;
}

.borde-3-terciario-hover:hover, input[type=submit].borde-3-terciario-hover:hover {
  border: 3px solid #00b370;
}

.bt-terciario {
  border-top: 1px solid #00b370;
}

.bl-terciario {
  border-left: 1px solid #00b370;
}

.br-terciario {
  border-right: 1px solid #00b370;
}

.bb-terciario {
  border-bottom: 1px solid #00b370;
}

.borde-img-terciario img {
  border: 1px solid #00b370;
}

.color-destacado, a.color-destacado {
  color: #bf1a1e;
}

.link-destacado:hover {
  color: #bf1a1e;
}

.focus-destacado:focus {
  color: #bf1a1e;
}

.bg-destacado {
  background-color: #bf1a1e;
}

.bg-destacado-hover:hover {
  background-color: #bf1a1e;
}

hr.linea-destacado {
  border: 0;
  height: 1px;
  background: #bf1a1e;
}

.borde-destacado, input[type=submit].borde-destacado {
  border: 1px solid #bf1a1e;
}

.borde-destacado-hover:hover, input[type=submit].borde-destacado-hover:hover {
  border: 1px solid #bf1a1e;
}

.borde-2-destacado, input[type=submit].borde-2-destacado {
  border: 2px solid #bf1a1e;
}

.borde-2-destacado-hover:hover, input[type=submit].borde-2-destacado-hover:hover {
  border: 2px solid #bf1a1e;
}

.borde-3-destacado, input[type=submit].borde-3-destacado {
  border: 3px solid #bf1a1e;
}

.borde-3-destacado-hover:hover, input[type=submit].borde-3-destacado-hover:hover {
  border: 3px solid #bf1a1e;
}

.bt-destacado {
  border-top: 1px solid #bf1a1e;
}

.bl-destacado {
  border-left: 1px solid #bf1a1e;
}

.br-destacado {
  border-right: 1px solid #bf1a1e;
}

.bb-destacado {
  border-bottom: 1px solid #bf1a1e;
}

.borde-img-destacado img {
  border: 1px solid #bf1a1e;
}

.color-blanco, a.color-blanco {
  color: #ffffff;
}

.link-blanco:hover {
  color: #ffffff;
}

.focus-blanco:focus {
  color: #ffffff;
}

.bg-blanco {
  background-color: #ffffff;
}

.bg-blanco-hover:hover {
  background-color: #ffffff;
}

hr.linea-blanco {
  border: 0;
  height: 1px;
  background: #ffffff;
}

.borde-blanco, input[type=submit].borde-blanco {
  border: 1px solid #ffffff;
}

.borde-blanco-hover:hover, input[type=submit].borde-blanco-hover:hover {
  border: 1px solid #ffffff;
}

.borde-2-blanco, input[type=submit].borde-2-blanco {
  border: 2px solid #ffffff;
}

.borde-2-blanco-hover:hover, input[type=submit].borde-2-blanco-hover:hover {
  border: 2px solid #ffffff;
}

.borde-3-blanco, input[type=submit].borde-3-blanco {
  border: 3px solid #ffffff;
}

.borde-3-blanco-hover:hover, input[type=submit].borde-3-blanco-hover:hover {
  border: 3px solid #ffffff;
}

.bt-blanco {
  border-top: 1px solid #ffffff;
}

.bl-blanco {
  border-left: 1px solid #ffffff;
}

.br-blanco {
  border-right: 1px solid #ffffff;
}

.bb-blanco {
  border-bottom: 1px solid #ffffff;
}

.borde-img-blanco img {
  border: 1px solid #ffffff;
}

.color-negro, a.color-negro {
  color: #000;
}

.link-negro:hover {
  color: #000;
}

.focus-negro:focus {
  color: #000;
}

.bg-negro {
  background-color: #000;
}

.bg-negro-hover:hover {
  background-color: #000;
}

hr.linea-negro {
  border: 0;
  height: 1px;
  background: #000;
}

.borde-negro, input[type=submit].borde-negro {
  border: 1px solid #000;
}

.borde-negro-hover:hover, input[type=submit].borde-negro-hover:hover {
  border: 1px solid #000;
}

.borde-2-negro, input[type=submit].borde-2-negro {
  border: 2px solid #000;
}

.borde-2-negro-hover:hover, input[type=submit].borde-2-negro-hover:hover {
  border: 2px solid #000;
}

.borde-3-negro, input[type=submit].borde-3-negro {
  border: 3px solid #000;
}

.borde-3-negro-hover:hover, input[type=submit].borde-3-negro-hover:hover {
  border: 3px solid #000;
}

.bt-negro {
  border-top: 1px solid #000;
}

.bl-negro {
  border-left: 1px solid #000;
}

.br-negro {
  border-right: 1px solid #000;
}

.bb-negro {
  border-bottom: 1px solid #000;
}

.borde-img-negro img {
  border: 1px solid #000;
}

.color-gris, a.color-gris {
  color: #7b7b7b;
}

.link-gris:hover {
  color: #7b7b7b;
}

.focus-gris:focus {
  color: #7b7b7b;
}

.bg-gris {
  background-color: #7b7b7b;
}

.bg-gris-hover:hover {
  background-color: #7b7b7b;
}

hr.linea-gris {
  border: 0;
  height: 1px;
  background: #7b7b7b;
}

.borde-gris, input[type=submit].borde-gris {
  border: 1px solid #7b7b7b;
}

.borde-gris-hover:hover, input[type=submit].borde-gris-hover:hover {
  border: 1px solid #7b7b7b;
}

.borde-2-gris, input[type=submit].borde-2-gris {
  border: 2px solid #7b7b7b;
}

.borde-2-gris-hover:hover, input[type=submit].borde-2-gris-hover:hover {
  border: 2px solid #7b7b7b;
}

.borde-3-gris, input[type=submit].borde-3-gris {
  border: 3px solid #7b7b7b;
}

.borde-3-gris-hover:hover, input[type=submit].borde-3-gris-hover:hover {
  border: 3px solid #7b7b7b;
}

.bt-gris {
  border-top: 1px solid #7b7b7b;
}

.bl-gris {
  border-left: 1px solid #7b7b7b;
}

.br-gris {
  border-right: 1px solid #7b7b7b;
}

.bb-gris {
  border-bottom: 1px solid #7b7b7b;
}

.borde-img-gris img {
  border: 1px solid #7b7b7b;
}

.color-gris-100, a.color-gris-100 {
  color: #fbfbfb;
}

.link-gris-100:hover {
  color: #fbfbfb;
}

.focus-gris-100:focus {
  color: #fbfbfb;
}

.bg-gris-100 {
  background-color: #fbfbfb;
}

.bg-gris-100-hover:hover {
  background-color: #fbfbfb;
}

hr.linea-gris-100 {
  border: 0;
  height: 1px;
  background: #fbfbfb;
}

.borde-gris-100, input[type=submit].borde-gris-100 {
  border: 1px solid #fbfbfb;
}

.borde-gris-100-hover:hover, input[type=submit].borde-gris-100-hover:hover {
  border: 1px solid #fbfbfb;
}

.borde-2-gris-100, input[type=submit].borde-2-gris-100 {
  border: 2px solid #fbfbfb;
}

.borde-2-gris-100-hover:hover, input[type=submit].borde-2-gris-100-hover:hover {
  border: 2px solid #fbfbfb;
}

.borde-3-gris-100, input[type=submit].borde-3-gris-100 {
  border: 3px solid #fbfbfb;
}

.borde-3-gris-100-hover:hover, input[type=submit].borde-3-gris-100-hover:hover {
  border: 3px solid #fbfbfb;
}

.bt-gris-100 {
  border-top: 1px solid #fbfbfb;
}

.bl-gris-100 {
  border-left: 1px solid #fbfbfb;
}

.br-gris-100 {
  border-right: 1px solid #fbfbfb;
}

.bb-gris-100 {
  border-bottom: 1px solid #fbfbfb;
}

.borde-img-gris-100 img {
  border: 1px solid #fbfbfb;
}

.color-gris-200, a.color-gris-200 {
  color: whitesmoke;
}

.link-gris-200:hover {
  color: whitesmoke;
}

.focus-gris-200:focus {
  color: whitesmoke;
}

.bg-gris-200 {
  background-color: whitesmoke;
}

.bg-gris-200-hover:hover {
  background-color: whitesmoke;
}

hr.linea-gris-200 {
  border: 0;
  height: 1px;
  background: whitesmoke;
}

.borde-gris-200, input[type=submit].borde-gris-200 {
  border: 1px solid whitesmoke;
}

.borde-gris-200-hover:hover, input[type=submit].borde-gris-200-hover:hover {
  border: 1px solid whitesmoke;
}

.borde-2-gris-200, input[type=submit].borde-2-gris-200 {
  border: 2px solid whitesmoke;
}

.borde-2-gris-200-hover:hover, input[type=submit].borde-2-gris-200-hover:hover {
  border: 2px solid whitesmoke;
}

.borde-3-gris-200, input[type=submit].borde-3-gris-200 {
  border: 3px solid whitesmoke;
}

.borde-3-gris-200-hover:hover, input[type=submit].borde-3-gris-200-hover:hover {
  border: 3px solid whitesmoke;
}

.bt-gris-200 {
  border-top: 1px solid whitesmoke;
}

.bl-gris-200 {
  border-left: 1px solid whitesmoke;
}

.br-gris-200 {
  border-right: 1px solid whitesmoke;
}

.bb-gris-200 {
  border-bottom: 1px solid whitesmoke;
}

.borde-img-gris-200 img {
  border: 1px solid whitesmoke;
}

.color-gris-300, a.color-gris-300 {
  color: #eeeeee;
}

.link-gris-300:hover {
  color: #eeeeee;
}

.focus-gris-300:focus {
  color: #eeeeee;
}

.bg-gris-300 {
  background-color: #eeeeee;
}

.bg-gris-300-hover:hover {
  background-color: #eeeeee;
}

hr.linea-gris-300 {
  border: 0;
  height: 1px;
  background: #eeeeee;
}

.borde-gris-300, input[type=submit].borde-gris-300 {
  border: 1px solid #eeeeee;
}

.borde-gris-300-hover:hover, input[type=submit].borde-gris-300-hover:hover {
  border: 1px solid #eeeeee;
}

.borde-2-gris-300, input[type=submit].borde-2-gris-300 {
  border: 2px solid #eeeeee;
}

.borde-2-gris-300-hover:hover, input[type=submit].borde-2-gris-300-hover:hover {
  border: 2px solid #eeeeee;
}

.borde-3-gris-300, input[type=submit].borde-3-gris-300 {
  border: 3px solid #eeeeee;
}

.borde-3-gris-300-hover:hover, input[type=submit].borde-3-gris-300-hover:hover {
  border: 3px solid #eeeeee;
}

.bt-gris-300 {
  border-top: 1px solid #eeeeee;
}

.bl-gris-300 {
  border-left: 1px solid #eeeeee;
}

.br-gris-300 {
  border-right: 1px solid #eeeeee;
}

.bb-gris-300 {
  border-bottom: 1px solid #eeeeee;
}

.borde-img-gris-300 img {
  border: 1px solid #eeeeee;
}

.color-gris-400, a.color-gris-400 {
  color: #e1e1e1;
}

.link-gris-400:hover {
  color: #e1e1e1;
}

.focus-gris-400:focus {
  color: #e1e1e1;
}

.bg-gris-400 {
  background-color: #e1e1e1;
}

.bg-gris-400-hover:hover {
  background-color: #e1e1e1;
}

hr.linea-gris-400 {
  border: 0;
  height: 1px;
  background: #e1e1e1;
}

.borde-gris-400, input[type=submit].borde-gris-400 {
  border: 1px solid #e1e1e1;
}

.borde-gris-400-hover:hover, input[type=submit].borde-gris-400-hover:hover {
  border: 1px solid #e1e1e1;
}

.borde-2-gris-400, input[type=submit].borde-2-gris-400 {
  border: 2px solid #e1e1e1;
}

.borde-2-gris-400-hover:hover, input[type=submit].borde-2-gris-400-hover:hover {
  border: 2px solid #e1e1e1;
}

.borde-3-gris-400, input[type=submit].borde-3-gris-400 {
  border: 3px solid #e1e1e1;
}

.borde-3-gris-400-hover:hover, input[type=submit].borde-3-gris-400-hover:hover {
  border: 3px solid #e1e1e1;
}

.bt-gris-400 {
  border-top: 1px solid #e1e1e1;
}

.bl-gris-400 {
  border-left: 1px solid #e1e1e1;
}

.br-gris-400 {
  border-right: 1px solid #e1e1e1;
}

.bb-gris-400 {
  border-bottom: 1px solid #e1e1e1;
}

.borde-img-gris-400 img {
  border: 1px solid #e1e1e1;
}

.color-gris-500, a.color-gris-500 {
  color: #959595;
}

.link-gris-500:hover {
  color: #959595;
}

.focus-gris-500:focus {
  color: #959595;
}

.bg-gris-500 {
  background-color: #959595;
}

.bg-gris-500-hover:hover {
  background-color: #959595;
}

hr.linea-gris-500 {
  border: 0;
  height: 1px;
  background: #959595;
}

.borde-gris-500, input[type=submit].borde-gris-500 {
  border: 1px solid #959595;
}

.borde-gris-500-hover:hover, input[type=submit].borde-gris-500-hover:hover {
  border: 1px solid #959595;
}

.borde-2-gris-500, input[type=submit].borde-2-gris-500 {
  border: 2px solid #959595;
}

.borde-2-gris-500-hover:hover, input[type=submit].borde-2-gris-500-hover:hover {
  border: 2px solid #959595;
}

.borde-3-gris-500, input[type=submit].borde-3-gris-500 {
  border: 3px solid #959595;
}

.borde-3-gris-500-hover:hover, input[type=submit].borde-3-gris-500-hover:hover {
  border: 3px solid #959595;
}

.bt-gris-500 {
  border-top: 1px solid #959595;
}

.bl-gris-500 {
  border-left: 1px solid #959595;
}

.br-gris-500 {
  border-right: 1px solid #959595;
}

.bb-gris-500 {
  border-bottom: 1px solid #959595;
}

.borde-img-gris-500 img {
  border: 1px solid #959595;
}

.color-gris-600, a.color-gris-600 {
  color: #626262;
}

.link-gris-600:hover {
  color: #626262;
}

.focus-gris-600:focus {
  color: #626262;
}

.bg-gris-600 {
  background-color: #626262;
}

.bg-gris-600-hover:hover {
  background-color: #626262;
}

hr.linea-gris-600 {
  border: 0;
  height: 1px;
  background: #626262;
}

.borde-gris-600, input[type=submit].borde-gris-600 {
  border: 1px solid #626262;
}

.borde-gris-600-hover:hover, input[type=submit].borde-gris-600-hover:hover {
  border: 1px solid #626262;
}

.borde-2-gris-600, input[type=submit].borde-2-gris-600 {
  border: 2px solid #626262;
}

.borde-2-gris-600-hover:hover, input[type=submit].borde-2-gris-600-hover:hover {
  border: 2px solid #626262;
}

.borde-3-gris-600, input[type=submit].borde-3-gris-600 {
  border: 3px solid #626262;
}

.borde-3-gris-600-hover:hover, input[type=submit].borde-3-gris-600-hover:hover {
  border: 3px solid #626262;
}

.bt-gris-600 {
  border-top: 1px solid #626262;
}

.bl-gris-600 {
  border-left: 1px solid #626262;
}

.br-gris-600 {
  border-right: 1px solid #626262;
}

.bb-gris-600 {
  border-bottom: 1px solid #626262;
}

.borde-img-gris-600 img {
  border: 1px solid #626262;
}

.color-gris-700, a.color-gris-700 {
  color: #484848;
}

.link-gris-700:hover {
  color: #484848;
}

.focus-gris-700:focus {
  color: #484848;
}

.bg-gris-700 {
  background-color: #484848;
}

.bg-gris-700-hover:hover {
  background-color: #484848;
}

hr.linea-gris-700 {
  border: 0;
  height: 1px;
  background: #484848;
}

.borde-gris-700, input[type=submit].borde-gris-700 {
  border: 1px solid #484848;
}

.borde-gris-700-hover:hover, input[type=submit].borde-gris-700-hover:hover {
  border: 1px solid #484848;
}

.borde-2-gris-700, input[type=submit].borde-2-gris-700 {
  border: 2px solid #484848;
}

.borde-2-gris-700-hover:hover, input[type=submit].borde-2-gris-700-hover:hover {
  border: 2px solid #484848;
}

.borde-3-gris-700, input[type=submit].borde-3-gris-700 {
  border: 3px solid #484848;
}

.borde-3-gris-700-hover:hover, input[type=submit].borde-3-gris-700-hover:hover {
  border: 3px solid #484848;
}

.bt-gris-700 {
  border-top: 1px solid #484848;
}

.bl-gris-700 {
  border-left: 1px solid #484848;
}

.br-gris-700 {
  border-right: 1px solid #484848;
}

.bb-gris-700 {
  border-bottom: 1px solid #484848;
}

.borde-img-gris-700 img {
  border: 1px solid #484848;
}

.color-gris-800, a.color-gris-800 {
  color: #2f2f2f;
}

.link-gris-800:hover {
  color: #2f2f2f;
}

.focus-gris-800:focus {
  color: #2f2f2f;
}

.bg-gris-800 {
  background-color: #2f2f2f;
}

.bg-gris-800-hover:hover {
  background-color: #2f2f2f;
}

hr.linea-gris-800 {
  border: 0;
  height: 1px;
  background: #2f2f2f;
}

.borde-gris-800, input[type=submit].borde-gris-800 {
  border: 1px solid #2f2f2f;
}

.borde-gris-800-hover:hover, input[type=submit].borde-gris-800-hover:hover {
  border: 1px solid #2f2f2f;
}

.borde-2-gris-800, input[type=submit].borde-2-gris-800 {
  border: 2px solid #2f2f2f;
}

.borde-2-gris-800-hover:hover, input[type=submit].borde-2-gris-800-hover:hover {
  border: 2px solid #2f2f2f;
}

.borde-3-gris-800, input[type=submit].borde-3-gris-800 {
  border: 3px solid #2f2f2f;
}

.borde-3-gris-800-hover:hover, input[type=submit].borde-3-gris-800-hover:hover {
  border: 3px solid #2f2f2f;
}

.bt-gris-800 {
  border-top: 1px solid #2f2f2f;
}

.bl-gris-800 {
  border-left: 1px solid #2f2f2f;
}

.br-gris-800 {
  border-right: 1px solid #2f2f2f;
}

.bb-gris-800 {
  border-bottom: 1px solid #2f2f2f;
}

.borde-img-gris-800 img {
  border: 1px solid #2f2f2f;
}

.color-gris-900, a.color-gris-900 {
  color: #151515;
}

.link-gris-900:hover {
  color: #151515;
}

.focus-gris-900:focus {
  color: #151515;
}

.bg-gris-900 {
  background-color: #151515;
}

.bg-gris-900-hover:hover {
  background-color: #151515;
}

hr.linea-gris-900 {
  border: 0;
  height: 1px;
  background: #151515;
}

.borde-gris-900, input[type=submit].borde-gris-900 {
  border: 1px solid #151515;
}

.borde-gris-900-hover:hover, input[type=submit].borde-gris-900-hover:hover {
  border: 1px solid #151515;
}

.borde-2-gris-900, input[type=submit].borde-2-gris-900 {
  border: 2px solid #151515;
}

.borde-2-gris-900-hover:hover, input[type=submit].borde-2-gris-900-hover:hover {
  border: 2px solid #151515;
}

.borde-3-gris-900, input[type=submit].borde-3-gris-900 {
  border: 3px solid #151515;
}

.borde-3-gris-900-hover:hover, input[type=submit].borde-3-gris-900-hover:hover {
  border: 3px solid #151515;
}

.bt-gris-900 {
  border-top: 1px solid #151515;
}

.bl-gris-900 {
  border-left: 1px solid #151515;
}

.br-gris-900 {
  border-right: 1px solid #151515;
}

.bb-gris-900 {
  border-bottom: 1px solid #151515;
}

.borde-img-gris-900 img {
  border: 1px solid #151515;
}

.color-red-twit, a.color-red-twit {
  color: #10a5da;
}

.link-red-twit:hover {
  color: #10a5da;
}

.focus-red-twit:focus {
  color: #10a5da;
}

.bg-red-twit {
  background-color: #10a5da;
}

.bg-red-twit-hover:hover {
  background-color: #10a5da;
}

hr.linea-red-twit {
  border: 0;
  height: 1px;
  background: #10a5da;
}

.borde-red-twit, input[type=submit].borde-red-twit {
  border: 1px solid #10a5da;
}

.borde-red-twit-hover:hover, input[type=submit].borde-red-twit-hover:hover {
  border: 1px solid #10a5da;
}

.borde-2-red-twit, input[type=submit].borde-2-red-twit {
  border: 2px solid #10a5da;
}

.borde-2-red-twit-hover:hover, input[type=submit].borde-2-red-twit-hover:hover {
  border: 2px solid #10a5da;
}

.borde-3-red-twit, input[type=submit].borde-3-red-twit {
  border: 3px solid #10a5da;
}

.borde-3-red-twit-hover:hover, input[type=submit].borde-3-red-twit-hover:hover {
  border: 3px solid #10a5da;
}

.bt-red-twit {
  border-top: 1px solid #10a5da;
}

.bl-red-twit {
  border-left: 1px solid #10a5da;
}

.br-red-twit {
  border-right: 1px solid #10a5da;
}

.bb-red-twit {
  border-bottom: 1px solid #10a5da;
}

.borde-img-red-twit img {
  border: 1px solid #10a5da;
}

.color-red-face, a.color-red-face {
  color: #344c87;
}

.link-red-face:hover {
  color: #344c87;
}

.focus-red-face:focus {
  color: #344c87;
}

.bg-red-face {
  background-color: #344c87;
}

.bg-red-face-hover:hover {
  background-color: #344c87;
}

hr.linea-red-face {
  border: 0;
  height: 1px;
  background: #344c87;
}

.borde-red-face, input[type=submit].borde-red-face {
  border: 1px solid #344c87;
}

.borde-red-face-hover:hover, input[type=submit].borde-red-face-hover:hover {
  border: 1px solid #344c87;
}

.borde-2-red-face, input[type=submit].borde-2-red-face {
  border: 2px solid #344c87;
}

.borde-2-red-face-hover:hover, input[type=submit].borde-2-red-face-hover:hover {
  border: 2px solid #344c87;
}

.borde-3-red-face, input[type=submit].borde-3-red-face {
  border: 3px solid #344c87;
}

.borde-3-red-face-hover:hover, input[type=submit].borde-3-red-face-hover:hover {
  border: 3px solid #344c87;
}

.bt-red-face {
  border-top: 1px solid #344c87;
}

.bl-red-face {
  border-left: 1px solid #344c87;
}

.br-red-face {
  border-right: 1px solid #344c87;
}

.bb-red-face {
  border-bottom: 1px solid #344c87;
}

.borde-img-red-face img {
  border: 1px solid #344c87;
}

.color-red-wath, a.color-red-wath {
  color: #12a13c;
}

.link-red-wath:hover {
  color: #12a13c;
}

.focus-red-wath:focus {
  color: #12a13c;
}

.bg-red-wath {
  background-color: #12a13c;
}

.bg-red-wath-hover:hover {
  background-color: #12a13c;
}

hr.linea-red-wath {
  border: 0;
  height: 1px;
  background: #12a13c;
}

.borde-red-wath, input[type=submit].borde-red-wath {
  border: 1px solid #12a13c;
}

.borde-red-wath-hover:hover, input[type=submit].borde-red-wath-hover:hover {
  border: 1px solid #12a13c;
}

.borde-2-red-wath, input[type=submit].borde-2-red-wath {
  border: 2px solid #12a13c;
}

.borde-2-red-wath-hover:hover, input[type=submit].borde-2-red-wath-hover:hover {
  border: 2px solid #12a13c;
}

.borde-3-red-wath, input[type=submit].borde-3-red-wath {
  border: 3px solid #12a13c;
}

.borde-3-red-wath-hover:hover, input[type=submit].borde-3-red-wath-hover:hover {
  border: 3px solid #12a13c;
}

.bt-red-wath {
  border-top: 1px solid #12a13c;
}

.bl-red-wath {
  border-left: 1px solid #12a13c;
}

.br-red-wath {
  border-right: 1px solid #12a13c;
}

.bb-red-wath {
  border-bottom: 1px solid #12a13c;
}

.borde-img-red-wath img {
  border: 1px solid #12a13c;
}

.color-gris-alterno, a.color-gris-alterno {
  color: #e4f8ff;
}

.link-gris-alterno:hover {
  color: #e4f8ff;
}

.focus-gris-alterno:focus {
  color: #e4f8ff;
}

.bg-gris-alterno {
  background-color: #e4f8ff;
}

.bg-gris-alterno-hover:hover {
  background-color: #e4f8ff;
}

hr.linea-gris-alterno {
  border: 0;
  height: 1px;
  background: #e4f8ff;
}

.borde-gris-alterno, input[type=submit].borde-gris-alterno {
  border: 1px solid #e4f8ff;
}

.borde-gris-alterno-hover:hover, input[type=submit].borde-gris-alterno-hover:hover {
  border: 1px solid #e4f8ff;
}

.borde-2-gris-alterno, input[type=submit].borde-2-gris-alterno {
  border: 2px solid #e4f8ff;
}

.borde-2-gris-alterno-hover:hover, input[type=submit].borde-2-gris-alterno-hover:hover {
  border: 2px solid #e4f8ff;
}

.borde-3-gris-alterno, input[type=submit].borde-3-gris-alterno {
  border: 3px solid #e4f8ff;
}

.borde-3-gris-alterno-hover:hover, input[type=submit].borde-3-gris-alterno-hover:hover {
  border: 3px solid #e4f8ff;
}

.bt-gris-alterno {
  border-top: 1px solid #e4f8ff;
}

.bl-gris-alterno {
  border-left: 1px solid #e4f8ff;
}

.br-gris-alterno {
  border-right: 1px solid #e4f8ff;
}

.bb-gris-alterno {
  border-bottom: 1px solid #e4f8ff;
}

.borde-img-gris-alterno img {
  border: 1px solid #e4f8ff;
}

.color-gris-tabla, a.color-gris-tabla {
  color: #f7f7f7;
}

.link-gris-tabla:hover {
  color: #f7f7f7;
}

.focus-gris-tabla:focus {
  color: #f7f7f7;
}

.bg-gris-tabla {
  background-color: #f7f7f7;
}

.bg-gris-tabla-hover:hover {
  background-color: #f7f7f7;
}

hr.linea-gris-tabla {
  border: 0;
  height: 1px;
  background: #f7f7f7;
}

.borde-gris-tabla, input[type=submit].borde-gris-tabla {
  border: 1px solid #f7f7f7;
}

.borde-gris-tabla-hover:hover, input[type=submit].borde-gris-tabla-hover:hover {
  border: 1px solid #f7f7f7;
}

.borde-2-gris-tabla, input[type=submit].borde-2-gris-tabla {
  border: 2px solid #f7f7f7;
}

.borde-2-gris-tabla-hover:hover, input[type=submit].borde-2-gris-tabla-hover:hover {
  border: 2px solid #f7f7f7;
}

.borde-3-gris-tabla, input[type=submit].borde-3-gris-tabla {
  border: 3px solid #f7f7f7;
}

.borde-3-gris-tabla-hover:hover, input[type=submit].borde-3-gris-tabla-hover:hover {
  border: 3px solid #f7f7f7;
}

.bt-gris-tabla {
  border-top: 1px solid #f7f7f7;
}

.bl-gris-tabla {
  border-left: 1px solid #f7f7f7;
}

.br-gris-tabla {
  border-right: 1px solid #f7f7f7;
}

.bb-gris-tabla {
  border-bottom: 1px solid #f7f7f7;
}

.borde-img-gris-tabla img {
  border: 1px solid #f7f7f7;
}

.color-gris-tabla-hover, a.color-gris-tabla-hover {
  color: #ebebeb;
}

.link-gris-tabla-hover:hover {
  color: #ebebeb;
}

.focus-gris-tabla-hover:focus {
  color: #ebebeb;
}

.bg-gris-tabla-hover {
  background-color: #ebebeb;
}

.bg-gris-tabla-hover-hover:hover {
  background-color: #ebebeb;
}

hr.linea-gris-tabla-hover {
  border: 0;
  height: 1px;
  background: #ebebeb;
}

.borde-gris-tabla-hover, input[type=submit].borde-gris-tabla-hover {
  border: 1px solid #ebebeb;
}

.borde-gris-tabla-hover-hover:hover, input[type=submit].borde-gris-tabla-hover-hover:hover {
  border: 1px solid #ebebeb;
}

.borde-2-gris-tabla-hover, input[type=submit].borde-2-gris-tabla-hover {
  border: 2px solid #ebebeb;
}

.borde-2-gris-tabla-hover-hover:hover, input[type=submit].borde-2-gris-tabla-hover-hover:hover {
  border: 2px solid #ebebeb;
}

.borde-3-gris-tabla-hover, input[type=submit].borde-3-gris-tabla-hover {
  border: 3px solid #ebebeb;
}

.borde-3-gris-tabla-hover-hover:hover, input[type=submit].borde-3-gris-tabla-hover-hover:hover {
  border: 3px solid #ebebeb;
}

.bt-gris-tabla-hover {
  border-top: 1px solid #ebebeb;
}

.bl-gris-tabla-hover {
  border-left: 1px solid #ebebeb;
}

.br-gris-tabla-hover {
  border-right: 1px solid #ebebeb;
}

.bb-gris-tabla-hover {
  border-bottom: 1px solid #ebebeb;
}

.borde-img-gris-tabla-hover img {
  border: 1px solid #ebebeb;
}

.color-primario-claro, a.color-primario-claro {
  color: #afd5ef;
}

.link-primario-claro:hover {
  color: #afd5ef;
}

.focus-primario-claro:focus {
  color: #afd5ef;
}

.bg-primario-claro {
  background-color: #afd5ef;
}

.bg-primario-claro-hover:hover {
  background-color: #afd5ef;
}

hr.linea-primario-claro {
  border: 0;
  height: 1px;
  background: #afd5ef;
}

.borde-primario-claro, input[type=submit].borde-primario-claro {
  border: 1px solid #afd5ef;
}

.borde-primario-claro-hover:hover, input[type=submit].borde-primario-claro-hover:hover {
  border: 1px solid #afd5ef;
}

.borde-2-primario-claro, input[type=submit].borde-2-primario-claro {
  border: 2px solid #afd5ef;
}

.borde-2-primario-claro-hover:hover, input[type=submit].borde-2-primario-claro-hover:hover {
  border: 2px solid #afd5ef;
}

.borde-3-primario-claro, input[type=submit].borde-3-primario-claro {
  border: 3px solid #afd5ef;
}

.borde-3-primario-claro-hover:hover, input[type=submit].borde-3-primario-claro-hover:hover {
  border: 3px solid #afd5ef;
}

.bt-primario-claro {
  border-top: 1px solid #afd5ef;
}

.bl-primario-claro {
  border-left: 1px solid #afd5ef;
}

.br-primario-claro {
  border-right: 1px solid #afd5ef;
}

.bb-primario-claro {
  border-bottom: 1px solid #afd5ef;
}

.borde-img-primario-claro img {
  border: 1px solid #afd5ef;
}

.color-secundario-claro, a.color-secundario-claro {
  color: #26b1f5;
}

.link-secundario-claro:hover {
  color: #26b1f5;
}

.focus-secundario-claro:focus {
  color: #26b1f5;
}

.bg-secundario-claro {
  background-color: #26b1f5;
}

.bg-secundario-claro-hover:hover {
  background-color: #26b1f5;
}

hr.linea-secundario-claro {
  border: 0;
  height: 1px;
  background: #26b1f5;
}

.borde-secundario-claro, input[type=submit].borde-secundario-claro {
  border: 1px solid #26b1f5;
}

.borde-secundario-claro-hover:hover, input[type=submit].borde-secundario-claro-hover:hover {
  border: 1px solid #26b1f5;
}

.borde-2-secundario-claro, input[type=submit].borde-2-secundario-claro {
  border: 2px solid #26b1f5;
}

.borde-2-secundario-claro-hover:hover, input[type=submit].borde-2-secundario-claro-hover:hover {
  border: 2px solid #26b1f5;
}

.borde-3-secundario-claro, input[type=submit].borde-3-secundario-claro {
  border: 3px solid #26b1f5;
}

.borde-3-secundario-claro-hover:hover, input[type=submit].borde-3-secundario-claro-hover:hover {
  border: 3px solid #26b1f5;
}

.bt-secundario-claro {
  border-top: 1px solid #26b1f5;
}

.bl-secundario-claro {
  border-left: 1px solid #26b1f5;
}

.br-secundario-claro {
  border-right: 1px solid #26b1f5;
}

.bb-secundario-claro {
  border-bottom: 1px solid #26b1f5;
}

.borde-img-secundario-claro img {
  border: 1px solid #26b1f5;
}

.color-terciario-claro, a.color-terciario-claro {
  color: #34ffb3;
}

.link-terciario-claro:hover {
  color: #34ffb3;
}

.focus-terciario-claro:focus {
  color: #34ffb3;
}

.bg-terciario-claro {
  background-color: #34ffb3;
}

.bg-terciario-claro-hover:hover {
  background-color: #34ffb3;
}

hr.linea-terciario-claro {
  border: 0;
  height: 1px;
  background: #34ffb3;
}

.borde-terciario-claro, input[type=submit].borde-terciario-claro {
  border: 1px solid #34ffb3;
}

.borde-terciario-claro-hover:hover, input[type=submit].borde-terciario-claro-hover:hover {
  border: 1px solid #34ffb3;
}

.borde-2-terciario-claro, input[type=submit].borde-2-terciario-claro {
  border: 2px solid #34ffb3;
}

.borde-2-terciario-claro-hover:hover, input[type=submit].borde-2-terciario-claro-hover:hover {
  border: 2px solid #34ffb3;
}

.borde-3-terciario-claro, input[type=submit].borde-3-terciario-claro {
  border: 3px solid #34ffb3;
}

.borde-3-terciario-claro-hover:hover, input[type=submit].borde-3-terciario-claro-hover:hover {
  border: 3px solid #34ffb3;
}

.bt-terciario-claro {
  border-top: 1px solid #34ffb3;
}

.bl-terciario-claro {
  border-left: 1px solid #34ffb3;
}

.br-terciario-claro {
  border-right: 1px solid #34ffb3;
}

.bb-terciario-claro {
  border-bottom: 1px solid #34ffb3;
}

.borde-img-terciario-claro img {
  border: 1px solid #34ffb3;
}

.color-destacado-claro, a.color-destacado-claro {
  color: #eb6d70;
}

.link-destacado-claro:hover {
  color: #eb6d70;
}

.focus-destacado-claro:focus {
  color: #eb6d70;
}

.bg-destacado-claro {
  background-color: #eb6d70;
}

.bg-destacado-claro-hover:hover {
  background-color: #eb6d70;
}

hr.linea-destacado-claro {
  border: 0;
  height: 1px;
  background: #eb6d70;
}

.borde-destacado-claro, input[type=submit].borde-destacado-claro {
  border: 1px solid #eb6d70;
}

.borde-destacado-claro-hover:hover, input[type=submit].borde-destacado-claro-hover:hover {
  border: 1px solid #eb6d70;
}

.borde-2-destacado-claro, input[type=submit].borde-2-destacado-claro {
  border: 2px solid #eb6d70;
}

.borde-2-destacado-claro-hover:hover, input[type=submit].borde-2-destacado-claro-hover:hover {
  border: 2px solid #eb6d70;
}

.borde-3-destacado-claro, input[type=submit].borde-3-destacado-claro {
  border: 3px solid #eb6d70;
}

.borde-3-destacado-claro-hover:hover, input[type=submit].borde-3-destacado-claro-hover:hover {
  border: 3px solid #eb6d70;
}

.bt-destacado-claro {
  border-top: 1px solid #eb6d70;
}

.bl-destacado-claro {
  border-left: 1px solid #eb6d70;
}

.br-destacado-claro {
  border-right: 1px solid #eb6d70;
}

.bb-destacado-claro {
  border-bottom: 1px solid #eb6d70;
}

.borde-img-destacado-claro img {
  border: 1px solid #eb6d70;
}

.color-negro-claro, a.color-negro-claro {
  color: #c5c5c5;
}

.link-negro-claro:hover {
  color: #c5c5c5;
}

.focus-negro-claro:focus {
  color: #c5c5c5;
}

.bg-negro-claro {
  background-color: #c5c5c5;
}

.bg-negro-claro-hover:hover {
  background-color: #c5c5c5;
}

hr.linea-negro-claro {
  border: 0;
  height: 1px;
  background: #c5c5c5;
}

.borde-negro-claro, input[type=submit].borde-negro-claro {
  border: 1px solid #c5c5c5;
}

.borde-negro-claro-hover:hover, input[type=submit].borde-negro-claro-hover:hover {
  border: 1px solid #c5c5c5;
}

.borde-2-negro-claro, input[type=submit].borde-2-negro-claro {
  border: 2px solid #c5c5c5;
}

.borde-2-negro-claro-hover:hover, input[type=submit].borde-2-negro-claro-hover:hover {
  border: 2px solid #c5c5c5;
}

.borde-3-negro-claro, input[type=submit].borde-3-negro-claro {
  border: 3px solid #c5c5c5;
}

.borde-3-negro-claro-hover:hover, input[type=submit].borde-3-negro-claro-hover:hover {
  border: 3px solid #c5c5c5;
}

.bt-negro-claro {
  border-top: 1px solid #c5c5c5;
}

.bl-negro-claro {
  border-left: 1px solid #c5c5c5;
}

.br-negro-claro {
  border-right: 1px solid #c5c5c5;
}

.bb-negro-claro {
  border-bottom: 1px solid #c5c5c5;
}

.borde-img-negro-claro img {
  border: 1px solid #c5c5c5;
}

.color-gris-claro, a.color-gris-claro {
  color: #d1d1d1;
}

.link-gris-claro:hover {
  color: #d1d1d1;
}

.focus-gris-claro:focus {
  color: #d1d1d1;
}

.bg-gris-claro {
  background-color: #d1d1d1;
}

.bg-gris-claro-hover:hover {
  background-color: #d1d1d1;
}

hr.linea-gris-claro {
  border: 0;
  height: 1px;
  background: #d1d1d1;
}

.borde-gris-claro, input[type=submit].borde-gris-claro {
  border: 1px solid #d1d1d1;
}

.borde-gris-claro-hover:hover, input[type=submit].borde-gris-claro-hover:hover {
  border: 1px solid #d1d1d1;
}

.borde-2-gris-claro, input[type=submit].borde-2-gris-claro {
  border: 2px solid #d1d1d1;
}

.borde-2-gris-claro-hover:hover, input[type=submit].borde-2-gris-claro-hover:hover {
  border: 2px solid #d1d1d1;
}

.borde-3-gris-claro, input[type=submit].borde-3-gris-claro {
  border: 3px solid #d1d1d1;
}

.borde-3-gris-claro-hover:hover, input[type=submit].borde-3-gris-claro-hover:hover {
  border: 3px solid #d1d1d1;
}

.bt-gris-claro {
  border-top: 1px solid #d1d1d1;
}

.bl-gris-claro {
  border-left: 1px solid #d1d1d1;
}

.br-gris-claro {
  border-right: 1px solid #d1d1d1;
}

.bb-gris-claro {
  border-bottom: 1px solid #d1d1d1;
}

.borde-img-gris-claro img {
  border: 1px solid #d1d1d1;
}

.color-primario-obscuro, a.color-primario-obscuro {
  color: #006ea9;
}

.link-primario-obscuro:hover {
  color: #006ea9;
}

.focus-primario-obscuro:focus {
  color: #006ea9;
}

.bg-primario-obscuro {
  background-color: #006ea9;
}

.bg-primario-obscuro-hover:hover {
  background-color: #006ea9;
}

hr.linea-primario-obscuro {
  border: 0;
  height: 1px;
  background: #006ea9;
}

.borde-primario-obscuro, input[type=submit].borde-primario-obscuro {
  border: 1px solid #006ea9;
}

.borde-primario-obscuro-hover:hover, input[type=submit].borde-primario-obscuro-hover:hover {
  border: 1px solid #006ea9;
}

.borde-2-primario-obscuro, input[type=submit].borde-2-primario-obscuro {
  border: 2px solid #006ea9;
}

.borde-2-primario-obscuro-hover:hover, input[type=submit].borde-2-primario-obscuro-hover:hover {
  border: 2px solid #006ea9;
}

.borde-3-primario-obscuro, input[type=submit].borde-3-primario-obscuro {
  border: 3px solid #006ea9;
}

.borde-3-primario-obscuro-hover:hover, input[type=submit].borde-3-primario-obscuro-hover:hover {
  border: 3px solid #006ea9;
}

.bt-primario-obscuro {
  border-top: 1px solid #006ea9;
}

.bl-primario-obscuro {
  border-left: 1px solid #006ea9;
}

.br-primario-obscuro {
  border-right: 1px solid #006ea9;
}

.bb-primario-obscuro {
  border-bottom: 1px solid #006ea9;
}

.borde-img-primario-obscuro img {
  border: 1px solid #006ea9;
}

.color-secundario-obscuro, a.color-secundario-obscuro {
  color: #054463;
}

.link-secundario-obscuro:hover {
  color: #054463;
}

.focus-secundario-obscuro:focus {
  color: #054463;
}

.bg-secundario-obscuro {
  background-color: #054463;
}

.bg-secundario-obscuro-hover:hover {
  background-color: #054463;
}

hr.linea-secundario-obscuro {
  border: 0;
  height: 1px;
  background: #054463;
}

.borde-secundario-obscuro, input[type=submit].borde-secundario-obscuro {
  border: 1px solid #054463;
}

.borde-secundario-obscuro-hover:hover, input[type=submit].borde-secundario-obscuro-hover:hover {
  border: 1px solid #054463;
}

.borde-2-secundario-obscuro, input[type=submit].borde-2-secundario-obscuro {
  border: 2px solid #054463;
}

.borde-2-secundario-obscuro-hover:hover, input[type=submit].borde-2-secundario-obscuro-hover:hover {
  border: 2px solid #054463;
}

.borde-3-secundario-obscuro, input[type=submit].borde-3-secundario-obscuro {
  border: 3px solid #054463;
}

.borde-3-secundario-obscuro-hover:hover, input[type=submit].borde-3-secundario-obscuro-hover:hover {
  border: 3px solid #054463;
}

.bt-secundario-obscuro {
  border-top: 1px solid #054463;
}

.bl-secundario-obscuro {
  border-left: 1px solid #054463;
}

.br-secundario-obscuro {
  border-right: 1px solid #054463;
}

.bb-secundario-obscuro {
  border-bottom: 1px solid #054463;
}

.borde-img-secundario-obscuro img {
  border: 1px solid #054463;
}

.color-terciario-obscuro, a.color-terciario-obscuro {
  color: #008050;
}

.link-terciario-obscuro:hover {
  color: #008050;
}

.focus-terciario-obscuro:focus {
  color: #008050;
}

.bg-terciario-obscuro {
  background-color: #008050;
}

.bg-terciario-obscuro-hover:hover {
  background-color: #008050;
}

hr.linea-terciario-obscuro {
  border: 0;
  height: 1px;
  background: #008050;
}

.borde-terciario-obscuro, input[type=submit].borde-terciario-obscuro {
  border: 1px solid #008050;
}

.borde-terciario-obscuro-hover:hover, input[type=submit].borde-terciario-obscuro-hover:hover {
  border: 1px solid #008050;
}

.borde-2-terciario-obscuro, input[type=submit].borde-2-terciario-obscuro {
  border: 2px solid #008050;
}

.borde-2-terciario-obscuro-hover:hover, input[type=submit].borde-2-terciario-obscuro-hover:hover {
  border: 2px solid #008050;
}

.borde-3-terciario-obscuro, input[type=submit].borde-3-terciario-obscuro {
  border: 3px solid #008050;
}

.borde-3-terciario-obscuro-hover:hover, input[type=submit].borde-3-terciario-obscuro-hover:hover {
  border: 3px solid #008050;
}

.bt-terciario-obscuro {
  border-top: 1px solid #008050;
}

.bl-terciario-obscuro {
  border-left: 1px solid #008050;
}

.br-terciario-obscuro {
  border-right: 1px solid #008050;
}

.bb-terciario-obscuro {
  border-bottom: 1px solid #008050;
}

.borde-img-terciario-obscuro img {
  border: 1px solid #008050;
}

.color-destacado-obscuro, a.color-destacado-obscuro {
  color: #921417;
}

.link-destacado-obscuro:hover {
  color: #921417;
}

.focus-destacado-obscuro:focus {
  color: #921417;
}

.bg-destacado-obscuro {
  background-color: #921417;
}

.bg-destacado-obscuro-hover:hover {
  background-color: #921417;
}

hr.linea-destacado-obscuro {
  border: 0;
  height: 1px;
  background: #921417;
}

.borde-destacado-obscuro, input[type=submit].borde-destacado-obscuro {
  border: 1px solid #921417;
}

.borde-destacado-obscuro-hover:hover, input[type=submit].borde-destacado-obscuro-hover:hover {
  border: 1px solid #921417;
}

.borde-2-destacado-obscuro, input[type=submit].borde-2-destacado-obscuro {
  border: 2px solid #921417;
}

.borde-2-destacado-obscuro-hover:hover, input[type=submit].borde-2-destacado-obscuro-hover:hover {
  border: 2px solid #921417;
}

.borde-3-destacado-obscuro, input[type=submit].borde-3-destacado-obscuro {
  border: 3px solid #921417;
}

.borde-3-destacado-obscuro-hover:hover, input[type=submit].borde-3-destacado-obscuro-hover:hover {
  border: 3px solid #921417;
}

.bt-destacado-obscuro {
  border-top: 1px solid #921417;
}

.bl-destacado-obscuro {
  border-left: 1px solid #921417;
}

.br-destacado-obscuro {
  border-right: 1px solid #921417;
}

.bb-destacado-obscuro {
  border-bottom: 1px solid #921417;
}

.borde-img-destacado-obscuro img {
  border: 1px solid #921417;
}

.color-negro-obscuro, a.color-negro-obscuro {
  color: #f3f3f3;
}

.link-negro-obscuro:hover {
  color: #f3f3f3;
}

.focus-negro-obscuro:focus {
  color: #f3f3f3;
}

.bg-negro-obscuro {
  background-color: #f3f3f3;
}

.bg-negro-obscuro-hover:hover {
  background-color: #f3f3f3;
}

hr.linea-negro-obscuro {
  border: 0;
  height: 1px;
  background: #f3f3f3;
}

.borde-negro-obscuro, input[type=submit].borde-negro-obscuro {
  border: 1px solid #f3f3f3;
}

.borde-negro-obscuro-hover:hover, input[type=submit].borde-negro-obscuro-hover:hover {
  border: 1px solid #f3f3f3;
}

.borde-2-negro-obscuro, input[type=submit].borde-2-negro-obscuro {
  border: 2px solid #f3f3f3;
}

.borde-2-negro-obscuro-hover:hover, input[type=submit].borde-2-negro-obscuro-hover:hover {
  border: 2px solid #f3f3f3;
}

.borde-3-negro-obscuro, input[type=submit].borde-3-negro-obscuro {
  border: 3px solid #f3f3f3;
}

.borde-3-negro-obscuro-hover:hover, input[type=submit].borde-3-negro-obscuro-hover:hover {
  border: 3px solid #f3f3f3;
}

.bt-negro-obscuro {
  border-top: 1px solid #f3f3f3;
}

.bl-negro-obscuro {
  border-left: 1px solid #f3f3f3;
}

.br-negro-obscuro {
  border-right: 1px solid #f3f3f3;
}

.bb-negro-obscuro {
  border-bottom: 1px solid #f3f3f3;
}

.borde-img-negro-obscuro img {
  border: 1px solid #f3f3f3;
}

.color-gris-obscuro, a.color-gris-obscuro {
  color: #696969;
}

.link-gris-obscuro:hover {
  color: #696969;
}

.focus-gris-obscuro:focus {
  color: #696969;
}

.bg-gris-obscuro {
  background-color: #696969;
}

.bg-gris-obscuro-hover:hover {
  background-color: #696969;
}

hr.linea-gris-obscuro {
  border: 0;
  height: 1px;
  background: #696969;
}

.borde-gris-obscuro, input[type=submit].borde-gris-obscuro {
  border: 1px solid #696969;
}

.borde-gris-obscuro-hover:hover, input[type=submit].borde-gris-obscuro-hover:hover {
  border: 1px solid #696969;
}

.borde-2-gris-obscuro, input[type=submit].borde-2-gris-obscuro {
  border: 2px solid #696969;
}

.borde-2-gris-obscuro-hover:hover, input[type=submit].borde-2-gris-obscuro-hover:hover {
  border: 2px solid #696969;
}

.borde-3-gris-obscuro, input[type=submit].borde-3-gris-obscuro {
  border: 3px solid #696969;
}

.borde-3-gris-obscuro-hover:hover, input[type=submit].borde-3-gris-obscuro-hover:hover {
  border: 3px solid #696969;
}

.bt-gris-obscuro {
  border-top: 1px solid #696969;
}

.bl-gris-obscuro {
  border-left: 1px solid #696969;
}

.br-gris-obscuro {
  border-right: 1px solid #696969;
}

.bb-gris-obscuro {
  border-bottom: 1px solid #696969;
}

.borde-img-gris-obscuro img {
  border: 1px solid #696969;
}

.no-margin {
  margin: 0 !important;
}

.img-spa-0 img {
  margin: 0 !important;
}

.spa-xl, .m-xl {
  margin: 100px;
}

.spa-lg, .m-lg {
  margin: 50px;
}

.spa, .m {
  margin: 25px;
}

.spa-md, .m-md {
  margin: 15px;
}

.spa-sm, .m-sm {
  margin: 10px;
}

.spa-xs, .m-xs {
  margin: 5px;
}

.spa-0, .m-0 {
  margin: 0 !important;
}

.spa-top-xl, .mt-xl {
  margin-top: 100px;
}

.spa-top-lg, .mt-lg {
  margin-top: 50px;
}

.spa-top, .mt {
  margin-top: 25px;
}

.spa-top-md, .mt-md {
  margin-top: 15px;
}

.spa-top-sm, .mt-sm {
  margin-top: 10px;
}

.spa-top-xs, .mt-xs {
  margin-top: 5px;
}

.spa-top-0, .mt-0 {
  margin-top: 0 !important;
}

.spa-bot-xl, .mb-xl {
  margin-bottom: 100px;
}

.spa-bot-lg, .mb-lg {
  margin-bottom: 50px;
}

.spa-bot, .mb {
  margin-bottom: 25px;
}

.spa-bot-md, .mb-md {
  margin-bottom: 15px;
}

.spa-bot-sm, .mb-sm {
  margin-bottom: 10px;
}

.spa-bot-xs, .mb-xs {
  margin-bottom: 5px;
}

.spa-bot-0, .mb-0 {
  margin-bottom: 0 !important;
}

.spa-der-xl, .mr-xl {
  margin-right: 100px;
}

.spa-der-lg, .mr-lg {
  margin-right: 50px;
}

.spa-der, .mr {
  margin-right: 25px;
}

.spa-der-md, .mr-md {
  margin-right: 15px;
}

.spa-der-sm, .mr-sm {
  margin-right: 10px;
}

.spa-der-xs, .mr-xs {
  margin-right: 5px;
}

.spa-der-0, .mr-0 {
  margin-right: 0 !important;
}

.spa-izq-xl, .ml-xl {
  margin-left: 100px;
}

.spa-izq-lg, .ml-lg {
  margin-left: 50px;
}

.spa-izq, .ml {
  margin-left: 25px;
}

.spa-izq-md, .ml-md {
  margin-left: 15px;
}

.spa-izq-sm, .ml-sm {
  margin-left: 10px;
}

.spa-izq-xs, .ml-xs {
  margin-left: 5px;
}

.spa-izq-0, .ml-0 {
  margin-left: 0 !important;
}

@media (max-width: 1200px) {
  .spa-lg-xl, .m-lg-xl {
    margin: 100px;
  }

  .spa-lg-lg, .m-lg-lg {
    margin: 50px;
  }

  .spa-lg-m, .m-lg-m {
    margin: 25px;
  }

  .spa-lg-md, .m-lg-md {
    margin: 15px;
  }

  .spa-lg-sm, .m-lg-sm {
    margin: 10px;
  }

  .spa-lg-xs, .m-lg-xs {
    margin: 5px;
  }

  .spa-lg-0, .m-lg-0 {
    margin: 0 !important;
  }

  .spa-lg-top-xl, .m-lg-t-xl {
    margin-top: 100px;
  }

  .spa-lg-top-lg, .m-lg-t-lg {
    margin-top: 50px;
  }

  .spa-lg-top, .m-lg-t {
    margin-top: 25px;
  }

  .spa-lg-top-md, .m-lg-t-md {
    margin-top: 15px;
  }

  .spa-lg-top-sm, .m-lg-t-sm {
    margin-top: 10px;
  }

  .spa-lg-top-xs, .m-lg-t-xs {
    margin-top: 5px;
  }

  .spa-lg-top-0, .m-lg-t-0 {
    margin-top: 0 !important;
  }

  .spa-lg-bot-xl, .m-lg-b-xl {
    margin-bottom: 100px;
  }

  .spa-lg-bot-lg, .m-lg-b-lg {
    margin-bottom: 50px;
  }

  .spa-lg-bot, .m-lg-b {
    margin-bottom: 25px;
  }

  .spa-lg-bot-md, .m-lg-b-md {
    margin-bottom: 15px;
  }

  .spa-lg-bot-sm, .m-lg-b-sm {
    margin-bottom: 10px;
  }

  .spa-lg-bot-xs, .m-lg-b-xs {
    margin-bottom: 5px;
  }

  .spa-lg-bot-0, .m-lg-b-0 {
    margin-bottom: 0 !important;
  }

  .spa-lg-der-xl, .m-lg-r-xl {
    margin-right: 100px;
  }

  .spa-lg-der-lg, .m-lg-r-lg {
    margin-right: 50px;
  }

  .spa-lg-der, .m-lg-r {
    margin-right: 25px;
  }

  .spa-lg-der-md, .m-lg-r-md {
    margin-right: 15px;
  }

  .spa-lg-der-sm, .m-lg-r-sm {
    margin-right: 10px;
  }

  .spa-lg-der-xs, .m-lg-r-xs {
    margin-right: 5px;
  }

  .spa-lg-der-0, .m-lg-r-0 {
    margin-right: 0 !important;
  }

  .spa-lg-izq-xl, .m-lg-l-xl {
    margin-left: 100px;
  }

  .spa-lg-izq-lg, .m-lg-l-lg {
    margin-left: 50px;
  }

  .spa-lg-izq, .m-lg-l {
    margin-left: 25px;
  }

  .spa-lg-izq-md, .m-lg-l-md {
    margin-left: 15px;
  }

  .spa-lg-izq-sm, .m-lg-l-sm {
    margin-left: 10px;
  }

  .spa-lg-izq-xs, .m-lg-l-xs {
    margin-left: 5px;
  }

  .spa-lg-izq-0, .m-lg-l-0 {
    margin-left: 0 !important;
  }
}
@media (max-width: 1024px) {
  .spa-md-xl, .m-md-xl {
    margin: 100px;
  }

  .spa-md-lg, .m-md-lg {
    margin: 50px;
  }

  .spa-md-m, .m-md-m {
    margin: 25px;
  }

  .spa-md-md, .m-md-md {
    margin: 15px;
  }

  .spa-md-sm, .m-md-sm {
    margin: 10px;
  }

  .spa-md-xs, .m-md-xs {
    margin: 5px;
  }

  .spa-md-0, .m-md-0 {
    margin: 0 !important;
  }

  .spa-md-top-xl, .m-md-t-xl {
    margin-top: 100px;
  }

  .spa-md-top-lg, .m-md-t-lg {
    margin-top: 50px;
  }

  .spa-md-top, .m-md-t {
    margin-top: 25px;
  }

  .spa-md-top-md, .m-md-t-md {
    margin-top: 15px;
  }

  .spa-md-top-sm, .m-md-t-sm {
    margin-top: 10px;
  }

  .spa-md-top-xs, .m-md-t-xs {
    margin-top: 5px;
  }

  .spa-md-top-0, .m-md-t-0 {
    margin-top: 0 !important;
  }

  .spa-md-bot-xl, .m-md-b-xl {
    margin-bottom: 100px;
  }

  .spa-md-bot-lg, .m-md-b-lg {
    margin-bottom: 50px;
  }

  .spa-md-bot, .m-md-b {
    margin-bottom: 25px;
  }

  .spa-md-bot-md, .m-md-b-md {
    margin-bottom: 15px;
  }

  .spa-md-bot-sm, .m-md-b-sm {
    margin-bottom: 10px;
  }

  .spa-md-bot-xs, .m-md-b-xs {
    margin-bottom: 5px;
  }

  .spa-md-bot-0, .m-md-b-0 {
    margin-bottom: 0 !important;
  }

  .spa-md-der-xl, .m-md-r-xl {
    margin-right: 100px;
  }

  .spa-md-der-lg, .m-md-r-lg {
    margin-right: 50px;
  }

  .spa-md-der, .m-md-r {
    margin-right: 25px;
  }

  .spa-md-der-md, .m-md-r-md {
    margin-right: 15px;
  }

  .spa-md-der-sm, .m-md-r-sm {
    margin-right: 10px;
  }

  .spa-md-der-xs, .m-md-r-xs {
    margin-right: 5px;
  }

  .spa-md-der-0, .m-md-r-0 {
    margin-right: 0 !important;
  }

  .spa-md-izq-xl, .m-md-l-xl {
    margin-left: 100px;
  }

  .spa-md-izq-lg, .m-md-l-lg {
    margin-left: 50px;
  }

  .spa-md-izq, .m-md-l {
    margin-left: 25px;
  }

  .spa-md-izq-md, .m-md-l-md {
    margin-left: 15px;
  }

  .spa-md-izq-sm, .m-md-l-sm {
    margin-left: 10px;
  }

  .spa-md-izq-xs, .m-md-l-xs {
    margin-left: 5px;
  }

  .spa-md-izq-0, .m-md-l-0 {
    margin-left: 0 !important;
  }
}
@media (max-width: 768px) {
  .spa-sm-xl, .m-sm-xl {
    margin: 100px;
  }

  .spa-sm-lg, .m-sm-lg {
    margin: 50px;
  }

  .spa-sm-m, .m-sm-m {
    margin: 25px;
  }

  .spa-sm-md, .m-sm-md {
    margin: 15px;
  }

  .spa-sm-sm, .m-sm-sm {
    margin: 10px;
  }

  .spa-sm-xs, .m-sm-xs {
    margin: 5px;
  }

  .spa-sm-0, .m-sm-0 {
    margin: 0 !important;
  }

  .spa-sm-top-xl, .m-sm-t-xl {
    margin-top: 100px;
  }

  .spa-sm-top-lg, .m-sm-t-lg {
    margin-top: 50px;
  }

  .spa-sm-top, .m-sm-t {
    margin-top: 25px;
  }

  .spa-sm-top-md, .m-sm-t-md {
    margin-top: 15px;
  }

  .spa-sm-top-sm, .m-sm-t-sm {
    margin-top: 10px;
  }

  .spa-sm-top-xs, .m-sm-t-xs {
    margin-top: 5px;
  }

  .spa-sm-top-0, .m-sm-t-0 {
    margin-top: 0 !important;
  }

  .spa-sm-bot-xl, .m-sm-b-xl {
    margin-bottom: 100px;
  }

  .spa-sm-bot-lg, .m-sm-b-lg {
    margin-bottom: 50px;
  }

  .spa-sm-bot, .m-sm-b {
    margin-bottom: 25px;
  }

  .spa-sm-bot-md, .m-sm-b-md {
    margin-bottom: 15px;
  }

  .spa-sm-bot-sm, .m-sm-b-sm {
    margin-bottom: 10px;
  }

  .spa-sm-bot-xs, .m-sm-b-xs {
    margin-bottom: 5px;
  }

  .spa-sm-bot-0, .m-sm-b-0 {
    margin-bottom: 0 !important;
  }

  .spa-sm-der-xl, .m-sm-r-xl {
    margin-right: 100px;
  }

  .spa-sm-der-lg, .m-sm-r-lg {
    margin-right: 50px;
  }

  .spa-sm-der, .m-sm-r {
    margin-right: 25px;
  }

  .spa-sm-der-md, .m-sm-r-md {
    margin-right: 15px;
  }

  .spa-sm-der-sm, .m-sm-r-sm {
    margin-right: 10px;
  }

  .spa-sm-der-xs, .m-sm-r-xs {
    margin-right: 5px;
  }

  .spa-sm-der-0, .m-sm-r-0 {
    margin-right: 0 !important;
  }

  .spa-sm-izq-xl, .m-sm-l-xl {
    margin-left: 100px;
  }

  .spa-sm-izq-lg, .m-sm-l-lg {
    margin-left: 50px;
  }

  .spa-sm-izq, .m-sm-l {
    margin-left: 25px;
  }

  .spa-sm-izq-md, .m-sm-l-md {
    margin-left: 15px;
  }

  .spa-sm-izq-sm, .m-sm-l-sm {
    margin-left: 10px;
  }

  .spa-sm-izq-xs, .m-sm-l-xs {
    margin-left: 5px;
  }

  .spa-sm-izq-0, .m-sm-l-0 {
    margin-left: 0 !important;
  }
}
@media (max-width: 480px) {
  .spa-xs-xl, .m-xs-xl {
    margin: 100px;
  }

  .spa-xs-lg, .m-xs-lg {
    margin: 50px;
  }

  .spa-xs-m, .m-xs-m {
    margin: 25px;
  }

  .spa-xs-md, .m-xs-md {
    margin: 15px;
  }

  .spa-xs-sm, .m-xs-sm {
    margin: 10px;
  }

  .spa-xs-xs, .m-xs-xs {
    margin: 5px;
  }

  .spa-xs-0, .m-xs-0 {
    margin: 0 !important;
  }

  .spa-xs-top-xl, .m-xs-t-xl {
    margin-top: 100px;
  }

  .spa-xs-top-lg, .m-xs-t-lg {
    margin-top: 50px;
  }

  .spa-xs-top, .m-xs-t {
    margin-top: 25px;
  }

  .spa-xs-top-md, .m-xs-t-md {
    margin-top: 15px;
  }

  .spa-xs-top-sm, .m-xs-t-sm {
    margin-top: 10px;
  }

  .spa-xs-top-xs, .m-xs-t-xs {
    margin-top: 5px;
  }

  .spa-xs-top-0, .m-xs-t-0 {
    margin-top: 0 !important;
  }

  .spa-xs-bot-xl, .m-xs-b-xl {
    margin-bottom: 100px;
  }

  .spa-xs-bot-lg, .m-xs-b-lg {
    margin-bottom: 50px;
  }

  .spa-xs-bot, .m-xs-b {
    margin-bottom: 25px;
  }

  .spa-xs-bot-md, .m-xs-b-md {
    margin-bottom: 15px;
  }

  .spa-xs-bot-sm, .m-xs-b-sm {
    margin-bottom: 10px;
  }

  .spa-xs-bot-xs, .m-xs-b-xs {
    margin-bottom: 5px;
  }

  .spa-xs-bot-0, .m-xs-b-0 {
    margin-bottom: 0 !important;
  }

  .spa-xs-der-xl, .m-xs-r-xl {
    margin-right: 100px;
  }

  .spa-xs-der-lg, .m-xs-r-lg {
    margin-right: 50px;
  }

  .spa-xs-der, .m-xs-r {
    margin-right: 25px;
  }

  .spa-xs-der-md, .m-xs-r-md {
    margin-right: 15px;
  }

  .spa-xs-der-sm, .m-xs-r-sm {
    margin-right: 10px;
  }

  .spa-xs-der-xs, .m-xs-r-xs {
    margin-right: 5px;
  }

  .spa-xs-der-0, .m-xs-r-0 {
    margin-right: 0 !important;
  }

  .spa-xs-izq-xl, .m-xs-l-xl {
    margin-left: 100px;
  }

  .spa-xs-izq-lg, .m-xs-l-lg {
    margin-left: 50px;
  }

  .spa-xs-izq, .m-xs-l {
    margin-left: 25px;
  }

  .spa-xs-izq-md, .m-xs-l-md {
    margin-left: 15px;
  }

  .spa-xs-izq-sm, .m-xs-l-sm {
    margin-left: 10px;
  }

  .spa-xs-izq-xs, .m-xs-l-xs {
    margin-left: 5px;
  }

  .spa-xs-izq-0, .m-xs-l-0 {
    margin-left: 0 !important;
  }
}
.padding-xxl, .p-xxl {
  padding: 100px;
}

.padding-xl, .p-xl {
  padding: 50px;
}

.padding-lg, .p-lg {
  padding: 25px;
}

.padding-md, .p-md {
  padding: 15px;
}

.padding, .p {
  padding: 20px;
}

.padding-sm, .p-sm {
  padding: 10px;
}

.padding-xs, .p-xs {
  padding: 5px;
}

.padding-bot-xxl, .pb-xxl {
  padding-bottom: 100px;
}

.padding-bot-xl, .pb-xl {
  padding-bottom: 50px;
}

.padding-bot-lg, .pb-lg {
  padding-bottom: 25px;
}

.padding-bot-md, .pb-md {
  padding-bottom: 15px;
}

.padding-bot, .pb {
  padding-bottom: 20px;
}

.padding-bot-sm, .pb-sm {
  padding-bottom: 10px;
}

.padding-bot-xs, .pb-xs {
  padding-bottom: 5px;
}

.padding-der-xxl, .pr-xxl {
  padding-right: 100px;
}

.padding-der-xl, .pr-xl {
  padding-right: 50px;
}

.padding-der-lg, .pr-lg {
  padding-right: 25px;
}

.padding-der-md, .pr-md {
  padding-right: 15px;
}

.padding-der, .pr {
  padding-right: 20px;
}

.padding-der-sm, .pr-sm {
  padding-right: 10px;
}

.padding-der-xs, .pr-xs {
  padding-right: 5px;
}

.padding-izq-xxl, .pl-xxl {
  padding-left: 100px;
}

.padding-izq-xl, .pl-xl {
  padding-left: 50px;
}

.padding-izq-lg, .pl-lg {
  padding-left: 25px;
}

.padding-izq-md, .pl-md {
  padding-left: 15px;
}

.padding-izq, .pl {
  padding-left: 20px;
}

.padding-izq-sm, .pl-sm {
  padding-left: 10px;
}

.padding-izq-xs, .pl-xs {
  padding-left: 5px;
}

.padding-top-xxl, .pt-xxl {
  padding-top: 100px;
}

.padding-top-xl, .pt-xl {
  padding-top: 50px;
}

.padding-top-lg, .pt-lg {
  padding-top: 25px;
}

.padding-top-md, .pt-md {
  padding-top: 15px;
}

.padding-top, .pt {
  padding-top: 20px;
}

.padding-top-sm, .pt-sm {
  padding-top: 10px;
}

.padding-top-xs, .pt-xs {
  padding-top: 5px;
}

.padding-0, .p-0 {
  padding: 0 !important;
}

.padding-top-0, .pt-0 {
  padding-top: 0 !important;
}

.padding-izq-0, .pl-0 {
  padding-left: 0 !important;
}

.padding-der-0, .pr-0 {
  padding-right: 0 !important;
}

.padding-bot-0, .pb-0 {
  padding-bottom: 0 !important;
}

@media (max-width: 1200px) {
  .padding-lg-xl, .p-lg-xl {
    padding: 100px;
  }

  .padding-lg-lg, .p-lg-lg {
    padding: 50px;
  }

  .padding-lg-.p-lg-t {
    padding: 25px;
  }

  .padding-lg-sm, .p-lg-md {
    padding: 15px;
  }

  .padding-lg-sm, .p-lg-sm {
    padding: 10px;
  }

  .padding-lg-xs, .p-lg-xs {
    padding: 5px;
  }

  .padding-lg-0, .p-lg-0 {
    padding: 0 !important;
  }

  .padding-lg-top-xl, .p-lg-t-xl {
    padding-top: 100px;
  }

  .padding-lg-top-lg, .p-lg-t-lg {
    padding-top: 50px;
  }

  .padding-lg-top, .p-lg-t {
    padding-top: 25px;
  }

  .padding-lg-top-lg, .p-lg-t-md {
    padding-top: 15px;
  }

  .padding-lg-top-sm, .p-lg-t-sm {
    padding-top: 10px;
  }

  .padding-lg-top-xs, .p-lg-t-xs {
    padding-top: 5px;
  }

  .padding-lg-top-0, .p-lg-t-0 {
    padding-top: 0 !important;
  }

  .padding-lg-bot-xl, .p-lg-b-xl {
    padding-bottom: 100px;
  }

  .padding-lg-bot-lg, .p-lg-b-lg {
    padding-bottom: 50px;
  }

  .padding-lg-bot, .p-lg-b {
    padding-bottom: 25px;
  }

  .padding-lg-bot-md, .p-lg-b-md {
    padding-bottom: 15px;
  }

  .padding-lg-bot-sm, .p-lg-b-sm {
    padding-bottom: 10px;
  }

  .padding-lg-bot-xs, .p-lg-b-xs {
    padding-bottom: 5px;
  }

  .padding-lg-bot-0, .p-lg-b-0 {
    padding-bottom: 0 !important;
  }

  .padding-lg-der-xl, .p-lg-r-xl {
    padding-right: 100px;
  }

  .padding-lg-der-lg, .p-lg-r-lg {
    padding-right: 50px;
  }

  .padding-lg-der, .p-lg-r {
    padding-right: 25px;
  }

  .padding-lg-der-md, .p-lg-r-md {
    padding-right: 15px;
  }

  .padding-lg-der-sm, .p-lg-r-sm {
    padding-right: 10px;
  }

  .padding-lg-der-xs, .p-lg-r-xs {
    padding-right: 5px;
  }

  .padding-lg-der-0, .p-lg-r-0 {
    padding-right: 0 !important;
  }

  .padding-lg-izq-xl, .p-lg-l-xl {
    padding-left: 100px;
  }

  .padding-lg-izq-lg, .p-lg-l-lg {
    padding-left: 50px;
  }

  .padding-lg-izq, .p-lg-l {
    padding-left: 25px;
  }

  .padding-lg-izq-md, .p-lg-l-md {
    padding-left: 15px;
  }

  .padding-lg-izq-sm, .p-lg-l-sm {
    padding-left: 10px;
  }

  .padding-lg-izq-xs, .p-lg-l-xs {
    padding-left: 5px;
  }

  .padding-lg-izq-0, .p-lg-l-0 {
    padding-left: 0 !important;
  }
}
@media (max-width: 1024px) {
  .padding-md-xl, .p-md-xl {
    padding: 100px;
  }

  .padding-md-lg, .p-md-lg {
    padding: 50px;
  }

  .padding-md-.p-md-t {
    padding: 25px;
  }

  .padding-md-sm, .p-md-md {
    padding: 15px;
  }

  .padding-md-sm, .p-md-sm {
    padding: 10px;
  }

  .padding-md-xs, .p-md-xs {
    padding: 5px;
  }

  .padding-md-0, .p-md-0 {
    padding: 0 !important;
  }

  .padding-md-top-xl, .p-md-t-xl {
    padding-top: 100px;
  }

  .padding-md-top-lg, .p-md-t-lg {
    padding-top: 50px;
  }

  .padding-md-top, .p-md-t {
    padding-top: 25px;
  }

  .padding-md-top-md, .p-md-t-md {
    padding-top: 15px;
  }

  .padding-md-top-sm, .p-md-t-sm {
    padding-top: 10px;
  }

  .padding-md-top-xs, .p-md-t-xs {
    padding-top: 5px;
  }

  .padding-md-top-0, .p-md-t-0 {
    padding-top: 0 !important;
  }

  .padding-md-bot-xl, .p-md-b-xl {
    padding-bottom: 100px;
  }

  .padding-md-bot-lg, .p-md-b-lg {
    padding-bottom: 50px;
  }

  .padding-md-bot, .p-md-b {
    padding-bottom: 25px;
  }

  .padding-md-bot-md, .p-md-b-md {
    padding-bottom: 15px;
  }

  .padding-md-bot-sm, .p-md-b-sm {
    padding-bottom: 10px;
  }

  .padding-md-bot-xs, .p-md-b-xs {
    padding-bottom: 5px;
  }

  .padding-md-bot-0, .p-md-b-0 {
    padding-bottom: 0 !important;
  }

  .padding-md-der-xl, .p-md-r-xl {
    padding-right: 100px;
  }

  .padding-md-der-lg, .p-md-r-lg {
    padding-right: 50px;
  }

  .padding-md-der, .p-md-r {
    padding-right: 25px;
  }

  .padding-md-der-md, .p-md-r-md {
    padding-right: 15px;
  }

  .padding-md-der-sm, .p-md-r-sm {
    padding-right: 10px;
  }

  .padding-md-der-xs, .p-md-r-xs {
    padding-right: 5px;
  }

  .padding-md-der-0, .p-md-r-0 {
    padding-right: 0 !important;
  }

  .padding-md-izq-xl, .p-md-l-xl {
    padding-left: 100px;
  }

  .padding-md-izq-lg, .p-md-l-lg {
    padding-left: 50px;
  }

  .padding-md-izq, .p-md-l {
    padding-left: 25px;
  }

  .padding-md-izq-md, .p-md-l-md {
    padding-left: 15px;
  }

  .padding-md-izq-sm, .p-md-l-sm {
    padding-left: 10px;
  }

  .padding-md-izq-xs, .p-md-l-xs {
    padding-left: 5px;
  }

  .padding-md-izq-0, .p-md-l-0 {
    padding-left: 0 !important;
  }
}
@media (max-width: 768px) {
  .padding-sm-xl, .p-sm-xl {
    padding: 100px;
  }

  .padding-sm-lg, .p-sm-lg {
    padding: 50px;
  }

  .padding-sm-.p-sm-t {
    padding: 25px;
  }

  .padding-sm-sm, .p-sm-md {
    padding: 15px;
  }

  .padding-sm-sm, .p-sm-sm {
    padding: 10px;
  }

  .padding-sm-xs, .p-sm-xs {
    padding: 5px;
  }

  .padding-sm-0, .p-sm-0 {
    padding: 0 !important;
  }

  .padding-sm-top-xl, .p-sm-t-xl {
    padding-top: 100px;
  }

  .padding-sm-top-lg, .p-sm-t-lg {
    padding-top: 50px;
  }

  .padding-sm-top, .p-sm-t {
    padding-top: 25px;
  }

  .padding-sm-top-sm, .p-sm-t-md {
    padding-top: 15px;
  }

  .padding-sm-top-sm, .p-sm-t-sm {
    padding-top: 10px;
  }

  .padding-sm-top-xs, .p-sm-t-xs {
    padding-top: 5px;
  }

  .padding-sm-top-0, .p-sm-t-0 {
    padding-top: 0 !important;
  }

  .padding-sm-bot-xl, .p-sm-b-xl {
    padding-bottom: 100px;
  }

  .padding-sm-bot-lg, .p-sm-b-lg {
    padding-bottom: 50px;
  }

  .padding-sm-bot, .p-sm-b {
    padding-bottom: 25px;
  }

  .padding-sm-bot-md, .p-sm-b-md {
    padding-bottom: 15px;
  }

  .padding-sm-bot-sm, .p-sm-b-sm {
    padding-bottom: 10px;
  }

  .padding-sm-bot-xs, .p-sm-b-xs {
    padding-bottom: 5px;
  }

  .padding-sm-bot-0, .p-sm-b-0 {
    padding-bottom: 0 !important;
  }

  .padding-sm-der-xl, .p-sm-r-xl {
    padding-right: 100px;
  }

  .padding-sm-der-lg, .p-sm-r-lg {
    padding-right: 50px;
  }

  .padding-sm-der, .p-sm-r {
    padding-right: 25px;
  }

  .padding-sm-der-md, .p-sm-r-md {
    padding-right: 15px;
  }

  .padding-sm-der-sm, .p-sm-r-sm {
    padding-right: 10px;
  }

  .padding-sm-der-xs, .p-sm-r-xs {
    padding-right: 5px;
  }

  .padding-sm-der-0, .p-sm-r-0 {
    padding-right: 0 !important;
  }

  .padding-sm-izq-xl, .p-sm-l-xl {
    padding-left: 100px;
  }

  .padding-sm-izq-lg, .p-sm-l-lg {
    padding-left: 50px;
  }

  .padding-sm-izq, .p-sm-l {
    padding-left: 25px;
  }

  .padding-sm-izq-md, .p-sm-l-md {
    padding-left: 15px;
  }

  .padding-sm-izq-sm, .p-sm-l-sm {
    padding-left: 10px;
  }

  .padding-sm-izq-xs, .p-sm-l-xs {
    padding-left: 5px;
  }

  .padding-sm-izq-0, .p-sm-l-0 {
    padding-left: 0 !important;
  }
}
@media (max-width: 480px) {
  .padding-xs-xl, .p-xs-xl {
    padding: 100px;
  }

  .padding-xs-lg, .p-xs-lg {
    padding: 50px;
  }

  .padding-xs-.p-xs-t {
    padding: 25px;
  }

  .padding-xs-sm, .p-xs-md {
    padding: 15px;
  }

  .padding-xs-sm, .p-xs-sm {
    padding: 10px;
  }

  .padding-xs-xs, .p-xs-xs {
    padding: 5px;
  }

  .padding-xs-0, .p-xs-0 {
    padding: 0 !important;
  }

  .padding-xs-top-xl, .p-xs-t-xl {
    padding-top: 100px;
  }

  .padding-xs-top-lg, .p-xs-t-lg {
    padding-top: 50px;
  }

  .padding-xs-top, .p-xs-t {
    padding-top: 25px;
  }

  .padding-xs-top-xs, .p-xs-t-md {
    padding-top: 15px;
  }

  .padding-xs-top-xs, .p-xs-t-sm {
    padding-top: 10px;
  }

  .padding-xs-top-xs, .p-xs-t-xs {
    padding-top: 5px;
  }

  .padding-xs-top-0, .p-xs-t-0 {
    padding-top: 0 !important;
  }

  .padding-xs-bot-xl, .p-xs-b-xl {
    padding-bottom: 100px;
  }

  .padding-xs-bot-lg, .p-xs-b-lg {
    padding-bottom: 50px;
  }

  .padding-xs-bot, .p-xs-b {
    padding-bottom: 25px;
  }

  .padding-xs-bot-md, .p-xs-b-md {
    padding-bottom: 15px;
  }

  .padding-xs-bot-sm, .p-xs-b-sm {
    padding-bottom: 10px;
  }

  .padding-xs-bot-xs, .p-xs-b-xs {
    padding-bottom: 5px;
  }

  .padding-xs-bot-0, .p-xs-b-0 {
    padding-bottom: 0 !important;
  }

  .padding-xs-der-xl, .p-xs-r-xl {
    padding-right: 100px;
  }

  .padding-xs-der-lg, .p-xs-r-lg {
    padding-right: 50px;
  }

  .padding-xs-der, .p-xs-r {
    padding-right: 25px;
  }

  .padding-xs-der-md, .p-xs-r-md {
    padding-right: 15px;
  }

  .padding-xs-der-sm, .p-xs-r-sm {
    padding-right: 10px;
  }

  .padding-xs-der-xs, .p-xs-r-xs {
    padding-right: 5px;
  }

  .padding-xs-der-0, .p-xs-r-0 {
    padding-right: 0 !important;
  }

  .padding-xs-izq-xl, .p-xs-l-xl {
    padding-left: 100px;
  }

  .padding-xs-izq-lg, .p-xs-l-lg {
    padding-left: 50px;
  }

  .padding-xs-izq, .p-xs-l {
    padding-left: 25px;
  }

  .padding-xs-izq-md, .p-xs-l-md {
    padding-left: 15px;
  }

  .padding-xs-izq-sm, .p-xs-l-sm {
    padding-left: 10px;
  }

  .padding-xs-izq-xs, .p-xs-l-xs {
    padding-left: 5px;
  }

  .padding-xs-izq-0, .p-xs-l-0 {
    padding-left: 0 !important;
  }
}
.opacity {
  transition: all 0.8s;
}
.opacity.hidden {
  opacity: 0;
}
.opacity.show {
  opacity: 1;
}

.show {
  transition: all 0.5s;
  transition-delay: 0.2s;
}
.show.hidden {
  opacity: 0;
  translate: 0 15px;
}
.show.show {
  opacity: 1;
  translate: 0 0;
}

::selection {
  background: #42b6e5;
  color: #ffffff;
}

::-moz-selection {
  background: #000;
  color: #ffffff;
}

.titulo-producto {
  margin-bottom: 20px;
  padding-bottom: 10px;
  color: #42b6e5;
  text-align: center;
  position: relative;
}

span.titulo-producto::before {
  display: block;
  position: absolute;
  top: -20px;
  left: -15px;
  background-color: #afd5ef;
  width: 50px;
  height: 50px;
  content: "";
  z-index: -1;
}

.titulo-componente {
  font-size: 45px;
  font-weight: 400;
  font-weight: 700;
}

.subtitulo-componente {
  color: #42b6e5;
  font-size: 30px;
  font-weight: 400;
}

.subtitulo-componente a {
  transition: all 0.3s ease-out;
  -webkit-transition: all 0.3s ease-out;
  -moz-transition: all 0.3s ease-out;
  -ms-transition: all 0.3s ease-out;
  color: #42b6e5;
}

.titulo-tab {
  position: relative;
  color: #7b7b7b;
  font-size: 20px;
  font-weight: 700;
  text-align: center;
  cursor: pointer;
}
.titulo-tab.activo {
  color: #42b6e5;
}
.titulo-tab.activo:before, .titulo-tab:hover:before {
  content: "";
  position: absolute;
  display: block;
  width: 100%;
  height: 4px;
  position: absolute;
  left: 50%;
  transform: translate(-50%, 0);
  bottom: -5px;
  background-color: #7b7b7b;
}
.titulo-tab.activo:before {
  background-color: #42b6e5;
}

.alt {
  color: #7b7b7b;
  font-size: 14px;
  font-style: italic;
}
.alt:before {
  content: '"';
}
.alt:after {
  content: '"';
}

a {
  color: #42b6e5;
}
a:hover {
  color: #000;
}
a:active, a:focus {
  color: #42b6e5;
}

.box-1 {
  padding: 15px 25px;
  border: 1px solid #d1d1d1;
}

.box-shadow {
  -webkit-box-shadow: 0 2px 0 0px rgba(0, 0, 0, 0.2);
  -moz-box-shadow: 0 2px 0 0px rgba(0, 0, 0, 0.2);
  box-shadow: 0 2px 0 0px rgba(0, 0, 0, 0.2);
}

.rotar-90z {
  -ms-transform: rotate(90deg);
  -webkit-transform: rotate(90deg);
  transform: rotate(90deg);
}

.rotar-90 {
  -ms-transform: rotate(-90deg);
  -webkit-transform: rotate(-90deg);
  transform: rotate(-90deg);
}

.rotar-180 {
  -ms-transform: rotate(-180deg);
  -webkit-transform: rotate(-180deg);
  transform: rotate(-180deg);
}

.opacity-8 {
  opacity: 0.8;
}

.opacity-2 {
  opacity: 0.2;
}

.visible-in-xs {
  display: none;
}

blockquote i {
  font-family: "Open Sans", sans-serif !important;
  line-height: normal;
}

input:-webkit-autofill {
  padding-left: 20px;
  -webkit-box-shadow: 0 0 0px 1000px #ffffff inset;
  -webkit-text-fill-color: #42b6e5 !important;
}

.ul-tick ul {
  margin-top: 10px;
  padding-left: 34px;
  overflow: hidden;
}
.ul-tick ul li {
  position: relative;
  margin-bottom: 10px;
  text-indent: -17px;
}
.ul-tick ul li:last-child {
  margin-bottom: 0;
}
.ul-tick ul li:before {
  margin-right: 15px;
  display: inline-block;
  vertical-align: text-top;
  font-family: "iconos";
  content: "\e923";
  color: #00b370;
}

.tachado {
  text-decoration: line-through;
}

.map-container {
  width: 100%;
}

.map-container iframe {
  width: 100%;
  display: block;
  pointer-events: none;
  position: relative;
  /* IE needs a position other than static */
}

.map-container iframe.clicked {
  pointer-events: auto;
}

.margen_der img {
  margin-right: 50px;
}

.margen_izq img {
  margin-left: 50px;
}

.flecha_slider .swiper-button-next,
.flecha_slider .swiper-button-prev {
  padding: 15px 18px;
  top: 30%;
  font-size: 28px;
  width: auto;
  height: auto;
  background-color: rgba(255, 255, 255, 0.7);
  background-image: none;
}
@media (max-width: 480px) {
  .flecha_slider .swiper-button-next,
.flecha_slider .swiper-button-prev {
    display: none;
  }
}
.flecha_slider .swiper-button-next {
  right: 10px;
}
.flecha_slider .swiper-button-prev {
  left: 10px;
}

.slide-4col-simple .swiper-button-next,
.slide-4col-simple .swiper-button-prev {
  top: 25%;
}

.slide-5col-puntos {
  padding: 0px 5px !important;
  padding-bottom: 50px !important;
}
@media (max-width: 1024px) {
  .slide-5col-puntos {
    padding-bottom: 0 !important;
  }
}
.slide-5col-puntos .flecha-5col-next,
.slide-5col-puntos .flecha-5col-prev {
  padding: 15px 18px;
  top: 40%;
  font-size: 28px;
  width: auto;
  height: auto;
  background-color: rgba(255, 255, 255, 0.5);
  background-image: none;
}
@media (max-width: 480px) {
  .slide-5col-puntos .flecha-5col-next,
.slide-5col-puntos .flecha-5col-prev {
    display: none;
  }
}
.slide-5col-puntos .flecha-5col-next {
  right: 0;
}
.slide-5col-puntos .flecha-5col-prev {
  left: 0;
}
@media (max-width: 1024px) {
  .slide-5col-puntos .pagination-5col {
    display: none;
  }
}
.slide-5col-puntos .pagination-5col.swiper-pagination-bullets {
  bottom: 0px;
}
.slide-5col-puntos .pagination-5col .swiper-pagination-bullet {
  width: 15px;
  height: 15px;
}
.slide-5col-puntos .pagination-5col .swiper-pagination-bullet.swiper-pagination-bullet-active {
  background: #42b6e5;
}

@media (max-width: 1024px) {
  .slide-6col-simple .swiper-lazy-preloader {
    z-index: -1;
  }
}

.flechas {
  background: rgba(0, 0, 0, 0.2);
  color: #ffffff;
  font-size: 36px;
  padding: 15px 10px;
}
.flechas:hover {
  background: rgba(0, 0, 0, 0.8);
}

.slide-3col-simple {
  padding: 15px 10px !important;
  padding-top: 0 !important;
}

.slide-4col-simple {
  padding: 15px 10px !important;
}

.borde1 {
  border: 2px solid #ffffff;
  border-radius: 5px 5px 5px 5px;
  -moz-border-radius: 5px 5px 5px 5px;
  -webkit-border-radius: 5px 5px 5px 5px;
}

.borde2 {
  border: 2px solid #42b6e5;
  border-radius: 5px 5px 5px 5px;
  -moz-border-radius: 5px 5px 5px 5px;
  -webkit-border-radius: 5px 5px 5px 5px;
}

.borde-0 {
  border: none;
}

.size-5 {
  font-size: 5px;
}

.size-6 {
  font-size: 6px;
}

.size-7 {
  font-size: 7px;
}

.size-8 {
  font-size: 8px;
}

.size-9 {
  font-size: 9px;
}

div.tool_jq {
  display: none;
  line-height: 18px;
}

#tool_tip_jq {
  display: none;
  margin: 0 10px 1em 0;
  padding: 12px;
  background: #e4f8ff;
  border: 1px solid #7b7b7b;
  font-size: 1.2em;
  line-height: 12px;
  z-index: 30000;
  -webkit-box-shadow: 3px 3px 3px 0px rgba(0, 0, 0, 0.2);
  -moz-box-shadow: 3px 3px 3px 0px rgba(0, 0, 0, 0.2);
  box-shadow: 3px 3px 3px 0px rgba(0, 0, 0, 0.2);
}

/*////////////////*/
/* FORMULARIOS */
/*////////////////*/
input,
select {
  padding: 0 10px;
  border: 1px solid #d1d1d1;
}

textarea {
  padding: 15px 15px;
  border: 1px solid #d1d1d1;
}

.img_codigo {
  top: 0;
  right: 0;
}

input::-webkit-input-placeholder {
  color: #afd5ef;
  font-size: 13px;
}

input:-moz-placeholder {
  color: #afd5ef;
  font-size: 13px;
  opacity: 1;
}

input::-moz-placeholder {
  color: #afd5ef;
  font-size: 13px;
  opacity: 1;
}

input:-ms-input-placeholder {
  color: #afd5ef;
  font-size: 13px;
}

.btn-radius {
  border-radius: 15px;
}

.btn_border {
  border: 1px solid #7b7b7b;
}

input.contacto,
select.contacto,
textarea.contacto {
  border-radius: initial;
  padding-left: 15px;
  color: #696969;
  font-size: 20px;
  font-family: "Open Sans", sans-serif;
}

input.contacto::-webkit-input-placeholder, select.contacto::-webkit-input-placeholder, textarea.contacto::-webkit-input-placeholder {
  color: #696969;
  font-size: 20px;
}

input.contacto:-moz-placeholder, select.contacto:-moz-placeholder, textarea.contacto:-moz-placeholder {
  color: #696969;
  font-size: 20px;
  opacity: 1;
}

input.contacto::-moz-placeholder, select.contacto::-moz-placeholder, textarea.contacto::-moz-placeholder {
  color: #696969;
  font-size: 20px;
  opacity: 1;
}

input.contacto:-ms-input-placeholder, select.contacto:-ms-input-placeholder, textarea.contacto:-ms-input-placeholder {
  color: #696969;
  font-size: 20px;
}

.reset_button {
  background: white;
  border: 0;
  padding: 0;
}

.reset_button:focus,
.reset_button:focus span[class^=icono-],
.reset_button:focus span[class*=" icono-"] {
  background: #42b6e5;
  color: #ffffff;
  outline: none;
}

/*//////////////////////*/
/*//////////////////////*/
input.suscripcion {
  background: rgba(0, 0, 0, 0);
  border: 1px solid #fff;
  color: #7b7b7b;
  border-radius: 0;
  font-size: 18px;
}

input.suscripcion::-webkit-input-placeholder {
  background: rgba(0, 0, 0, 0);
  color: #7b7b7b;
  border-radius: 0;
  font-size: 18px;
}

input.suscripcion:-moz-placeholder {
  background: rgba(0, 0, 0, 0);
  color: #7b7b7b;
  border-radius: 0;
  font-size: 18px;
  opacity: 1;
}

input.suscripcion::-moz-placeholder {
  background: rgba(0, 0, 0, 0);
  color: #7b7b7b;
  border-radius: 0;
  font-size: 18px;
  opacity: 1;
}

input.suscripcion:-ms-input-placeholder {
  background: rgba(0, 0, 0, 0);
  color: #7b7b7b;
  border-radius: 0;
  font-size: 18px;
}

.bg_suscripcion {
  height: 230px;
  background-image: url(/../imagenes/img_presentacion/suscripcion.jpg);
  background-repeat: no-repeat;
  background-position: center;
  background-size: cover;
}

/*//////////////////////*/
/*//////////////////////*/
.pie_horario {
  padding-left: 140px;
}

/*//////////////////////*/
/*//////////////////////*/
select.filtrado {
  height: 43px;
}

/*//////////////////////*/
/*//////////////////////*/
input.filtrado {
  height: 35px;
}

select.filtrado_precio {
  height: 35px;
  border: 0;
}

/*//////////////////////*/
/*//////////////////////*/
input.cantidad {
  width: 40px;
  height: 35px;
  border: 1px solid #dddddd;
  border-radius: 1px;
  margin-top: -10px;
  color: #7b7b7b;
  text-align: center;
}

input.reguladores {
  border: 1px solid #dddddd;
  border-radius: 0;
  padding: 15px 15px;
  margin: 0;
  color: #7b7b7b;
  background: #fbfbfb;
}

/*//////////////////////*/
/* BUSCADOR AVANZADO */
/*//////////////////////*/
.buscador-avanzado input[type=text] {
  height: 37px;
}

.tab {
  position: relative;
  top: 2px;
  border: 1px solid transparent;
  border-top: 4px solid transparent;
}

.tab.activo {
  border: 1px solid #d1d1d1;
  border-top: 4px solid #42b6e5;
  border-bottom: none;
  background-color: #ffffff;
}

/*////////////////*/
/* CABEZAL */
/*////////////////*/
.logo img.off,
.logo-eco img.off {
  display: none;
}

.cabeZ.fijar {
  top: 0;
  width: 100%;
  background-color: #ffffff;
  -webkit-box-shadow: 3px 3px 3px 0px rgba(0, 0, 0, 0.1);
  -moz-box-shadow: 3px 3px 3px 0px rgba(0, 0, 0, 0.1);
  box-shadow: 3px 3px 3px 0px rgba(0, 0, 0, 0.1);
  z-index: 50;
}
.cabeZ.fijar .logo img.off,
.cabeZ.fijar .logo-eco img.off {
  display: inline-block;
}
.cabeZ.fijar .logo img.on,
.cabeZ.fijar .logo-eco img.on {
  display: none;
}
.cabeZ.fijar .link-afix:hover {
  color: #42b6e5;
}

.cabezal_index {
  position: fixed;
  top: 0;
  left: 0;
}

@media (max-width: 1024px) {
  .cabezal_index {
    position: static;
  }
}
/*////////////////*/
/* MENU */
/*////////////////*/
.menu-a {
  position: relative;
  display: inline-block;
  font-size: 20px;
}
.menu-a a {
  color: #fff;
  display: inline-block;
  padding-right: 15px;
  margin-right: 10px;
  border-right: 2px solid #076694;
}
.menu-a a:hover {
  color: #076694;
}
.menu-a a.ultimo-a {
  margin-right: 0;
  padding-right: 0;
  border-right: none;
}

.cont-menu {
  position: relative;
  z-index: 5;
}

.cont-tipo2 {
  position: relative;
}

.menu.tipo2 {
  position: relative;
}
.menu a {
  text-decoration: none;
}
.menu .menu-nivel1 {
  position: relative;
  display: inline-block;
  font-size: 10px;
  padding-bottom: 15px;
}
.menu .menu-nivel1.tipo2 {
  position: static;
}
.menu .menu-nivel1.tipo2 .cont-menu-nivel2-tipo2 a {
  margin-right: 0;
}
.menu .menu-nivel1 a {
  display: inline-block;
  margin-right: 30px;
  padding-bottom: 10px;
}
.menu .menu-nivel1 a.ultimo {
  margin-right: 0;
  padding-right: 50px;
  border-right: 1px solid #e0e0e0;
}
.menu .menu-nivel1 a.activo {
  color: #076694;
}
.menu .menu-nivel1 a.menu_a {
  font-size: 14px;
}
.menu .menu-nivel1:hover .cont-menu-nivel2 {
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  position: absolute;
  opacity: 1;
  visibility: visible;
  background-color: #ffffff;
  -webkit-box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
  -moz-box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
  box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
}
.menu .menu-nivel1:hover .cont-menu-nivel2-tipo2 {
  top: 100%;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  position: absolute;
  opacity: 1;
  visibility: visible;
  background-color: #ffffff;
  -webkit-box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
  -moz-box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
  box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
}
.menu .menu-nivel1:hover .bloque-menu-nivel2 {
  top: 100%;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  position: absolute;
  opacity: 1;
  visibility: visible;
  background-color: #ffffff;
}

.catalogo-menu-nivel2 {
  padding: 10px;
}
.catalogo-menu-nivel2 a {
  margin-bottom: 10px;
  font-size: 18px;
}

.catalogo-menu-nivel3 {
  padding-left: 10px;
}
.catalogo-menu-nivel3 a {
  font-size: 15px;
}

.cont-menu-nivel2 {
  top: 60%;
  width: 240px;
  position: absolute;
  opacity: 0;
  visibility: hidden;
  z-index: 2;
}
.cont-menu-nivel2.menu-escritorio {
  width: 150px;
}

.cont-menu-nivel2-tipo2 {
  top: 80%;
  left: 0;
  width: 100%;
  position: absolute;
  opacity: 0;
  visibility: hidden;
  z-index: 2;
}
.cont-menu-nivel2-tipo2.menu-escritorio {
  width: 150px;
}

.cont-menu-nivel2.submenu-der {
  right: 0;
}

.bloque-menu-nivel2 {
  padding: 20px;
  left: 0;
  width: 100%;
  position: absolute;
  opacity: 0;
  visibility: hidden;
  border: 1px solid #d1d1d1;
  border-top: 3px solid;
  z-index: 16;
}

.menu .menu-nivel2 {
  position: relative;
}
.menu .menu-nivel2 a {
  display: block;
  margin: 0 10px;
  padding: 10px;
  color: #000;
  font-size: 14px;
  border-bottom: 1px solid #e4f8ff;
}
.menu .menu-nivel2 a:hover {
  color: #42b6e5;
}
.menu .menu-nivel2 a.ultimo {
  margin-bottom: 5px;
  border-bottom: none;
}
.menu .menu-nivel2:hover .cont-menu-nivel3 {
  top: 0;
  left: 100%;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  position: absolute;
  opacity: 1;
  visibility: visible;
  background-color: #ffffff;
  -webkit-box-shadow: 4px 5px 6px 0px rgba(24, 24, 28, 0.3);
  -moz-box-shadow: 4px 5px 6px 0px rgba(24, 24, 28, 0.3);
  box-shadow: 4px 5px 6px 0px rgba(24, 24, 28, 0.3);
}

.cont-menu-nivel3 {
  left: 90%;
  width: 200px;
  position: absolute;
  opacity: 0;
  visibility: hidden;
}

.menu_b {
  position: fixed;
  top: 25%;
  right: 0;
  z-index: 20;
}

.menu_b_titulo {
  opacity: 0;
}

/*////////////////*/
/* MENU - ESCRITORIO */
/*////////////////*/
.cont-escritorio-menu {
  position: relative;
  z-index: 6;
}

.escritorio-menu a {
  text-decoration: none;
}
.escritorio-menu .escritorio-menu-nivel1 {
  position: relative;
  padding-bottom: 10px;
  display: inline-block;
}
.escritorio-menu .escritorio-menu-nivel1 a {
  display: inline-block;
  font-size: 15px;
}
.escritorio-menu .escritorio-menu-nivel1 a.ultimo {
  margin-right: 0;
}
.escritorio-menu .escritorio-menu-nivel1 a.escritorio-menu_a {
  font-size: 14px;
}
.escritorio-menu .escritorio-menu-nivel1:hover .cont-escritorio-menu-nivel2 {
  padding: 5px 0;
  top: 100%;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  position: absolute;
  opacity: 1;
  visibility: visible;
  background-color: #42b6e5;
  border-radius: 4px;
  -webkit-box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
  -moz-box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
  box-shadow: 0px 0px 2px 0px rgba(24, 24, 28, 0.3);
}
.escritorio-menu .escritorio-menu-nivel1:hover .bloque-escritorio-menu-nivel2 {
  top: 100%;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  position: absolute;
  opacity: 1;
  visibility: visible;
  background-color: #ffffff;
}

.cont-escritorio-menu-nivel2 {
  top: 80%;
  width: 285px;
  position: absolute;
  opacity: 0;
  visibility: hidden;
  z-index: 1;
}

.cont-escritorio-menu-nivel2.subescritorio-menu-der {
  right: 0;
}

.bloque-escritorio-menu-nivel2 {
  padding: 20px;
  left: 0;
  width: 100%;
  position: absolute;
  opacity: 0;
  visibility: hidden;
  border: 1px solid #d1d1d1;
  border-top: 3px solid;
  z-index: 16;
}

.escritorio-menu .escritorio-menu-nivel2 {
  position: relative;
}
.escritorio-menu .escritorio-menu-nivel2 a {
  display: block;
  margin: 0 10px;
  padding: 10px;
  color: #ffffff;
  font-size: 15px;
  border-bottom: 1px solid #126ea8;
}
.escritorio-menu .escritorio-menu-nivel2 a:hover {
  color: #bf1a1e;
}
.escritorio-menu .escritorio-menu-nivel2 a.ultimo {
  margin-bottom: 5px;
  border-bottom: none;
}

.icon-menu-resp {
  top: -5px;
}

.ui-datepicker select.ui-datepicker-month,
.ui-datepicker select.ui-datepicker-year {
  width: 39% !important;
  height: 24px;
  padding: 5px 10px;
  margin: 0 5px !important;
}

/*//////////////////////////*/
/* PORTADAS */
/*//////////////////////////*/
/*//////////////////////////*/
/* PORTADA A */
/*//////////////////////////*/
.cont-portada_a {
  position: relative;
  margin-bottom: 35px;
  min-height: 500px;
}
@media (max-width: 480px) {
  .cont-portada_a {
    min-height: auto;
  }
}
.cont-portada_a .cont-portada_a_slider {
  display: block;
}
.cont-portada_a .swiper-slide {
  background-color: #ffffff;
}
.cont-portada_a figure {
  margin-bottom: 0;
  text-align: center;
}
.cont-portada_a figure img {
  margin: 0 auto;
}
.cont-portada_a .flechas_slider_a {
  position: absolute;
  width: 100%;
  top: 50%;
  left: 0;
}
.cont-portada_a .flechas_slider_a .flecha_slider {
  opacity: 1;
  position: absolute;
  top: calc(50% - 8px);
  margin: 0 13px;
  color: #000;
  cursor: pointer;
  z-index: 10;
}
.cont-portada_a .flechas_slider_a .flecha_slider.next {
  right: 0;
}
.cont-portada_a .flechas_slider_a .flecha_slider.prev {
  left: 0;
}
.cont-portada_a .flechas_slider_a .flecha_slider span {
  font-size: 50px;
}
.cont-portada_a .flechas_slider_a .flecha_slider.swiper-button-disabled {
  opacity: 0;
}
.cont-portada_a .cont-portada_a_fig {
  width: 100% !important;
  text-align: center;
  padding-left: 50px;
  padding-right: 50px;
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
}
.cont-portada_a .titulo {
  position: absolute;
  width: 100%;
  bottom: 0;
  left: 0;
  padding: 20px;
  padding-bottom: 2%;
  text-align: center;
  color: #ffffff;
  background: url(/imagenes/img_presentacion/loader.gif) center center no-repeat;
  background: -moz-linear-gradient(top, rgba(0, 0, 0, 0) 15%, rgba(0, 0, 0, 0.65) 100%);
  background: -webkit-gradient(linear, left top, left bottom, color-stop(15%, rgba(0, 0, 0, 0)), color-stop(100%, rgba(0, 0, 0, 0.65)));
  background: -webkit-linear-gradient(top, rgba(0, 0, 0, 0) 15%, rgba(0, 0, 0, 0.65) 100%);
  background: -o-linear-gradient(top, rgba(0, 0, 0, 0) 15%, rgba(0, 0, 0, 0.65) 100%);
  background: -ms-linear-gradient(top, rgba(0, 0, 0, 0) 15%, rgba(0, 0, 0, 0.65) 100%);
  background: linear-gradient(to bottom, rgba(0, 0, 0, 0) 15%, rgba(0, 0, 0, 0.65) 100%);
  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#00000000", endColorstr="#a6000000",GradientType=0 );
}
.cont-portada_a .titulo h2 {
  font-size: 30px;
  line-height: 1;
}
@media (max-width: 480px) {
  .cont-portada_a .titulo h2 {
    font-size: 18px;
  }
}
.cont-portada_a .titulo h2 a {
  display: inline-block;
  color: #ffffff;
  font-weight: 700;
  text-decoration: none;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
.cont-portada_a .titulo h2 a:hover {
  color: #afd5ef;
}
.cont-portada_a .titulo h3 {
  margin-bottom: 0;
  font-size: 30px;
  color: #42b6e5;
  text-transform: uppercase;
}
@media (max-width: 480px) {
  .cont-portada_a .titulo h3 {
    font-size: 20px;
  }
}
.cont-portada_a .titulo h3:hover a {
  color: #42b6e5;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
.cont-portada_a .titulo h3 a {
  color: #ffffff;
}
.cont-portada_a .titulo h3 p {
  margin-bottom: 0;
}
.cont-portada_a span {
  font-size: 50px !important;
}

.portada_b_c, .portada_e {
  max-width: 1400px;
  margin-bottom: 50px;
}
.portada_b_c article, .portada_e article {
  position: relative;
}
.portada_b_c article a, .portada_e article a {
  text-decoration: none;
}
.portada_b_c article .ico_ampliar, .portada_e article .ico_ampliar {
  position: absolute;
  font-family: "iconos";
  display: block;
  width: 100%;
  top: 80px;
  font-size: 60px;
  color: #ffffff;
  text-align: center;
  opacity: 0;
  z-index: 2;
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
}
.portada_b_c article .ico_ampliar:before, .portada_e article .ico_ampliar:before {
  content: "\e908";
}
.portada_b_c article.estilo_1 img, .portada_e article.estilo_1 img {
  min-width: 350px;
  max-width: 350px;
  min-height: 250px;
  max-height: 250px;
}
.portada_b_c article.estilo_2 img, .portada_e article.estilo_2 img {
  min-width: 700px;
  max-width: 700px;
  min-height: 250px;
  max-height: 250px;
}
.portada_b_c article.estilo_2.vertical img, .portada_e article.estilo_2.vertical img {
  min-width: 350px;
  max-width: 350px;
  min-height: 500px;
  max-height: 500px;
}
.portada_b_c article.estilo_4 img, .portada_e article.estilo_4 img {
  min-width: 700px;
  max-width: 700px;
  min-height: 500px;
  max-height: 500px;
}
.portada_b_c article.video .ico_ampliar, .portada_e article.video .ico_ampliar {
  top: calc(50% - 35px);
  opacity: 1;
}
.portada_b_c article.video .ico_ampliar:before, .portada_e article.video .ico_ampliar:before {
  color: #ffffff !important;
  content: "\e91a";
}
.portada_b_c article > .titular, .portada_e article > .titular {
  position: absolute;
  bottom: 0;
  width: 100%;
  padding: 30px 40px;
}
.portada_b_c article > .titular:before, .portada_e article > .titular:before {
  content: "";
  position: absolute;
  display: block;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background: -moz-linear-gradient(top, rgba(0, 0, 0, 0) 5%, rgba(0, 0, 0, 0.8) 100%);
  background: -webkit-gradient(linear, left top, left bottom, color-stop(5%, rgba(0, 0, 0, 0)), color-stop(100%, rgba(0, 0, 0, 0.8)));
  background: -webkit-linear-gradient(top, rgba(0, 0, 0, 0) 5%, rgba(0, 0, 0, 0.8) 100%);
  background: -o-linear-gradient(top, rgba(0, 0, 0, 0) 5%, rgba(0, 0, 0, 0.8) 100%);
  background: -ms-linear-gradient(top, rgba(0, 0, 0, 0) 5%, rgba(0, 0, 0, 0.8) 100%);
  background: linear-gradient(to bottom, rgba(0, 0, 0, 0) 5%, rgba(0, 0, 0, 0.8) 100%);
  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#00000000", endColorstr="#a6000000",GradientType=0 );
}
.portada_b_c article div.cont-video, .portada_e article div.cont-video {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  padding: 0;
}
.portada_b_c article figure, .portada_e article figure {
  position: relative;
  margin: 0;
  overflow: hidden;
  display: block;
  background: #000;
}
@media (max-width: 480px) {
  .portada_b_c article figure, .portada_e article figure {
    text-align: center;
  }
  .portada_b_c article figure img, .portada_e article figure img {
    width: 100%;
  }
}
.portada_b_c article figure img, .portada_e article figure img {
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
  image-rendering: optimizeQuality;
  -moz-image-rendering: optimizeQuality;
  -webkit-image-rendering: optimizeQuality;
}
@media (max-width: 1024px) {
  .portada_b_c article figure img, .portada_e article figure img {
    min-width: auto !important;
    max-width: auto !important;
    min-height: auto !important;
    max-height: auto !important;
    width: 100%;
  }
}
.portada_b_c article h3, .portada_e article h3,
.portada_b_c article h4,
.portada_e article h4 {
  position: relative;
  margin-top: 0;
  margin-bottom: 0;
  font-size: 17px;
  font-weight: 600;
  color: #ffffff;
  z-index: 1;
}
.portada_b_c article h3 a, .portada_e article h3 a,
.portada_b_c article h4 a,
.portada_e article h4 a {
  color: #ffffff;
}
.portada_b_c article h4, .portada_e article h4 {
  margin-bottom: 0;
  font-weight: 300;
  font-size: 18px;
  text-transform: uppercase;
  color: #ffffff;
}
.portada_b_c article h4 a, .portada_e article h4 a {
  color: #ffffff;
}
@media (max-width: 480px) {
  .portada_b_c article h4, .portada_e article h4 {
    font-size: 15px;
  }
}
.portada_b_c article.estilo_4 > .titular h3, .portada_e article.estilo_4 > .titular h3 {
  font-weight: 700;
  font-size: 22px;
}
@media (max-width: 480px) {
  .portada_b_c article.estilo_4 > .titular h3, .portada_e article.estilo_4 > .titular h3 {
    font-size: 15px;
  }
}
.portada_b_c article.estilo_4 .ico_ampliar, .portada_e article.estilo_4 .ico_ampliar {
  top: 60px;
  font-size: 80px;
}
.portada_b_c article.estilo_4.video .ico_ampliar, .portada_e article.estilo_4.video .ico_ampliar {
  top: calc(50% - 40px);
}
.portada_b_c article p, .portada_e article p {
  height: 120px;
  font-size: 13px;
  color: #7b7b7b;
}
.portada_b_c article:hover .ico_ampliar, .portada_e article:hover .ico_ampliar {
  top: calc(50% - 35px);
  opacity: 1;
}
.portada_b_c article:hover figure img, .portada_e article:hover figure img {
  opacity: 0.5;
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
}
.portada_b_c article .video-container, .portada_e article .video-container {
  padding-bottom: 68.25%;
  padding-top: 30px;
  z-index: 1;
}
.portada_b_c article .ver_noticia, .portada_e article .ver_noticia {
  position: absolute;
  top: 0;
  right: 0;
  z-index: 1;
}
.portada_b_c article .ver_noticia a, .portada_e article .ver_noticia a {
  padding: 5px 10px;
  display: inline-block;
  font-size: 11px;
  font-weight: 700;
  color: #006ea9;
  background-color: #d1d1d1;
  opacity: 0.8;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
.portada_b_c article .ver_noticia a:hover, .portada_e article .ver_noticia a:hover {
  color: #42b6e5;
  opacity: 1;
}

.titulo-portada {
  position: relative;
}
.titulo-portada:before {
  position: absolute;
  width: 100%;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
  content: attr(data-titulo);
  font-size: 110px;
  color: #00b4ea;
  z-index: -1;
}
@media (max-width: 480px) {
  .titulo-portada:before {
    display: none;
  }
}

.bg_portadac {
  background-image: url(/../imagenes/img_presentacion/bg-portadac.jpg);
  background-repeat: no-repeat;
  background-position: center;
  background-size: cover;
}

.portada-a-slider {
  top: 50%;
}
.portada-a-slider .swiper-pagination-bullet {
  display: block;
  vertical-align: middle;
  width: 16px;
  height: 16px;
  opacity: 0.6;
  margin-bottom: 10px;
  border: 2px solid #ffffff;
  color: #ffffff;
  background: rgba(0, 0, 0, 0);
}
.portada-a-slider .swiper-pagination-bullet-active {
  display: block;
  vertical-align: middle;
  width: 15px;
  height: 15px;
  margin-bottom: 10px;
  color: #ffffff;
  background: #ffffff;
  opacity: 1;
}
.portada-a-slider .swiper-button-prev {
  vertical-align: middle;
  position: initial;
  opacity: 0.5;
  margin-right: 10px;
}
.portada-a-slider .swiper-button-prev:hover {
  opacity: 1;
}
.portada-a-slider .swiper-button-next {
  vertical-align: middle;
  position: initial;
  opacity: 0.5;
}
.portada-a-slider .swiper-button-next:hover {
  opacity: 1;
}

.portada-b-slider {
  margin-top: -5px;
}

.portada_e {
  max-width: 100%;
  position: relative;
  height: 660px;
}
.portada_e article h3 {
  font-weight: 700;
  font-size: 22px;
}
@media (max-width: 480px) {
  .portada_e article h3 {
    font-size: 15px;
  }
}
.portada_e article h4 {
  margin-bottom: 0;
  font-weight: 300;
  font-size: 18px;
  text-transform: uppercase;
  color: #ffffff;
}
@media (max-width: 480px) {
  .portada_e article h4 {
    font-size: 15px;
  }
}
.portada_e article .video-container {
  padding-bottom: 53.7%;
  padding-top: 30px;
  z-index: 1;
}
.portada_e .estilo_5 {
  position: absolute;
  width: 100%;
  height: 100%;
  top: 0;
  left: 0;
}
.portada_e .estilo_5.noimg {
  background: #000;
}
.portada_e .estilo_5 .container-video {
  max-width: 1120px;
  height: 660px;
}
.portada_e .estilo_5 .ico_ampliar {
  position: absolute;
  font-family: "iconos";
  display: block;
  width: 100%;
  top: 80px;
  font-size: 60px;
  color: #ffffff;
  text-align: center;
  opacity: 0;
  z-index: 2;
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
  text-shadow: 0 0 6px #000;
  top: calc(50% - 35px);
  opacity: 1;
}
.portada_e .estilo_5 .ico_ampliar:before {
  content: "\e908";
}
.portada_e .estilo_5 .ico_ampliar:before {
  color: #ffffff !important;
  content: "\e91a";
}
.portada_e .estilo_5 .titular {
  position: absolute;
  bottom: 0;
  width: 100%;
  padding: 30px 40px;
  color: #fff;
  text-shadow: 0 0 3px #000;
}
.portada_e .estilo_5 .titular a {
  color: #fff;
  font-weight: 700;
  font-size: 22px;
  text-decoration: none;
}
.portada_e .estilo_5 div.cont-video {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  padding: 0;
}

.buscador-simple {
  padding: 40px 30px;
}

.buscador {
  display: none;
  position: fixed;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  z-index: 900;
  background-color: rgba(237, 48, 106, 0.9);
}

.buscador-contendor {
  position: relative;
  top: 30%;
}

.buscador-cerrar {
  position: fixed;
  top: 0;
  right: 20%;
  margin: 25px;
  margin-top: 65px;
}

input.buscador_principal {
  height: 54px;
  background-color: rgba(0, 0, 0, 0);
  border: none;
  font-size: 13px;
  padding-top: 5px;
  padding-left: 40px;
  color: #afd5ef;
  appearance: initial;
  -moz-appearance: initial;
  -webkit-appearance: initial;
}
input.buscador_principal:focus {
  outline: none;
  border: 0;
  box-shadow: none;
}

input.buscador_principal::-webkit-input-placeholder {
  color: #afd5ef;
  font-size: 13px;
}

input.buscador_principal:-moz-placeholder {
  color: #afd5ef;
  font-size: 13px;
  opacity: 1;
}

input.buscador_principal::-moz-placeholder {
  color: #afd5ef;
  font-size: 13px;
  opacity: 1;
}

input.buscador_principal:-ms-input-placeholder {
  color: #afd5ef;
  font-size: 13px;
}

@media (max-width: 480px) {
  input.buscador_principal {
    padding-left: 35px;
  }
}
#slides {
  height: 690px;
  background-color: #42b6e5;
}

.over-img, .cont-galeria-video h3, .cont-video_contenido h3, .jugador figure aside, .autoridad figure aside {
  width: 100%;
  background: rgba(19, 19, 19, 0);
  background: -moz-linear-gradient(top, rgba(19, 19, 19, 0) 0%, black 100%);
  background: -webkit-gradient(left top, left bottom, color-stop(0%, rgba(19, 19, 19, 0)), color-stop(100%, black));
  background: -webkit-linear-gradient(top, rgba(19, 19, 19, 0) 0%, black 100%);
  background: -o-linear-gradient(top, rgba(19, 19, 19, 0) 0%, black 100%);
  background: -ms-linear-gradient(top, rgba(19, 19, 19, 0) 0%, black 100%);
  background: linear-gradient(to bottom, rgba(19, 19, 19, 0) 0%, black 100%);
  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#131313", endColorstr="#000000", GradientType=0 );
}

.mas_detalles span {
  margin-top: 12px;
  opacity: 0;
}
.mas_detalles:hover {
  padding-left: 40px;
}
.mas_detalles:hover span {
  opacity: 1;
}

/*///////////////////////////////////////////////////////////////////////*/
/*///////////////////////////////////////////////////////////////////////*/
.banner_a {
  position: absolute;
  right: 0;
  top: 0;
}
.banner_a img {
  margin: 0;
}
@media (max-width: 1024px) {
  .banner_a img {
    position: static;
  }
}
.banner_a .alt {
  display: none;
}

/*///////////////////////////////////////////////////////////////////////*/
/* PRESENTACION */
/*///////////////////////////////////////////////////////////////////////*/
.cont_slide_contenido {
  overflow: hidden;
  border-bottom: 3px solid #42b6e5;
}
.cont_slide_contenido.login {
  height: 640px;
}
.cont_slide_contenido.proyecto {
  height: 500px;
  background-position: 50% 50%;
  background-repeat: no-repeat;
  background-size: cover;
}

.slide_contenido {
  width: 100%;
  text-align: center;
  position: absolute;
  top: 50%;
  transform: translate(0, -50%);
}

.cont_slide_contenido img {
  max-width: none;
  width: auto;
  left: calc(50% - 960px);
  position: absolute;
}

.flecha_top {
  background-color: #207bbb;
  padding: 15px 8px;
  position: fixed;
  right: 0;
  bottom: 160px;
  margin-right: 30px;
  z-index: 20;
  text-decoration: none;
  border-radius: 7px 7px 7px 7px;
  -moz-border-radius: 7px 7px 7px 7px;
  -webkit-border-radius: 7px 7px 7px 7px;
  border: 0px solid #000000;
}
@media (max-width: 1024px) {
  .flecha_top {
    display: none !important;
  }
}

.btn_flecha_propiedad {
  position: relative;
  width: 45px;
  height: 45px;
  top: 25px;
  top: 22.5px;
  text-align: center;
  line-height: 45px;
}

.pie_borde {
  border-top: 4px solid #076694;
}

.numeracion-indice {
  margin-right: 10px;
  width: 30px;
  height: 30px;
  border-radius: 50%;
  text-align: center;
  line-height: 30px;
  vertical-align: initial;
}

.fotos img {
  width: 110px;
  border: 1px solid #d1d1d1;
}

.fotos.activo img {
  border: 1px solid #42b6e5;
}

.slider-fotos {
  padding: 0 40px;
}

.mini-foto-producto.slick-main-active img {
  border: 1px solid #42b6e5;
}

.mini-foto-producto img {
  width: 100px;
  height: 100px;
  border: 1px solid #d1d1d1;
}

.mini-foto-producto {
  cursor: pointer;
}

.slick-slider {
  margin-bottom: 40px !important;
}

.flecha-fotos-producto {
  position: absolute;
  top: 50%;
  top: calc(50% - 18px);
  padding: 10px 6px;
  color: #696969;
  font-size: 18px;
  border-radius: 4px;
  background-color: #d1d1d1;
  cursor: pointer;
}

.flecha-fotos-producto.slick-disabled {
  color: #7b7b7b;
}

.flecha-fotos-producto.izquierda {
  left: 0;
}

.flecha-fotos-producto.derecha {
  right: 0;
}

.foto_galeria {
  display: inline-block;
  width: 100%;
  height: 280px;
  overflow: hidden;
  background-repeat: no-repeat;
  background-position: center;
  background-size: auto 130%;
  transition: all 0.5s ease-out;
  -webkit-transition: all 0.5s ease-out;
  -moz-transition: all 0.5s ease-out;
  -ms-transition: all 0.5s ease-out;
  transition-timing-function: ease-in;
  image-rendering: optimizeQuality;
  -moz-image-rendering: optimizeQuality;
  -webkit-image-rendering: optimizeQuality;
}
.foto_galeria:hover {
  opacity: 0.8;
  background-size: auto 100%;
  transition: all 2s ease-out;
  -webkit-transition: all 2s ease-out;
  -moz-transition: all 2s ease-out;
  -ms-transition: all 2s ease-out;
}

.galeria_producto_ultima {
  background: rgba(0, 0, 0, 0.8);
  color: #ffffff;
  position: absolute;
  height: 100%;
  width: 100%;
  top: 0;
  left: 0;
}
.galeria_producto_ultima p {
  background: none;
  top: 45%;
  font-size: 18px;
}

/* .paginacion_contenedor {
	text-align: center;
}
.paginacion {
	// float: left;
	display: inline-block;
	li{ 
		display: inline-block;

		a:hover{
			background-color: $colorPrimario;
			color: $colorBlanco;
			span{
				color: $colorBlanco;
			}
		}

	}
	a, &.activo {
		display: inline-block; 
		margin: 0 $espacioMini;
		@include color($colorGrisObscuro);
		font-size: $textoExtra;
		padding: $espacioMedio 20px;
		border-radius: 3px;
		@include transition(.2s);
		// @include color($colorGrisClaro,true);
		border: 1px solid $colorGris;

	}
	}	 */
.flechas_paginacion a {
  color: #ffffff;
  background: #076694;
  margin: 0px 10px;
  border: 0;
  font-size: 36px;
}
.flechas_paginacion a:hover {
  color: #076694;
  background: none;
  border: none;
}
.flechas_paginacion.activo {
  color: #ffffff;
  background-color: #076694;
  border: 1px solid #076694;
}

.active a {
  background-color: #076694;
  color: #ffffff;
}

.img_pag_activo {
  display: inline-block;
  margin-right: 10px;
  font-size: 20px;
  background: #42b6e5;
  color: #ffffff;
  padding: 5px 15px;
  border-radius: 4px;
  text-align: center;
}

.img_pag {
  display: inline-block;
  margin-right: 10px;
  font-size: 20px;
  color: #42b6e5;
  padding: 5px 15px;
  border-radius: 4px;
  text-align: center;
}

.mostrar {
  padding: 8px 12px;
  border: 1px solid #d1d1d1;
  font-size: 18px;
  border-radius: 10%;
  color: #7b7b7b;
}
.mostrar:hover {
  background-color: #000;
  color: #ffffff;
  border: 1px solid #000;
}

.activo_mostrar {
  padding: 8px 12px;
  font-size: 18px;
  border-radius: 10%;
  background-color: #000;
  color: #ffffff;
}
.activo_mostrar:hover {
  color: #ffffff;
}

.alert,
.mensaje {
  font-family: "Open Sans", sans-serif;
  position: relative;
  padding: 20px;
  margin-bottom: 15px;
  font-size: 16px;
  color: #ffffff;
  border: 2px solid #076694;
  background-color: #ffffff;
  color: #076694;
}
.alert p,
.mensaje p {
  margin: 0;
  line-height: normal;
}
.alert.alert-padding-sm,
.mensaje.alert-padding-sm {
  padding: 10px;
}
.alert::before,
.mensaje::before {
  display: block;
  position: absolute;
  font-family: "iconos";
  content: "\e925";
  width: 100%;
  top: -12px;
  left: -10px;
  color: #42b6e5;
  text-align: left;
  font-size: 26px;
  text-shadow: 0px 0px 6px #ffffff;
}

.alert_carrito {
  position: relative;
  padding: 20px;
  margin-bottom: 15px;
  font-size: 12px;
  color: #ffffff;
  border: 3px solid #076694;
  background-color: #ffffff;
  color: #696969;
}
.alert_carrito p {
  margin: 0;
  line-height: normal;
}
.alert_carrito.alert-padding-sm {
  padding: 10px;
}
.alert_carrito::before {
  display: block;
  position: absolute;
  font-family: "iconos";
  content: "\e925";
  width: 100%;
  top: -12px;
  left: -10px;
  color: #42b6e5;
  text-align: left;
  font-size: 45px;
  text-shadow: 0px 0px 6px #ffffff;
}

/*///////////////////////////////////*/
/* MENU LATERAL FIJO */
/*///////////////////////////////////*/
.cont-menu_lateral_fijo {
  position: fixed;
  top: 25%;
  right: 0;
  z-index: 20;
}
@media (max-width: 1024px) {
  .cont-menu_lateral_fijo {
    top: auto;
    bottom: 0;
    width: 100%;
    text-align: center;
    background-color: #ffffff;
    -webkit-box-shadow: 0px -5px 22px 0px rgba(0, 0, 0, 0.29);
    -moz-box-shadow: 0px -5px 22px 0px rgba(0, 0, 0, 0.29);
    box-shadow: 0px -5px 22px 0px rgba(0, 0, 0, 0.29);
  }
  .cont-menu_lateral_fijo > div {
    display: inline-block;
  }
  .cont-menu_lateral_fijo .menu_lateral_fijo-titulo {
    display: none !important;
  }
}
.cont-menu_lateral_fijo .menu_lateral_fijo-titulo {
  position: relative;
  opacity: 0;
  padding: 0;
  right: -100%;
  visibility: hidden;
  width: 0;
  height: 0;
  transition: all 0.3s ease-out;
  -webkit-transition: all 0.3s ease-out;
  -moz-transition: all 0.3s ease-out;
  -ms-transition: all 0.3s ease-out;
}
.cont-menu_lateral_fijo .menu_lateral_fijo-cont {
  overflow: hidden;
}
.cont-menu_lateral_fijo .menu_lateral_fijo-cont:hover {
  background: #ffffff;
}
.cont-menu_lateral_fijo .menu_lateral_fijo-cont:hover .menu_lateral_fijo-titulo {
  opacity: 1;
  padding: 10px 30px;
  right: 0;
  visibility: visible;
  width: auto;
  height: auto;
  overflow: hidden;
}

.padding_cabezal {
  padding-top: 100px;
}
@media (max-width: 1024px) {
  .padding_cabezal {
    padding-top: 10px;
  }
}

.input_suscripcion input {
  height: 70px;
  padding-left: 20px;
}
.input_suscripcion input::-webkit-input-placeholder {
  /* Chrome/Opera/Safari */
  font-size: 18px;
  color: #7b7b7b;
}
.input_suscripcion input::-moz-placeholder {
  /* Firefox 19+ */
  font-size: 18px;
  color: #7b7b7b;
}
.input_suscripcion input:-ms-input-placeholder {
  /* IE 10+ */
  font-size: 18px;
  color: #7b7b7b;
}
.input_suscripcion input:-moz-placeholder {
  /* Firefox 18- */
  font-size: 18px;
  color: #7b7b7b;
}
.input_suscripcion .boton_suscripcion {
  padding: 15px 40px;
  margin-top: 8px;
  margin-right: 18px;
}
@media (max-width: 480px) {
  .input_suscripcion .boton_suscripcion {
    padding: 15px 15px;
  }
}

.contenedor_a {
  position: absolute;
  top: 50%;
  left: 50%;
  width: 100%;
  z-index: 1;
}
.contenedor_a .swiper-pagination {
  position: absolute;
  right: 0;
  top: 50%;
  width: 10px;
}
.contenedor_a .swiper-pagination-bullet {
  width: 16px;
  height: 16px;
  margin-bottom: 10px;
  background: none;
  border: 2px solid #fff;
  opacity: 0.5;
}
.contenedor_a .swiper-pagination-bullet-active {
  background: #ffffff;
  margin-bottom: 10px;
  width: 15px;
  height: 15px;
  opacity: 1;
}

.flecha_a {
  display: inline-block;
  -moz-animation: hola 0.8s infinite;
  -webkit-animation: hola 0.8s infinite;
  animation: hola 0.8s infinite;
  transition-timing-function: cubic-bezier(0, 0.62, 0.19, 1.05);
}

@-moz-keyframes hola {
  from {
    -moz-transform: translateY(2);
    transform: translateY(2);
  }
  to {
    -moz-transform: translateY(8px);
    transform: translateY(8px);
  }
}
@-webkit-keyframes hola {
  from {
    -moz-transform: translateY(2);
    transform: translateY(2);
  }
  to {
    -moz-transform: translateY(8px);
    transform: translateY(8px);
  }
}
@keyframes hola {
  from {
    -moz-transform: translateY(2);
    transform: translateY(2);
  }
  to {
    -moz-transform: translateY(8px);
    transform: translateY(8px);
  }
}
.logo img {
  height: 47px;
  width: 212px;
}

.logo-eco img {
  height: 47px;
  width: 155px;
}

.logo_pie img {
  height: 60px;
  width: 270px;
}

.swiper-button-next-seccion {
  position: absolute;
  top: 50%;
  margin-top: -22px;
  z-index: 10;
  cursor: pointer;
  right: 10%;
}

.swiper-button-prev-seccion {
  position: absolute;
  top: 50%;
  margin-top: -22px;
  z-index: 10;
  cursor: pointer;
  left: 10%;
}

.boton_buscar {
  position: absolute;
  top: 0;
  right: 50px;
}
@media (max-width: 480px) {
  .boton_buscar {
    right: 0;
  }
}

.boton_buscar::after {
  font-family: "iconos";
  content: "\e915";
  color: #42b6e5;
  text-align: left;
  font-size: 45px;
}

.focus_file:focus {
  color: #076694;
}

.swiper-pagination-a {
  position: initial !important;
  text-align: right !important;
  float: right;
}

.tarjeta {
  position: relative;
}
.tarjeta a {
  text-decoration: none;
}
.tarjeta .ico_ampliar {
  position: absolute;
  font-family: "iconos";
  display: block;
  width: 100%;
  top: 50px;
  font-size: 70px;
  color: #ffffff;
  text-align: center;
  opacity: 0;
  z-index: 1;
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
}
.tarjeta .ico_ampliar:before {
  content: "\e908";
}
.tarjeta.video .ico_ampliar {
  top: 45px;
  top: calc(50% - 52px);
  opacity: 1;
}
.tarjeta.video .ico_ampliar:before {
  color: #ffffff !important;
  content: "\e91a";
}
.tarjeta > div {
  padding: 20px;
}
.tarjeta div.cont-video {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  padding: 0;
}
.tarjeta figure {
  position: relative;
  overflow: hidden;
  display: block;
  background: #000;
}
@media (max-width: 480px) {
  .tarjeta figure {
    text-align: center;
  }
  .tarjeta figure img {
    width: 100%;
  }
}
.tarjeta figure img {
  width: 100%;
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
  image-rendering: optimizeQuality;
  -moz-image-rendering: optimizeQuality;
  -webkit-image-rendering: optimizeQuality;
}
.tarjeta hgroup {
  color: #42b6e5;
}
.tarjeta hgroup h3 {
  min-height: 40px;
  margin-top: 0;
  font-size: 17px;
  font-weight: 600;
  color: #006ea9;
}
.tarjeta hgroup h4 {
  margin-bottom: 5px;
  font-size: 15px;
  font-weight: 300;
}
.tarjeta hgroup h5 {
  margin-bottom: 5px;
  color: #7b7b7b;
  font-size: 12px;
  font-weight: 300;
  text-transform: uppercase;
  width: 100%;
  height: 12px;
  overflow: hidden;
  white-space: nowrap;
  text-overflow: ellipsis;
}
.tarjeta p {
  height: 120px;
  font-size: 13px;
  text-align: justify;
  color: #7b7b7b;
}
.tarjeta:hover .ico_ampliar {
  opacity: 1;
}
.tarjeta:hover figure img {
  opacity: 0.5;
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
}
@media (max-width: 480px) {
  .tarjeta.listado figure, .tarjeta.listado > div {
    display: inline-block;
    vertical-align: middle;
  }
  .tarjeta.listado figure {
    width: 40%;
    margin-bottom: 0;
    background: none;
  }
  .tarjeta.listado > div {
    width: 55%;
  }
  .tarjeta.listado > div p {
    display: none;
  }
  .tarjeta.listado .ico_ampliar {
    display: none;
  }
}

.cont-compartir, .btn,
a.btn {
  position: relative;
  padding: 6px 5px;
  font-size: 15px;
  color: #006ea9;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 480px) {
  .cont-compartir, .btn,
a.btn {
    color: #42b6e5;
    background-color: whitesmoke;
  }
  .cont-compartir > span.icono, .btn > span.icono {
    margin-top: 5px;
    display: inline-block;
  }
}
.cont-compartir > div, .btn > div {
  position: absolute;
  top: 0;
  right: 0;
  display: inline-block;
  opacity: 0;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 480px) {
  .cont-compartir > div, .btn > div {
    opacity: 1;
  }
}
.cont-compartir > div a, .btn > div a {
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
  position: relative;
  display: inline-block;
  width: 39px;
  padding: 10px;
  text-align: center;
  color: #ffffff;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 480px) {
  .cont-compartir > div a, .btn > div a {
    transform: scale(1);
    -webkit-transform: scale(1);
    -moz-transform: scale(1);
    -ms-transform: scale(1);
  }
}
.cont-compartir > div a:hover, .btn > div a:hover {
  opacity: 0.5;
  text-decoration: none;
}
.cont-compartir > div a.twit, .btn > div a.twit {
  left: 8px;
  color: #ffffff;
  background-color: #10a5da;
}
.cont-compartir > div a.face, .btn > div a.face {
  left: 4px;
  color: #ffffff;
  background-color: #344c87;
}
.cont-compartir > div a.what, .btn > div a.what {
  color: #ffffff;
  background-color: #12a13c;
}
.cont-compartir:hover, .btn:hover, .cont-compartir.activo, .activo.btn {
  color: #42b6e5;
  background-color: whitesmoke;
}
.cont-compartir:hover > div, .btn:hover > div, .cont-compartir.activo > div, .activo.btn > div {
  opacity: 1;
}
.cont-compartir:hover > div a, .btn:hover > div a, .cont-compartir.activo > div a, .activo.btn > div a {
  transform: scale(1);
  -webkit-transform: scale(1);
  -moz-transform: scale(1);
  -ms-transform: scale(1);
}

@media (max-width: 480px) {
  .swiper-slide .cont-compartir .compartir-txt, .swiper-slide .btn .compartir-txt {
    display: none;
  }
}

.parrafo {
  margin-bottom: 25px;
}
.parrafo h3 {
  margin-bottom: 25px;
  color: #006ea9;
  font-weight: 700;
  font-size: 18px;
}
.parrafo .texto {
  font-size: 18px !important;
}

.cont-plantel_trofeo {
  max-width: 1215px;
  margin: 0 auto;
  margin-bottom: 50px;
  text-align: left;
}
@media (max-width: 1024px) {
  .cont-plantel_trofeo {
    text-align: center;
  }
}
.cont-plantel_trofeo .plantel_trofeo a {
  text-decoration: none;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
.cont-plantel_trofeo .plantel_trofeo .item {
  text-align: center;
  display: inline-block;
  margin: 0 2px;
  margin-bottom: 15px;
  font-size: 14px;
  color: #006ea9;
}
.cont-plantel_trofeo .plantel_trofeo .item img {
  margin-bottom: 5px;
  width: 144px;
}
@media (max-width: 480px) {
  .cont-plantel_trofeo .plantel_trofeo .item {
    margin: 1%;
    width: 46%;
  }
  .cont-plantel_trofeo .plantel_trofeo .item img {
    width: 100%;
  }
}

.cont-noticias h4 {
  margin-bottom: 0;
  color: #006ea9;
  font-size: 18px;
  font-weight: 300;
}
.cont-noticias h1 {
  margin-bottom: 20px;
  color: #006ea9;
  font-size: 36px;
  font-weight: 700;
}
@media (max-width: 1024px) {
  .cont-noticias h1 {
    font-size: 25px;
  }
}
.cont-noticias h3 > p {
  font-size: 15px;
  line-height: 1.5;
}
.cont-noticias .texto {
  margin-bottom: 30px;
  color: #7b7b7b;
  font-size: 16px;
}
.cont-noticias .tarjeta hgroup h3 {
  font-size: 14px;
}

.cont-tags {
  margin-bottom: 50px;
}
.cont-tags h3 {
  margin-bottom: 15px;
  color: #006ea9;
  font-size: 18px;
  font-weight: 700;
}
.cont-tags a {
  position: relative;
  display: inline-block;
  margin-right: 15px;
  margin-bottom: 5px;
  padding: 7px 10px;
  padding-right: 45px;
  color: #7b7b7b;
  font-size: 15px;
  text-decoration: none;
  border: 1px solid #afd5ef;
  background-color: #f8fcff;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
.cont-tags a:hover {
  background-color: #e4f8ff;
}
.cont-tags a:after {
  content: "+";
  position: absolute;
  display: inline-block;
  top: 0;
  right: 0;
  color: #006ea9;
  padding: 0 10px;
  font-weight: 700;
  font-size: 25px;
  text-align: center;
  vertical-align: middle;
  border-left: 1px solid #afd5ef;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}

.cont-slider_noticias .arrows:hover .next,
.cont-slider_noticias .arrows:hover .prev {
  opacity: 0.8;
}
.cont-slider_noticias .arrows .swiper-button-next,
.cont-slider_noticias .arrows .swiper-button-prev {
  position: absolute;
  top: 0;
  width: 14%;
  height: 90%;
  margin-top: 0;
  z-index: 2;
}
.cont-slider_noticias .arrows .swiper-button-next {
  right: 0;
  background-position: 80% 60%;
}
.cont-slider_noticias .arrows .swiper-button-prev {
  left: 0;
  background-position: 20% 60%;
}
.cont-slider_noticias .arrows .next,
.cont-slider_noticias .arrows .prev {
  position: absolute;
  width: 20%;
  height: 90%;
  top: 0;
  opacity: 0;
  z-index: 1;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
.cont-slider_noticias .arrows .next {
  right: 0;
}
.cont-slider_noticias .arrows .prev {
  left: 0;
}
.cont-slider_noticias .arrows .swiper-button-disabled + .prev, .cont-slider_noticias .arrows .swiper-button-disabled + .next {
  opacity: 0;
}
.cont-slider_noticias img {
  width: 100%;
}
.cont-slider_noticias .video-container {
  padding-bottom: 66%;
  padding-top: 0px;
  z-index: 3;
}

.noticias-miniaturas .swiper-slide {
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
.noticias-miniaturas .swiper-slide-thumb-active {
  opacity: 0.5;
}
.noticias-miniaturas .ico_ampliar {
  position: absolute;
  font-family: "iconos";
  display: block;
  width: 100%;
  top: 30px;
  font-size: 60px;
  color: #ffffff;
  text-align: center;
  opacity: 1;
  z-index: 1;
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
}
@media (max-width: 1024px) {
  .noticias-miniaturas .ico_ampliar {
    top: calc(50% - 17px);
    font-size: 26px;
  }
}
.noticias-miniaturas .ico_ampliar:before {
  color: #ffffff !important;
  content: "\e91a";
}

@media (max-width: 1024px) {
  .pagination-mod {
    display: none;
  }
}
.pagination-mod.swiper-pagination-bullets {
  bottom: 0px;
}
.pagination-mod .swiper-pagination-bullet {
  width: 15px;
  height: 15px;
}
.pagination-mod .swiper-pagination-bullet.swiper-pagination-bullet-active {
  background: #006ea9;
}

.cont-cabezal_insitucional {
  display: inline-block;
  position: relative;
}
.cont-cabezal_insitucional hgrup {
  position: absolute;
  bottom: 0;
  left: 0;
  padding: 50px;
  width: 100%;
  background: rgba(255, 255, 255, 0);
  background: -moz-linear-gradient(top, rgba(255, 255, 255, 0) 0%, rgba(1, 21, 31, 0.75) 50%);
  background: -webkit-gradient(left top, left bottom, color-stop(0%, rgba(255, 255, 255, 0)), color-stop(50%, rgba(1, 21, 31, 0.75)));
  background: -webkit-linear-gradient(top, rgba(255, 255, 255, 0) 0%, rgba(1, 21, 31, 0.75) 50%);
  background: -o-linear-gradient(top, rgba(255, 255, 255, 0) 0%, rgba(1, 21, 31, 0.75) 50%);
  background: -ms-linear-gradient(top, rgba(255, 255, 255, 0) 0%, rgba(1, 21, 31, 0.75) 50%);
  background: linear-gradient(to bottom, rgba(255, 255, 255, 0) 0%, rgba(1, 21, 31, 0.75) 50%);
  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#ffffff", endColorstr="#01151f", GradientType=0 );
}
.cont-cabezal_insitucional h1 {
  margin-bottom: 0;
  font-size: 50px;
  font-weight: 700;
  color: #ffffff;
}
@media (max-width: 480px) {
  .cont-cabezal_insitucional h1 {
    font-size: 25px;
  }
}
.cont-cabezal_insitucional h2 {
  font-size: 24px;
  font-weight: 600;
  color: #42b6e5;
}
.cont-cabezal_insitucional h2:before, .cont-cabezal_insitucional h2:after {
  display: none;
}
.cont-cabezal_insitucional img {
  margin: 0;
}
.cont-cabezal_insitucional .alt {
  display: none;
}
.cont-cabezal_insitucional .bajar {
  display: inline-block;
  font-size: 16px;
  color: #ffffff;
  text-decoration: none;
  -moz-animation: flecha 3s infinite 3s;
  -webkit-animation: flecha 3s infinite 3s;
  animation: flecha 3s infinite 3s;
}
.cont-cabezal_insitucional .bajar span {
  color: #ffffff;
}

.cont-relacionados img {
  margin-bottom: 15px;
}
.cont-relacionados a {
  text-decoration: none;
  color: #42b6e5;
}
.cont-relacionados h3 {
  font-size: 17px;
  font-weight: 600;
  color: #006ea9;
}

@-moz-keyframes flecha {
  0%, 20%, 50%, 80%, 100% {
    -moz-transform: translateY(0);
    transform: translateY(0);
  }
  40% {
    -moz-transform: translateY(15px);
    transform: translateY(15px);
  }
  60% {
    -moz-transform: translateY(20px);
    transform: translateY(20px);
  }
}
@-webkit-keyframes flecha {
  0%, 20%, 50%, 80%, 100% {
    -webkit-transform: translateY(0);
    transform: translateY(0);
  }
  40% {
    -webkit-transform: translateY(15px);
    transform: translateY(15px);
  }
  60% {
    -webkit-transform: translateY(20px);
    transform: translateY(20px);
  }
}
@keyframes flecha {
  0%, 20%, 50%, 80%, 100% {
    -moz-transform: translateY(0);
    -ms-transform: translateY(0);
    -webkit-transform: translateY(0);
    transform: translateY(0);
  }
  40% {
    -moz-transform: translateY(15px);
    -ms-transform: translateY(15px);
    -webkit-transform: translateY(15px);
    transform: translateY(15px);
  }
  60% {
    -moz-transform: translateY(20px);
    -ms-transform: translateY(20px);
    -webkit-transform: translateY(20px);
    transform: translateY(20px);
  }
}
body.old_player {
  filter: grayscale(100%) brightness(90%) contrast(120%);
  -webkit-filter: grayscale(100%) brightness(90%) contrast(120%);
}
body.jugador_barra {
  padding-bottom: 40px;
}

.jugador, .autoridad {
  margin: 0 -10px;
}
.jugador figure, .autoridad figure {
  position: relative;
  display: block;
  margin: 0;
  overflow: hidden;
  background: #000;
}
@media (max-width: 480px) {
  .jugador figure, .autoridad figure {
    text-align: center;
  }
  .jugador figure img, .autoridad figure img {
    width: 100%;
  }
}
.jugador figure aside, .autoridad figure aside {
  position: absolute;
  width: 100%;
  padding-top: 50px;
  padding-bottom: 15px;
  text-align: center;
  color: #ffffff;
  font-size: 15px;
  bottom: 0;
  left: 0;
  transition: all 0.2s ease-out;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
}
@media (max-width: 480px) {
  .jugador figure aside, .autoridad figure aside {
    font-size: 12px;
  }
}
.jugador figure aside p, .autoridad figure aside p {
  display: inline-block;
  padding: 0 10px;
  margin: 0;
}
@media (max-width: 480px) {
  .jugador figure aside p, .autoridad figure aside p {
    padding: 0 5px;
  }
}
.jugador figure aside span, .autoridad figure aside span {
  vertical-align: middle;
}
.jugador figure aside [class^=icono-], .autoridad figure aside [class^=icono-],
.jugador figure aside [class*=" icono-"],
.autoridad figure aside [class*=" icono-"] {
  font-size: 20px;
}
@media (max-width: 480px) {
  .jugador figure aside [class^=icono-], .autoridad figure aside [class^=icono-],
.jugador figure aside [class*=" icono-"],
.autoridad figure aside [class*=" icono-"] {
    font-size: 14px;
  }
}
.jugador figure img, .autoridad figure img {
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
  image-rendering: optimizeQuality;
  -moz-image-rendering: optimizeQuality;
  -webkit-image-rendering: optimizeQuality;
}
.jugador hgroup, .autoridad hgroup {
  text-align: center;
}
.jugador hgroup h3, .autoridad hgroup h3 {
  padding: 15px;
  font-size: 17px;
  color: #ffffff;
  font-weight: 600;
  background-color: #3b6ea5;
}
@media (max-width: 768px) {
  .jugador hgroup h3, .autoridad hgroup h3 {
    padding-right: 5px;
    padding-left: 5px;
    font-size: 12px;
  }
}
.jugador hgroup h4, .autoridad hgroup h4 {
  margin: 0;
  padding: 3px;
  color: #7b7b7b;
  font-size: 14px;
}
@media (max-width: 768px) {
  .jugador hgroup h4, .autoridad hgroup h4 {
    font-size: 10px;
  }
}
.jugador hgroup h5, .autoridad hgroup h5 {
  padding: 5px;
  padding-bottom: 10px;
  color: #000;
  font-size: 15px;
  font-weight: 300;
}
.jugador hgroup h5 img, .autoridad hgroup h5 img {
  max-height: 20px;
}
.jugador hgroup h5 img, .autoridad hgroup h5 img,
.jugador hgroup h5 span,
.autoridad hgroup h5 span {
  vertical-align: middle;
}
.jugador hgroup h5 span, .autoridad hgroup h5 span {
  color: #7b7b7b;
  font-size: 11px;
  font-weight: 400;
}
.jugador hgroup h5 small, .autoridad hgroup h5 small {
  color: #7b7b7b;
}
.jugador hgroup h5 a, .autoridad hgroup h5 a {
  text-decoration: none;
  color: #42b6e5;
}
.jugador hgroup h5 a small, .autoridad hgroup h5 a small {
  color: #42b6e5;
}
.jugador:hover figure img, .autoridad:hover figure img {
  opacity: 0.5;
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
}

.cont-barra_menu_jugador, .cont-barra_menu_club {
  position: fixed;
  width: 100%;
  margin-bottom: -100px;
  bottom: 0;
  left: 0;
  background-color: #42b6e5;
  color: #ffffff;
  z-index: 2;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  -webkit-box-shadow: 0 -5px 5px 3px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 -5px 5px 3px rgba(0, 0, 0, 0.08);
  box-shadow: 0 -5px 5px 3px rgba(0, 0, 0, 0.08);
}
.cont-barra_menu_jugador.barra_fija, .barra_fija.cont-barra_menu_club {
  margin-bottom: 0;
}
.cont-barra_menu_jugador.barra_fija .barra_menu_jugador figure, .barra_fija.cont-barra_menu_club .barra_menu_jugador figure {
  bottom: 0;
}
.cont-barra_menu_jugador .barra_menu_jugador, .cont-barra_menu_club .barra_menu_jugador {
  position: relative;
  padding-left: 80px;
}
@media (max-width: 480px) {
  .cont-barra_menu_jugador .barra_menu_jugador, .cont-barra_menu_club .barra_menu_jugador {
    padding-left: 0;
    text-align: center;
  }
}
.cont-barra_menu_jugador .barra_menu_jugador .derecho, .cont-barra_menu_club .barra_menu_jugador .derecho {
  text-align: right;
}
@media (max-width: 480px) {
  .cont-barra_menu_jugador .barra_menu_jugador .derecho, .cont-barra_menu_club .barra_menu_jugador .derecho {
    text-align: center;
  }
}
.cont-barra_menu_jugador .barra_menu_jugador figure, .cont-barra_menu_club .barra_menu_jugador figure {
  position: absolute;
  left: 0;
  bottom: -100px;
  margin: 0;
  text-align: center;
  display: inline-block;
  overflow: hidden;
  width: 65px;
  height: 65px;
  vertical-align: middle;
  border-radius: 50%;
  cursor: pointer;
  transition: all 400ms ease-out;
  -webkit-transition: all 400ms ease-out;
  -moz-transition: all 400ms ease-out;
  -ms-transition: all 400ms ease-out;
  -webkit-box-shadow: 0 -5px 5px 3px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 -5px 5px 3px rgba(0, 0, 0, 0.08);
  box-shadow: 0 -5px 5px 3px rgba(0, 0, 0, 0.08);
}
@media (max-width: 480px) {
  .cont-barra_menu_jugador .barra_menu_jugador figure, .cont-barra_menu_club .barra_menu_jugador figure {
    display: none;
  }
}
.cont-barra_menu_jugador .barra_menu_jugador h3, .cont-barra_menu_club .barra_menu_jugador h3 {
  display: inline-block;
  margin-bottom: 0;
  margin-right: 5px;
  padding-right: 10px;
  font-size: 14px;
  border-right: 1px solid;
  cursor: pointer;
}
@media (max-width: 480px) {
  .cont-barra_menu_jugador .barra_menu_jugador h3, .cont-barra_menu_club .barra_menu_jugador h3 {
    display: none;
  }
}
.cont-barra_menu_jugador .barra_menu_jugador a, .cont-barra_menu_club .barra_menu_jugador a {
  display: inline-block;
  padding: 10px;
  font-size: 14px;
  font-weight: 700;
  text-decoration: none;
  color: #ffffff;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  /* &.activo {
  	@include box-shadow(0, -4px, 0, $colorPrimarioObscuro, true);
  } */
}
.cont-barra_menu_jugador .barra_menu_jugador a:hover, .cont-barra_menu_club .barra_menu_jugador a:hover {
  -webkit-box-shadow: inset 0 -4px 0 0px #ffffff;
  -moz-box-shadow: inset 0 -4px 0 0px #ffffff;
  box-shadow: inset 0 -4px 0 0px #ffffff;
}

@media (max-width: 480px) {
  .cont-barra_menu_club .barra_menu {
    text-align: right;
  }
}
.cont-barra_menu_club .barra_menu .items {
  display: inline-block;
}
@media (max-width: 480px) {
  .cont-barra_menu_club .barra_menu .items {
    position: absolute;
    display: none;
    margin-bottom: 38px;
    padding: 5px 15px;
    text-align: left;
    bottom: 0;
    right: 0;
    background-color: #ffffff;
    -webkit-box-shadow: -4px -4px 5px 0px rgba(0, 0, 0, 0.15);
    -moz-box-shadow: -4px -4px 5px 0px rgba(0, 0, 0, 0.15);
    box-shadow: -4px -4px 5px 0px rgba(0, 0, 0, 0.15);
  }
}
.cont-barra_menu_club .barra_menu h3 {
  display: inline-block;
  margin-bottom: 0;
  margin-right: 15px;
  font-size: 14px;
  font-weight: 700;
}
.cont-barra_menu_club .barra_menu h3:before, .cont-barra_menu_club .barra_menu h3:after {
  display: inline-block;
  font-family: "iconos";
  content: "\e909";
  color: #eeba02;
  font-size: 15px;
}
.cont-barra_menu_club .barra_menu h3:before {
  margin-right: 10px;
}
.cont-barra_menu_club .barra_menu h3:after {
  margin-left: 10px;
}
@media (max-width: 480px) {
  .cont-barra_menu_club .barra_menu h3 {
    text-align: right;
    padding: 10px 0;
  }
}
.cont-barra_menu_club .barra_menu a {
  display: inline-block;
  padding: 10px;
  font-size: 12px;
  text-decoration: none;
  color: #ffffff;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-barra_menu_club .barra_menu a:hover {
  -webkit-box-shadow: inset 0 -4px 0 0px #ffffff;
  -moz-box-shadow: inset 0 -4px 0 0px #ffffff;
  box-shadow: inset 0 -4px 0 0px #ffffff;
}
@media (max-width: 480px) {
  .cont-barra_menu_club .barra_menu a {
    display: block;
    font-size: 13px;
    color: #42b6e5;
  }
}

.cont-jugador_slider_club {
  padding: 10px;
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
.cont-jugador_slider_club .cabezal {
  color: #ffffff;
  background-color: #006ea9;
  font-size: 15px;
  padding: 10px 20px;
  text-transform: uppercase;
}
@media (max-width: 480px) {
  .cont-jugador_slider_club .cabezal {
    display: none;
  }
}
.cont-jugador_slider_club .cuerpo {
  height: 415px;
  overflow-x: hidden;
}
@media (max-width: 480px) {
  .cont-jugador_slider_club .cuerpo {
    height: 315px;
  }
}

.jugador_slider_club {
  margin: 15px;
  padding-bottom: 15px;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.jugador_slider_club:hover {
  -webkit-transform: scale(1.03);
  -moz-transform: scale(1.03);
  -ms-transform: scale(1.03);
  transform: scale(1.03);
  background-color: #e4f8ff;
}
.jugador_slider_club:not(:last-child) {
  border-bottom: 1px solid #d1d1d1;
}
.jugador_slider_club .numero {
  color: #42b6e5;
  font-size: 35px;
  font-weight: 700;
}
@media (max-width: 480px) {
  .jugador_slider_club .numero {
    margin-right: 10px;
  }
}
.jugador_slider_club hgroup img {
  width: 45px;
  margin-right: 10px;
}
@media (max-width: 480px) {
  .jugador_slider_club hgroup img {
    width: 55px;
  }
}
.jugador_slider_club hgroup h3 {
  margin: 0;
  font-size: 17px;
  color: #006ea9;
  font-weight: 600;
}
@media (max-width: 768px) {
  .jugador_slider_club hgroup h3 {
    font-size: 12px;
  }
}
.jugador_slider_club hgroup h5 {
  color: #000;
  font-size: 15px;
  font-weight: 300;
  margin: 0;
}
.jugador_slider_club aside {
  font-weight: 700;
  color: #006ea9;
  font-size: 24px;
}
@media (max-width: 480px) {
  .jugador_slider_club aside {
    font-size: 14px;
  }
}
.jugador_slider_club aside span {
  vertical-align: middle;
}
.jugador_slider_club p {
  margin: 0;
  font-size: 14px;
}

.cont-plantel_club {
  padding: 10px;
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
.cont-plantel_club .cabezal {
  color: #ffffff;
  background-color: #006ea9;
  font-size: 15px;
  padding: 10px 20px;
  text-transform: uppercase;
}
@media (max-width: 480px) {
  .cont-plantel_club .cabezal {
    display: none;
  }
}
.cont-plantel_club .cuerpo {
  height: 100vh;
  overflow-x: auto;
}
.cont-plantel_club .cuerpo.tecnico {
  height: auto;
  overflow-x: visible;
}

.jugador_club {
  margin: 15px;
  padding-bottom: 15px;
}
.jugador_club:not(:last-child) {
  border-bottom: 1px solid #d1d1d1;
}
.jugador_club p {
  margin: 0;
  font-size: 14px;
  color: #7b7b7b;
}
.jugador_club aside {
  font-weight: 700;
  color: #006ea9;
  font-size: 24px;
  width: 90px;
  display: inline-block;
  text-align: left;
}
@media (max-width: 480px) {
  .jugador_club aside {
    font-size: 14px;
  }
}
.jugador_club .galeria {
  margin: 15px;
  font-size: 15px;
  color: #006ea9;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.jugador_club .galeria:hover {
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
  transform: scale(1.3);
  text-decoration: none;
}
.jugador_club hgroup h3 {
  color: #006ea9;
  margin: 0;
  font-size: 15px;
  font-weight: 600;
}
@media (max-width: 768px) {
  .jugador_club hgroup h3 {
    font-size: 12px;
  }
}
.jugador_club hgroup h4 {
  margin: 0;
  color: #7b7b7b;
  font-size: 15px;
}
@media (max-width: 768px) {
  .jugador_club hgroup h4 {
    font-size: 10px;
  }
}
.jugador_club hgroup h5 {
  padding: 5px;
  padding-bottom: 10px;
  color: #000;
  font-size: 15px;
  font-weight: 300;
}
.jugador_club hgroup h5 img,
.jugador_club hgroup h5 span {
  vertical-align: middle;
}
.jugador_club hgroup h5 span {
  color: #7b7b7b;
  font-size: 11px;
  font-weight: 400;
}
.jugador_club hgroup h5 a {
  text-decoration: none;
}
.jugador_club:hover figure img {
  opacity: 0.5;
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
}

.autoridad hgroup {
  padding-top: 15px;
  text-align: center;
}
.autoridad hgroup h3 {
  margin-bottom: 0;
  padding: 0;
  font-size: 17px;
  color: #3b6ea5;
  font-weight: 600;
  background-color: transparent;
}
@media (max-width: 768px) {
  .autoridad hgroup h3 {
    padding-right: 5px;
    padding-left: 5px;
    font-size: 12px;
  }
}
.autoridad.sinfoto hgroup {
  text-align: left;
}
.autoridad.sinfoto hgroup a {
  position: relative;
  font-weight: 700;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.autoridad.sinfoto hgroup a:hover {
  color: #006ea9;
}
.autoridad.sinfoto hgroup span.cont {
  display: inline-block;
  padding-left: 40px;
}
.autoridad.sinfoto hgroup span.icono {
  position: absolute;
  left: 0;
  font-weight: 700;
  font-size: 36px;
}

@media (min-width: 1354px) {
  .cont-congreso .texto-liga {
    max-width: 83%;
    margin: 0 auto;
  }
}
.cont-congreso .cont-item_congreso {
  margin-top: 40px;
}
.cont-congreso .cabezal_congreso {
  background-image: url(/imagenes/img_presentacion/bg_congreso-auf.png);
  background-size: cover;
}
.cont-congreso .cabezal_congreso h1 {
  color: #fff;
}
.cont-congreso .cabezal_congreso .texto-liga {
  color: #00418a;
  font-weight: 600;
}
.cont-congreso .titulo_liga {
  font-size: 18px;
  color: #3b6ea5;
  font-weight: 700;
  margin-bottom: 15px;
  text-align: initial;
}
.cont-congreso .titulo_liga .cant-votos {
  color: #00c7f4;
}
@media (max-width: 991px) {
  .cont-congreso .titulo_liga {
    text-align: center;
  }
}
.cont-congreso .icono-escudo {
  font-weight: 700;
  font-size: 50px;
  color: #42b6e5;
}

.club_cabezal {
  position: fixed;
  top: 0;
  left: 0;
  padding: 8px;
  margin-top: 49px;
  opacity: 0;
  visibility: hidden;
  width: 100%;
  font-size: 20px;
  font-weight: 700;
  text-align: center;
  color: #006ea9;
  background: #ffffff;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  -webkit-box-shadow: 0 5px 5px 3px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 5px 5px 3px rgba(0, 0, 0, 0.08);
  box-shadow: 0 5px 5px 3px rgba(0, 0, 0, 0.08);
}
.club_cabezal img {
  height: 43px;
  margin-right: 5px;
  vertical-align: middle;
}
.club_cabezal span {
  vertical-align: middle;
}

.clubes_escudos {
  display: flex;
  flex-grow: 1;
  flex-wrap: wrap;
  justify-content: center;
  gap: 10px;
  /*a {
    display: inline-block;
    margin-left: 5px;
    margin-right: 5px;
    @include transition(200ms); 
    &:hover {
      @include prefixo(transform, scale(1.3));
    }
  }*/
}
.clubes_escudos:hover a:not(:hover) {
  filter: grayscale(1);
}
.clubes_escudos img {
  display: inline-block;
  width: 53px;
}

.cont-fixture_campeonato {
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
.cont-fixture_campeonato h3 {
  margin-bottom: 5px;
  padding: 13px 20px;
  color: #ffffff;
  font-size: 18px;
  font-weight: 700;
  background-color: #006ea9;
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
@media (max-width: 480px) {
  .cont-fixture_campeonato h3 {
    text-align: center;
    font-size: 14px;
  }
}
.cont-fixture_campeonato .swiper-container {
  padding-bottom: 10px;
}
.cont-fixture_campeonato .fecha_slider {
  padding: 12px;
  font-size: 15px;
  font-weight: 700;
  text-align: center;
}
.cont-fixture_campeonato .fecha_slider.especial {
  font-size: 18px;
  color: #006ea9;
  border-bottom: 1px solid #eeeeee;
}
.cont-fixture_campeonato .slider-fechas-titulo .flecha-fecha {
  padding: 10px;
  position: absolute;
  font-size: 25px;
  top: 0;
  cursor: pointer;
  z-index: 3;
}
.cont-fixture_campeonato .slider-fechas-titulo .flecha-fecha.flecha-fecha-next, .cont-fixture_campeonato .slider-fechas-titulo .flecha-fecha.flecha-fecha-contenedor-next {
  right: 0;
}
.cont-fixture_campeonato .slider-fechas-titulo .flecha-fecha.flecha-fecha-prev, .cont-fixture_campeonato .slider-fechas-titulo .flecha-fecha.flecha-fecha-contenedor-prev {
  left: 0;
}
.cont-fixture_campeonato .slider-fechas-titulo .flecha-fecha.swiper-button-disabled {
  opacity: 0.4;
}
.cont-fixture_campeonato .item-fixture {
  padding: 19px 15px;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  font-size: 14px;
  font-weight: 300;
}
@media (max-width: 480px) {
  .cont-fixture_campeonato .item-fixture {
    padding: 5px 10px;
    font-size: 12px;
  }
}
.cont-fixture_campeonato .item-fixture:hover {
  background-color: #ebebeb;
}
.cont-fixture_campeonato .item-fixture.noultimo {
  border-top: 1px solid #eeeeee;
}
.cont-fixture_campeonato .item-fixture img {
  height: 37px;
  margin-right: 5px;
  vertical-align: middle;
}
@media (max-width: 480px) {
  .cont-fixture_campeonato .item-fixture img {
    width: 24px;
    height: auto;
    margin-right: 3px;
  }
}
.cont-fixture_campeonato .item-fixture .club2 {
  text-align: right;
}
.cont-fixture_campeonato .item-fixture .club2 img {
  margin-right: 0;
  margin-left: 5px;
}
@media (max-width: 480px) {
  .cont-fixture_campeonato .item-fixture .club2 img {
    margin-left: 3px;
  }
}
.cont-fixture_campeonato .item-fixture .resultado {
  color: #006ea9;
  font-weight: 700;
  font-size: 15px;
}
@media (max-width: 480px) {
  .cont-fixture_campeonato .item-fixture .resultado {
    font-size: 12px;
  }
}
.cont-fixture_campeonato .item-fixture .fecha_estadio {
  font-size: 13px;
  line-height: 1.1;
}
@media (max-width: 480px) {
  .cont-fixture_campeonato .item-fixture .fecha_estadio {
    font-size: 10px;
  }
}
.cont-fixture_campeonato .item-fixture .fecha_estadio strong {
  display: block;
  font-weight: 700;
  font-size: 14px;
}
@media (max-width: 480px) {
  .cont-fixture_campeonato .item-fixture .fecha_estadio strong {
    font-size: 11px;
  }
}
.cont-fixture_campeonato .item-fixture a {
  color: #000;
}
.cont-fixture_campeonato .item-fixture a.icono {
  font-size: 21px;
  color: #006ea9;
}
@media (max-width: 480px) {
  .cont-fixture_campeonato .item-fixture a.icono {
    font-size: 16px;
  }
}
.cont-fixture_campeonato .item-fixture a:hover {
  text-decoration: none;
}

.cont-cabezal_historico_club a {
  font-size: 16px;
  font-weight: 300;
  line-height: 1;
  color: #006ea9;
}
@media (max-width: 768px) {
  .cont-cabezal_historico_club a {
    display: inline-block;
    margin-bottom: 15px;
  }
}
.cont-cabezal_historico_club a:hover {
  text-decoration: none;
}
.cont-cabezal_historico_club a span {
  vertical-align: middle;
}
.cont-cabezal_historico_club a .icono {
  margin-right: 5px;
  font-size: 22px;
  color: #000;
}
.cont-cabezal_historico_club figure {
  vertical-align: middle;
}
.cont-cabezal_historico_club figure img {
  height: 140px;
}
.cont-cabezal_historico_club h1 {
  margin-bottom: 0;
  font-size: 36px;
  font-weight: 700;
  color: #006ea9;
}
@media (max-width: 768px) {
  .cont-cabezal_historico_club h1 {
    font-size: 26px;
  }
}
.cont-cabezal_historico_club h2 {
  margin-bottom: 0;
  font-size: 36px;
  font-weight: 300;
  color: #006ea9;
}
@media (max-width: 768px) {
  .cont-cabezal_historico_club h2 {
    font-size: 26px;
  }
}

.cont-sede {
  margin-bottom: 30px;
  padding: 15px;
  border: 1px solid #d1d1d1;
  -webkit-box-shadow: 0 5px 5px 3px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 5px 5px 3px rgba(0, 0, 0, 0.08);
  box-shadow: 0 5px 5px 3px rgba(0, 0, 0, 0.08);
}
.cont-sede figure {
  margin: 0;
  margin-bottom: 53px;
  text-align: center;
}
@media (max-width: 768px) {
  .cont-sede figure {
    margin-bottom: 20px;
  }
}
.cont-sede figure img {
  width: 100%;
}
@media (max-width: 768px) {
  .cont-sede figure img {
    width: 110px;
  }
}
.cont-sede h3 {
  margin-bottom: 25px;
  padding: 10px;
  color: #006ea9;
  font-size: 22px;
  font-weight: 700;
  text-align: center;
  background-color: whitesmoke;
  border-bottom: 1px solid #d1d1d1;
}
.cont-sede ul {
  margin-bottom: 25px;
}
.cont-sede ul li {
  margin-bottom: 5px;
  padding-bottom: 5px;
  border-bottom: 1px solid #eeeeee;
  font-size: 15px;
}
.cont-sede ul li a {
  color: #006ea9;
  word-break: break-all;
}
.cont-sede ul li strong {
  font-weight: 700;
}
.cont-sede .redes {
  font-size: 15px;
}
.cont-sede .redes a {
  display: inline-block;
  margin-bottom: 10px;
  margin-right: 10px;
  color: #000;
}
.cont-sede .redes a:hover {
  text-decoration: none;
  color: #42b6e5;
}
.cont-sede .redes a .icono {
  color: #42b6e5;
  font-size: 22px;
  vertical-align: middle;
}

.cont-direccion {
  margin-bottom: 30px;
}
.cont-direccion h3 {
  margin-bottom: 0;
  padding: 15px;
  color: #ffffff;
  font-size: 20px;
  font-weight: 700;
  text-align: center;
  background-color: #006ea9;
}
.cont-direccion a {
  color: #ffffff;
}
.cont-direccion a:hover {
  text-decoration: none;
}
.cont-direccion figure {
  position: relative;
  background-color: #000;
}
.cont-direccion figure:before {
  content: "";
  position: absolute;
  display: block;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background: rgba(0, 0, 0, 0);
  background: -moz-linear-gradient(top, rgba(0, 0, 0, 0) 0%, rgba(0, 0, 0, 0) 50%, rgba(0, 0, 0, 0.25) 73%, rgba(0, 0, 0, 0.5) 100%);
  background: -webkit-gradient(left top, left bottom, color-stop(0%, rgba(0, 0, 0, 0)), color-stop(50%, rgba(0, 0, 0, 0)), color-stop(73%, rgba(0, 0, 0, 0.75)), color-stop(100%, rgba(0, 0, 0, 0.75)));
  background: -webkit-linear-gradient(top, rgba(0, 0, 0, 0) 0%, rgba(0, 0, 0, 0) 50%, rgba(0, 0, 0, 0.25) 73%, rgba(0, 0, 0, 0.5) 100%);
  background: -o-linear-gradient(top, rgba(0, 0, 0, 0) 0%, rgba(0, 0, 0, 0) 50%, rgba(0, 0, 0, 0.25) 73%, rgba(0, 0, 0, 0.5) 100%);
  background: -ms-linear-gradient(top, rgba(0, 0, 0, 0) 0%, rgba(0, 0, 0, 0) 50%, rgba(0, 0, 0, 0.25) 73%, rgba(0, 0, 0, 0.5) 100%);
  background: linear-gradient(to bottom, rgba(0, 0, 0, 0) 0%, rgba(0, 0, 0, 0) 50%, rgba(0, 0, 0, 0.25) 73%, rgba(0, 0, 0, 0.5) 100%);
  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#000000", endColorstr="#000000", GradientType=0 );
}
.cont-direccion figure img {
  width: 100%;
}
.cont-direccion figure .direccion,
.cont-direccion figure .como_llegar {
  position: absolute;
  bottom: 0;
  margin-bottom: 20px;
  font-size: 15px;
  color: #ffffff;
}
.cont-direccion figure .direccion span,
.cont-direccion figure .como_llegar span {
  vertical-align: middle;
}
.cont-direccion figure .direccion .icono,
.cont-direccion figure .como_llegar .icono {
  font-size: 22px;
  margin-right: 5px;
}
.cont-direccion figure .direccion {
  left: 0;
  margin-left: 25px;
}
@media (max-width: 480px) {
  .cont-direccion figure .direccion {
    margin-bottom: 60px;
  }
}
.cont-direccion figure .como_llegar {
  right: 0;
  font-weight: 700;
  margin-right: 25px;
}
@media (max-width: 480px) {
  .cont-direccion figure .como_llegar {
    right: auto;
    left: 0;
    margin-left: 25px;
  }
}

.cont-slide_historicos {
  overflow: hidden;
  text-align: center;
}
.cont-slide_historicos .swiper-container {
  width: 270px !important;
  overflow: visible !important;
}
.cont-slide_historicos h4 {
  min-height: 45px;
  font-size: 24px;
  font-weight: 700;
  color: #d1d1d1;
  margin-bottom: 0;
  line-height: 45px;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-slide_historicos .swiper-slide-active h4 {
  font-size: 33px;
  color: #000;
}
.cont-slide_historicos .swiper-slide-active h4 a {
  color: #000;
}
.cont-slide_historicos .swiper-button-next,
.cont-slide_historicos .swiper-container-rtl .swiper-button-prev {
  background-image: url("data:image/svg+xml;charset=utf-8,%3Csvg%20xmlns%3D'http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg'%20viewBox%3D'0%200%2027%2044'%3E%3Cpath%20d%3D'M27%2C22L27%2C22L5%2C44l-2.1-2.1L22.8%2C22L2.9%2C2.1L5%2C0L27%2C22L27%2C22z'%20fill%3D'%23000000'%2F%3E%3C%2Fsvg%3E");
}
.cont-slide_historicos .swiper-button-prev,
.cont-slide_historicos .swiper-container-rtl .swiper-button-next {
  background-image: url("data:image/svg+xml;charset=utf-8,%3Csvg%20xmlns%3D'http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg'%20viewBox%3D'0%200%2027%2044'%3E%3Cpath%20d%3D'M0%2C22L22%2C0l2.1%2C2.1L4.2%2C22l19.9%2C19.9L22%2C44L0%2C22L0%2C22L0%2C22z'%20fill%3D'%23000000'%2F%3E%3C%2Fsvg%3E");
}

.cont-titulo_campeon {
  text-align: center;
  font-size: 18px;
  font-weight: 300;
  color: #000;
}
.cont-titulo_campeon h2 {
  color: #076694;
  font-size: 30px;
  font-weight: 300;
  text-align: center;
}
.cont-titulo_campeon img {
  display: inline-block;
  height: 30px;
  vertical-align: middle;
}
.cont-titulo_campeon span {
  vertical-align: middle;
}
.cont-titulo_campeon .destacado {
  font-size: 20px;
  font-weight: 700;
  color: #006ea9;
}

.cargador {
  position: absolute;
  width: 100%;
  margin-top: 50px;
  top: 0;
  text-align: center;
  z-index: 3;
}

#cargador_partidos {
  margin: 15px;
  text-align: center;
}

section h2 {
  margin-bottom: 25px;
  color: #42b6e5;
  font-size: 33px;
  font-weight: 400;
  text-align: center;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  section h2 {
    font-size: 22px;
  }
}
section h2:before, section h2:after {
  position: relative;
  top: -2px;
  font-size: 21px;
  font-family: "iconos";
}
@media (max-width: 768px) {
  section h2:before, section h2:after {
    display: none;
  }
}
section h2:before {
  margin-right: 10px;
  content: "\e917";
}
section h2:after {
  margin-left: 10px;
  content: "\e917";
}
section h2.subtitulo {
  color: #006ea9;
  font-size: 30px;
  font-weight: 300;
}
@media (max-width: 768px) {
  section h2.subtitulo {
    font-size: 20px;
  }
}
section h2 a:hover {
  color: #42b6e5;
  text-decoration: none;
}

.tabs-container,
.tabs-container-plantel {
  border-bottom: 1px solid #d1d1d1;
}

.tabs-items {
  text-align: center;
}
.tabs-items .tab-item {
  width: auto;
  display: inline-block;
  padding: 5px 15px;
  font-size: 15px;
  color: #42b6e5;
  text-transform: uppercase;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .tabs-items .tab-item {
    font-size: 12px;
  }
}
.tabs-items .tab-item.swiper-slide-thumb-active, .tabs-items .tab-item.swiper-slide-active {
  font-weight: 700;
  background-color: #ffffff;
}
.tabs-items .tab-item:hover, .tabs-items .tab-item.activo {
  color: #ffffff;
  background-color: #42b6e5;
}
.tabs-items .tab-item.especial {
  color: #006ea9;
  font-weight: 600;
  border-left: 1px solid #eeeeee;
}
.tabs-items .tab-item.especial:hover, .tabs-items .tab-item.especial.activo {
  color: #ffffff;
  background-color: #006ea9;
}

.tabs-sub-items, .tabs-sub-items-submenu {
  text-align: center;
  margin-bottom: 10px;
  margin-top: 9px;
}
.tabs-sub-items .tab-sub-item, .tabs-sub-items-submenu .tab-sub-item {
  width: auto;
  display: inline-block;
  padding: 5px 15px;
  font-size: 15px;
  font-weight: 600;
  color: #076694;
  text-transform: uppercase;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.tabs-sub-items .tab-sub-item:hover, .tabs-sub-items-submenu .tab-sub-item:hover, .tabs-sub-items .tab-sub-item.activo, .tabs-sub-items-submenu .tab-sub-item.activo, .tabs-sub-items .tab-sub-item.swiper-slide-thumb-active, .tabs-sub-items-submenu .tab-sub-item.swiper-slide-thumb-active, .tabs-sub-items .tab-sub-item.swiper-slide-active, .tabs-sub-items-submenu .tab-sub-item.swiper-slide-active {
  color: #076694;
  text-decoration: underline;
}
.tabs-sub-items span, .tabs-sub-items-submenu span {
  font-size: 20px;
  color: #d1d1d1;
}

.tabs-sub-items-submenu.center {
  justify-content: center;
}
@media (max-width: 480px) {
  .tabs-sub-items-submenu.center {
    justify-content: initial;
  }
}
.tabs-sub-items-submenu .tab-sub-item {
  display: inline-block;
  font-size: 14px;
  font-weight: 400;
  color: #7b7b7b;
}
.tabs-sub-items-submenu .tab-sub-item:hover, .tabs-sub-items-submenu .tab-sub-item.activo, .tabs-sub-items-submenu .tab-sub-item.swiper-slide-thumb-active, .tabs-sub-items-submenu .tab-sub-item.swiper-slide-active {
  color: #42b6e5;
  text-decoration: none;
}
.tabs-sub-items-submenu .tab-sub-item.activo {
  font-weight: 700;
  color: #006ea9;
}
.tabs-sub-items-submenu span {
  font-size: 6px;
  color: inherit;
  vertical-align: middle;
}

.amplia_img figure {
  margin: 0;
  position: relative;
  overflow: hidden;
  display: block;
  height: 100%;
  background: #000;
}
@media (max-width: 480px) {
  .amplia_img figure {
    text-align: center;
  }
  .amplia_img figure img {
    width: 100%;
  }
}
.amplia_img figure img {
  height: 100%;
  width: 100%;
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
  image-rendering: optimizeQuality;
  -moz-image-rendering: optimizeQuality;
  -webkit-image-rendering: optimizeQuality;
}
.amplia_img:hover figure img {
  opacity: 0.5;
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
}

/**************
// BOTONES
**************/
.btn,
a.btn {
  border-radius: 0;
  transition: all 0.3s ease-out;
  -webkit-transition: all 0.3s ease-out;
  -moz-transition: all 0.3s ease-out;
  -ms-transition: all 0.3s ease-out;
}
.btn.btn-round,
a.btn.btn-round {
  border-radius: 4px;
}
.btn.btn-primario-outline,
a.btn.btn-primario-outline {
  padding: 5px 15px;
  color: #006ea9;
  border: 1px solid #006ea9;
  font-weight: 700;
}
@media (max-width: 480px) {
  .btn.btn-primario-outline,
a.btn.btn-primario-outline {
    padding: 5px 8px;
  }
}
.btn.btn-primario-outline:hover,
a.btn.btn-primario-outline:hover {
  color: #ffffff;
  background-color: #006ea9;
}
.btn > div,
a.btn > div {
  top: -1px;
  right: -118px;
}
.btn > div a,
a.btn > div a {
  margin-right: 0;
}

.btn_2,
a.btn_2 {
  border-radius: 0;
  font-size: 15px;
  font-weight: 700;
  color: #076694;
  margin-top: 10px;
  text-decoration: none;
  transition: all 0.3s ease-out;
  -webkit-transition: all 0.3s ease-out;
  -moz-transition: all 0.3s ease-out;
  -ms-transition: all 0.3s ease-out;
}
@media (max-width: 480px) {
  .btn_2,
a.btn_2 {
    display: inline-block;
    width: 100%;
    margin-bottom: 25px;
    text-align: right;
  }
}
.btn_2:hover,
a.btn_2:hover {
  color: #42b6e5;
}
.btn_2.center,
a.btn_2.center {
  text-align: center;
  display: block;
  margin-top: 30px;
}
.btn_2 span,
a.btn_2 span {
  font-size: 20px;
  vertical-align: sub;
  margin-left: 5px;
  color: #000;
}

.btn-volver a {
  font-size: 15px;
}
@media (max-width: 480px) {
  .btn-volver {
    padding: 10px 0;
    top: 0;
    position: sticky;
    background-color: white;
    z-index: 3;
    text-align: center;
  }
}

header {
  position: relative;
}
header .cont-background {
  width: 100%;
  overflow: hidden;
  position: absolute;
  left: 0;
  top: 0;
}
header .cont-background img {
  width: 1920px;
  max-width: none;
  position: relative;
  top: 0;
}
header .cont-cabezal {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
}
header .cont-cabezal .titulo {
  color: #ffffff;
  font-size: 28px;
  float: left;
  font-weight: 600;
  margin-top: 75px;
}
header .cont-cabezal .socio {
  float: right;
  margin-top: 30px;
  margin-left: 20px;
}
header .cont-cabezal .redes {
  float: right;
  margin-top: 65px;
}
header .cont-cabezal .redes div.item_red {
  vertical-align: middle;
  display: inline-block;
  margin-right: 10px;
}
header .cont-cabezal .redes div.item_red a {
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
header .cont-cabezal .redes div.item_red a span {
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
header .cont-cabezal .redes div.item_red a:hover span {
  color: #afd5ef;
}
header .cont-cabezal .redes div.item_red .escudo {
  position: relative;
  font-size: 50px;
  color: #ffffff;
}
header .cont-cabezal .redes div.item_red .red {
  position: absolute;
  font-size: 19px;
  color: #ffffff;
}
header .cont-cabezal .redes div.item_red .icono-red-face {
  top: 17px;
  left: 15px;
}
header .cont-cabezal .redes div.item_red .icono-red-twit {
  top: 19px;
  left: 10px;
  font-size: 16px;
}
header .cont-cabezal .redes div.item_red .icono-red-yout {
  top: 17px;
  left: 9px;
}
header .cont-cabezal .redes div.item_red .icono-red-inst {
  top: 17px;
  left: 10px;
}
header .cont-cabezal .redes div.item_red .icono-red-goog {
  top: 17px;
  left: 10px;
}
header .cont-cabezal .redes .radio {
  display: inline-block;
  color: #ffffff;
  vertical-align: middle;
  font-size: 13px;
}
@media (max-width: 480px) {
  header .cont-cabezal .redes .radio {
    display: none;
  }
}
header .cont-cabezal .redes .radio .titular {
  width: 65px;
  line-height: 1;
}
header .cont-cabezal .redes .radio .titular span {
  font-size: 16px;
}
header .cont-cabezal .redes .radio .controles {
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
header .cont-cabezal .redes .radio .controles:hover {
  color: #afd5ef;
}
header .cont-cabezal .redes .radio .controles span {
  font-size: 40px;
}

.cont-seccion {
  margin-top: 25px;
  margin-bottom: 30px;
}
.cont-seccion .barra_navegacion {
  text-align: center;
  font-size: 15px;
}
.cont-seccion .barra_navegacion a {
  color: #076694;
  display: inline-block;
}
.cont-seccion .barra_navegacion span {
  color: #42b6e5;
  display: inline-block;
  vertical-align: middle;
  margin: 0 5px;
}
.cont-seccion .barra_navegacion p {
  color: #076694;
  display: inline-block;
}
.cont-seccion h1 {
  margin-bottom: 25px;
  margin-top: 20px;
  color: #076694;
  font-size: 36px;
  font-weight: 700;
  text-align: center;
}
@media (max-width: 480px) {
  .cont-seccion h1 {
    font-size: 24px;
  }
}
.cont-seccion h1:before, .cont-seccion h1:after {
  position: relative;
  top: -2px;
  font-size: 21px;
  font-family: "iconos";
}
@media (max-width: 480px) {
  .cont-seccion h1:before, .cont-seccion h1:after {
    display: none;
    font-size: 14px;
  }
}
.cont-seccion h1:before {
  margin-right: 20px;
  content: "\e917";
  color: #42b6e5;
  font-weight: 300;
}
@media (max-width: 480px) {
  .cont-seccion h1:before {
    margin-right: 10px;
  }
}
.cont-seccion h1:after {
  margin-left: 20px;
  content: "\e917";
  color: #42b6e5;
  font-weight: 300;
}
@media (max-width: 480px) {
  .cont-seccion h1:after {
    margin-left: 10px;
  }
}
.cont-seccion h2.subtitulo {
  color: #076694;
  font-size: 30px;
  font-weight: 300;
  text-align: center;
}
@media (max-width: 480px) {
  .cont-seccion h2.subtitulo {
    font-size: 24px;
  }
}
.cont-seccion h4 {
  margin-bottom: 20px;
  color: #076694;
  font-size: 15px;
  font-weight: 700;
  text-align: center;
}
.cont-seccion h4.borde {
  padding-bottom: 20px;
  border-bottom: 1px solid #eeeeee;
}

.cont-logos {
  text-align: center;
  margin: 50px 0;
}
@media (max-width: 768px) {
  .cont-logos {
    margin: 25px 0;
  }
}
.cont-logos img {
  margin-right: 25px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .cont-logos img {
    padding-bottom: 35px;
  }
}
.cont-logos img:last-child {
  margin-right: 15px;
}
@media (max-width: 768px) {
  .cont-logos img:last-child {
    margin: 0 auto;
  }
}
.cont-logos .bloque {
  margin-bottom: 35px;
}
.cont-logos .separacion {
  border-left: 1px solid #d1d1d1;
}
@media (max-width: 768px) {
  .cont-logos .separacion {
    padding-top: 35px;
    border-top: 1px solid #d1d1d1;
    border-left: none;
  }
}
.cont-logos h3 {
  margin-bottom: 15px;
  color: #42b6e5;
  font-weight: 300;
  font-size: 16px;
}

.cont-mapa_pie {
  font-size: 14px;
  color: #076694;
}
.cont-mapa_pie h3 {
  margin-bottom: 9px;
  font-size: 20px;
  font-weight: 700;
}
.cont-mapa_pie a {
  color: #076694;
}
.cont-mapa_pie .icono {
  margin-right: 5px;
  font-size: 15px;
  vertical-align: middle;
}
.cont-mapa_pie #map {
  height: 337px;
}
@media (max-width: 1500px) {
  .cont-mapa_pie #map {
    height: 379px;
  }
}
@media (max-width: 480px) {
  .cont-mapa_pie #map {
    height: 337px;
  }
}
.cont-mapa_pie .item-contact {
  position: relative;
  padding: 23px;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  background: -moz-linear-gradient(top, rgba(0, 0, 0, 0.1) 0%, rgba(0, 0, 0, 0) 25%, rgba(0, 0, 0, 0) 99%);
  background: -webkit-gradient(linear, left top, left bottom, color-stop(0%, rgba(0, 0, 0, 0.1)), color-stop(25%, rgba(0, 0, 0, 0)), color-stop(99%, rgba(0, 0, 0, 0)));
  background: -webkit-linear-gradient(top, rgba(0, 0, 0, 0.1) 0%, rgba(0, 0, 0, 0) 25%, rgba(0, 0, 0, 0) 99%);
  background: -o-linear-gradient(top, rgba(0, 0, 0, 0.1) 0%, rgba(0, 0, 0, 0) 25%, rgba(0, 0, 0, 0) 99%);
  background: -ms-linear-gradient(top, rgba(0, 0, 0, 0.1) 0%, rgba(0, 0, 0, 0) 25%, rgba(0, 0, 0, 0) 99%);
  background: linear-gradient(to bottom, rgba(0, 0, 0, 0.1) 0%, rgba(0, 0, 0, 0) 25%, rgba(0, 0, 0, 0) 99%);
  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#1a000000", endColorstr="#00000000",GradientType=0 );
}
.cont-mapa_pie .item-contact:hover,
.cont-mapa_pie .item-contact.activo {
  color: #ffffff;
  background: #076694;
}
.cont-mapa_pie .item-contact:hover a,
.cont-mapa_pie .item-contact.activo a {
  color: #ffffff;
}
.cont-mapa_pie .item-contact.activo:before {
  position: absolute;
  content: "";
  display: block;
  top: 50%;
  top: calc(50% - 13px);
  right: -20px;
  width: 0;
  height: 0;
  border-style: solid;
  border-width: 13.5px 0 13.5px 20px;
  border-color: transparent transparent transparent #076694;
  z-index: 1;
}
@media (max-width: 480px) {
  .cont-mapa_pie .item-contact.activo:before {
    display: none;
  }
}

.cont-buscador {
  display: none;
  position: absolute;
  width: 100%;
  background: #004f7a;
  z-index: 2;
  top: 118px;
}
@media screen and (max-width: 768px) {
  .cont-buscador {
    top: 80px;
  }
}
.cont-buscador div {
  padding: 13px;
}
.cont-buscador input {
  background: none;
  border: none;
  color: #ffffff;
  font-size: 23px;
  position: relative;
}
.cont-buscador input:focus {
  outline: none;
  box-shadow: none;
}
.cont-buscador input::placeholder {
  color: #42b6e5;
  font-size: 23px;
}
.cont-buscador input:-ms-input-placeholder {
  color: #42b6e5;
  font-size: 23px;
}
.cont-buscador input::-webkit-input-placeholder {
  color: #42b6e5;
  font-size: 23px;
}
.cont-buscador input::-moz-placeholder {
  color: #42b6e5;
  font-size: 23px;
}
.cont-buscador span {
  position: absolute;
  right: 0;
  top: 0;
  padding-top: 28px;
  padding-right: 31px;
  color: #ffffff;
  font-size: 20px;
  cursor: pointer;
}
.cont-buscador .cont-busquedas {
  background: #e6e6e6;
  color: #2997b2;
  font-size: 14px;
  padding: 0px;
}
.cont-buscador .cont-busquedas p {
  display: inline-block;
  margin-bottom: 0;
  margin-right: 15px;
}
.cont-buscador .cont-busquedas .container {
  padding: 9px;
}
.cont-buscador .cont-busquedas .container div {
  display: inline-block;
  padding: 0;
}
.cont-buscador .cont-busquedas .container div .container {
  display: block;
  position: relative;
  margin-right: 20px;
  padding: 0 0 0 25px;
  margin-bottom: 0;
  cursor: pointer;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
}
.cont-buscador .cont-busquedas .container div .container input {
  position: absolute;
  opacity: 0;
  cursor: pointer;
}
.cont-buscador .cont-busquedas .container div .checkmark {
  position: absolute;
  top: 2px;
  left: 0;
  height: 17px;
  width: 17px;
  padding: 0;
  background-color: #ccc;
  border-radius: 3px;
}
.cont-buscador .cont-busquedas .container div .container:hover input ~ .checkmark {
  background-color: #ccc;
}
.cont-buscador .cont-busquedas .container div .container input:checked ~ .checkmark {
  background-color: #2997b2;
}
.cont-buscador .cont-busquedas .container div .checkmark:after {
  content: "";
  position: absolute;
  display: none;
}
.cont-buscador .cont-busquedas .container div .container input:checked ~ .checkmark:after {
  display: block;
}
.cont-buscador .cont-busquedas .container div .container .checkmark:after {
  left: 5px;
  top: 1px;
  width: 7px;
  height: 12px;
  border: solid white;
  border-width: 0 2px 2px 0;
  -webkit-transform: rotate(45deg);
  -ms-transform: rotate(45deg);
  transform: rotate(45deg);
}

.cont-buscador_rapido {
  margin-bottom: 35px;
  width: 100%;
}
.cont-buscador_rapido input {
  background: none;
  border: 1px solid #e1e1e1;
  font-size: 16px;
  position: relative;
}
.cont-buscador_rapido input:focus {
  outline: none;
  box-shadow: none;
}
.cont-buscador_rapido span {
  position: absolute;
  right: 0;
  top: 0;
  padding-top: 16px;
  padding-right: 30px;
  font-size: 20px;
  cursor: pointer;
}

.cont-menu-resp {
  display: none;
  position: absolute;
  width: 100%;
  bottom: 0;
  color: white;
  padding: 7px 15px;
  font-size: 14px;
  background-color: #021b22;
  text-transform: uppercase;
}
.cont-menu-resp .columna_1 {
  float: left;
  cursor: pointer;
}
.cont-menu-resp .columna_1 p {
  display: inline-block;
  margin-bottom: 0;
  vertical-align: text-bottom;
  margin-right: 5px;
}
.cont-menu-resp .columna_2 {
  float: right;
}
.cont-menu-resp .columna_2 a {
  color: #ffffff;
  text-decoration: none;
}
.cont-menu-resp .columna_2 a:hover {
  color: #42b6e5;
}
.cont-menu-resp .columna_2 a .icono-lupa {
  font-size: 17px;
  vertical-align: text-top;
}
.cont-menu-resp .columna_2 a .icono-red-twit {
  font-size: 13px;
}
.cont-menu-resp .columna_2 .redes-resp {
  display: none;
}
.cont-menu-resp .columna_2 .redes-resp span {
  margin-right: 5px;
}

.menu_lateral {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 34;
  width: 360px;
  height: 100%;
  overflow: auto;
  background-color: #fff;
  transition: all 0.3s;
  -moz-transition: all 0.3s;
  -ms-transition: all 0.3s;
  -webkit-transition: all 0.3s;
}
@media (max-width: 480px) {
  .menu_lateral {
    width: 100%;
    background-position: bottom;
    background-repeat: no-repeat;
  }
}

.menu_lateral_fondo {
  position: fixed;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background: rgba(0, 0, 0, 0.5);
  z-index: 34;
}

.cont-menu-responsive ul {
  margin-top: 35px;
  list-style: none;
}
.cont-menu-responsive ul li {
  position: relative;
  font-size: 18px;
  margin-bottom: 10px;
  list-style: none;
}
.cont-menu-responsive ul li a {
  text-decoration: none;
  color: #42b6e5;
}
.cont-menu-responsive ul li a.titulo {
  font-size: 18px;
}
.cont-menu-responsive ul li a:not([href]) {
  color: #000;
}
.cont-menu-responsive ul li a:hover {
  color: #076694;
}
.cont-menu-responsive ul li span {
  display: inline-block;
  font-size: 8px;
  margin-left: 10px;
  vertical-align: middle;
  cursor: pointer;
  position: absolute;
  top: 8px;
  right: 0;
}
.cont-menu-responsive ul > li {
  border-bottom: 1px solid #dcdcdc;
  padding-bottom: 10px;
}
.cont-menu-responsive ul > li:last-child {
  border-bottom: none;
}
.cont-menu-responsive ul .cont-menu-responsive-submenu {
  margin-top: 15px;
}
.cont-menu-responsive ul .cont-menu-responsive-submenu li {
  font-size: 14px;
  color: #076694;
  padding-left: 15px;
}
.cont-menu-responsive ul .cont-menu-responsive-submenu .cont-menu-responsive-sub-sub-menu {
  margin-top: 7px;
}
.cont-menu-responsive ul .cont-menu-responsive-submenu .cont-menu-responsive-sub-sub-menu li {
  font-size: 13px;
  color: #076694;
  border-bottom: none;
}

.titulo-historicos, .titulo-detacado {
  position: absolute;
  right: 10px;
  top: -7px;
  z-index: 10;
}
@media (max-width: 1024px) {
  .titulo-historicos, .titulo-detacado {
    position: static;
    margin-bottom: 10px;
    text-align: center;
  }
}
.titulo-historicos.top, .top.titulo-detacado {
  top: 0;
}
.titulo-historicos.notop, .notop.titulo-detacado {
  position: static;
  margin-top: 10px;
}
@media (max-width: 1024px) {
  .titulo-historicos.notop, .notop.titulo-detacado {
    width: 100%;
    text-align: center;
    margin-top: 20px;
    margin-bottom: 20px;
  }
}
.titulo-historicos.sinestrellas, .sinestrellas.titulo-detacado {
  text-align: right;
  position: static;
  margin-bottom: 20px;
}
@media (max-width: 1024px) {
  .titulo-historicos.sinestrellas, .sinestrellas.titulo-detacado {
    position: static;
    text-align: center;
  }
}
.titulo-historicos .estrellas, .titulo-detacado .estrellas {
  text-align: center;
  margin-bottom: 4px;
}
.titulo-historicos .estrellas span, .titulo-detacado .estrellas span {
  margin: 0 2px;
  color: #eeba02;
  font-size: 12px;
}
.titulo-historicos .contenido, .titulo-detacado .contenido {
  font-size: 15px;
  text-transform: uppercase;
  font-weight: 700;
}
.titulo-historicos .contenido a, .titulo-detacado .contenido a {
  padding-left: 20px;
  color: #076694;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.titulo-historicos .contenido a:hover, .titulo-detacado .contenido a:hover {
  color: #42b6e5;
}
.titulo-historicos .contenido a span, .titulo-detacado .contenido a span {
  vertical-align: middle;
  margin-left: 7px;
  font-size: 20px;
  color: #000;
}

.titulo-detacado {
  position: static;
  text-align: center;
  margin-top: 20px;
  margin-bottom: 15px;
}
.titulo-detacado .contenido {
  color: #42b6e5;
  font-size: 24px;
  font-weight: 600;
  text-transform: none;
}
.titulo-detacado .contenido a {
  color: #42b6e5;
}
.titulo-detacado .estrellas {
  text-align: center;
  margin-bottom: 4px;
}
.titulo-detacado .estrellas span {
  margin: 0 2px;
  color: #eeba02;
  font-size: 12px;
}

.botones-tablas {
  margin-top: 20px;
}
.botones-tablas a {
  margin-right: 10px;
}
@media (max-width: 480px) {
  .botones-tablas .btn {
    display: block;
    width: 100%;
    margin-top: 15px;
  }
}
@media (max-width: 480px) {
  .botones-tablas .btn:nth-child(2) {
    text-align: left;
  }
}
@media (max-width: 480px) {
  .botones-tablas .btn:nth-child(2) > div {
    right: 0;
  }
}
.botones-tablas .info {
  margin: 10px 0;
  font-size: 14px;
  color: #7b7b7b;
  font-style: italic;
  text-align: justify;
}
.botones-tablas .info span {
  vertical-align: middle;
}
.botones-tablas .info .icono {
  color: #42b6e5;
}
.botones-tablas.inside {
  margin-top: 0;
  padding-left: 10px;
  padding-bottom: 10px;
}
.botones-tablas.inside.borde {
  padding-top: 10px;
  padding-bottom: 0;
  border-top: 1px solid #eeeeee;
}
.botones-tablas.inside .btn.btn-primario-outline,
.botones-tablas.inside a.btn.btn-primario-outline {
  border-color: #ffffff;
}
.botones-tablas.inside .btn.btn-primario-outline:hover,
.botones-tablas.inside a.btn.btn-primario-outline:hover {
  border-color: #006ea9;
}

.logo_fijo {
  display: none;
}

.nav_fijo {
  position: fixed;
  top: 0;
  padding-top: 10px;
  height: 55px;
  background-color: #006ea9;
  text-align: right;
  z-index: 50;
}
.nav_fijo .logo_fijo {
  display: block;
  position: absolute;
  top: -5px;
  z-index: 50;
}
.nav_fijo .club_cabezal {
  opacity: 1;
  visibility: visible;
}

input,
select {
  height: 50px;
}

input,
select,
textarea {
  padding: 10px 15px;
  border: 1px solid #d1d1d1;
  border-radius: initial;
  padding-left: 15px;
  color: #696969;
  font-size: 15px;
  font-family: "Open Sans", sans-serif;
}

input::-webkit-input-placeholder, select::-webkit-input-placeholder, textarea::-webkit-input-placeholder {
  color: #696969;
  font-size: 15px;
}

input:-moz-placeholder, select:-moz-placeholder, textarea:-moz-placeholder {
  color: #696969;
  font-size: 15px;
  opacity: 1;
}

input::-moz-placeholder, select::-moz-placeholder, textarea::-moz-placeholder {
  color: #696969;
  font-size: 15px;
  opacity: 1;
}

input:-ms-input-placeholder, select:-ms-input-placeholder, textarea:-ms-input-placeholder {
  color: #696969;
  font-size: 15px;
}

.link, .link-vermas {
  display: inline-block;
  margin-top: 20px;
  color: #006ea9;
  font-size: 15px;
  font-weight: 700;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.link:hover, .link-vermas:hover {
  color: #42b6e5;
  text-decoration: none;
}
.link span, .link-vermas span {
  vertical-align: middle;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.link [class^=icono-], .link-vermas [class^=icono-],
.link [class*=" icono-"],
.link-vermas [class*=" icono-"] {
  display: inline-block;
  margin-left: 5px;
  color: #006ea9;
  font-weight: 700;
  font-size: 17px;
}

.link-vermas [class^=icono-],
.link-vermas [class*=" icono-"] {
  color: #000;
  font-size: 15px;
}
.link-vermas:hover [class^=icono-],
.link-vermas:hover [class*=" icono-"] {
  -ms-transform: translateX(5px);
  -webkit-transform: translateX(5px);
  transform: translateX(5px);
}

.cont-galeria-video, .cont-video_contenido {
  overflow: hidden;
  font-size: 10px;
}
.cont-galeria-video a, .cont-video_contenido a {
  text-decoration: none;
}
.cont-galeria-video .columna-1, .cont-video_contenido .columna-1 {
  display: inline-block;
  width: 35%;
}
@media (max-width: 480px) {
  .cont-galeria-video .columna-1, .cont-video_contenido .columna-1 {
    width: 100%;
  }
}
.cont-galeria-video .columna-2, .cont-video_contenido .columna-2 {
  display: inline-block;
  width: 65%;
  background: url(/imagenes/img_presentacion/loader.gif) center center no-repeat;
}
.cont-galeria-video .columna-2.novideo, .cont-video_contenido .columna-2.novideo {
  background: none;
}
@media (max-width: 480px) {
  .cont-galeria-video .columna-2, .cont-video_contenido .columna-2 {
    width: 100%;
  }
}
.cont-galeria-video .activo .ico_ampliar, .cont-video_contenido .activo .ico_ampliar {
  opacity: 0;
}
.cont-galeria-video .activo figure, .cont-video_contenido .activo figure {
  opacity: 0.8;
}
.cont-galeria-video .ico_ampliar, .cont-video_contenido .ico_ampliar {
  position: absolute;
  font-family: "iconos";
  display: block;
  width: 100%;
  top: 25%;
  font-size: 80px;
  color: #ffffff;
  text-align: center;
  z-index: 1;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  cursor: pointer;
}
.cont-galeria-video .ico_ampliar:before, .cont-video_contenido .ico_ampliar:before {
  content: "\e91a";
}
.cont-galeria-video h3, .cont-video_contenido h3 {
  position: absolute;
  bottom: 0;
  margin: 0;
  color: #ffffff;
  font-size: 20px;
  padding: 50px;
  font-weight: 700;
}
.cont-galeria-video figure, .cont-video_contenido figure {
  position: relative;
  display: block;
  margin: 0;
  overflow: hidden;
  background: #000;
}
@media (max-width: 480px) {
  .cont-galeria-video figure, .cont-video_contenido figure {
    text-align: center;
  }
  .cont-galeria-video figure img, .cont-video_contenido figure img {
    width: 100%;
  }
}
.cont-galeria-video figure img, .cont-video_contenido figure img {
  position: relative;
  top: calc(50% - 110px);
  transition: all 700ms ease;
  -webkit-transition: all 700ms ease;
  -moz-transition: all 700ms ease;
  -ms-transition: all 700ms ease;
  image-rendering: optimizeQuality;
  -moz-image-rendering: optimizeQuality;
  -webkit-image-rendering: optimizeQuality;
}
.cont-galeria-video figure h3, .cont-video_contenido figure h3 {
  font-size: 2em;
  padding: 50px;
}
.cont-galeria-video .galeria-video, .cont-video_contenido .galeria-video {
  padding-right: 1%;
}
.cont-galeria-video .galeria-video .slide-vertical, .cont-video_contenido .galeria-video .slide-vertical {
  height: 560px;
  padding: 20px 0;
}
@media (max-width: 480px) {
  .cont-galeria-video .galeria-video .slide-vertical, .cont-video_contenido .galeria-video .slide-vertical {
    height: auto;
    padding: 0;
  }
}
.cont-galeria-video .galeria-video .slide-vertical .swiper-button-disabled, .cont-video_contenido .galeria-video .slide-vertical .swiper-button-disabled {
  opacity: 0.5 !important;
}
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-next, .cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-next,
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-prev,
.cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-prev {
  position: absolute;
  z-index: 1;
  text-align: center;
  width: 100%;
  cursor: pointer;
  background: #006ea9;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-next:hover, .cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-next:hover,
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-prev:hover,
.cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-prev:hover {
  background: #42b6e5;
}
@media (max-width: 480px) {
  .cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-next, .cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-next,
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-prev,
.cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-prev {
    display: none;
  }
}
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-next, .cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-next {
  bottom: 0;
}
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-next .swiper-button-next, .cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-next .swiper-button-next {
  position: static;
  display: inline-block;
  background-image: none;
  color: #ffffff;
  width: auto;
  height: auto;
  margin: 6px;
}
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-prev, .cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-prev {
  top: 0;
}
.cont-galeria-video .galeria-video .slide-vertical .flecha-vertical-prev .swiper-button-prev, .cont-video_contenido .galeria-video .slide-vertical .flecha-vertical-prev .swiper-button-prev {
  position: static;
  display: inline-block;
  background-image: none;
  color: #ffffff;
  width: auto;
  height: auto;
  margin: 6px;
}
.cont-galeria-video .galeria-video .ico_ampliar, .cont-video_contenido .galeria-video .ico_ampliar {
  font-size: 60px;
  top: calc(50% - 50px);
}
@media (max-width: 480px) {
  .cont-galeria-video .galeria-video, .cont-video_contenido .galeria-video {
    padding-right: 0;
    background: #000;
  }
}
.cont-galeria-video .galeria-video article, .cont-video_contenido .galeria-video article {
  position: relative;
  text-align: center;
}
.cont-galeria-video .galeria-video article h3, .cont-video_contenido .galeria-video article h3 {
  padding: 15px;
  font-size: 1.7em;
  font-weight: 600;
}
@media (max-width: 480px) {
  .cont-galeria-video .galeria-video article h3, .cont-video_contenido .galeria-video article h3 {
    display: none;
  }
}
.cont-galeria-video .galeria-video article figure, .cont-video_contenido .galeria-video article figure {
  height: 175px;
}
@media (max-width: 480px) {
  .cont-galeria-video .galeria-video article figure, .cont-video_contenido .galeria-video article figure {
    height: auto;
  }
}
.cont-galeria-video .ampliacion figure, .cont-video_contenido .ampliacion figure {
  height: 560px;
}
@media (max-width: 480px) {
  .cont-galeria-video .ampliacion figure, .cont-video_contenido .ampliacion figure {
    height: 280px;
  }
}
.cont-galeria-video .ampliacion figure img, .cont-video_contenido .ampliacion figure img {
  top: calc(50% - 220px);
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
}
@media (max-width: 480px) {
  .cont-galeria-video .ampliacion figure img, .cont-video_contenido .ampliacion figure img {
    top: calc(50% - 110px);
  }
}
.cont-galeria-video .ampliacion figure .ico_ampliar, .cont-video_contenido .ampliacion figure .ico_ampliar {
  top: calc(50% - 60px);
}
.cont-galeria-video .ampliacion figure h3, .cont-video_contenido .ampliacion figure h3 {
  font-size: 2.4em;
  padding: 50px;
}
@media (max-width: 480px) {
  .cont-galeria-video .ampliacion figure h3, .cont-video_contenido .ampliacion figure h3 {
    padding: 20px;
    font-size: 1.4em;
  }
}
.cont-galeria-video .ampliacion .video-container, .cont-video_contenido .ampliacion .video-container {
  padding-bottom: 68%;
}
.cont-galeria-video article:hover figure img, .cont-video_contenido article:hover figure img {
  opacity: 0.5;
  transform: scale(1.3);
  -webkit-transform: scale(1.3);
  -moz-transform: scale(1.3);
  -ms-transform: scale(1.3);
}

.cont-video_contenido .columna-2 {
  display: block;
  margin-bottom: 25px;
  width: auto;
}
.cont-video_contenido .ampliacion figure {
  height: 560px;
}
@media (max-width: 1025px) {
  .cont-video_contenido .ampliacion figure {
    height: 325px;
  }
}
@media (max-width: 480px) {
  .cont-video_contenido .ampliacion figure {
    height: 220px;
  }
}
.cont-video_contenido .ampliacion figure img {
  top: calc(50% - 289px);
  transform: none;
  -webkit-transform: none;
  -moz-transform: none;
  -ms-transform: none;
}
@media (max-width: 768px) {
  .cont-video_contenido .ampliacion figure img {
    top: 0;
  }
}
@media (max-width: 480px) {
  .cont-video_contenido .ampliacion figure img {
    top: calc(50% - 110px);
  }
}
.cont-video_contenido .ampliacion figure.img_youtube img {
  top: calc(50% - 360px);
  left: calc(50% - 680px);
  min-height: 560px;
  width: inherit;
  max-width: none;
}

.cont-fixture {
  padding: 15px;
  color: #ffffff;
  font-size: 14px;
  background: #006ea9;
}
.cont-fixture h3 {
  margin-bottom: 0;
  font-size: 18px;
  font-weight: 800;
}
@media (max-width: 480px) {
  .cont-fixture h3 {
    text-align: center;
  }
}
.cont-fixture .fecha_slider {
  margin: 15px 0;
  padding: 12px;
  text-align: center;
  background: #42b6e5;
}
.cont-fixture .slider-fechas-titulo .flecha-fecha {
  margin-top: 15px;
  padding: 10px;
  position: absolute;
  font-size: 25px;
  top: 0;
  cursor: pointer;
  z-index: 3;
}
.cont-fixture .slider-fechas-titulo .flecha-fecha.flecha-fecha-next {
  right: 0;
}
.cont-fixture .slider-fechas-titulo .flecha-fecha.flecha-fecha-prev {
  left: 0;
}
.cont-fixture .slider-fechas-titulo .flecha-fecha.swiper-button-disabled {
  opacity: 0.4;
}
.cont-fixture .swiper-slide {
  overflow: hidden;
}
.cont-fixture .item-fixture.noultimo {
  padding-bottom: 15px;
  margin-bottom: 15px;
  border-bottom: 1px solid #007fc3;
}
.cont-fixture .item-fixture .item-fixture-col1 {
  padding-left: 40px;
  font-size: 16px;
  font-weight: 300;
}
@media (max-width: 480px) {
  .cont-fixture .item-fixture .item-fixture-col1 {
    display: flex;
    padding-left: 15px;
  }
}
.cont-fixture .item-fixture .item-fixture-col1 > div {
  margin-bottom: 10px;
}
.cont-fixture .item-fixture .item-fixture-col1 > div.ultimo {
  margin-bottom: 0;
}
@media (max-width: 480px) {
  .cont-fixture .item-fixture .item-fixture-col1 > div.ultimo {
    text-align: right;
  }
}
@media (max-width: 480px) {
  .cont-fixture .item-fixture .item-fixture-col1 > div {
    flex: auto;
  }
}
.cont-fixture .item-fixture .item-fixture-col1 img {
  margin-right: 10px;
  vertical-align: middle;
}
.cont-fixture .item-fixture .item-fixture-col2 {
  line-height: 1.2;
}
.cont-fixture .item-fixture .item-fixture-col2 a {
  color: #ffffff;
  text-decoration: none;
}
.cont-fixture .item-fixture .item-fixture-col2 a:hover {
  color: #afd5ef;
}
@media (max-width: 480px) {
  .cont-fixture .item-fixture .item-fixture-col2 {
    margin-top: 10px;
  }
}

.cont-tabla_posiciones, .cont-proximos_partidos, .cont-proximos_partidos_home, .cont-tabla_posiciones_home {
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
.cont-tabla_posiciones h3, .cont-proximos_partidos h3, .cont-proximos_partidos_home h3, .cont-tabla_posiciones_home h3 {
  margin-bottom: 5px;
  padding: 13px 20px;
  color: #ffffff;
  font-size: 18px;
  font-weight: 700;
  background-color: #006ea9;
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
@media (max-width: 480px) {
  .cont-tabla_posiciones h3, .cont-proximos_partidos h3, .cont-proximos_partidos_home h3, .cont-tabla_posiciones_home h3 {
    text-align: center;
    font-size: 14px;
  }
}
.cont-tabla_posiciones h3.invertido, .cont-proximos_partidos h3.invertido, .cont-proximos_partidos_home h3.invertido, .cont-tabla_posiciones_home h3.invertido {
  color: #006ea9;
  font-weight: 800;
  background-color: #ffffff;
  box-shadow: none;
}
.cont-tabla_posiciones aside, .cont-proximos_partidos aside, .cont-proximos_partidos_home aside, .cont-tabla_posiciones_home aside {
  padding: 0 10px;
}
@media (max-width: 480px) {
  .cont-tabla_posiciones aside, .cont-proximos_partidos aside, .cont-proximos_partidos_home aside, .cont-tabla_posiciones_home aside {
    padding: 0;
  }
}
.cont-tabla_posiciones aside .item-tabla_posiciones, .cont-proximos_partidos aside .item-tabla_posiciones, .cont-proximos_partidos_home aside .item-tabla_posiciones, .cont-tabla_posiciones_home aside .item-tabla_posiciones {
  border-bottom: 1px solid #d1d1d1;
}
.cont-tabla_posiciones section, .cont-proximos_partidos section, .cont-proximos_partidos_home section, .cont-tabla_posiciones_home section {
  padding: 0 10px 15px;
}
@media (max-width: 480px) {
  .cont-tabla_posiciones section, .cont-proximos_partidos section, .cont-proximos_partidos_home section, .cont-tabla_posiciones_home section {
    padding: 0;
  }
}
.cont-tabla_posiciones section .item-tabla_posiciones, .cont-proximos_partidos section .item-tabla_posiciones, .cont-proximos_partidos_home section .item-tabla_posiciones, .cont-tabla_posiciones_home section .item-tabla_posiciones {
  border-bottom: 1px solid #d1d1d1;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-tabla_posiciones section .item-tabla_posiciones .club_titulo, .cont-proximos_partidos section .item-tabla_posiciones .club_titulo, .cont-proximos_partidos_home section .item-tabla_posiciones .club_titulo, .cont-tabla_posiciones_home section .item-tabla_posiciones .club_titulo {
  font-size: 11px;
}
.cont-tabla_posiciones section .item-tabla_posiciones img, .cont-proximos_partidos section .item-tabla_posiciones img, .cont-proximos_partidos_home section .item-tabla_posiciones img, .cont-tabla_posiciones_home section .item-tabla_posiciones img {
  vertical-align: middle;
  margin-right: 5px;
  /* @media (max-width: $screen-xs) {
  	width: 30px;
  } */
}
.cont-tabla_posiciones section .item-tabla_posiciones:nth-child(2n+2), .cont-proximos_partidos section .item-tabla_posiciones:nth-child(2n+2), .cont-proximos_partidos_home section .item-tabla_posiciones:nth-child(2n+2), .cont-tabla_posiciones_home section .item-tabla_posiciones:nth-child(2n+2) {
  background-color: #f7f7f7;
}
.cont-tabla_posiciones section .item-tabla_posiciones:hover, .cont-proximos_partidos section .item-tabla_posiciones:hover, .cont-proximos_partidos_home section .item-tabla_posiciones:hover, .cont-tabla_posiciones_home section .item-tabla_posiciones:hover {
  background-color: #ebebeb;
}
.cont-tabla_posiciones section .item-tabla_posiciones.mini img, .cont-proximos_partidos section .item-tabla_posiciones.mini img, .cont-proximos_partidos_home section .item-tabla_posiciones.mini img, .cont-tabla_posiciones_home section .item-tabla_posiciones.mini img {
  height: 31px;
}
.cont-tabla_posiciones .item-tabla_posiciones, .cont-proximos_partidos .item-tabla_posiciones, .cont-proximos_partidos_home .item-tabla_posiciones, .cont-tabla_posiciones_home .item-tabla_posiciones {
  padding: 10px 12px;
  font-size: 15px;
}
.cont-tabla_posiciones .item-tabla_posiciones.mini, .cont-proximos_partidos .item-tabla_posiciones.mini, .cont-proximos_partidos_home .item-tabla_posiciones.mini, .cont-tabla_posiciones_home .item-tabla_posiciones.mini {
  padding: 3px 12px;
}
.cont-tabla_posiciones .item-tabla_posiciones.mini.esultimo, .cont-proximos_partidos .item-tabla_posiciones.mini.esultimo, .cont-proximos_partidos_home .item-tabla_posiciones.mini.esultimo, .cont-tabla_posiciones_home .item-tabla_posiciones.mini.esultimo {
  border-bottom: none;
}
.cont-tabla_posiciones .item-tabla_posiciones.titular, .cont-proximos_partidos .item-tabla_posiciones.titular, .cont-proximos_partidos_home .item-tabla_posiciones.titular, .cont-tabla_posiciones_home .item-tabla_posiciones.titular {
  padding: 12px;
}
@media (max-width: 480px) {
  .cont-tabla_posiciones .item-tabla_posiciones, .cont-proximos_partidos .item-tabla_posiciones, .cont-proximos_partidos_home .item-tabla_posiciones, .cont-tabla_posiciones_home .item-tabla_posiciones {
    padding: 7px 5px;
    font-size: 10px;
  }
}
.cont-tabla_posiciones .item-tabla_posiciones .row, .cont-proximos_partidos .item-tabla_posiciones .row, .cont-proximos_partidos_home .item-tabla_posiciones .row, .cont-tabla_posiciones_home .item-tabla_posiciones .row {
  margin-right: -10px;
  margin-left: -10px;
}
@media (max-width: 480px) {
  .cont-tabla_posiciones .item-tabla_posiciones .row, .cont-proximos_partidos .item-tabla_posiciones .row, .cont-proximos_partidos_home .item-tabla_posiciones .row, .cont-tabla_posiciones_home .item-tabla_posiciones .row {
    margin-right: -5px;
    margin-left: -5px;
  }
}
.cont-tabla_posiciones .item-tabla_posiciones .row .col, .cont-proximos_partidos .item-tabla_posiciones .row .col, .cont-proximos_partidos_home .item-tabla_posiciones .row .col, .cont-tabla_posiciones_home .item-tabla_posiciones .row .col,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-1,
.cont-proximos_partidos .item-tabla_posiciones .row .col-1,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-1,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-1,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-2,
.cont-proximos_partidos .item-tabla_posiciones .row .col-2,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-2,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-2,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-3,
.cont-proximos_partidos .item-tabla_posiciones .row .col-3,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-3,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-3,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-4,
.cont-proximos_partidos .item-tabla_posiciones .row .col-4,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-4,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-4,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-5,
.cont-proximos_partidos .item-tabla_posiciones .row .col-5,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-5,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-5,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-6,
.cont-proximos_partidos .item-tabla_posiciones .row .col-6,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-6,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-6,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-7,
.cont-proximos_partidos .item-tabla_posiciones .row .col-7,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-7,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-7,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-8,
.cont-proximos_partidos .item-tabla_posiciones .row .col-8,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-8,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-8 {
  padding-right: 10px;
  padding-left: 10px;
}
@media (max-width: 480px) {
  .cont-tabla_posiciones .item-tabla_posiciones .row .col, .cont-proximos_partidos .item-tabla_posiciones .row .col, .cont-proximos_partidos_home .item-tabla_posiciones .row .col, .cont-tabla_posiciones_home .item-tabla_posiciones .row .col,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-1,
.cont-proximos_partidos .item-tabla_posiciones .row .col-1,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-1,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-1,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-2,
.cont-proximos_partidos .item-tabla_posiciones .row .col-2,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-2,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-2,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-3,
.cont-proximos_partidos .item-tabla_posiciones .row .col-3,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-3,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-3,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-4,
.cont-proximos_partidos .item-tabla_posiciones .row .col-4,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-4,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-4,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-5,
.cont-proximos_partidos .item-tabla_posiciones .row .col-5,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-5,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-5,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-6,
.cont-proximos_partidos .item-tabla_posiciones .row .col-6,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-6,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-6,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-7,
.cont-proximos_partidos .item-tabla_posiciones .row .col-7,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-7,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-7,
.cont-tabla_posiciones .item-tabla_posiciones .row .col-8,
.cont-proximos_partidos .item-tabla_posiciones .row .col-8,
.cont-proximos_partidos_home .item-tabla_posiciones .row .col-8,
.cont-tabla_posiciones_home .item-tabla_posiciones .row .col-8 {
    padding-right: 5px;
    padding-left: 5px;
  }
}
.cont-tabla_posiciones.tabla_clubes .item-tabla_posiciones, .tabla_clubes.cont-proximos_partidos .item-tabla_posiciones, .tabla_clubes.cont-proximos_partidos_home .item-tabla_posiciones, .tabla_clubes.cont-tabla_posiciones_home .item-tabla_posiciones {
  padding-top: 7px;
  padding-bottom: 7px;
}
.cont-tabla_posiciones.tabla_clubes .item-tabla_posiciones.titular, .tabla_clubes.cont-proximos_partidos .item-tabla_posiciones.titular, .tabla_clubes.cont-proximos_partidos_home .item-tabla_posiciones.titular, .tabla_clubes.cont-tabla_posiciones_home .item-tabla_posiciones.titular {
  padding: 12px;
}
.cont-tabla_posiciones.tabla_clubes .item-tabla_posiciones img, .tabla_clubes.cont-proximos_partidos .item-tabla_posiciones img, .tabla_clubes.cont-proximos_partidos_home .item-tabla_posiciones img, .tabla_clubes.cont-tabla_posiciones_home .item-tabla_posiciones img {
  max-height: 22px;
}
.cont-tabla_posiciones.tabla_clubes .item-tabla_posiciones a, .tabla_clubes.cont-proximos_partidos .item-tabla_posiciones a, .tabla_clubes.cont-proximos_partidos_home .item-tabla_posiciones a, .tabla_clubes.cont-tabla_posiciones_home .item-tabla_posiciones a {
  color: #000;
  text-decoration: none;
}

.cont-tabla_posiciones_home h3 {
  text-align: center;
}
.cont-tabla_posiciones_home aside .item-tabla_posiciones {
  padding: 5px 0;
  border-bottom: none;
}
@media (max-width: 768px) {
  .cont-tabla_posiciones_home aside .item-tabla_posiciones {
    padding: 5px 10px;
    font-size: 15px;
  }
}
.cont-tabla_posiciones_home section {
  position: relative;
  padding: 0 5px;
  padding-bottom: 20px;
}
.cont-tabla_posiciones_home section .swiper-container {
  height: 140px;
  margin-top: 10px;
}
.cont-tabla_posiciones_home section .item-tabla_posiciones {
  padding: 5px;
  border-bottom: none;
}
.cont-tabla_posiciones_home section .item-tabla_posiciones:nth-child(2n+2) {
  background-color: #ffffff;
}
.cont-tabla_posiciones_home section .item-tabla_posiciones img {
  width: 25px;
}
@media (max-width: 768px) {
  .cont-tabla_posiciones_home section .item-tabla_posiciones {
    font-size: 15px;
  }
}
.cont-tabla_posiciones_home section .swiper-button-disabled {
  display: none;
  opacity: 0;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-tabla_posiciones_home section .swiper-button-next,
.cont-tabla_posiciones_home section .swiper-button-prev {
  background-image: none;
  position: static;
  height: auto;
  font-size: 13px;
  margin-bottom: 5px;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-tabla_posiciones_home section .swiper-button-next:hover,
.cont-tabla_posiciones_home section .swiper-button-prev:hover {
  color: #42b6e5;
}
.cont-tabla_posiciones_home section .flechas_cont {
  position: absolute;
  width: 100%;
  bottom: 0;
  text-align: center;
}
.cont-tabla_posiciones_home section .flechas_cont .flecha-vertical-4col-prev,
.cont-tabla_posiciones_home section .flechas_cont .flecha-vertical-4col-next {
  display: inline-block;
}

.cont-proximos_partidos_home h3 {
  text-align: center;
}
.cont-proximos_partidos_home .item-tabla_posiciones {
  font-size: 13px;
}
.cont-proximos_partidos_home .item-tabla_posiciones .titular {
  margin-bottom: 5px;
  text-align: center;
  color: #006ea9;
}
.cont-proximos_partidos_home .item-tabla_posiciones p {
  margin-top: 5px;
  margin-bottom: 0;
  font-size: 12px;
}
.cont-proximos_partidos_home .item-tabla_posiciones a {
  color: #006ea9;
  font-weight: 700;
  text-decoration: none;
}
.cont-proximos_partidos_home section {
  position: relative;
  padding: 0 5px;
  padding-bottom: 40px;
}
.cont-proximos_partidos_home section .swiper-container {
  height: 320px;
  margin-top: 10px;
}
.cont-proximos_partidos_home section .item-tabla_posiciones {
  padding: 10px 5px;
}
.cont-proximos_partidos_home section .item-tabla_posiciones img {
  width: 25px;
}
.cont-proximos_partidos_home section .swiper-button-disabled {
  display: none;
  opacity: 0;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-proximos_partidos_home section .swiper-button-next,
.cont-proximos_partidos_home section .swiper-button-prev {
  background-image: none;
  position: static;
  height: auto;
  font-size: 13px;
  margin-bottom: 15px;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-proximos_partidos_home section .swiper-button-next:hover,
.cont-proximos_partidos_home section .swiper-button-prev:hover {
  color: #42b6e5;
}
.cont-proximos_partidos_home section .flechas_cont {
  position: absolute;
  width: 100%;
  bottom: 0;
  text-align: center;
}
.cont-proximos_partidos_home section .flechas_cont .flecha-vertical-3col-prev,
.cont-proximos_partidos_home section .flechas_cont .flecha-vertical-3col-next {
  display: inline-block;
}
.cont-proximos_partidos_home.dos_partidos section .item-tabla_posiciones {
  background-color: #ffffff;
  font-size: 15px;
}
.cont-proximos_partidos_home.dos_partidos section .item-tabla_posiciones:last-child {
  margin-top: 10px;
  border-bottom: none;
}
.cont-proximos_partidos_home.dos_partidos section .item-tabla_posiciones .titular {
  font-weight: 700;
  color: #000;
}
.cont-proximos_partidos_home.dos_partidos section .item-tabla_posiciones p {
  margin: 10px;
  text-align: center;
  font-size: 13px;
}
.cont-proximos_partidos_home.un_partido section .item-tabla_posiciones {
  font-size: 20px;
  border-bottom: none;
}
.cont-proximos_partidos_home.un_partido section .item-tabla_posiciones .titular {
  margin-bottom: 15px;
  font-size: 15px;
  font-weight: 700;
  color: #000;
}
.cont-proximos_partidos_home.un_partido section .item-tabla_posiciones p {
  margin: 10px;
  text-align: center;
  font-size: 16px;
}
.cont-proximos_partidos_home.un_partido section .item-tabla_posiciones img {
  width: 45px;
}
.cont-proximos_partidos_home.un_partido section .fecha_hora {
  margin-top: 15px;
  margin-bottom: 10px;
  text-align: center;
  font-weight: 700;
  line-height: 1;
}
.cont-proximos_partidos_home.un_partido section .fecha_hora .dia {
  color: #006ea9;
}
.cont-proximos_partidos_home.un_partido section .pais {
  font-weight: 300;
  margin: 0 20px 20px;
}
.cont-proximos_partidos_home.un_partido section .pais.uruguay {
  color: #42b6e5;
}

.cont-proximos_partidos h3 {
  text-align: center;
}
.cont-proximos_partidos .item-tabla_posiciones {
  font-size: 14px;
}
.cont-proximos_partidos .item-tabla_posiciones .titular {
  margin-bottom: 0;
  text-align: center;
  font-size: 15px;
  font-weight: 700;
  color: #000;
}
.cont-proximos_partidos .item-tabla_posiciones p {
  margin-top: 5px;
  margin-bottom: 0;
  text-align: center;
}
.cont-proximos_partidos .item-tabla_posiciones a {
  color: #006ea9;
  font-weight: 700;
  text-align: center;
  text-transform: uppercase;
  text-decoration: none;
}
.cont-proximos_partidos .item-tabla_posiciones .cont-item {
  border-left: 1px solid #d1d1d1;
}
.cont-proximos_partidos .item-tabla_posiciones .item {
  margin-bottom: 3px;
}
.cont-proximos_partidos section {
  position: relative;
  padding: 0 25px;
}
.cont-proximos_partidos section .swiper-container {
  margin-top: 10px;
}
.cont-proximos_partidos section .item-tabla_posiciones {
  border: none;
  padding: 10px 5px;
}
.cont-proximos_partidos section .item-tabla_posiciones img {
  width: 25px;
}
.cont-proximos_partidos section .item-tabla_posiciones:hover {
  background-color: transparent;
}
.cont-proximos_partidos section .swiper-button-next,
.cont-proximos_partidos section .swiper-button-prev {
  background-image: none;
  height: auto;
  width: auto;
  font-size: 25px;
  font-weight: 700;
  margin-top: 0;
  margin-bottom: 0;
}
.cont-proximos_partidos section .swiper-button-disabled {
  display: none;
  opacity: 0;
}
.cont-proximos_partidos.bg_alterno {
  color: #ffffff;
  background-color: #006ea9;
}
.cont-proximos_partidos.bg_alterno .titular {
  color: #ffffff;
}
.cont-proximos_partidos.bg_alterno .item-tabla_posiciones .cont-item {
  border-left: 1px solid #008050;
}
.cont-proximos_partidos.bg_alterno section .swiper-button-next,
.cont-proximos_partidos.bg_alterno section .swiper-button-prev {
  color: #ffffff;
}

.cont-tabla_fase {
  padding-bottom: 12px;
  text-align: center;
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
.cont-tabla_fase h3 {
  padding: 25px;
  margin-bottom: 0;
  font-size: 15px;
  font-weight: 700;
}
.cont-tabla_fase .item {
  padding: 14px 0;
  border-top: 1px solid #f7f7f7;
  font-size: 15px;
}
.cont-tabla_fase .item img {
  margin: 0 10px;
  max-width: 40px;
}
@media (max-width: 768px) {
  .cont-tabla_fase .item img {
    margin: 0 5px;
    max-width: 30px;
  }
}
.cont-tabla_fase .item a {
  font-size: 12px;
  font-weight: 700;
}
.cont-tabla_fase .item span {
  margin: 0 10px;
  font-weight: 700;
  color: #006ea9;
  letter-spacing: 8px;
}
@media (max-width: 768px) {
  .cont-tabla_fase .item span {
    letter-spacing: 5px;
  }
}

.cont-listado_descargas, .cont-listado_descargas_min {
  padding: 0 15%;
}
@media (max-width: 1024px) {
  .cont-listado_descargas, .cont-listado_descargas_min {
    padding: 0 5%;
  }
}
.cont-listado_descargas .item-listado_descargas, .cont-listado_descargas_min .item-listado_descargas {
  color: #42b6e5;
  font-size: 18px;
  padding: 20px 0;
  font-weight: 700;
  border-bottom: 1px solid #d1d1d1;
}
@media (max-width: 768px) {
  .cont-listado_descargas .item-listado_descargas, .cont-listado_descargas_min .item-listado_descargas {
    padding: 10px;
    font-size: 15px;
  }
}
.cont-listado_descargas .item-listado_descargas a, .cont-listado_descargas_min .item-listado_descargas a {
  position: relative;
  display: inline-block;
  padding-left: 50px;
  color: #006ea9;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-listado_descargas .item-listado_descargas a:hover, .cont-listado_descargas_min .item-listado_descargas a:hover {
  color: #42b6e5;
  text-decoration: none;
}
@media (max-width: 480px) {
  .cont-listado_descargas .item-listado_descargas a, .cont-listado_descargas_min .item-listado_descargas a {
    padding-left: 0;
  }
}
.cont-listado_descargas .item-listado_descargas span, .cont-listado_descargas_min .item-listado_descargas span {
  font-weight: 400;
  vertical-align: middle;
}
.cont-listado_descargas .item-listado_descargas span[class^=icono-], .cont-listado_descargas_min .item-listado_descargas span[class^=icono-], .cont-listado_descargas .item-listado_descargas span[class*=" icono-"], .cont-listado_descargas_min .item-listado_descargas span[class*=" icono-"] {
  position: absolute;
  top: 0;
  left: 0;
  color: #000;
  font-size: 40px;
}
@media (max-width: 768px) {
  .cont-listado_descargas .item-listado_descargas span[class^=icono-], .cont-listado_descargas_min .item-listado_descargas span[class^=icono-], .cont-listado_descargas .item-listado_descargas span[class*=" icono-"], .cont-listado_descargas_min .item-listado_descargas span[class*=" icono-"] {
    font-size: 25px;
  }
}
@media (max-width: 480px) {
  .cont-listado_descargas .item-listado_descargas span[class^=icono-], .cont-listado_descargas_min .item-listado_descargas span[class^=icono-], .cont-listado_descargas .item-listado_descargas span[class*=" icono-"], .cont-listado_descargas_min .item-listado_descargas span[class*=" icono-"] {
    display: none;
  }
}

.cont-listado_descargas_min {
  padding: initial;
}
.cont-listado_descargas_min .item-listado_descargas {
  padding-left: 10px;
  padding-right: 10px;
  font-size: 15px;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-listado_descargas_min .item-listado_descargas:hover {
  background-color: #e4f8ff;
}
.cont-listado_descargas_min .item-listado_descargas span[class^=icono-], .cont-listado_descargas_min .item-listado_descargas span[class*=" icono-"] {
  font-size: 30px;
}
.cont-listado_descargas_min .item-titulo {
  color: #7b7b7b;
  font-size: 15px;
  padding-bottom: 5px;
  padding-right: 40px;
  border-bottom: 1px solid #d1d1d1;
}
@media (max-width: 768px) {
  .cont-listado_descargas_min .item-titulo {
    padding: 10px;
    font-size: 15px;
  }
}
.cont-listado_descargas_min .item-titulo span {
  font-weight: 400;
  vertical-align: middle;
}
.cont-listado_descargas_min .item-titulo span[class^=icono-], .cont-listado_descargas_min .item-titulo span[class*=" icono-"] {
  margin-right: 10px;
  color: #000;
  font-size: 40px;
}
@media (max-width: 768px) {
  .cont-listado_descargas_min .item-titulo span[class^=icono-], .cont-listado_descargas_min .item-titulo span[class*=" icono-"] {
    font-size: 25px;
  }
}
@media (max-width: 480px) {
  .cont-listado_descargas_min .item-titulo span[class^=icono-], .cont-listado_descargas_min .item-titulo span[class*=" icono-"] {
    display: none;
  }
}

.cont-buscador_descargas .buscar {
  position: relative;
  margin-bottom: 10px;
}
.cont-buscador_descargas .buscar label {
  position: absolute;
  top: 0;
  left: 0;
}
.cont-buscador_descargas .buscar .icono {
  display: inline-block;
  margin: 15px 10px;
  color: #42b6e5;
  font-size: 23px;
}
.cont-buscador_descargas .buscar input {
  padding-left: 45px;
}
.cont-buscador_descargas h3 {
  margin-bottom: 10px;
  font-size: 15px;
  font-weight: 700;
}
.cont-buscador_descargas .categorias {
  margin-bottom: 20px;
}
.cont-buscador_descargas .categorias .item label {
  font-size: 15px;
}
.cont-buscador_descargas a {
  color: #006ea9;
  font-size: 15px;
  font-weight: 700;
  text-decoration: none;
}
.cont-buscador_descargas a .icono {
  font-size: 7px;
  display: inline-block;
}
.cont-buscador_descargas a .icono.arriba {
  display: none;
  transform: rotate(180deg);
}

.cont-rango_fechas {
  margin-bottom: 10px;
  padding: 0 15px;
  border: 1px solid #d1d1d1;
}
.cont-rango_fechas .icono {
  font-size: 30px;
  color: #42b6e5;
  vertical-align: middle;
}
.cont-rango_fechas span.separador {
  font-size: 18px;
  vertical-align: middle;
}
.cont-rango_fechas .fecha_calendario {
  display: inline-block;
  width: 135px;
  font-weight: 700;
}
.cont-rango_fechas .fecha_calendario input {
  border: none;
  font-weight: 700;
  text-align: center;
}
.cont-rango_fechas .fecha_calendario input:focus {
  box-shadow: none;
  border-color: transparent;
  outline-color: transparent;
}

.btn-buscar {
  position: relative;
  text-align: center;
  color: #ffffff;
  background-color: #006ea9;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.btn-buscar:hover {
  opacity: 0.8;
}
.btn-buscar .icono {
  position: absolute;
  margin: 15px;
  top: 0;
  left: 0;
  font-size: 23px;
  color: #42b6e5;
}
.btn-buscar .btn {
  width: 100%;
  display: inline-block;
  padding: 12px;
  color: #ffffff;
  font-size: 18px;
  font-weight: 700;
  background-color: #006ea9;
}

.cont-titulos_slider {
  text-align: center;
  color: #006ea9;
}
@media (max-width: 480px) {
  .cont-titulos_slider {
    padding: 0;
  }
}
.cont-titulos_slider h4 {
  margin-top: 15px;
  margin-bottom: 0;
  font-size: 30px;
  font-weight: 600;
}
.cont-titulos_slider p {
  margin-bottom: 0;
  font-size: 16px;
}
.cont-titulos_slider a {
  color: #006ea9;
  text-decoration: none;
}
.cont-titulos_slider .swiper-slide {
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-titulos_slider img {
  max-height: 220px;
}
.cont-titulos_slider:hover .swiper-slide:not(:hover) {
  filter: grayscale(1);
}
@media (max-width: 480px) {
  .cont-titulos_slider .swiper-slide {
    filter: grayscale(0) !important;
  }
}

.cont-calendario {
  padding: 10px 20px;
  border: 1px solid whitesmoke;
  -webkit-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
  box-shadow: 0 0 8px 5px rgba(0, 0, 0, 0.08);
}
@media (max-width: 480px) {
  .cont-calendario {
    padding: 10px 0;
  }
  .cont-calendario .swiper-slide {
    padding: 0 10px;
  }
  .cont-calendario [class^=col],
.cont-calendario [class*=" col"] {
    padding-right: 5px;
    padding-left: 5px;
  }
}
.cont-calendario h3 {
  margin: 0;
  font-size: 15px;
  font-weight: 700;
}
.cont-calendario .cabezal_calendario {
  padding-bottom: 15px;
  border-bottom: 1px solid whitesmoke;
}
@media (max-width: 480px) {
  .cont-calendario .cabezal_calendario {
    padding-left: 25px;
    padding-right: 20px;
  }
}
.cont-calendario .slider-calendario-titulo {
  position: relative;
  font-size: 15px;
  font-weight: 700;
}
.cont-calendario .slider-calendario-titulo .flecha-calendario {
  position: absolute;
  top: 5px;
  cursor: pointer;
  color: #000;
  font-size: 23px;
  z-index: 3;
}
.cont-calendario .slider-calendario-titulo .flecha-calendario.flecha-calendario-prev {
  left: 10px;
}
.cont-calendario .slider-calendario-titulo .flecha-calendario.flecha-calendario-next {
  right: 10px;
}
.cont-calendario .slider-calendario-titulo .flecha-calendario.swiper-button-disabled {
  color: #d1d1d1;
}
.cont-calendario .slider-calendario-titulo .calendario_slider {
  padding: 5px 0;
}
.cont-calendario .slider-calendario-contenido {
  font-size: 14px;
}
.cont-calendario .slider-calendario-contenido .swiper-slide {
  overflow: hidden;
}
.cont-calendario .slider-calendario-contenido .datos_partidos {
  line-height: 1.2;
}
.cont-calendario .slider-calendario-contenido .goles {
  font-size: 16px;
  color: #006ea9;
}
.cont-calendario .slider-calendario-contenido .goles a {
  position: absolute;
  width: 90px;
  bottom: 10px;
  left: calc(50% - 40px);
  opacity: 0;
  font-size: 12px;
  color: #006ea9;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-calendario .slider-calendario-contenido .goles a {
    display: none;
  }
}
.cont-calendario .slider-calendario-contenido .goles a:hover {
  color: #42b6e5;
}
.cont-calendario .slider-calendario-contenido .goles a strong {
  display: inline-block;
  margin-left: 3px;
  vertical-align: middle;
  color: #42b6e5;
  font-weight: 400;
  font-size: 20px;
}
.cont-calendario .slider-calendario-contenido .gol_jugador {
  font-size: 12px;
}
.cont-calendario .slider-calendario-contenido .gol_jugador a {
  color: #000;
}
.cont-calendario .slider-calendario-contenido .item-partido {
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  padding: 20px 10px;
}
.cont-calendario .slider-calendario-contenido .item-partido:nth-child(2n+2) {
  background-color: #f7f7f7;
}
.cont-calendario .slider-calendario-contenido .item-partido:hover {
  padding: 20px 10px;
  background-color: #ebebeb;
}
.cont-calendario .slider-calendario-contenido .item-partido:hover .goles a {
  opacity: 1;
  bottom: -25px;
}
.cont-calendario .slider-calendario-contenido .item-partido.noultimo {
  border-bottom: 1px solid whitesmoke;
}
@media (max-width: 768px) {
  .cont-calendario .slider-calendario-contenido .item-partido .copa img {
    max-width: 50px;
  }
}

.cont-segunda_fase h3 {
  margin-bottom: 30px;
  font-weight: 700;
  font-size: 15px;
  text-align: center;
}
.cont-segunda_fase h4 {
  margin-bottom: 30px;
  font-size: 14px;
  text-align: center;
}
.cont-segunda_fase .fases:first-child .partido {
  margin-left: 0;
}
.cont-segunda_fase .fases:first-child .partido:after {
  display: none;
}
.cont-segunda_fase .fases:first-child.semifinal {
  padding-top: 0;
}
.cont-segunda_fase .fases:first-child.semifinal .grupo:before {
  top: calc(50% - 104px);
  height: 207px;
}
.cont-segunda_fase .fases:first-child.semifinal .partido {
  margin-bottom: 120px;
}
.cont-segunda_fase .fases:first-child.semifinal + .final {
  padding-top: 230px;
  padding-top: 103.5px;
}
.cont-segunda_fase .fases:first-child.final {
  padding-top: 0;
}
.cont-segunda_fase .fases:first-child.final .grupo:before {
  top: calc(50% - 104px);
  height: 207px;
}
@media (max-width: 480px) {
  .cont-segunda_fase .fases {
    padding-top: 0 !important;
  }
}
.cont-segunda_fase .fases .grupo:last-child .partido:last-child {
  margin-bottom: 0;
}
.cont-segunda_fase .fases.octavos {
  padding-top: 0;
}
@media (max-width: 480px) {
  .cont-segunda_fase .fases.octavos .partido:first-child:before {
    content: "";
    display: inline-block;
    position: absolute;
    bottom: -50px;
    top: auto;
    right: 50%;
    height: 50px;
    width: 1px;
    background-color: #000;
  }
}
.cont-segunda_fase .fases.cuartos {
  padding-top: 70px;
}
.cont-segunda_fase .fases.cuartos .grupo:before {
  top: calc(50% - 137px);
  height: 274px;
}
.cont-segunda_fase .fases.cuartos .partido {
  margin-bottom: 187px;
}
@media (max-width: 480px) {
  .cont-segunda_fase .fases.cuartos .partido:first-child:before {
    content: "";
    display: inline-block;
    position: absolute;
    bottom: -30px;
    top: auto;
    right: 50%;
    height: 30px;
    width: 1px;
    background-color: #000;
  }
}
.cont-segunda_fase .fases.semifinal {
  padding-top: 210px;
}
.cont-segunda_fase .fases.semifinal .grupo:before {
  top: calc(50% - 273px);
  height: 546px;
}
.cont-segunda_fase .fases.semifinal .partido {
  margin-bottom: 460px;
}
.cont-segunda_fase .fases.final {
  padding-top: 480px;
}
.cont-segunda_fase .fases.final .grupo:before {
  display: none;
}
.cont-segunda_fase .fases.final .grupo .partido {
  margin-bottom: 50px;
}
.cont-segunda_fase .fases.final .grupo .partido:last-child:after {
  display: none;
}
.cont-segunda_fase .fases.final .grupo .resultado.ganador {
  position: relative;
}
.cont-segunda_fase .fases.final .grupo .resultado.ganador:before {
  display: inline-block;
  position: absolute;
  content: "\e909";
  margin: 9px -30px;
  top: 0;
  right: 0;
  color: #ebbc03;
  font-family: "iconos";
  font-size: 20px;
  font-weight: 400;
}
.cont-segunda_fase .grupo {
  position: relative;
}
.cont-segunda_fase .grupo:before {
  content: "";
  display: inline-block;
  position: absolute;
  top: 50%;
  top: calc(50% - 68.5px);
  height: 137px;
  right: -15px;
  width: 1px;
  background-color: #000;
}
@media (max-width: 480px) {
  .cont-segunda_fase .grupo:before {
    display: none;
  }
}
.cont-segunda_fase .partido {
  position: relative;
  margin: 0 14px;
  margin-bottom: 50px;
  border: 1px solid whitesmoke;
  border-bottom: none;
  -webkit-box-shadow: 0 5px 10px 0px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 5px 10px 0px rgba(0, 0, 0, 0.08);
  box-shadow: 0 5px 10px 0px rgba(0, 0, 0, 0.08);
}
@media (max-width: 1024px) {
  .cont-segunda_fase .partido {
    margin: 0 0 30px;
  }
}
@media (max-width: 480px) {
  .cont-segunda_fase .partido {
    margin: 0;
    margin-bottom: 50px !important;
  }
}
.cont-segunda_fase .partido:after, .cont-segunda_fase .partido:before {
  content: "";
  display: inline-block;
  position: absolute;
  top: 50%;
  top: calc(50% - 1px);
  height: 1px;
  width: 30px;
  background-color: #000;
}
@media (max-width: 1200px) {
  .cont-segunda_fase .partido:after, .cont-segunda_fase .partido:before {
    width: 15px;
  }
}
@media (max-width: 480px) {
  .cont-segunda_fase .partido:after, .cont-segunda_fase .partido:before {
    display: none;
  }
}
.cont-segunda_fase .partido:after {
  left: -30px;
}
@media (max-width: 1024px) {
  .cont-segunda_fase .partido:after {
    left: -15px;
    z-index: -1;
  }
}
.cont-segunda_fase .partido:before {
  right: -30px;
}
@media (max-width: 1200px) {
  .cont-segunda_fase .partido:before {
    right: -15px;
  }
}
@media (max-width: 1024px) {
  .cont-segunda_fase .partido:before {
    right: -15px;
    z-index: -1;
  }
}
.cont-segunda_fase .partido.primero {
  margin-left: 0;
}
.cont-segunda_fase .partido.primero:after {
  display: none;
}
.cont-segunda_fase .partido.ultimo {
  margin-right: 0;
}
.cont-segunda_fase .partido.ultimo:before {
  display: none;
}
.cont-segunda_fase .partido.enlace:hover a {
  opacity: 1;
  bottom: -28px;
}
.cont-segunda_fase .partido.enlace a {
  position: absolute;
  width: 90px;
  bottom: 22px;
  left: calc(50% - 40px);
  opacity: 0;
  text-align: center;
  font-size: 12px;
  font-weight: 700;
  color: #006ea9;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-segunda_fase .partido.enlace a {
    opacity: 1;
    bottom: -28px;
    left: 0;
  }
}
.cont-segunda_fase .partido.enlace a:hover {
  color: #42b6e5;
}
.cont-segunda_fase .partido.enlace a strong {
  display: inline-block;
  margin-left: 3px;
  vertical-align: middle;
  color: #42b6e5;
  font-weight: 400;
  font-size: 20px;
}
.cont-segunda_fase .partido .fecha_partido {
  position: absolute;
  width: 100%;
  top: 0;
  left: 0;
  font-size: 11px;
  color: #42b6e5;
}
.cont-segunda_fase .partido .fecha_partido span {
  display: block;
  margin-top: -17px;
  margin-left: 10px;
}
.cont-segunda_fase .partido .cuadro {
  font-size: 14px;
  border-bottom: 1px solid whitesmoke;
}
@media (max-width: 1024px) {
  .cont-segunda_fase .partido .cuadro .row {
    margin-right: -5px;
    margin-left: -5px;
  }
  .cont-segunda_fase .partido .cuadro .row .col,
.cont-segunda_fase .partido .cuadro .row .col-4 {
    padding-right: 5px;
    padding-left: 5px;
  }
}
.cont-segunda_fase .partido .cuadro .pais {
  padding: 10px;
}
@media (max-width: 1300px) {
  .cont-segunda_fase .partido .cuadro .pais {
    padding: 10px 5px;
  }
}
@media (max-width: 480px) {
  .cont-segunda_fase .partido .cuadro .pais {
    padding: 10px;
  }
}
.cont-segunda_fase .partido .cuadro .pais img,
.cont-segunda_fase .partido .cuadro .pais .no-img {
  display: inline-block;
  margin-right: 5px;
  width: 28px;
  height: 19px;
  vertical-align: middle;
  background-color: whitesmoke;
}
@media (max-width: 1200px) {
  .cont-segunda_fase .partido .cuadro .pais img,
.cont-segunda_fase .partido .cuadro .pais .no-img {
    display: none;
  }
}
@media (max-width: 480px) {
  .cont-segunda_fase .partido .cuadro .pais img,
.cont-segunda_fase .partido .cuadro .pais .no-img {
    display: inline-block;
  }
}
.cont-segunda_fase .partido .cuadro .resultado {
  padding: 10px;
  color: #006ea9;
  font-weight: 700;
  text-align: center;
  border-left: 1px solid whitesmoke;
}

.datos_estadisticos, .cont-jugador .estadisticas .segundo-dato .mas_numeros, .cont-jugador .estadisticas .segundo-dato .numeros, .cont-jugador .estadisticas .segundo-dato .partidos {
  vertical-align: middle;
  position: relative;
  display: inline-block;
  margin-right: 30px;
  font-weight: 700;
  text-align: center;
  vertical-align: middle;
}
.datos_estadisticos span, .cont-jugador .estadisticas .segundo-dato .mas_numeros span, .cont-jugador .estadisticas .segundo-dato .numeros span, .cont-jugador .estadisticas .segundo-dato .partidos span {
  color: #42b6e5;
}
.datos_estadisticos strong, .cont-jugador .estadisticas .segundo-dato .mas_numeros strong, .cont-jugador .estadisticas .segundo-dato .numeros strong, .cont-jugador .estadisticas .segundo-dato .partidos strong {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  color: #006ea9;
  font-weight: 600;
}
.datos_estadisticos p, .cont-jugador .estadisticas .segundo-dato .mas_numeros p, .cont-jugador .estadisticas .segundo-dato .numeros p, .cont-jugador .estadisticas .segundo-dato .partidos p {
  color: #006ea9;
}

.cont-jugador .jugador_datos {
  width: 255px;
}
@media (max-width: 768px) {
  .cont-jugador .jugador_datos {
    margin-top: 25px;
    width: auto;
  }
}
.cont-jugador .jugador_datos figure {
  margin: 0;
  text-align: center;
}
@media (max-width: 768px) {
  .cont-jugador .jugador_datos figure {
    display: inline-block;
    overflow: hidden;
    width: 175px;
    height: 175px;
    vertical-align: middle;
    border-radius: 50%;
  }
}
@media (max-width: 480px) {
  .cont-jugador .jugador_datos figure {
    width: 140px;
    height: 140px;
  }
}
@media (max-width: 768px) {
  .cont-jugador .jugador_datos figure + div {
    width: calc(100% - 205px);
    padding-left: 20px;
    vertical-align: middle;
  }
}
@media (max-width: 480px) {
  .cont-jugador .jugador_datos figure + div {
    width: calc(100% - 145px);
  }
}
.cont-jugador .jugador_datos figure + div h3 {
  color: #006ea9;
  font-weight: 700;
  font-size: 34px;
}
@media (max-width: 480px) {
  .cont-jugador .jugador_datos figure + div h3 {
    font-size: 24px;
  }
}
.cont-jugador .jugador_datos.sindatos {
  margin-top: 0;
  width: 100%;
  text-align: center;
}
.cont-jugador .jugador_datos.sindatos figure {
  margin: 0;
  text-align: center;
  display: inline-block;
  overflow: hidden;
  width: 175px;
  height: 175px;
  vertical-align: middle;
  border-radius: 50%;
}
@media (max-width: 480px) {
  .cont-jugador .jugador_datos.sindatos figure {
    width: 140px;
    height: 140px;
  }
}
.cont-jugador .jugador_datos.sindatos figure + div {
  padding-left: 20px;
  vertical-align: middle;
  text-align: left;
}
@media (max-width: 480px) {
  .cont-jugador .jugador_datos.sindatos figure + div {
    width: calc(100% - 145px);
  }
}
.cont-jugador .jugador_datos.sindatos figure + div h3 {
  color: #006ea9;
  font-weight: 700;
  font-size: 24px;
}
.cont-jugador .jugador_datos.sindatos .contenido {
  margin-bottom: 20px;
  margin-top: 15px;
  text-align: left;
}
.cont-jugador .jugador_datos.sindatos .redes a {
  display: block;
  margin-right: 5px;
}
.cont-jugador .contenido {
  margin-bottom: 20px;
  font-size: 15px;
  background-color: whitesmoke;
}
@media (max-width: 768px) {
  .cont-jugador .contenido {
    margin-top: 15px;
    font-size: 12px;
    background-color: #ffffff;
  }
}
.cont-jugador .contenido p {
  margin-bottom: 0;
  padding: 10px 12px;
  line-height: 1.2;
  border-bottom: 1px solid #eeeeee;
}
@media (max-width: 768px) {
  .cont-jugador .contenido {
    box-shadow: none;
  }
}
.cont-jugador .redes a {
  display: block;
  margin-top: 10px;
  font-size: 13px;
  color: #000;
}
@media (max-width: 768px) {
  .cont-jugador .redes a {
    display: block;
    margin-right: 5px;
  }
}
.cont-jugador .redes a:hover {
  text-decoration: none;
  color: #42b6e5;
}
.cont-jugador .redes a span {
  display: inline-block;
  width: 25px;
  margin-right: 10px;
  font-size: 18px;
  color: #42b6e5;
  vertical-align: middle;
  text-align: center;
}
.cont-jugador .estadisticas .primer-dato {
  padding: 15px 0;
  color: #006ea9;
  font-weight: 700;
}
.cont-jugador .estadisticas .primer-dato .columna_1,
.cont-jugador .estadisticas .primer-dato .columna_2 {
  position: relative;
}
.cont-jugador .estadisticas .primer-dato .columna_1 > span,
.cont-jugador .estadisticas .primer-dato .columna_2 > span {
  position: absolute;
  font-size: 34px;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .primer-dato .columna_1 > span,
.cont-jugador .estadisticas .primer-dato .columna_2 > span {
    font-size: 24px;
  }
}
.cont-jugador .estadisticas .primer-dato .columna_1 > div,
.cont-jugador .estadisticas .primer-dato .columna_2 > div {
  padding-left: 45px;
  line-height: 1;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .primer-dato .columna_1 > div,
.cont-jugador .estadisticas .primer-dato .columna_2 > div {
    padding-left: 33px;
  }
}
.cont-jugador .estadisticas .primer-dato .columna_1 > div p,
.cont-jugador .estadisticas .primer-dato .columna_2 > div p {
  margin: 0;
  font-size: 14px;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .primer-dato .columna_1 > div p,
.cont-jugador .estadisticas .primer-dato .columna_2 > div p {
    font-size: 12px;
  }
}
.cont-jugador .estadisticas .primer-dato .columna_1 > div span,
.cont-jugador .estadisticas .primer-dato .columna_2 > div span {
  font-size: 20px;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .primer-dato .columna_1 > div span,
.cont-jugador .estadisticas .primer-dato .columna_2 > div span {
    font-size: 15px;
  }
}
.cont-jugador .estadisticas .primer-dato .columna_1 > div span span,
.cont-jugador .estadisticas .primer-dato .columna_2 > div span span {
  font-weight: 300;
  font-size: 14px;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .primer-dato .columna_1 > div span span,
.cont-jugador .estadisticas .primer-dato .columna_2 > div span span {
    display: block;
    font-size: 12px;
  }
}
.cont-jugador .estadisticas .primer-dato .columna_2 > div {
  padding: 0;
}
.cont-jugador .estadisticas .segundo-dato {
  color: #7b7b7b;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .segundo-dato .partidos {
    margin-right: 15px;
  }
}
.cont-jugador .estadisticas .segundo-dato .partidos span {
  font-size: 84px;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .segundo-dato .partidos span {
    font-size: 60px;
  }
}
.cont-jugador .estadisticas .segundo-dato .partidos strong {
  margin-top: 20px;
  font-size: 30px;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .segundo-dato .partidos strong {
    margin-top: 13px;
    font-size: 22px;
  }
}
.cont-jugador .estadisticas .segundo-dato .partidos p {
  font-size: 16px;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .segundo-dato .partidos p {
    font-size: 12px;
  }
}
.cont-jugador .estadisticas .segundo-dato .partidos .numeros_resp {
  position: absolute;
  width: 95px;
  top: 0;
  left: 65px;
  font-size: 12px;
  font-weight: 400;
  text-align: left;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .segundo-dato .numeros {
    display: none;
  }
}
.cont-jugador .estadisticas .segundo-dato .numeros span {
  font-size: 55px;
}
.cont-jugador .estadisticas .segundo-dato .numeros strong {
  color: #7b7b7b;
  margin-top: 18px;
  font-size: 16px;
}
.cont-jugador .estadisticas .segundo-dato .numeros p {
  font-weight: 400;
  color: #7b7b7b;
  font-size: 13px;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros {
  line-height: 1.2;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .segundo-dato .mas_numeros {
    margin-right: 20px;
  }
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros.ultimo {
  margin-right: 0;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros span {
  display: block;
  font-size: 30px;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros strong {
  display: block;
  position: static;
  font-size: 24px;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros p {
  display: block;
  font-size: 13px;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros_extra p {
  margin-bottom: 0;
  display: block;
  font-size: 13px;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros_extra span {
  vertical-align: middle;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros_extra span.icono {
  color: #42b6e5;
  font-size: 18px;
}
.cont-jugador .estadisticas .segundo-dato .mas_numeros_extra strong {
  color: #006ea9;
  vertical-align: middle;
}
.cont-jugador .estadisticas .tercer-dato h3 {
  color: #006ea9;
  font-size: 16px;
  font-weight: 700;
}
.cont-jugador .estadisticas .tercer-dato a {
  display: inline-block;
  padding: 5px 8px;
  margin: 0 5px 5px 0;
  color: #ffffff;
  font-size: 15px;
  font-weight: 700;
  background-color: #42b6e5;
  border-radius: 3px;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-jugador .estadisticas .tercer-dato a {
    padding: 2px 6px;
    font-size: 12px;
  }
}
.cont-jugador .estadisticas .tercer-dato a:hover {
  text-decoration: none;
  background-color: #006ea9;
}
.cont-jugador .estadisticas .cuarto-dato .titulos {
  text-align: center;
}
.cont-jugador .estadisticas .cuarto-dato .titulos span {
  display: inline-block;
  margin-bottom: 8px;
  color: #e6be00;
  font-size: 14px;
}
.cont-jugador .estadisticas .cuarto-dato .titulos h2 {
  color: #006ea9;
  font-size: 16px;
  font-weight: 700;
}
.cont-jugador .estadisticas .cuarto-dato .titulos h2:after, .cont-jugador .estadisticas .cuarto-dato .titulos h2:before {
  display: none;
}
.cont-jugador .estadisticas .cuarto-dato .titulos_obtenidos {
  text-align: center;
}
.cont-jugador .estadisticas .cuarto-dato .titulos_obtenidos a {
  margin-top: 10px;
  color: #006ea9;
  font-size: 14px;
}
.cont-jugador .estadisticas .cuarto-dato .titulos_obtenidos img {
  max-height: 80px;
}
.cont-jugador .estadisticas .cuarto-dato .titulos_obtenidos p {
  margin-bottom: 0;
}
.cont-jugador .estadisticas .cuarto-dato .titulos_obtenidos .swiper-button-next,
.cont-jugador .estadisticas .cuarto-dato .titulos_obtenidos .swiper-button-prev {
  height: 24px;
}
.cont-jugador .trayectoria {
  width: 280px;
  padding: 3px;
  border: 1px solid #d1d1d1;
  -webkit-box-shadow: 0 5px 10px 0px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 0 5px 10px 0px rgba(0, 0, 0, 0.08);
  box-shadow: 0 5px 10px 0px rgba(0, 0, 0, 0.08);
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria {
    width: auto;
    padding: 0;
    border: none;
    box-shadow: none;
  }
}
.cont-jugador .trayectoria h3 {
  padding: 10px;
  text-align: center;
  font-weight: 700;
  font-size: 22px;
  color: #006ea9;
  background-color: whitesmoke;
  border-bottom: 1px solid #d1d1d1;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria h3 {
    background-color: initial;
    border-bottom: none;
  }
}
.cont-jugador .trayectoria h3:after, .cont-jugador .trayectoria h3:before {
  display: none;
}
.cont-jugador .trayectoria .cuerpo {
  position: relative;
  margin: 50px 25px;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria .cuerpo {
    margin: 10px 0;
  }
}
.cont-jugador .trayectoria .cuerpo .cuadro {
  position: relative;
  padding-left: 50px;
  line-height: 1.2;
  top: 3px;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria .cuerpo .cuadro {
    padding-left: 40px;
    padding-bottom: 10px;
  }
}
.cont-jugador .trayectoria .cuerpo .cuadro img {
  position: absolute;
  top: -3px;
  left: 0;
  max-height: 40px;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria .cuerpo .cuadro img {
    height: 30px;
    width: auto;
  }
}
.cont-jugador .trayectoria .cuerpo .cuadro h4 {
  margin-bottom: 0;
  color: #000;
  font-size: 14px;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria .cuerpo .cuadro h4 {
    font-size: 12px;
  }
}
.cont-jugador .trayectoria .cuerpo .cuadro h4 a {
  color: #000;
}
.cont-jugador .trayectoria .cuerpo .cuadro h4 a span {
  color: #42b6e5;
}
.cont-jugador .trayectoria .cuerpo .cuadro p {
  margin-bottom: 0;
  color: #7b7b7b;
  font-size: 14px;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria .cuerpo .cuadro p {
    font-size: 11px;
  }
}
.cont-jugador .trayectoria .cuerpo .slide-trayectoria {
  height: 260px;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria .cuerpo .slide-trayectoria {
    height: auto;
  }
}
.cont-jugador .trayectoria .cuerpo .flechas-trayectoria {
  position: absolute;
  left: 0;
  width: 100%;
  text-align: center;
  z-index: 2;
}
@media (max-width: 768px) {
  .cont-jugador .trayectoria .cuerpo .flechas-trayectoria {
    display: none;
  }
}
.cont-jugador .trayectoria .cuerpo .flechas-trayectoria.swiper-button-disabled {
  opacity: 0.3;
}
.cont-jugador .trayectoria .cuerpo .flechas-trayectoria.flecha-trayectoria-next {
  bottom: -40px;
}
.cont-jugador .trayectoria .cuerpo .flechas-trayectoria.flecha-trayectoria-prev {
  top: -30px;
}
.cont-jugador .trayectoria .cuerpo .flechas-trayectoria .swiper-button-next,
.cont-jugador .trayectoria .cuerpo .flechas-trayectoria .swiper-button-prev {
  display: inline-block;
  width: 19px;
  height: 21px;
  margin-top: 0;
  position: static;
  background-image: none !important;
}

.cont-jugador-partidos .selector {
  color: #ffffff;
  background-color: #006ea9;
}
.cont-jugador-partidos .selector .opcion {
  display: inline-block;
  padding: 15px;
  margin-left: -3px;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .selector .opcion {
    padding: 15px 12px;
  }
}
.cont-jugador-partidos .selector .opcion:first-child {
  margin-left: 0;
}
.cont-jugador-partidos .selector .opcion:hover, .cont-jugador-partidos .selector .opcion.activo {
  background-color: #054463;
  -webkit-box-shadow: inset 0 -4px 0 0px #42b6e5;
  -moz-box-shadow: inset 0 -4px 0 0px #42b6e5;
  box-shadow: inset 0 -4px 0 0px #42b6e5;
}
.cont-jugador-partidos .selector .opcion.btn_menu {
  padding: 10px;
}
.cont-jugador-partidos .selector .opcion.btn_menu:hover {
  background-color: transparent;
  box-shadow: none;
}
.cont-jugador-partidos .selector .opcion.btn_menu strong {
  display: inline-block;
}
.cont-jugador-partidos .selector .opcion.btn_menu strong span {
  margin-bottom: 2px;
  margin-right: 0;
}
.cont-jugador-partidos .selector .opcion span {
  font-size: 20px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .selector .opcion span {
    margin-right: 5px;
  }
}
.cont-jugador-partidos .selector .opcion a {
  color: #ffffff;
  text-decoration: none;
}
.cont-jugador-partidos .selector .opcion p {
  display: inline-block;
  margin-bottom: 0;
  padding: 0 8px;
  vertical-align: middle;
  font-size: 15px;
  font-weight: 700;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .selector .opcion p {
    display: none;
  }
}
.cont-jugador-partidos .selector .opcion strong {
  padding: 3px 5px;
  vertical-align: middle;
  color: #006ea9;
  font-size: 15px;
  font-weight: 700;
  background-color: #ffffff;
  border-radius: 4px;
}
.cont-jugador-partidos .selector .cantidades {
  display: inline-block;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .selector .cantidades {
    display: none;
    padding: 15px 12px;
  }
}
.cont-jugador-partidos .selector .cantidades select {
  width: 70px;
  padding: 0 10px;
  color: #ffffff;
  font-size: 15px;
  background-color: #006ea9;
  border: 0;
  border-left: 1px solid #42b6e5;
  border-radius: 0;
  outline: none;
}
@media (max-width: 480px) {
  .cont-jugador-partidos .selector .cantidades select {
    width: 110px;
  }
}
.cont-jugador-partidos .selector .cantidades select option {
  padding: 20px;
}
.cont-jugador-partidos .selector .cantidades span {
  font-size: 20px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .selector .cantidades span {
    margin-right: 5px;
  }
}
.cont-jugador-partidos .selector .cantidades p {
  display: inline-block;
  margin-bottom: 0;
  padding: 0 8px;
  vertical-align: middle;
  font-size: 15px;
  font-weight: 700;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .selector .cantidades p {
    display: none;
  }
}
.cont-jugador-partidos .selector .cantidades a {
  display: inline-block;
  margin-bottom: 0;
  padding: 3px 8px;
  vertical-align: middle;
  color: #d1d1d1;
  font-size: 15px;
  font-weight: 700;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-jugador-partidos .selector .cantidades a:hover, .cont-jugador-partidos .selector .cantidades a.activo {
  vertical-align: middle;
  color: #006ea9;
  font-size: 15px;
  font-weight: 700;
  background-color: #ffffff;
  border-radius: 4px;
}
.cont-jugador-partidos .selector .fechas {
  display: inline-block;
}
@media (max-width: 1024px) {
  .cont-jugador-partidos .selector .fechas {
    display: none;
  }
}
.cont-jugador-partidos .selector .fechas > div {
  display: inline-block;
}
@media (max-width: 1024px) {
  .cont-jugador-partidos .selector .fechas > div {
    width: 100%;
  }
}
.cont-jugador-partidos .selector .fechas > div:first-child input {
  border-right: 1px solid #42b6e5;
}
@media (max-width: 1024px) {
  .cont-jugador-partidos .selector .fechas > div:first-child input {
    border-right: none;
  }
}
.cont-jugador-partidos .selector .fechas input {
  padding: 15px;
  padding-left: 45px;
  color: #ffffff;
  font-size: 15px;
  background-color: #006ea9;
  border: 0;
  border-radius: 0;
  outline: none;
}
.cont-jugador-partidos .selector .fechas input:focus {
  box-shadow: none;
}
@media (max-width: 480px) {
  .cont-jugador-partidos .selector .fechas input {
    width: 100%;
  }
}
.cont-jugador-partidos .selector .fechas input::-webkit-input-placeholder {
  color: #ffffff;
  font-size: 15px;
}

.cont-jugador-partidos .selector .fechas input:-moz-placeholder {
  color: #ffffff;
  font-size: 15px;
  opacity: 1;
}

.cont-jugador-partidos .selector .fechas input::-moz-placeholder {
  color: #ffffff;
  font-size: 15px;
  opacity: 1;
}

.cont-jugador-partidos .selector .fechas input:-ms-input-placeholder {
  color: #ffffff;
  font-size: 15px;
}

.cont-jugador-partidos .selector .fechas .fecha_calendario {
  display: inline-block;
  margin-right: 5px;
  width: 155px;
  position: relative;
}
@media (max-width: 480px) {
  .cont-jugador-partidos .selector .fechas .fecha_calendario {
    width: 100%;
  }
}
.cont-jugador-partidos .selector .fechas p {
  display: inline-block;
  margin-bottom: 0;
  padding: 0 8px;
  vertical-align: middle;
  font-size: 15px;
  font-weight: 700;
}
@media (max-width: 1024px) {
  .cont-jugador-partidos .selector .fechas p {
    display: none;
  }
}
.cont-jugador-partidos .selector .fechas label {
  margin: 0;
}
.cont-jugador-partidos .selector .fechas .icono {
  position: absolute;
  margin: 15px;
  color: #ffffff;
  font-size: 22px;
}
.cont-jugador-partidos .selector .filtro {
  display: inline-block;
  width: 210px;
  float: right;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .selector .filtro {
    display: none;
    float: none;
    width: auto;
  }
}
.cont-jugador-partidos .selector .filtro .filtro_torneo {
  padding: 17px;
  font-size: 15px;
  cursor: pointer;
  background-color: #42b6e5;
}
.cont-jugador-partidos .selector .filtro select {
  padding: 0 20px;
  color: #ffffff;
  font-size: 15px;
  background-color: #006ea9;
  border: 0;
  border-left: 1px solid #42b6e5;
  border-radius: 0;
  outline: none;
}
@media (max-width: 480px) {
  .cont-jugador-partidos .selector .filtro select {
    border-left: none;
    width: 100%;
  }
}
.cont-jugador-partidos .selector .filtro option {
  padding: 20px;
}
.cont-jugador-partidos .selector .btn_filtro {
  float: right;
  font-size: 15px;
  font-weight: 700;
  text-transform: uppercase;
  color: #ffffff;
  border-left: 1px solid #42b6e5;
  background-color: #006ea9;
}
.cont-jugador-partidos .selector .btn_filtro a {
  display: inline-block;
  padding: 15px;
  color: #ffffff;
  text-decoration: none;
}
.cont-jugador-partidos .selector .btn_filtro a:hover {
  background-color: #42b6e5;
}
.cont-jugador-partidos .selector.selector_blanco {
  border: 1px solid #d1d1d1;
  background-color: white;
}
.cont-jugador-partidos .selector.selector_blanco .cont-partidos {
  display: inline-block;
  border: 0;
  box-shadow: none;
  vertical-align: middle;
}
.cont-jugador-partidos .selector.selector_blanco .cont-partidos .estadisticas {
  padding: 15px;
}
.cont-jugador-partidos .cont-partidos {
  border: 1px solid #d1d1d1;
  -webkit-box-shadow: 5px 5px 10px 0px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 5px 5px 10px 0px rgba(0, 0, 0, 0.08);
  box-shadow: 5px 5px 10px 0px rgba(0, 0, 0, 0.08);
}
.cont-jugador-partidos .cont-partidos .estadisticas {
  padding: 20px 30px;
  font-size: 14px;
  color: #006ea9;
}
@media (max-width: 480px) {
  .cont-jugador-partidos .cont-partidos .estadisticas {
    padding: 20px 15px;
  }
}
.cont-jugador-partidos .cont-partidos .estadisticas.off {
  opacity: 0;
  visibility: hidden;
}
@media (max-width: 480px) {
  .cont-jugador-partidos .cont-partidos .estadisticas.off {
    display: none;
  }
}
.cont-jugador-partidos .cont-partidos .estadisticas span {
  display: inline-block;
  padding-right: 15px;
  cursor: pointer;
}
@media (max-width: 480px) {
  .cont-jugador-partidos .cont-partidos .estadisticas span {
    display: block;
  }
}
.cont-jugador-partidos .cont-partidos .estadisticas span:hover {
  color: #42b6e5;
}
.cont-jugador-partidos .cont-partidos .estadisticas span strong {
  font-weight: 700;
}
.cont-jugador-partidos .cont-partidos .estadisticas span a {
  text-decoration: none;
}
.cont-jugador-partidos .cont-partidos .estadisticas span.amistosos {
  display: inline-block;
  padding-right: 0;
  float: right;
}
.cont-jugador-partidos .cont-partidos .estadisticas span.amistosos strong {
  padding: 0px 5px;
  font-weight: 700;
  color: #ffffff;
  background-color: #006ea9;
  border-radius: 50%;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .estadisticas span.amistosos {
    margin-top: 8px;
    float: none;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido {
  padding: 15px;
  border-top: 1px solid #e1e1e1;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido {
    padding: 15px 10px;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido:nth-child(2n+1) {
  background-color: whitesmoke;
}
.cont-jugador-partidos .cont-partidos .partidos .partido:hover {
  background-color: #ebebeb;
  -webkit-box-shadow: inset 0 0 0 1px #42b6e5;
  -moz-box-shadow: inset 0 0 0 1px #42b6e5;
  box-shadow: inset 0 0 0 1px #42b6e5;
}
.cont-jugador-partidos .cont-partidos .partidos .partido:hover .col_encuentro .resultados a {
  opacity: 1;
  top: 22px;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_copa {
    text-align: center;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_copa img {
  display: inline-block;
  margin-right: 10px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_copa img {
    display: none;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_copa .info {
  display: inline-block;
  vertical-align: middle;
  color: #000;
  font-size: 14px;
  line-height: 1.2;
  max-width: 150px;
}
@media (max-width: 1024px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_copa .info {
    max-width: 100px;
  }
}
@media (max-width: 480px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_copa .info {
    max-width: auto;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_copa .info strong {
  font-weight: 700;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_copa .info p {
  margin: 0;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro {
  text-align: center;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro {
    margin-bottom: 15px;
  }
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .row {
    margin-right: -5px;
    margin-left: -5px;
  }
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .row .col,
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .row .col-3 {
    padding-right: 5px;
    padding-left: 5px;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais {
  display: inline-block;
  vertical-align: middle;
  font-size: 16px;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais.pais-02 img {
    margin-right: 0;
    margin-left: 5px;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais img {
  display: inline-block;
  margin-right: 10px;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais img {
    width: 40px;
    margin-right: 5px;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais p {
  display: inline-block;
  margin-bottom: 0;
  font-size: 12px;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais p {
    display: none;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais span {
  display: none;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .pais span {
    display: inline-block;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .resultados {
  display: inline-block;
  vertical-align: middle;
  color: #006ea9;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .resultados p {
  position: relative;
  font-size: 18px;
  font-weight: 700;
  margin-bottom: 0;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .resultados p span {
  font-size: 15px;
  font-weight: 300;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .resultados p a {
  position: absolute;
  width: 90px;
  top: -20px;
  left: calc(50% - 40px);
  opacity: 0;
  font-size: 12px;
  color: #006ea9;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .resultados p a {
    display: none;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .resultados p a:hover {
  color: #42b6e5;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_encuentro .resultados p a strong {
  display: inline-block;
  margin-left: 3px;
  vertical-align: middle;
  color: #42b6e5;
  font-weight: 400;
  font-size: 20px;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_estadio {
    text-align: center;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_estadio p {
  margin-bottom: 0;
  color: #000;
  font-size: 12px;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_estadio a {
  display: none;
  font-size: 12px;
  color: #006ea9;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .col_estadio a {
    display: block;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_estadio a:hover {
  color: #42b6e5;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .col_estadio a strong {
  display: inline-block;
  margin-left: 3px;
  vertical-align: middle;
  color: #42b6e5;
  font-weight: 400;
  font-size: 20px;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .goles {
  color: #000;
  font-size: 14px;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .goles.novideo {
  opacity: 0;
}
@media (max-width: 768px) {
  .cont-jugador-partidos .cont-partidos .partidos .partido .goles.novideo {
    display: none;
  }
}
.cont-jugador-partidos .cont-partidos .partidos .partido .goles span {
  vertical-align: middle;
  color: #006ea9;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .goles a {
  display: inline-block;
  vertical-align: middle;
  color: #006ea9;
}
.cont-jugador-partidos .cont-partidos .partidos .partido .goles a:hover {
  text-decoration: none;
}

.cont-competencias .selector {
  color: #ffffff;
  background-color: #006ea9;
}
.cont-competencias .selector .opcion {
  display: inline-block;
  padding: 15px;
  margin-left: -3px;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-competencias .selector .opcion {
    margin-left: 0;
    padding: 15px 12px;
  }
}
.cont-competencias .selector .opcion:first-child {
  margin-left: 0;
}
.cont-competencias .selector .opcion:hover, .cont-competencias .selector .opcion.activo {
  background-color: #054463;
  -webkit-box-shadow: inset 0 -4px 0 0px #42b6e5;
  -moz-box-shadow: inset 0 -4px 0 0px #42b6e5;
  box-shadow: inset 0 -4px 0 0px #42b6e5;
}
.cont-competencias .selector .opcion span {
  font-size: 20px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .cont-competencias .selector .opcion span {
    margin-right: 5px;
  }
}
.cont-competencias .selector .opcion span.menu {
  margin: 4px 6px 4px 2px;
  font-size: 17px;
}
.cont-competencias .selector .opcion p {
  display: inline-block;
  margin-bottom: 0;
  padding: 0 8px;
  vertical-align: middle;
  font-size: 15px;
  font-weight: 700;
}
.cont-competencias .selector .opcion a:hover {
  color: #42b6e5;
  text-decoration: none;
}
.cont-competencias .selector .opcion strong {
  padding: 3px 5px;
  vertical-align: middle;
  color: #006ea9;
  font-size: 15px;
  font-weight: 700;
  background-color: #ffffff;
  border-radius: 4px;
}
.cont-competencias .selector .opciones_secundarias {
  text-align: right;
}
@media (max-width: 768px) {
  .cont-competencias .selector .opciones_secundarias {
    text-align: left;
    margin-bottom: 20px;
  }
}
.cont-competencias .selector .opciones_secundarias .opcion {
  padding-right: 10px;
  padding-left: 10px;
}
@media (max-width: 768px) {
  .cont-competencias .selector .opciones_secundarias .opcion {
    display: block;
    padding-top: 5px;
    padding-bottom: 5px;
  }
}
.cont-competencias .selector .opciones_secundarias .opcion p {
  font-size: 14px;
  font-weight: 400;
}
.cont-competencias .selector .filtro {
  display: inline-block;
  float: right;
}
.cont-competencias .selector .filtro select {
  padding: 0 20px;
  color: #ffffff;
  font-size: 15px;
  background-color: #006ea9;
  border: 0;
  border-left: 1px solid #42b6e5;
  border-radius: 0;
  outline: none;
}
.cont-competencias .selector .filtro option {
  padding: 20px;
}
.cont-competencias .cont-torneos {
  border: 1px solid #d1d1d1;
  -webkit-box-shadow: 5px 5px 10px 0px rgba(0, 0, 0, 0.08);
  -moz-box-shadow: 5px 5px 10px 0px rgba(0, 0, 0, 0.08);
  box-shadow: 5px 5px 10px 0px rgba(0, 0, 0, 0.08);
}
.cont-competencias .cont-torneos .estadisticas {
  padding: 20px 30px;
  font-size: 14px;
  color: #006ea9;
}
@media (max-width: 480px) {
  .cont-competencias .cont-torneos .estadisticas {
    padding: 20px 15px;
  }
}
.cont-competencias .cont-torneos .estadisticas span {
  display: inline-block;
  padding-right: 15px;
  cursor: pointer;
}
@media (max-width: 480px) {
  .cont-competencias .cont-torneos .estadisticas span {
    display: block;
  }
}
.cont-competencias .cont-torneos .estadisticas span:hover {
  color: #42b6e5;
}
.cont-competencias .cont-torneos .estadisticas span strong {
  font-weight: 700;
}
.cont-competencias .cont-torneos .estadisticas span.amistosos {
  display: inline-block;
  padding-right: 0;
  float: right;
}
.cont-competencias .cont-torneos .estadisticas span.amistosos strong {
  padding: 0px 5px;
  font-weight: 700;
  color: #ffffff;
  background-color: #006ea9;
  border-radius: 50%;
}
@media (max-width: 768px) {
  .cont-competencias .cont-torneos .estadisticas span.amistosos {
    margin-top: 8px;
    float: none;
  }
}
.cont-competencias .cont-torneos .torneos .torneo {
  padding: 15px;
  border-top: 1px solid #e1e1e1;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-competencias .cont-torneos .torneos .torneo:nth-child(2n+1) {
  background-color: whitesmoke;
}
.cont-competencias .cont-torneos .torneos .torneo:hover {
  background-color: #ebebeb;
  -webkit-box-shadow: inset 0 0 0 1px #42b6e5;
  -moz-box-shadow: inset 0 0 0 1px #42b6e5;
  box-shadow: inset 0 0 0 1px #42b6e5;
}
.cont-competencias .cont-torneos .torneos .torneo:hover .col_encuentro .resultados a {
  opacity: 1;
  top: 22px;
}
@media (max-width: 768px) {
  .cont-competencias .cont-torneos .torneos .torneo .col_copa {
    margin-bottom: 10px;
    text-align: center;
  }
}
.cont-competencias .cont-torneos .torneos .torneo .col_copa img {
  display: inline-block;
  max-width: 50px;
  margin-right: 5px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .cont-competencias .cont-torneos .torneos .torneo .col_copa img {
    margin-right: 0;
    margin-bottom: 10px;
  }
}
.cont-competencias .cont-torneos .torneos .torneo .col_copa p {
  display: inline-block;
  vertical-align: middle;
  margin-bottom: 0;
  color: #000;
  font-size: 16px;
}
@media (max-width: 768px) {
  .cont-competencias .cont-torneos .torneos .torneo .col_copa p {
    display: block;
    font-size: 14px;
  }
}
.cont-competencias .cont-torneos .torneos .torneo .col_copa p strong {
  display: inline-block;
  color: #000;
  font-weight: 700;
  font-size: 20px;
}
@media (max-width: 768px) {
  .cont-competencias .cont-torneos .torneos .torneo .col_copa p strong {
    font-size: 14px;
  }
}
.cont-competencias .cont-torneos .torneos .torneo .col_copa p.col_anio {
  display: inline-block;
  margin-bottom: 0;
  color: #006ea9;
  font-size: 14px;
  font-weight: 600;
}
@media (max-width: 768px) {
  .cont-competencias .cont-torneos .torneos .torneo .col_copa p.col_anio {
    margin-right: 10px;
  }
}
@media (max-width: 768px) {
  .cont-competencias .cont-torneos .torneos .torneo .col_puesto {
    text-align: center;
  }
}
.cont-competencias .cont-torneos .torneos .torneo .col_puesto img {
  display: inline-block;
  vertical-align: middle;
  margin-right: 10px;
}
.cont-competencias .cont-torneos .torneos .torneo .col_puesto p {
  display: inline-block;
  margin-bottom: 0;
  vertical-align: middle;
  color: #006ea9;
  font-size: 15px;
  font-weight: 700;
}

.cabezal-partido {
  background: #f7f7f7;
  padding: 10px 20px;
  margin-bottom: 25px;
}
.cabezal-partido:not(.partido) img {
  max-height: 70px;
}
.cabezal-partido .partido {
  margin: 10px 0;
  color: #006ea9;
  font-size: 25px;
  font-weight: 700;
}
@media (max-width: 1200px) {
  .cabezal-partido .partido {
    margin: 0;
    font-size: 30px;
  }
}
@media (max-width: 768px) {
  .cabezal-partido .partido {
    margin-bottom: 10px;
    font-size: 15px;
  }
  .cabezal-partido .partido .row {
    margin-right: -5px;
    margin-left: -5px;
  }
  .cabezal-partido .partido .row .col,
.cabezal-partido .partido .row .col-auto {
    padding-right: 5px;
    padding-left: 5px;
  }
}
.cabezal-partido .partido img {
  display: inline-block;
}
@media (max-width: 768px) {
  .cabezal-partido .partido img {
    width: 35px;
  }
}
.cabezal-partido .partido p {
  display: inline-block;
  margin-bottom: 0;
}
.cabezal-partido .partido strong {
  text-align: center;
  font-weight: 700;
}
@media (max-width: 768px) {
  .cabezal-partido .partido strong {
    font-size: 20px;
  }
}
.cabezal-partido .partido .columna_1 img,
.cabezal-partido .partido .columna_2 img {
  margin-left: 5px;
  max-width: 65px;
}
.cabezal-partido .partido .columna_1 {
  text-align: right;
}
.cabezal-partido .partido .columna_2 img.visible-sm {
  display: none;
}
@media (max-width: 768px) {
  .cabezal-partido .partido .columna_2 img.hidden-sm {
    display: none;
  }
  .cabezal-partido .partido .columna_2 img.visible-sm {
    display: inline-block;
  }
}
.cabezal-partido .compartir {
  text-align: right;
}
.cabezal-partido .compartir a {
  display: inline-block;
  color: #006ea9;
  font-weight: 600;
  font-size: 16px;
  vertical-align: middle;
}
.cabezal-partido .compartir span {
  display: inline-block;
  margin-right: 5px;
  font-size: 20px;
  vertical-align: middle;
}
.cabezal-partido .info {
  text-align: center;
}
.cabezal-partido .info h3 {
  color: #006ea9;
  font-size: 22px;
  font-weight: 600;
}
@media (max-width: 768px) {
  .cabezal-partido .info h3 {
    margin-bottom: 0;
    font-size: 13px;
  }
}
.cabezal-partido .info p {
  font-size: 16px;
  margin-bottom: 0;
}

.video-partido .columna_1 {
  position: relative;
  float: left;
  width: 45%;
  min-height: 473px;
  padding: 38px 30px 10px;
  text-align: center;
  color: #ffffff;
  background-color: #006ea9;
  background: url(/imagenes/img_presentacion/bg-partido.jpg) #006ea9 no-repeat;
}
@media (max-width: 768px) {
  .video-partido .columna_1 {
    float: none;
    width: 100%;
    min-height: auto;
    padding: 15px;
  }
}
.video-partido .columna_1 h4 {
  font-size: 16px;
  margin-bottom: 0;
}
@media (max-width: 768px) {
  .video-partido .columna_1 h4 {
    font-size: 14px;
  }
}
.video-partido .columna_1 p {
  font-size: 14px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 p {
    font-size: 12px;
  }
}
.video-partido .columna_1 p strong {
  font-weight: 600;
  font-size: 16px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 p strong {
    font-size: 14px;
  }
}
.video-partido .columna_1 .resultados {
  margin-bottom: 30px;
}
.video-partido .columna_1 .resultados p {
  font-size: 15px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .resultados img {
    width: 50px;
  }
}
.video-partido .columna_1 .resultados .cuadro_1 {
  display: inline-block;
}
.video-partido .columna_1 .resultados .resultado {
  display: inline-block;
  margin: 0 40px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .resultados .resultado {
    margin: 0 15px;
  }
}
.video-partido .columna_1 .resultados .resultado p {
  margin-bottom: 0;
  font-size: 14px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .resultados .resultado p {
    font-size: 13px;
  }
}
.video-partido .columna_1 .resultados .resultado strong {
  font-size: 36px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .resultados .resultado strong {
    font-size: 30px;
  }
  .video-partido .columna_1 .resultados .resultado strong small {
    font-size: 16px;
  }
}
.video-partido .columna_1 .resultados .cuadro_2 {
  display: inline-block;
}
.video-partido .columna_1 .goles {
  margin-bottom: 37px;
  text-align: left;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles {
    margin-bottom: 20px;
  }
}
.video-partido .columna_1 .goles span {
  margin-right: 5px;
  font-size: 13px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles span {
    margin-right: 2px;
    font-size: 11px;
  }
}
.video-partido .columna_1 .goles strong {
  font-size: 13px;
  font-weight: 700;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles strong {
    font-size: 10px;
  }
}
.video-partido .columna_1 .goles strong span {
  font-size: 13px;
  font-weight: 300;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles strong span {
    font-size: 10px;
  }
}
.video-partido .columna_1 .goles p {
  display: inline-block;
  margin-bottom: 0;
  font-size: 14px;
  vertical-align: middle;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles p {
    font-size: 10px;
  }
}
.video-partido .columna_1 .goles .col_1,
.video-partido .columna_1 .goles .col_2 {
  display: inline-block;
  vertical-align: top;
  padding: 0 20px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles .col_1,
.video-partido .columna_1 .goles .col_2 {
    padding: 0 10px;
  }
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles .col_1 {
    width: 50%;
    margin-right: 0;
  }
}
@media (max-width: 768px) {
  .video-partido .columna_1 .goles .col_2 {
    width: 47%;
  }
}
.video-partido .columna_1 > a {
  position: absolute;
  bottom: 0;
  left: 0;
  width: 100%;
  margin-bottom: 15px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 > a {
    position: static;
    margin-bottom: 0;
  }
}
.video-partido .columna_1 a {
  display: inline-block;
  vertical-align: middle;
  color: #ffffff;
  font-size: 14px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 a {
    font-size: 10px;
  }
}
.video-partido .columna_1 a:hover {
  color: #42b6e5;
  text-decoration: none;
}
.video-partido .columna_1 a span {
  display: inline-block;
  vertical-align: middle;
  font-size: 50px;
  margin-right: 10px;
}
@media (max-width: 768px) {
  .video-partido .columna_1 a span {
    font-size: 30px;
  }
}
.video-partido .columna_2 {
  float: left;
  width: 55%;
  background-color: #000;
}
@media (max-width: 768px) {
  .video-partido .columna_2 {
    float: none;
    width: 100%;
  }
}
.video-partido .columna_2:hover a span {
  color: #42b6e5;
}
.video-partido .columna_2 #video_partido .cont-fijo {
  position: fixed;
  width: 410px !important;
  bottom: 0;
  right: 0;
  z-index: 5;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  /* &:hover {
  	width: 400px !important;
  	@media (max-width: $screen-sm) {
  		width: 200px !important;
  	}
  } */
}
@media (max-width: 768px) {
  .video-partido .columna_2 #video_partido .cont-fijo {
    width: 100% !important;
  }
}
.video-partido .columna_2 #video_partido .cont-fijo .video-container {
  padding-bottom: 51.9%;
}
.video-partido .columna_2 #video_partido .cont-fijo .icono-cerrar {
  display: block;
  position: absolute;
  margin-top: -20px;
  top: 0;
  right: 0;
  font-size: 15px;
  cursor: pointer;
  z-index: 1;
}
.video-partido .columna_2 #video_partido .cont-fijo.off {
  position: static;
}
.video-partido .columna_2 .cont-video .video-container {
  padding-bottom: 68.6%;
  padding-top: 32px;
}
.video-partido .columna_2 a figure {
  position: relative;
  margin-bottom: 0;
}
.video-partido .columna_2 a figure img {
  min-height: 473px;
}
@media (max-width: 768px) {
  .video-partido .columna_2 a figure img {
    min-height: auto;
  }
}
.video-partido .columna_2 a span {
  position: absolute;
  top: calc(50% - 45px);
  left: calc(50% - 45px);
  color: #ffffff;
  font-size: 90px;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .video-partido .columna_2 a span {
    display: none;
  }
}

.cont-detalles .cont-cuadro .cabezal {
  margin-bottom: 10px;
}
.cont-detalles .cont-cuadro .cabezal img {
  display: inline-block;
  max-height: 80px;
  margin-right: 10px;
  vertical-align: middle;
}
.cont-detalles .cont-cuadro .cabezal p {
  display: inline-block;
  margin-bottom: 0;
  vertical-align: middle;
  color: #006ea9;
  font-size: 18px;
}
.cont-detalles .cont-cuadro .bloques {
  margin-bottom: 50px;
}
.cont-detalles .cont-cuadro .bloques h3 {
  color: #006ea9;
  font-size: 16px;
  font-weight: 700;
}
.cont-detalles .cont-cuadro .bloques h4 {
  color: #006ea9;
  font-size: 16px;
}
.cont-detalles .cont-cuadro .bloques p {
  line-height: 1.8;
  margin-bottom: 0;
  font-size: 16px;
}
.cont-detalles .cont-cuadro .bloques p a {
  color: #000;
  text-decoration: none;
}
.cont-detalles .cont-cuadro .bloques p a:hover {
  color: #42b6e5;
}
.cont-detalles .cont-cuadro .bloques p strong {
  display: inline-block;
  width: 20px;
  margin-right: 15px;
  color: #006ea9;
  font-size: 16px;
  font-weight: 700;
}
.cont-detalles .cont-cuadro .bloques p span[class^=icono-], .cont-detalles .cont-cuadro .bloques p span[class*=" icono-"] {
  vertical-align: middle;
  margin-left: 5px;
  font-size: 19px;
}
.cont-detalles .cont-cuadro .bloques p span[class^=icono-].cambio, .cont-detalles .cont-cuadro .bloques p span[class*=" icono-"].cambio {
  font-size: 12px;
}
.cont-detalles .cont-cuadro .bloques p span b {
  margin-left: 5px;
  font-size: 14px;
}
.cont-detalles .cont-cuadro .bloques p .salida {
  color: #bf1a1e;
}
.cont-detalles .cont-cuadro .bloques p .entrada {
  color: #008050;
}
.cont-detalles .cont-cuadro .bloques p .amarilla {
  color: #ffcf00;
}
.cont-detalles .cont-cuadro .bloques p .roja {
  color: #bf1a1e;
}
.cont-detalles .cont-cuadro .bloques p .gol_contra {
  color: #ee0000;
}
.cont-detalles .cont-cuadro .bloques p .gol {
  color: #3a658f;
}
.cont-detalles .cont-cuadro .bloques p .tipo_gol {
  vertical-align: middle;
  margin-left: 5px;
  font-size: 11px;
}
.cont-detalles .cont-cuadro .bloques.penales p {
  line-height: 1.5;
  position: relative;
}
.cont-detalles .cont-cuadro .bloques.penales p span {
  margin-right: 13px;
  font-size: 17px;
  vertical-align: middle;
}
.cont-detalles .cont-cuadro .bloques.penales p .estado {
  position: absolute;
  top: 6px;
  left: 7px;
  font-size: 14px;
}
.cont-detalles .cont-cuadro .bloques.penales p .estado.entro {
  color: #00b370;
}
.cont-detalles .cont-cuadro .bloques.penales p .estado.errado {
  color: #bf1a1e;
}
.cont-detalles .arbitros h3 {
  color: #006ea9;
  font-size: 16px;
  font-weight: 700;
}
.cont-detalles .arbitros p {
  line-height: 1.8;
  margin-bottom: 0;
  font-size: 16px;
}
.cont-detalles .arbitros p.publico {
  margin: 20px 0;
}
.cont-detalles .arbitros span {
  font-size: 12px;
}
.cont-detalles .columna_2 h2 {
  margin-bottom: 30px;
  padding-bottom: 15px;
  text-align: center;
  color: #006ea9;
  font-size: 18px;
  font-weight: 600;
  border-bottom: 1px solid #eeeeee;
  text-transform: uppercase;
}
.cont-detalles .columna_2 h2:after, .cont-detalles .columna_2 h2:before {
  display: none;
}
.cont-detalles .columna_2 h3 {
  margin-bottom: 20px;
  text-align: center;
  color: #7b7b7b;
  font-size: 18px;
}
.cont-detalles .columna_2 .resultados {
  display: inline-block;
}
.cont-detalles .columna_2 .resultados div {
  position: relative;
}
.cont-detalles .columna_2 .resultados div span {
  color: #42b6e5;
}
.cont-detalles .columna_2 .resultados div strong {
  position: absolute;
  width: 100%;
  top: 29%;
  left: 0;
}
.cont-detalles .columna_2 .resultados p {
  margin: 0;
  margin-top: 10px;
}
.cont-detalles .columna_2 .principal {
  margin-bottom: 30px;
  text-align: center;
}
.cont-detalles .columna_2 .principal div span {
  font-size: 155px;
  font-weight: 300;
}
.cont-detalles .columna_2 .principal div strong {
  color: #006ea9;
  font-size: 50px;
}
.cont-detalles .columna_2 .principal p {
  font-size: 20px;
  color: #006ea9;
}
.cont-detalles .columna_2 .secundarios {
  font-size: 10px;
  text-align: center;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2 .secundarios {
    font-size: 100%;
  }
}
.cont-detalles .columna_2 .secundarios div span {
  font-size: 8.5em;
}
.cont-detalles .columna_2 .secundarios div strong {
  color: #7b7b7b;
  font-weight: 400;
  font-size: 3em;
}
.cont-detalles .columna_2 .secundarios p {
  font-size: 1.8em;
  color: #7b7b7b;
}
.cont-detalles .columna_2 .goles {
  margin: 30px 0;
  padding: 30px 0;
  line-height: 1.2;
  font-size: 10px;
  border-top: 1px solid #e1e1e1;
  border-bottom: 1px solid #e1e1e1;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2 .goles {
    font-size: 90%;
  }
}
.cont-detalles .columna_2 .goles div {
  margin: 0 10px;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2 .goles div {
    margin: 0;
  }
}
.cont-detalles .columna_2 .goles strong {
  color: #006ea9;
  font-size: 3em;
  font-weight: 400;
  vertical-align: middle;
}
.cont-detalles .columna_2 .goles span {
  margin-left: 0.5em;
  color: #006ea9;
  font-size: 2em;
  vertical-align: middle;
}
.cont-detalles .columna_2 .goles p {
  margin: 0;
  color: #959595;
  font-size: 1.8em;
}
.cont-detalles .columna_2 .jugadores {
  text-align: center;
}
.cont-detalles .columna_2 .jugadores a.ampliar {
  display: block;
  margin-bottom: 20px;
  font-size: 14px;
  color: #006ea9;
}
.cont-detalles .columna_2 .jugadores .jugador_principal {
  display: inline-block;
  margin: 0 5px;
}
.cont-detalles .columna_2 .jugadores .jugador_principal figure {
  display: inline-block;
  margin: 0;
  margin-bottom: 10px;
  width: 60px;
  height: 60px;
  overflow: hidden;
  border-radius: 50%;
}
.cont-detalles .columna_2 .jugadores .jugador_principal figure img {
  width: 60px;
}
.cont-detalles .columna_2 .jugadores .jugador_principal h4 {
  font-size: 13px;
  margin-bottom: 0;
}
.cont-detalles .columna_2 .jugadores .jugador_principal p {
  font-size: 18px;
  color: #006ea9;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores {
  display: none;
  padding: 0 50px;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2 .jugadores .slider_jugadores {
    padding: 0;
  }
}
.cont-detalles .columna_2 .jugadores .slider_jugadores .flechas-jugadores {
  position: absolute;
  top: calc(50% - 15px);
  text-align: center;
  z-index: 2;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores .flechas-jugadores.swiper-button-disabled {
  opacity: 0.3;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores .flechas-jugadores.next {
  right: 0px;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores .flechas-jugadores.prev {
  left: 0px;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2 .jugadores .slider_jugadores .flechas-jugadores {
    display: none;
  }
}
.cont-detalles .columna_2 .jugadores .slider_jugadores .flechas-jugadores .swiper-button-next,
.cont-detalles .columna_2 .jugadores .slider_jugadores .flechas-jugadores .swiper-button-prev {
  display: inline-block;
  width: 17px;
  height: 31px;
  font-size: 31px;
  margin-top: 0;
  position: static;
  background-image: none !important;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores figure {
  display: inline-block;
  margin: 0;
  margin-bottom: 10px;
  width: 50px;
  height: 50px;
  overflow: hidden;
  border-radius: 50%;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores figure img {
  width: 50px;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores h4 {
  font-size: 12px;
  margin-bottom: 0;
  word-break: break-word;
}
.cont-detalles .columna_2 .jugadores .slider_jugadores p {
  font-size: 13px;
  font-weight: 700;
  color: #006ea9;
}
.cont-detalles .columna_2.horizontal .resultados {
  margin-bottom: 15px;
}
.cont-detalles .columna_2.horizontal .resultados p {
  margin-left: 10px;
  font-size: 1.6em;
}
.cont-detalles .columna_2.horizontal .principal {
  margin-bottom: 30px;
}
.cont-detalles .columna_2.horizontal .principal div span {
  font-size: 217px;
  font-weight: 300;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2.horizontal .principal div span {
    font-size: 150px;
  }
}
.cont-detalles .columna_2.horizontal .principal div strong {
  font-size: 65px;
  font-weight: 600;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2.horizontal .principal div strong {
    font-size: 50px;
  }
}
.cont-detalles .columna_2.horizontal .secundarios div span {
  font-size: 7.4em;
}
.cont-detalles .columna_2.horizontal .secundarios div strong {
  font-size: 2.4em;
  font-weight: 600;
}
.cont-detalles .columna_2.horizontal .secundarios p {
  text-align: left;
}
.cont-detalles .columna_2.horizontal .goles {
  margin-top: 0;
  margin-bottom: 20px;
  padding-top: 0;
  padding-bottom: 20px;
  border-top: 0;
}
.cont-detalles .columna_2.horizontal .goles span {
  margin-right: 5px;
}
.cont-detalles .columna_2.horizontal .goles div {
  margin: 0;
}
.cont-detalles .columna_2.horizontal .goles p {
  display: inline-block;
  vertical-align: middle;
}
.cont-detalles .columna_2.horizontal .jugadores {
  margin-bottom: 50px;
  padding-bottom: 25px;
  border-bottom: 1px solid #e1e1e1;
}
.cont-detalles .columna_2.horizontal .jugadores .slider_jugadores {
  padding: 0 40px;
}
@media (max-width: 768px) {
  .cont-detalles .columna_2.horizontal .jugadores .slider_jugadores {
    padding: 0;
  }
}

.cont-listado_jugadores .ordenamiento {
  margin-bottom: 10px;
  color: #ffffff;
  background-color: #006ea9;
  font-size: 14px;
}
@media (max-width: 768px) {
  .cont-listado_jugadores .ordenamiento {
    padding-top: 10px;
    padding-bottom: 10px;
    text-align: center;
  }
}
.cont-listado_jugadores .ordenamiento .item {
  display: inline-block;
  vertical-align: middle;
}
.cont-listado_jugadores .ordenamiento .item.mostrar_items {
  display: none;
}
@media (max-width: 768px) {
  .cont-listado_jugadores .ordenamiento .item {
    display: block;
  }
  .cont-listado_jugadores .ordenamiento .item.nomostrar_items {
    display: none;
  }
  .cont-listado_jugadores .ordenamiento .item.mostrarxs {
    display: none;
  }
  .cont-listado_jugadores .ordenamiento .item.mostrarxs span:first-child {
    display: inline-block;
  }
  .cont-listado_jugadores .ordenamiento .item.mostrar_items {
    display: block;
  }
}
.cont-listado_jugadores .ordenamiento .item span {
  vertical-align: middle;
}
.cont-listado_jugadores .ordenamiento .item:first-child strong {
  vertical-align: middle;
  font-size: 24px;
  font-weight: 700;
}
.cont-listado_jugadores .ordenamiento .ordenar_por {
  text-align: right;
}
.cont-listado_jugadores .ordenamiento .ordenar_por [class^=icono-],
.cont-listado_jugadores .ordenamiento .ordenar_por [class*=" icono-"] {
  width: 20px;
  height: 20px;
  display: inline-block;
  line-height: 22px;
  text-align: center;
  color: #006ea9;
  font-size: 11px;
  background-color: #ffffff;
  border-radius: 50%;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-listado_jugadores .ordenamiento .ordenar_por [class^=icono-]:hover, .cont-listado_jugadores .ordenamiento .ordenar_por [class^=icono-].activo,
.cont-listado_jugadores .ordenamiento .ordenar_por [class*=" icono-"]:hover,
.cont-listado_jugadores .ordenamiento .ordenar_por [class*=" icono-"].activo {
  color: #ffffff;
  background-color: #42b6e5;
}
.cont-listado_jugadores .ordenamiento .ordenar_por div {
  padding: 15px;
  border-left: 1px solid #26b1f5;
}
@media (max-width: 768px) {
  .cont-listado_jugadores .ordenamiento .ordenar_por div {
    padding: 5px;
    text-align: left;
    border-left: none;
  }
}
.cont-listado_jugadores .ordenamiento .ordenar_por div:first-child {
  font-weight: 700;
  border-left: none;
}
.cont-listado_jugadores .ordenamiento .ordenar_por div:last-child {
  padding-right: 0;
}
.cont-listado_jugadores .ordenamiento .ordenar_por .ascendente {
  -webkit-transform: rotate(180deg);
  -moz-transform: rotate(180deg);
  -ms-transform: rotate(180deg);
  transform: rotate(180deg);
}

.cont-buscador_jugadores {
  margin: 20px 10%;
}
@media (max-width: 768px) {
  .cont-buscador_jugadores {
    margin: 20px 0;
  }
}
.cont-buscador_jugadores h4 {
  color: #42b6e5;
  font-weight: 800;
  font-size: 18px;
  margin-top: 30px;
  margin-bottom: 10px;
  text-align: center;
}
.cont-buscador_jugadores h5 {
  color: #42b6e5;
  font-weight: 700;
  font-size: 14px;
}
.cont-buscador_jugadores .filto_letras {
  margin-bottom: 20px;
  font-size: 10px;
}
.cont-buscador_jugadores .filto_letras a {
  margin-right: 1.38%;
  font-size: 250%;
  color: #000;
  text-decoration: none;
}
@media (max-width: 1200px) {
  .cont-buscador_jugadores .filto_letras a {
    margin-right: 0.8%;
  }
}
@media (max-width: 1024px) {
  .cont-buscador_jugadores .filto_letras a {
    margin-right: 0.4%;
    font-size: 200%;
  }
}
@media (max-width: 768px) {
  .cont-buscador_jugadores .filto_letras a {
    display: none;
  }
}
.cont-buscador_jugadores .filto_letras a:first-child {
  margin-right: 3%;
}
@media (max-width: 1200px) {
  .cont-buscador_jugadores .filto_letras a:first-child {
    margin-right: 2%;
  }
}
.cont-buscador_jugadores .filto_letras a:last-child {
  margin-right: 0;
}
.cont-buscador_jugadores .filto_letras a:hover {
  color: #42b6e5;
}
.cont-buscador_jugadores .cont-filtro-avanzado {
  position: relative;
  top: 6px;
  color: #006ea9;
  font-size: 16px;
  font-weight: 700;
}
.cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro {
  position: relative;
  display: inline-block;
  padding: 10px 20px;
  padding-top: 12px;
  cursor: pointer;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro input[type=checkbox] {
  display: none;
}
.cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro label {
  margin: 0;
}
.cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro label span.check {
  position: absolute;
  left: 10px;
  width: 22px;
  height: 22px;
  border: 1px solid #d1d1d1;
  background-color: #ffffff;
}
.cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro:hover, .cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro.activo {
  -webkit-box-shadow: inset 0 4px 0 0px #42b6e5;
  -moz-box-shadow: inset 0 4px 0 0px #42b6e5;
  box-shadow: inset 0 4px 0 0px #42b6e5;
  background-color: #eeeeee;
}
.cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro:hover label span.check:after, .cont-buscador_jugadores .cont-filtro-avanzado .tab_filtro.activo label span.check:after {
  margin: 1px 2px;
  font-family: "iconos";
  font-size: 13px;
  font-weight: 400;
  content: "\e923";
  display: inline-block;
}
.cont-buscador_jugadores .cont-filtro-avanzado p {
  display: inline-block;
  margin-right: 25px;
}
@media (max-width: 768px) {
  .cont-buscador_jugadores .cont-filtro-avanzado p {
    display: block;
    margin-right: 0;
    margin-bottom: 20px;
    text-align: center;
  }
}
.cont-buscador_jugadores .cont-filtro-avanzado p span {
  font-weight: 600;
  vertical-align: middle;
}
.cont-buscador_jugadores .cont-filtro-avanzado p [class^=icono-],
.cont-buscador_jugadores .cont-filtro-avanzado p [class*=" icono-"] {
  font-weight: 400;
  margin-right: 8px;
  font-size: 12px;
}
.cont-buscador_jugadores .filtro-torneos {
  padding: 45px 20px;
  background-color: #eeeeee;
}
.cont-buscador_jugadores .filtro-torneos h3 {
  color: #006ea9;
  font-size: 16px;
  font-weight: 700;
}
@media (max-width: 768px) {
  .cont-buscador_jugadores .filtro-torneos .tipos_torneos {
    margin-bottom: 15px;
  }
}
.cont-buscador_jugadores .filtro-torneos .tipos_torneos a {
  display: block;
  position: relative;
  margin-right: -31px;
  padding: 10px;
  padding-left: 20px;
  font-size: 15px;
  font-weight: 600;
  text-decoration: none;
  color: #006ea9;
  border-top: 1px solid transparent;
  border-bottom: 1px solid transparent;
  z-index: 1;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
@media (max-width: 768px) {
  .cont-buscador_jugadores .filtro-torneos .tipos_torneos a {
    padding: 5px 10px;
    margin-right: 0;
  }
}
.cont-buscador_jugadores .filtro-torneos .tipos_torneos a:hover, .cont-buscador_jugadores .filtro-torneos .tipos_torneos a.activo {
  -webkit-box-shadow: inset 6px 0 0 0px #006ea9;
  -moz-box-shadow: inset 6px 0 0 0px #006ea9;
  box-shadow: inset 6px 0 0 0px #006ea9;
  border-top: 1px solid #d1d1d1;
  border-bottom: 1px solid #d1d1d1;
  background-color: #ffffff;
}
@media (max-width: 768px) {
  .cont-buscador_jugadores .filtro-torneos .tipos_torneos a:hover, .cont-buscador_jugadores .filtro-torneos .tipos_torneos a.activo {
    border-right: 1px solid #d1d1d1;
  }
}
.cont-buscador_jugadores .filtro-torneos .torneos select {
  min-height: 380px;
}
@media (max-width: 768px) {
  .cont-buscador_jugadores .filtro-torneos .torneos select {
    min-height: 50px;
  }
}
.cont-buscador_jugadores .filtro-torneos .torneos select option {
  padding: 5px;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos {
  position: relative;
  padding-bottom: 15px;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos div p {
  color: #006ea9;
  font-size: 15px;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos div p span {
  vertical-align: middle;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos div p [class^=icono-],
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos div p [class*=" icono-"] {
  margin-right: 8px;
  color: #42b6e5;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos .tag {
  text-align: left;
  white-space: unset !important;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos a {
  color: #006ea9;
  text-decoration: none;
  font-size: 13px;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos a:hover {
  color: #42b6e5;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos a.tag {
  display: inline-block;
  margin-right: 10px;
  margin-bottom: 10px;
  padding: 5px 7px;
  color: #ffffff;
  border-radius: 5px;
  background-color: #42b6e5;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos a.tag:hover {
  background-color: #006ea9;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos a [class^=icono-],
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos a [class*=" icono-"] {
  vertical-align: middle;
  margin-left: 12px;
  font-size: 7px;
  font-weight: 700;
}
.cont-buscador_jugadores .filtro-torneos .busqueda_torneos a.limpiar {
  position: absolute;
  left: 0;
  bottom: 0;
}
.cont-buscador_jugadores .filtro-trayectoria {
  margin: 40px 0;
}
.cont-buscador_jugadores .filtro-trayectoria p {
  position: absolute;
  margin: 16px 12px;
  color: #000;
  font-size: 13px;
}
.cont-buscador_jugadores .filtro-trayectoria .fecha_calendario {
  position: relative;
}
.cont-buscador_jugadores .filtro-trayectoria .fecha_calendario input {
  padding-left: 75px;
  font-size: 13px;
  text-align: right;
  border-radius: 0;
}
.cont-buscador_jugadores .filtro-trayectoria .fecha_calendario input::-webkit-input-placeholder {
  font-size: 13px;
}

.cont-buscador_jugadores .filtro-trayectoria .fecha_calendario input:-moz-placeholder {
  font-size: 13px;
  opacity: 1;
}

.cont-buscador_jugadores .filtro-trayectoria .fecha_calendario input::-moz-placeholder {
  font-size: 13px;
  opacity: 1;
}

.cont-buscador_jugadores .filtro-trayectoria .fecha_calendario input:-ms-input-placeholder {
  font-size: 13px;
}

.cont-buscador_jugadores .filtro-trayectoria .fecha_calendario .icono {
  position: absolute;
  margin: 13px;
  margin-left: 60px;
  color: #42b6e5;
  font-size: 22px;
}
.cont-buscador_jugadores .btn {
  display: block;
  text-align: center;
  color: #ffffff;
  font-size: 22px;
  font-weight: 800;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
  background-color: #42b6e5;
}
.cont-buscador_jugadores .btn:hover {
  background-color: #006ea9;
}
.cont-buscador_jugadores .btn span {
  vertical-align: middle;
}
.cont-buscador_jugadores .btn [class^=icono-],
.cont-buscador_jugadores .btn [class*=" icono-"] {
  margin-right: 5px;
}
.cont-buscador_jugadores .limpiar {
  text-align: right;
}
.cont-buscador_jugadores .limpiar a {
  display: inline-block;
  margin-top: 10px;
  padding: 5px 10px;
  color: #ffffff;
  font-size: 14px;
  text-align: right;
  text-decoration: none;
  background-color: #7b7b7b;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-buscador_jugadores .limpiar a:hover {
  background-color: #076694;
}
.cont-buscador_jugadores .limpiar a span {
  vertical-align: middle;
}
.cont-buscador_jugadores .limpiar a span.icono {
  font-size: 10px;
}

.cont-historicos {
  margin: 0 28%;
  padding-top: 10px;
  padding-bottom: 15px;
  font-size: 14px;
  font-weight: 700;
  text-align: center;
  border-top: 1px solid #e1e1e1;
  border-bottom: 1px solid #e1e1e1;
  text-transform: uppercase;
}
@media (max-width: 768px) {
  .cont-historicos {
    margin: 0;
    padding-top: 20px;
  }
}
.cont-historicos .historicos {
  display: inline-block;
  margin-right: 15px;
}
@media (max-width: 768px) {
  .cont-historicos .historicos {
    margin-right: 0;
  }
}
.cont-historicos .historicos span[class^=icono-], .cont-historicos .historicos span[class*=" icono-"] {
  margin-right: 5px;
  color: #eeba02;
}
.cont-historicos .historicos p {
  margin: 0;
  padding: 0 20px;
  font-size: 15px;
  border-right: 1px solid #e1e1e1;
  color: #006ea9;
}
@media (max-width: 768px) {
  .cont-historicos .historicos p {
    border-right: none;
  }
}
.cont-historicos .filtro {
  display: inline-block;
}
@media (max-width: 768px) {
  .cont-historicos .filtro {
    margin-top: 10px;
  }
}
.cont-historicos .filtro a {
  position: relative;
  display: inline-block;
  color: #7b7b7b;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-historicos .filtro a:after {
  content: "\e909";
  position: absolute;
  width: 100%;
  top: 0;
  left: 0;
  font-family: "iconos";
  color: #eeba02;
  opacity: 0;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-historicos .filtro a:hover {
  color: #42b6e5;
}
.cont-historicos .filtro a:hover:after {
  top: -16px;
  opacity: 1;
}
.cont-historicos .filtro span {
  display: inline-block;
  margin: 0 10px;
}

.cont-selecciones_menu {
  margin-bottom: 30px;
  font-size: 18px;
  text-align: center;
  font-weight: 600;
}
@media (max-width: 768px) {
  .cont-selecciones_menu {
    margin-bottom: 15px;
  }
}
.cont-selecciones_menu .selecciones_menu {
  display: inline-block;
  margin-right: 20px;
}
@media (max-width: 768px) {
  .cont-selecciones_menu .selecciones_menu {
    margin-right: 0;
  }
}
.cont-selecciones_menu .selecciones_menu span[class^=icono-], .cont-selecciones_menu .selecciones_menu span[class*=" icono-"] {
  margin-right: 5px;
  color: #eeba02;
}
.cont-selecciones_menu .selecciones_menu p {
  margin: 0;
  font-weight: 300;
  font-size: 26px;
  border-bottom: 3px solid #afd5ef;
  color: #006ea9;
}
.cont-selecciones_menu .filtro {
  display: inline-block;
}
@media (max-width: 768px) {
  .cont-selecciones_menu .filtro {
    margin-top: 10px;
  }
}
.cont-selecciones_menu .filtro a {
  position: relative;
  display: inline-block;
  color: #959595;
  text-decoration: none;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-selecciones_menu .filtro a:hover {
  color: #42b6e5;
}
@media (max-width: 768px) {
  .cont-selecciones_menu .filtro a {
    color: #7b7b7b;
    font-weight: 700;
    font-size: 14px;
    text-transform: uppercase;
  }
}
.cont-selecciones_menu .filtro span {
  display: inline-block;
  margin: 0 5px;
  opacity: 0;
}

.cont-paginacion {
  text-align: center;
}
.cont-paginacion > div {
  margin-bottom: 20px;
  font-size: 14px;
  font-weight: 700;
  color: #006ea9;
}
.cont-paginacion .paginacion {
  position: relative;
  display: inline-block;
  padding-left: 10px;
  padding-right: 10px;
}
@media (max-width: 768px) {
  .cont-paginacion .paginacion {
    display: block;
    padding-left: 20px;
    padding-right: 20px;
  }
}
.cont-paginacion .paginacion span {
  position: absolute;
  color: #006ea9;
  font-size: 18px;
  top: calc(50% - 8px);
}
.cont-paginacion .paginacion span.pag_izq {
  left: 0;
}
.cont-paginacion .paginacion span.pag_der {
  right: 0;
}
.cont-paginacion .paginacion a.flecha {
  margin: 0 10px;
  font-weight: 400;
  font-size: 12px;
}
.cont-paginacion .paginacion .pag {
  display: inline-block;
  margin: 0 2px;
  padding: 9px 13px;
  text-align: center;
  color: #ffffff;
  font-size: 16px;
  line-height: 1;
  text-decoration: none;
  border-radius: 5px;
  background-color: #006ea9;
  transition: all 200ms ease-out;
  -webkit-transition: all 200ms ease-out;
  -moz-transition: all 200ms ease-out;
  -ms-transition: all 200ms ease-out;
}
.cont-paginacion .paginacion .pag:hover:not(.actual) {
  background-color: #42b6e5;
}
.cont-paginacion .paginacion .pag.actual {
  opacity: 0.3;
  cursor: default;
}
.cont-paginacion select.paginacion {
  padding-left: 20px;
  padding-right: 20px;
}

.video_ok .video-container {
  display: block !important;
}

.cont-login {
  margin-top: 50px;
  margin-bottom: 50px;
}
@media (max-width: 480px) {
  .cont-login {
    margin: 0;
  }
}
.cont-login h3 {
  font-size: 16px;
  padding: 10px;
  color: #ffffff;
  background-color: #006ea9;
  margin-bottom: 20px;
}
.cont-login .texto {
  font-size: 13px;
}
.cont-login .cuerpo {
  padding: 30px;
  background-color: whitesmoke;
}
@media (max-width: 480px) {
  .cont-login .cuerpo {
    padding: 20px;
  }
}
.cont-login .logo_login {
  display: block;
  margin-bottom: 10px;
  text-align: center;
}
.cont-login .logo_login img {
  width: 75px;
  height: 150px;
}
.cont-login .olvido {
  display: block;
  margin-top: 10px;
  text-align: center;
  font-size: 15px;
}
.cont-login .cont-menu_login {
  position: relative;
}
.cont-login .menu_login {
  margin-bottom: 10px;
  text-align: right;
  color: #d1d1d1;
  font-size: 15px;
}
@media (max-width: 480px) {
  .cont-login .menu_login {
    height: 25px;
    overflow: auto;
    white-space: nowrap;
  }
  .cont-login .menu_login:before, .cont-login .menu_login:after {
    position: absolute;
    top: 0;
    content: "";
    display: block;
    width: 35px;
    height: 27px;
  }
  .cont-login .menu_login:before {
    left: -20px;
    background: whitesmoke;
    background: -moz-linear-gradient(left, whitesmoke 0%, rgba(246, 246, 246, 0.47) 53%, rgba(255, 255, 255, 0) 100%);
    background: -webkit-gradient(left top, right top, color-stop(0%, whitesmoke), color-stop(53%, rgba(246, 246, 246, 0.47)), color-stop(100%, rgba(255, 255, 255, 0)));
    background: -webkit-linear-gradient(left, whitesmoke 0%, rgba(246, 246, 246, 0.47) 53%, rgba(255, 255, 255, 0) 100%);
    background: -o-linear-gradient(left, whitesmoke 0%, rgba(246, 246, 246, 0.47) 53%, rgba(255, 255, 255, 0) 100%);
    background: -ms-linear-gradient(left, whitesmoke 0%, rgba(246, 246, 246, 0.47) 53%, rgba(255, 255, 255, 0) 100%);
    background: linear-gradient(to right, whitesmoke 0%, rgba(246, 246, 246, 0.47) 53%, rgba(255, 255, 255, 0) 100%);
    filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#f5f5f5", endColorstr="#ffffff", GradientType=1 );
  }
  .cont-login .menu_login:after {
    right: -20px;
    background: rgba(255, 255, 255, 0);
    background: -moz-linear-gradient(left, rgba(255, 255, 255, 0) 0%, rgba(246, 246, 246, 0.47) 47%, whitesmoke 100%);
    background: -webkit-gradient(left top, right top, color-stop(0%, rgba(255, 255, 255, 0)), color-stop(47%, rgba(246, 246, 246, 0.47)), color-stop(100%, whitesmoke));
    background: -webkit-linear-gradient(left, rgba(255, 255, 255, 0) 0%, rgba(246, 246, 246, 0.47) 47%, whitesmoke 100%);
    background: -o-linear-gradient(left, rgba(255, 255, 255, 0) 0%, rgba(246, 246, 246, 0.47) 47%, whitesmoke 100%);
    background: -ms-linear-gradient(left, rgba(255, 255, 255, 0) 0%, rgba(246, 246, 246, 0.47) 47%, whitesmoke 100%);
    background: linear-gradient(to right, rgba(255, 255, 255, 0) 0%, rgba(246, 246, 246, 0.47) 47%, whitesmoke 100%);
    filter: progid:DXImageTransform.Microsoft.gradient( startColorstr="#ffffff", endColorstr="#f5f5f5", GradientType=1 );
  }
}
.cont-login input:not([type=submit]):not([type=button]):not([type=checkbox]),
.cont-login textarea {
  margin-bottom: 25px;
}
.cont-login input[type=checkbox] {
  margin-left: 10px;
  margin-bottom: 10px;
}
.cont-login .bootstrap-tagsinput {
  position: relative;
  margin-bottom: 25px;
  padding: 10px 15px;
  border: 1px solid #d1d1d1;
}
.cont-login .bootstrap-tagsinput input {
  margin-bottom: 0 !important;
  height: 25px;
}
.cont-login label {
  font-size: 15px;
}
.cont-login input[type=submit],
.cont-login input[type=button] {
  width: 100%;
  text-transform: uppercase;
  color: #ffffff;
  cursor: pointer;
  background-color: #42b6e5;
}

.reset {
  display: block;
  margin-top: 5px;
  font-size: 15px;
  text-align: right;
}

/*PRECARGA DE PAGINA*/
.no-js #loader {
  display: none;
}

.js #loader {
  display: block;
  position: absolute;
  left: 100px;
  top: 0;
}

.se-pre-con {
  position: fixed;
  left: 0px;
  top: 0px;
  width: 100%;
  height: 100%;
  z-index: 9999;
  background: url(/../imagenes/img_presentacion/cargador_logo.gif) center no-repeat rgba(255, 255, 255, 0.9);
}

.header {
  background-color: #006ea9;
  background: linear-gradient(135deg, #004d75 0%, #006ea9 40%, #0095d4 100%);
  border-bottom: 1px solid #004c75b7;
  box-shadow: inset 0 -1px 0 #00a4e048;
  position: sticky;
  top: -1px;
  left: 0;
  width: 100%;
  z-index: 30;
  transition: all 0.2s;
}
@media screen and (max-width: 768px) {
  .header {
    position: sticky;
    top: -1px;
    left: 0;
    width: 100%;
    height: 80px;
    z-index: 30;
    display: flex;
    align-items: center;
    gap: 10px;
    justify-content: space-between;
  }
}
.header__cont {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 20px;
  width: 100%;
  padding: 15px;
  z-index: 1000;
  transition: all 0.2s;
}
.scroll .header__cont {
  padding: 8px 15px;
}
.header__cont--logo {
  display: flex;
  align-items: center;
}
@media screen and (max-width: 768px) {
  .header__cont--logo {
    position: absolute !important;
    left: 50% !important;
    top: 50% !important;
    transform: translate(-50%, -50%) !important;
  }
}
.header__cont--logo a {
  cursor: pointer;
  transition: all 0.2s;
}
.header__cont--logo a img {
  width: 36px;
  height: auto;
  transition: all 0.2s;
}
.scroll .header__cont--logo a img {
  width: 20px;
}
@media screen and (max-width: 768px) {
  .header__cont--logo a img {
    width: 30px !important;
  }
}
.header__cont--logo a:hover {
  opacity: 0.85;
  scale: 1.1;
}
.header__cont--redes {
  display: flex;
  gap: 10px;
  align-items: center;
  justify-content: center;
  flex-wrap: wrap;
}
@media screen and (max-width: 768px) {
  .header__cont--redes {
    gap: 10px;
  }
}
.header__cont--redes--servicios {
  display: flex;
  align-items: center;
  gap: 15px;
}
@media screen and (max-width: 768px) {
  .header__cont--redes--servicios {
    display: none;
  }
}
.header__cont--redes a {
  color: #fff;
  font-size: 18px;
  transition: all 0.2s;
}
.header__cont--redes a:hover {
  opacity: 0.85;
  scale: 1.1;
}
@media screen and (max-width: 768px) {
  .header__cont--redes a {
    font-size: 16px;
  }
}
.header__cont--redes a img {
  height: 20px;
}
.header__cont--nav {
  margin-right: auto;
  position: relative !important;
}
@media screen and (max-width: 768px) {
  .header__cont--nav {
    display: none;
  }
}
.header__cont--nav ul {
  display: flex;
  align-items: center;
  justify-content: flex-start;
  gap: 3px;
  list-style: none;
  padding-bottom: 0;
  margin-bottom: 0;
  flex-wrap: wrap;
}
.header__cont--nav ul li {
  display: flex;
  justify-content: center;
  align-items: center;
}
.header__cont--nav ul li:has(.cont-submenu:hover) > a {
  color: #ffffff;
  text-decoration: none;
  background: #42b6e5;
  border-radius: 3px;
}
.header__cont--nav ul li a, .header__cont--nav ul li .noLink {
  display: flex;
  justify-content: center;
  align-items: center;
  gap: 5px;
  padding: 10px;
  color: #fff;
}
.header__cont--nav ul li a span, .header__cont--nav ul li .noLink span {
  font-size: 13px;
  text-transform: uppercase;
}
.header__cont--nav ul li a i, .header__cont--nav ul li .noLink i {
  font-size: 11px;
}
.header__cont--nav ul li a:hover {
  color: #ffffff;
  text-decoration: none;
  background: #42b6e5;
  border-radius: 3px;
}
.header__cont--mobile {
  display: none;
}
@media screen and (max-width: 768px) {
  .header__cont--mobile {
    display: flex;
    align-items: center;
    gap: 15px;
  }
  .header__cont--mobile div, .header__cont--mobile a {
    display: flex;
    align-items: center;
    gap: 5px;
    color: #fff;
  }
  .header__cont--mobile div span, .header__cont--mobile a span {
    font-size: 14px;
  }
  .header__cont--mobile div i, .header__cont--mobile a i {
    font-size: 20px;
  }
}

.cont-submenu {
  opacity: 0;
  visibility: hidden;
  position: absolute;
  top: 20px;
  left: 0;
  z-index: 20;
  inline-size: min(clamp(520px, 60vw, 900px), 100vw - 32px);
  transition: opacity 200ms ease-out, top 200ms ease-out;
  border-radius: 0 0 5px 5px;
  padding: 25px;
  display: flex;
  flex-direction: column;
  gap: 30px;
  border-top: 5px solid #42b6e5;
  background-color: #fff;
  background-repeat: no-repeat;
  background-position: bottom right;
  background-size: clamp(400px, 18%, 160px);
}
.cont-submenu__menu {
  display: grid;
  grid-template-columns: repeat(5, 1fr);
  gap: 15px;
}
.cont-submenu__menu ul {
  display: flex;
  flex-direction: column;
  align-items: flex-start;
  justify-content: flex-start;
  gap: 8px;
  width: 100%;
}
.cont-submenu__menu ul li {
  padding: 0;
}
.cont-submenu__menu ul li a {
  padding: 0;
  cursor: pointer;
  color: #696969;
  text-transform: none;
}
.cont-submenu__menu ul li a:hover {
  background: transparent;
  color: #42b6e5;
}
.cont-submenu__menu ul li h5 {
  margin: 0;
  font-size: 13px;
  font-weight: 700;
  color: #006ea9;
  text-transform: uppercase;
  width: 100%;
}

#submenu:hover .cont-submenu {
  opacity: 1;
  visibility: visible;
  top: 38px;
}

#submenu2 {
  position: relative;
}
#submenu2 .cont-submenu {
  opacity: 0;
  visibility: hidden;
  position: absolute;
  top: 20px;
  right: 0;
  z-index: 20;
  width: max-content !important;
}
#submenu2 .cont-submenu .cont-submenu__menu {
  display: flex;
  align-items: center;
  gap: 10px;
  display: flex !important;
}
#submenu2 .cont-submenu .cont-submenu__menu ul {
  display: flex;
  flex-direction: column;
  align-items: flex-start;
  justify-content: flex-start;
  gap: 8px;
  width: 100%;
}
#submenu2 .cont-submenu .cont-submenu__menu ul li {
  padding: 0;
}
#submenu2 .cont-submenu .cont-submenu__menu ul li a {
  padding: 0;
  cursor: pointer;
  color: #696969;
  text-transform: none;
}
#submenu2 .cont-submenu .cont-submenu__menu ul li a:hover {
  background: transparent;
  color: #42b6e5;
}
#submenu2 .cont-submenu .cont-submenu__menu ul li h5 {
  margin: 0;
  font-size: 13px;
  font-weight: 700;
  color: #006ea9;
  text-transform: uppercase;
  width: 100%;
}

#submenu2:hover .cont-submenu {
  display: block;
  top: 45px;
  opacity: 1;
  visibility: visible;
}

.cont-historico {
  display: flex;
  flex-direction: column;
  gap: 5px;
}
.cont-historico__stars {
  display: flex;
  gap: 3px;
}
.cont-historico__stars .icono-estrella {
  color: orange;
}
.cont-historico h5 {
  font-size: 14px;
  color: #006ea9;
  font-weight: 700;
}
.cont-historico ul {
  display: flex;
  flex-direction: column;
  gap: 5px;
  justify-content: flex-start;
  align-items: flex-start;
}
.cont-historico ul li {
  padding: 0;
}
.cont-historico ul li a {
  color: #696969;
  padding: 0;
  text-transform: none;
}
.cont-historico ul li a span {
  text-transform: none;
}
.cont-historico ul li a:hover {
  color: #42b6e5;
  background: transparent;
}

.scroll .cont-buscador {
  top: 57px;
}
@media screen and (max-width: 768px) {
  .scroll .cont-buscador {
    top: 80px;
  }
}

.footer {
  color: #fff;
  padding-block: 50px 20px;
  display: flex;
  flex-direction: column;
  gap: 50px;
  width: 100%;
  background: #076694;
}
.footer__cont {
  padding-block: 10px 0;
  display: flex;
  align-items: center;
  gap: 30px;
  justify-content: start;
  max-width: 1400px;
  margin: 0 auto;
  width: 100%;
}
@media screen and (max-width: 768px) {
  .footer__cont {
    padding-inline: 15px;
  }
}
@media screen and (max-width: 768px) {
  .footer__cont {
    display: flex;
    flex-direction: column;
    gap: 30px;
    align-items: flex-start;
  }
}
.footer__cont--columna_1 {
  display: flex;
  align-items: center;
  gap: 20px;
  flex-shrink: 0;
}
@media screen and (max-width: 768px) {
  .footer__cont--columna_1 {
    display: flex;
    flex-direction: column;
    gap: 20px;
  }
}
.footer__cont--columna_1 img {
  width: 75px;
}
.footer__cont--columna_1 h3 {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 0;
}
.footer__cont--columna_1 span {
  font-size: 13px;
}
.footer__cont--columna_1--info {
  display: flex;
  flex-direction: column;
  gap: 5px;
}
.footer__cont--columna_1--info--line {
  display: flex;
  align-items: center;
  gap: 25px;
  padding: 15px 0;
}
@media screen and (max-width: 768px) {
  .footer__cont--columna_1--info--line {
    display: flex;
    flex-direction: column;
    gap: 20px;
    align-items: flex-start;
  }
}
.footer__cont--columna_1--info--line--item {
  display: flex;
  flex-direction: column;
  gap: 3px;
}
.footer__cont--columna_1--info--line--item a {
  color: #fff;
  font-weight: 700;
}
.footer__cont--columna_1--info--line--item a:hover {
  text-decoration: none;
  color: #42b6e5;
}
.footer__cont--columna_2 {
  display: flex;
  align-items: center;
  gap: 15px;
  margin-left: auto;
  justify-self: flex-end;
  align-items: flex-start;
}
@media screen and (max-width: 768px) {
  .footer__cont--columna_2 {
    display: flex;
    flex-direction: column;
    gap: 15px;
    margin-left: 0;
    justify-self: flex-start;
    align-items: flex-start;
  }
}
.footer__cont--columna_2--item {
  display: flex;
  align-items: center;
  gap: 10px;
  align-items: flex-start;
}
.footer__cont--columna_2--item i {
  font-size: 22px;
}
.footer__cont--columna_2--item--info {
  display: flex;
  flex-direction: column;
  gap: 3px;
}
.footer__cont--columna_2--item--info a {
  color: #fff;
  font-weight: 700;
}
.footer__cont--columna_2--item--info a:hover {
  text-decoration: none;
  color: #42b6e5;
}
.footer__cont--columna_2--item--info h3 {
  font-size: 18px;
  font-weight: 600;
}
.footer__cont--columna_2--item--info span {
  font-size: 13px;
}
.footer__cont--redes {
  display: flex;
  align-items: center;
  gap: 20px;
  justify-content: center;
  justify-self: center;
  width: 100%;
  padding-block: 30px;
  border-bottom: 1px solid #ffffff3d;
  border-top: 1px solid #ffffff3d;
  flex-wrap: wrap;
}
.footer__cont--redes img {
  height: 20px;
}
.footer__cont--redes a {
  color: #fff;
  font-size: 20px;
  transition: all 0.2s;
}
.footer__cont--redes a:hover {
  opacity: 0.85;
  scale: 1.1;
  text-decoration: none;
}
.footer__cont--firma {
  display: flex;
  align-items: center;
  gap: 10px;
  justify-content: space-between;
  margin: 0 0;
  width: 100%;
}
.footer__cont--firma--logos {
  display: flex;
  align-items: center;
  gap: 15px;
}
.footer__cont--firma--logos a img {
  width: 100%;
}
.footer__cont--firma span {
  display: flex;
  align-items: center;
  gap: 10px;
}
.footer__cont--firma span a {
  opacity: 0.7;
}
.footer__cont--firma span a img {
  width: 30px;
}

.pace {
  -webkit-pointer-events: none;
  pointer-events: none;
  -webkit-user-select: none;
  -moz-user-select: none;
  user-select: none;
}

.pace-inactive {
  display: none;
}

.pace .pace-progress {
  background: #42b6e5;
  position: fixed;
  z-index: 2000;
  top: 0;
  right: 100%;
  width: 100%;
  height: 3px;
}

.pace .pace-progress-inner {
  display: block;
  position: absolute;
  right: 0px;
  width: 100px;
  height: 100%;
  box-shadow: 0 0 10px #42b6e5, 0 0 5px #42b6e5;
  opacity: 1;
  -webkit-transform: rotate(3deg) translate(0px, -4px);
  -moz-transform: rotate(3deg) translate(0px, -4px);
  -ms-transform: rotate(3deg) translate(0px, -4px);
  -o-transform: rotate(3deg) translate(0px, -4px);
  transform: rotate(3deg) translate(0px, -4px);
}

.pace .pace-activity {
  display: block;
  position: fixed;
  z-index: 2000;
  top: 15px;
  right: 15px;
  width: 14px;
  height: 14px;
  border: solid 2px transparent;
  border-top-color: #FFF;
  border-left-color: #FFF;
  border-radius: 10px;
  -webkit-animation: pace-spinner 400ms linear infinite;
  -moz-animation: pace-spinner 400ms linear infinite;
  -ms-animation: pace-spinner 400ms linear infinite;
  -o-animation: pace-spinner 400ms linear infinite;
  animation: pace-spinner 400ms linear infinite;
}

@-webkit-keyframes pace-spinner {
  0% {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    -webkit-transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
@-moz-keyframes pace-spinner {
  0% {
    -moz-transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    -moz-transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
@-o-keyframes pace-spinner {
  0% {
    -o-transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    -o-transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
@-ms-keyframes pace-spinner {
  0% {
    -ms-transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    -ms-transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
@keyframes pace-spinner {
  0% {
    transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
@media screen and (max-width: 970px) {
  .pace .pace-progress {
    background: #42b6e5;
  }

  .pace .pace-activity {
    border-top-color: #42b6e5;
    border-left-color: #42b6e5;
  }
}
/* This is the default Tooltipster theme (feel free to modify or duplicate and create multiple themes!): */
.tooltipster-default {
  border: 1px solid #006ea9;
  background: #ffffff;
  color: #006ea9;
  font-weight: 700;
}

/* Use this next selector to style things like font-size and line-height: */
.tooltipster-default .tooltipster-content {
  font-family: Arial, sans-serif;
  font-size: 14px;
  line-height: 16px;
  padding: 8px 10px;
  overflow: hidden;
}

/* This next selector defines the color of the border on the outside of the arrow. This will automatically match the color and size of the border set on the main tooltip styles. Set display: none; if you would like a border around the tooltip but no border around the arrow */
.tooltipster-default .tooltipster-arrow .tooltipster-arrow-border {
  /* border-color: ... !important; */
}

/* If you're using the icon option, use this next selector to style them */
.tooltipster-icon {
  cursor: help;
  margin-left: 4px;
}

/* This is the base styling required to make all Tooltipsters work */
.tooltipster-base {
  padding: 0;
  font-size: 0;
  line-height: 0;
  position: absolute;
  left: 0;
  top: 0;
  z-index: 9999999;
  pointer-events: none;
  width: auto;
  overflow: visible;
}

.tooltipster-base .tooltipster-content {
  overflow: hidden;
}

/* These next classes handle the styles for the little arrow attached to the tooltip. By default, the arrow will inherit the same colors and border as what is set on the main tooltip itself. */
.tooltipster-arrow {
  display: block;
  text-align: center;
  width: 100%;
  height: 100%;
  position: absolute;
  top: 0;
  left: 0;
  z-index: -1;
}

.tooltipster-arrow span, .tooltipster-arrow-border {
  display: block;
  width: 0;
  height: 0;
  position: absolute;
}

.tooltipster-arrow-top span, .tooltipster-arrow-top-right span, .tooltipster-arrow-top-left span {
  border-left: 8px solid transparent !important;
  border-right: 8px solid transparent !important;
  border-top: 8px solid;
  bottom: -7px;
}

.tooltipster-arrow-top .tooltipster-arrow-border, .tooltipster-arrow-top-right .tooltipster-arrow-border, .tooltipster-arrow-top-left .tooltipster-arrow-border {
  border-left: 7px solid transparent !important;
  border-right: 7px solid transparent !important;
  border-top: 9px solid;
  bottom: -9px;
}

.tooltipster-arrow-bottom span, .tooltipster-arrow-bottom-right span, .tooltipster-arrow-bottom-left span {
  border-left: 8px solid transparent !important;
  border-right: 8px solid transparent !important;
  border-bottom: 8px solid;
  top: -7px;
}

.tooltipster-arrow-bottom .tooltipster-arrow-border, .tooltipster-arrow-bottom-right .tooltipster-arrow-border, .tooltipster-arrow-bottom-left .tooltipster-arrow-border {
  border-left: 9px solid transparent !important;
  border-right: 9px solid transparent !important;
  border-bottom: 9px solid;
  top: -7px;
}

.tooltipster-arrow-top span, .tooltipster-arrow-top .tooltipster-arrow-border, .tooltipster-arrow-bottom span, .tooltipster-arrow-bottom .tooltipster-arrow-border {
  left: 0;
  right: 0;
  margin: 0 auto;
}

.tooltipster-arrow-top-left span, .tooltipster-arrow-bottom-left span {
  left: 6px;
}

.tooltipster-arrow-top-left .tooltipster-arrow-border, .tooltipster-arrow-bottom-left .tooltipster-arrow-border {
  left: 5px;
}

.tooltipster-arrow-top-right span, .tooltipster-arrow-bottom-right span {
  right: 6px;
}

.tooltipster-arrow-top-right .tooltipster-arrow-border, .tooltipster-arrow-bottom-right .tooltipster-arrow-border {
  right: 5px;
}

.tooltipster-arrow-left span, .tooltipster-arrow-left .tooltipster-arrow-border {
  border-top: 8px solid transparent !important;
  border-bottom: 8px solid transparent !important;
  border-left: 8px solid;
  top: 50%;
  margin-top: -7px;
  right: -7px;
}

.tooltipster-arrow-left .tooltipster-arrow-border {
  border-top: 9px solid transparent !important;
  border-bottom: 9px solid transparent !important;
  border-left: 9px solid;
  margin-top: -8px;
}

.tooltipster-arrow-right span, .tooltipster-arrow-right .tooltipster-arrow-border {
  border-top: 8px solid transparent !important;
  border-bottom: 8px solid transparent !important;
  border-right: 8px solid;
  top: 50%;
  margin-top: -7px;
  left: -7px;
}

.tooltipster-arrow-right .tooltipster-arrow-border {
  border-top: 9px solid transparent !important;
  border-bottom: 9px solid transparent !important;
  border-right: 9px solid;
  margin-top: -8px;
}

/* Some CSS magic for the awesome animations - feel free to make your own custom animations and reference it in your Tooltipster settings! */
.tooltipster-fade {
  opacity: 0;
  -webkit-transition-property: opacity;
  -moz-transition-property: opacity;
  -o-transition-property: opacity;
  -ms-transition-property: opacity;
  transition-property: opacity;
}

.tooltipster-fade-show {
  opacity: 1;
}

.tooltipster-grow {
  -webkit-transform: scale(0, 0);
  -moz-transform: scale(0, 0);
  -o-transform: scale(0, 0);
  -ms-transform: scale(0, 0);
  transform: scale(0, 0);
  -webkit-transition-property: -webkit-transform;
  -moz-transition-property: -moz-transform;
  -o-transition-property: -o-transform;
  -ms-transition-property: -ms-transform;
  transition-property: transform;
  -webkit-backface-visibility: hidden;
}

.tooltipster-grow-show {
  -webkit-transform: scale(1, 1);
  -moz-transform: scale(1, 1);
  -o-transform: scale(1, 1);
  -ms-transform: scale(1, 1);
  transform: scale(1, 1);
  -webkit-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  -webkit-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -moz-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -ms-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -o-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
}

.tooltipster-swing {
  opacity: 0;
  -webkit-transform: rotateZ(4deg);
  -moz-transform: rotateZ(4deg);
  -o-transform: rotateZ(4deg);
  -ms-transform: rotateZ(4deg);
  transform: rotateZ(4deg);
  -webkit-transition-property: -webkit-transform, opacity;
  -moz-transition-property: -moz-transform;
  -o-transition-property: -o-transform;
  -ms-transition-property: -ms-transform;
  transition-property: transform;
}

.tooltipster-swing-show {
  opacity: 1;
  -webkit-transform: rotateZ(0deg);
  -moz-transform: rotateZ(0deg);
  -o-transform: rotateZ(0deg);
  -ms-transform: rotateZ(0deg);
  transform: rotateZ(0deg);
  -webkit-transition-timing-function: cubic-bezier(0.23, 0.635, 0.495, 1);
  -webkit-transition-timing-function: cubic-bezier(0.23, 0.635, 0.495, 2.4);
  -moz-transition-timing-function: cubic-bezier(0.23, 0.635, 0.495, 2.4);
  -ms-transition-timing-function: cubic-bezier(0.23, 0.635, 0.495, 2.4);
  -o-transition-timing-function: cubic-bezier(0.23, 0.635, 0.495, 2.4);
  transition-timing-function: cubic-bezier(0.23, 0.635, 0.495, 2.4);
}

.tooltipster-fall {
  top: 0;
  -webkit-transition-property: top;
  -moz-transition-property: top;
  -o-transition-property: top;
  -ms-transition-property: top;
  transition-property: top;
  -webkit-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  -webkit-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -moz-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -ms-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -o-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
}

.tooltipster-fall.tooltipster-dying {
  -webkit-transition-property: all;
  -moz-transition-property: all;
  -o-transition-property: all;
  -ms-transition-property: all;
  transition-property: all;
  top: 0px !important;
  opacity: 0;
}

.tooltipster-slide {
  left: -40px;
  -webkit-transition-property: left;
  -moz-transition-property: left;
  -o-transition-property: left;
  -ms-transition-property: left;
  transition-property: left;
  -webkit-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  -webkit-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -moz-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -ms-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  -o-transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
  transition-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1.15);
}

.tooltipster-slide.tooltipster-dying {
  -webkit-transition-property: all;
  -moz-transition-property: all;
  -o-transition-property: all;
  -ms-transition-property: all;
  transition-property: all;
  left: 0px !important;
  opacity: 0;
}

/* CSS transition for when contenting is changing in a tooltip that is still open. The only properties that will NOT transition are: width, height, top, and left */
.tooltipster-content-changing {
  opacity: 0.5;
  -webkit-transform: scale(1.1, 1.1);
  -moz-transform: scale(1.1, 1.1);
  -o-transform: scale(1.1, 1.1);
  -ms-transform: scale(1.1, 1.1);
  transform: scale(1.1, 1.1);
}

#tooltip {
  text-align: center;
  color: #fff;
  background: #12716d;
  position: absolute;
  z-index: 100;
  padding: 10px 15px 10px 15px;
  font-size: 10px;
  border-radius: 3px;
  line-height: 13px;
  font-size: 15px;
}

#tooltip:after {
  width: 0;
  height: 0;
  border-left: 7px solid transparent;
  border-right: 7px solid transparent;
  border-top: 7px solid #12716d;
  content: "";
  position: absolute;
  left: 50%;
  bottom: -6px;
  margin-left: -7px;
}

#tooltip.top:after {
  border-top-color: transparent;
  border-bottom: 7px solid #12716d;
  top: -20px;
  bottom: auto;
}

#tooltip.left:after {
  left: 7px;
  margin: 0;
}

#tooltip.right:after {
  right: 7px;
  left: auto;
  margin: 0;
}

*,
*:after,
*::before {
  -webkit-box-sizing: border-box;
  -moz-box-sizing: border-box;
  box-sizing: border-box;
}

.ac-custom {
  /*padding: 0 3em;*/
  /*max-width: 900px;*/
  /*margin: 0 auto;*/
}

.ac-custom h2 {
  font-size: 3em;
  font-weight: 300;
  padding: 0 0 0.5em;
  margin: 0 0 30px;
}

.ac-custom ul,
.ac-custom ol {
  list-style: none;
  padding: 0;
  margin: 0 auto;
  max-width: 800px;
}

.ac-custom li {
  margin: 0 auto;
  /*padding: 2em 0;*/
  position: relative;
}

.ac-custom label {
  display: inline-block;
  position: relative;
  /*font-size: 2em;*/
  padding: 0 0 0 30px;
  vertical-align: top;
  /*color: rgba(0,0,0,0.2);*/
  cursor: pointer;
  -webkit-transition: color 0.3s;
  transition: color 0.3s;
}

.ac-custom input[type=checkbox],
.ac-custom input[type=radio],
.ac-custom label::before {
  width: 18px;
  height: 18px;
  top: 50%;
  left: 0;
  margin-top: -9px;
  position: absolute;
  cursor: pointer;
}

.ac-custom input[type=checkbox],
.ac-custom input[type=radio] {
  opacity: 0;
  -webkit-appearance: none;
  display: inline-block;
  vertical-align: middle;
  z-index: 100;
}

.ac-custom label::before {
  content: "";
  border: 1px solid #e0e0e0;
  -webkit-transition: opacity 0.3s;
  transition: opacity 0.3s;
  border-radius: 3px;
}

.ac-radio label::before {
  border-radius: 50%;
}

.ac-custom input[type=checkbox]:checked + label,
.ac-custom input[type=radio]:checked + label {
  color: #0085d0;
}

.ac-custom input[type=checkbox]:checked + label::before,
.ac-custom input[type=radio]:checked + label::before {
  opacity: 0.8;
  border: 1px solid;
  border: none;
  background-color: #0085d0;
}

/* General SVG and path styles */
.ac-custom svg {
  position: absolute;
  width: 14px;
  height: 14px;
  top: 50%;
  margin-top: -7px;
  left: 2px;
  pointer-events: none;
}

.ac-custom svg path {
  stroke: #006ea9;
  stroke-width: 13px;
  stroke-linecap: round;
  stroke-linejoin: round;
  fill: none;
}

/* Specific input, SVG and path styles */
/* Circle */
.ac-circle input[type=checkbox],
.ac-circle input[type=radio],
.ac-circle label::before {
  width: 30px;
  height: 30px;
  margin-top: -14px;
  left: 10px;
  position: absolute;
}

.ac-circle label::before {
  background-color: #fff;
  border: none;
}

.ac-circle svg {
  width: 70px;
  height: 70px;
  margin-top: -35px;
  left: -10px;
}

.ac-circle svg path {
  stroke-width: 5px;
}

/* Box Fill */
.ac-boxfill svg path {
  stroke-width: 8px;
}

/* Swirl */
.ac-swirl svg path {
  stroke-width: 8px;
}

/* List */
.ac-list ol {
  list-style: decimal;
  list-style-position: inside;
}

.ac-list ol li {
  font-size: 2em;
  padding: 1em 1em 0 2em;
  text-indent: -14px;
}

.ac-list ol li label {
  font-size: 1em;
  text-indent: 0;
  padding-left: 30px;
}

.ac-list label::before {
  display: none;
}

.ac-list svg {
  width: 100%;
  height: 80px;
  left: 0;
  top: 1.2em;
  margin-top: 0px;
}

.ac-list svg path {
  stroke-width: 4px;
}

/* Media Queries */
@media screen and (max-width: 50em) {
  section {
    font-size: 80%;
  }
}
/*!
 * Datepicker for Bootstrap v1.6.4 (https://github.com/eternicode/bootstrap-datepicker)
 *
 * Copyright 2012 Stefan Petre
 * Improvements by Andrew Rowls
 * Licensed under the Apache License v2.0 (http://www.apache.org/licenses/LICENSE-2.0)
 */
.datepicker {
  border-radius: 4px;
  direction: ltr;
}

.datepicker-inline {
  width: 220px;
}

.datepicker.datepicker-rtl {
  direction: rtl;
}

.datepicker.datepicker-rtl table tr td span {
  float: right;
}

.datepicker-dropdown {
  top: 0;
  left: 0;
  padding: 4px;
}

.datepicker-dropdown:before {
  content: "";
  display: inline-block;
  border-left: 7px solid transparent;
  border-right: 7px solid transparent;
  border-bottom: 7px solid rgba(0, 0, 0, 0.15);
  border-top: 0;
  border-bottom-color: rgba(0, 0, 0, 0.2);
  position: absolute;
}

.datepicker-dropdown:after {
  content: "";
  display: inline-block;
  border-left: 6px solid transparent;
  border-right: 6px solid transparent;
  border-bottom: 6px solid #fff;
  border-top: 0;
  position: absolute;
}

.datepicker-dropdown.datepicker-orient-left:before {
  left: 6px;
}

.datepicker-dropdown.datepicker-orient-left:after {
  left: 7px;
}

.datepicker-dropdown.datepicker-orient-right:before {
  right: 6px;
}

.datepicker-dropdown.datepicker-orient-right:after {
  right: 7px;
}

.datepicker-dropdown.datepicker-orient-bottom:before {
  top: -7px;
}

.datepicker-dropdown.datepicker-orient-bottom:after {
  top: -6px;
}

.datepicker-dropdown.datepicker-orient-top:before {
  bottom: -7px;
  border-bottom: 0;
  border-top: 7px solid rgba(0, 0, 0, 0.15);
}

.datepicker-dropdown.datepicker-orient-top:after {
  bottom: -6px;
  border-bottom: 0;
  border-top: 6px solid #fff;
}

.datepicker table {
  margin: 0;
  -webkit-touch-callout: none;
  -webkit-user-select: none;
  -khtml-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
}

.datepicker table tr td,
.datepicker table tr th {
  text-align: center;
  width: 30px;
  height: 30px;
  border-radius: 4px;
  border: none;
}

.table-striped .datepicker table tr td, .cont-noticias .texto .datepicker table tr td,
.table-striped .datepicker table tr th,
.cont-noticias .texto .datepicker table tr th {
  background-color: transparent;
}

.datepicker table tr td.old,
.datepicker table tr td.new {
  color: #777777;
}

.datepicker table tr td.day:hover,
.datepicker table tr td.focused {
  background: #eeeeee;
  cursor: pointer;
}

.datepicker table tr td.disabled,
.datepicker table tr td.disabled:hover {
  background: none;
  color: #777777;
  cursor: default;
}

.datepicker table tr td.highlighted {
  color: #000;
  background-color: #d9edf7;
  border-color: #85c5e5;
  border-radius: 0;
}

.datepicker table tr td.highlighted:focus,
.datepicker table tr td.highlighted.focus {
  color: #000;
  background-color: #afd9ee;
  border-color: #298fc2;
}

.datepicker table tr td.highlighted:hover {
  color: #000;
  background-color: #afd9ee;
  border-color: #52addb;
}

.datepicker table tr td.highlighted:active,
.datepicker table tr td.highlighted.active {
  color: #000;
  background-color: #afd9ee;
  border-color: #52addb;
}

.datepicker table tr td.highlighted:active:hover,
.datepicker table tr td.highlighted.active:hover,
.datepicker table tr td.highlighted:active:focus,
.datepicker table tr td.highlighted.active:focus,
.datepicker table tr td.highlighted:active.focus,
.datepicker table tr td.highlighted.active.focus {
  color: #000;
  background-color: #91cbe8;
  border-color: #298fc2;
}

.datepicker table tr td.highlighted.disabled:hover,
.datepicker table tr td.highlighted[disabled]:hover,
fieldset[disabled] .datepicker table tr td.highlighted:hover,
.datepicker table tr td.highlighted.disabled:focus,
.datepicker table tr td.highlighted[disabled]:focus,
fieldset[disabled] .datepicker table tr td.highlighted:focus,
.datepicker table tr td.highlighted.disabled.focus,
.datepicker table tr td.highlighted[disabled].focus,
fieldset[disabled] .datepicker table tr td.highlighted.focus {
  background-color: #d9edf7;
  border-color: #85c5e5;
}

.datepicker table tr td.highlighted.focused {
  background: #afd9ee;
}

.datepicker table tr td.highlighted.disabled,
.datepicker table tr td.highlighted.disabled:active {
  background: #d9edf7;
  color: #777777;
}

.datepicker table tr td.today {
  color: #000;
  background-color: #ffdb99;
  border-color: #ffb733;
}

.datepicker table tr td.today:focus,
.datepicker table tr td.today.focus {
  color: #000;
  background-color: #ffc966;
  border-color: #b37400;
}

.datepicker table tr td.today:hover {
  color: #000;
  background-color: #ffc966;
  border-color: #f59e00;
}

.datepicker table tr td.today:active,
.datepicker table tr td.today.active {
  color: #000;
  background-color: #ffc966;
  border-color: #f59e00;
}

.datepicker table tr td.today:active:hover,
.datepicker table tr td.today.active:hover,
.datepicker table tr td.today:active:focus,
.datepicker table tr td.today.active:focus,
.datepicker table tr td.today:active.focus,
.datepicker table tr td.today.active.focus {
  color: #000;
  background-color: #ffbc42;
  border-color: #b37400;
}

.datepicker table tr td.today.disabled:hover,
.datepicker table tr td.today[disabled]:hover,
fieldset[disabled] .datepicker table tr td.today:hover,
.datepicker table tr td.today.disabled:focus,
.datepicker table tr td.today[disabled]:focus,
fieldset[disabled] .datepicker table tr td.today:focus,
.datepicker table tr td.today.disabled.focus,
.datepicker table tr td.today[disabled].focus,
fieldset[disabled] .datepicker table tr td.today.focus {
  background-color: #ffdb99;
  border-color: #ffb733;
}

.datepicker table tr td.today.focused {
  background: #ffc966;
}

.datepicker table tr td.today.disabled,
.datepicker table tr td.today.disabled:active {
  background: #ffdb99;
  color: #777777;
}

.datepicker table tr td.range {
  color: #000;
  background-color: #eeeeee;
  border-color: #bbbbbb;
  border-radius: 0;
}

.datepicker table tr td.range:focus,
.datepicker table tr td.range.focus {
  color: #000;
  background-color: #d5d5d5;
  border-color: #7c7c7c;
}

.datepicker table tr td.range:hover {
  color: #000;
  background-color: #d5d5d5;
  border-color: #9d9d9d;
}

.datepicker table tr td.range:active,
.datepicker table tr td.range.active {
  color: #000;
  background-color: #d5d5d5;
  border-color: #9d9d9d;
}

.datepicker table tr td.range:active:hover,
.datepicker table tr td.range.active:hover,
.datepicker table tr td.range:active:focus,
.datepicker table tr td.range.active:focus,
.datepicker table tr td.range:active.focus,
.datepicker table tr td.range.active.focus {
  color: #000;
  background-color: #c3c3c3;
  border-color: #7c7c7c;
}

.datepicker table tr td.range.disabled:hover,
.datepicker table tr td.range[disabled]:hover,
fieldset[disabled] .datepicker table tr td.range:hover,
.datepicker table tr td.range.disabled:focus,
.datepicker table tr td.range[disabled]:focus,
fieldset[disabled] .datepicker table tr td.range:focus,
.datepicker table tr td.range.disabled.focus,
.datepicker table tr td.range[disabled].focus,
fieldset[disabled] .datepicker table tr td.range.focus {
  background-color: #eeeeee;
  border-color: #bbbbbb;
}

.datepicker table tr td.range.focused {
  background: #d5d5d5;
}

.datepicker table tr td.range.disabled,
.datepicker table tr td.range.disabled:active {
  background: #eeeeee;
  color: #777777;
}

.datepicker table tr td.range.highlighted {
  color: #000;
  background-color: #e4eef3;
  border-color: #9dc1d3;
}

.datepicker table tr td.range.highlighted:focus,
.datepicker table tr td.range.highlighted.focus {
  color: #000;
  background-color: #c1d7e3;
  border-color: #4b88a6;
}

.datepicker table tr td.range.highlighted:hover {
  color: #000;
  background-color: #c1d7e3;
  border-color: #73a6c0;
}

.datepicker table tr td.range.highlighted:active,
.datepicker table tr td.range.highlighted.active {
  color: #000;
  background-color: #c1d7e3;
  border-color: #73a6c0;
}

.datepicker table tr td.range.highlighted:active:hover,
.datepicker table tr td.range.highlighted.active:hover,
.datepicker table tr td.range.highlighted:active:focus,
.datepicker table tr td.range.highlighted.active:focus,
.datepicker table tr td.range.highlighted:active.focus,
.datepicker table tr td.range.highlighted.active.focus {
  color: #000;
  background-color: #a8c8d8;
  border-color: #4b88a6;
}

.datepicker table tr td.range.highlighted.disabled:hover,
.datepicker table tr td.range.highlighted[disabled]:hover,
fieldset[disabled] .datepicker table tr td.range.highlighted:hover,
.datepicker table tr td.range.highlighted.disabled:focus,
.datepicker table tr td.range.highlighted[disabled]:focus,
fieldset[disabled] .datepicker table tr td.range.highlighted:focus,
.datepicker table tr td.range.highlighted.disabled.focus,
.datepicker table tr td.range.highlighted[disabled].focus,
fieldset[disabled] .datepicker table tr td.range.highlighted.focus {
  background-color: #e4eef3;
  border-color: #9dc1d3;
}

.datepicker table tr td.range.highlighted.focused {
  background: #c1d7e3;
}

.datepicker table tr td.range.highlighted.disabled,
.datepicker table tr td.range.highlighted.disabled:active {
  background: #e4eef3;
  color: #777777;
}

.datepicker table tr td.range.today {
  color: #000;
  background-color: #f7ca77;
  border-color: #f1a417;
}

.datepicker table tr td.range.today:focus,
.datepicker table tr td.range.today.focus {
  color: #000;
  background-color: #f4b747;
  border-color: #815608;
}

.datepicker table tr td.range.today:hover {
  color: #000;
  background-color: #f4b747;
  border-color: #bf800c;
}

.datepicker table tr td.range.today:active,
.datepicker table tr td.range.today.active {
  color: #000;
  background-color: #f4b747;
  border-color: #bf800c;
}

.datepicker table tr td.range.today:active:hover,
.datepicker table tr td.range.today.active:hover,
.datepicker table tr td.range.today:active:focus,
.datepicker table tr td.range.today.active:focus,
.datepicker table tr td.range.today:active.focus,
.datepicker table tr td.range.today.active.focus {
  color: #000;
  background-color: #f2aa25;
  border-color: #815608;
}

.datepicker table tr td.range.today.disabled:hover,
.datepicker table tr td.range.today[disabled]:hover,
fieldset[disabled] .datepicker table tr td.range.today:hover,
.datepicker table tr td.range.today.disabled:focus,
.datepicker table tr td.range.today[disabled]:focus,
fieldset[disabled] .datepicker table tr td.range.today:focus,
.datepicker table tr td.range.today.disabled.focus,
.datepicker table tr td.range.today[disabled].focus,
fieldset[disabled] .datepicker table tr td.range.today.focus {
  background-color: #f7ca77;
  border-color: #f1a417;
}

.datepicker table tr td.range.today.disabled,
.datepicker table tr td.range.today.disabled:active {
  background: #f7ca77;
  color: #777777;
}

.datepicker table tr td.selected,
.datepicker table tr td.selected.highlighted {
  color: #fff;
  background-color: #777777;
  border-color: #555555;
  text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
}

.datepicker table tr td.selected:focus,
.datepicker table tr td.selected.highlighted:focus,
.datepicker table tr td.selected.focus,
.datepicker table tr td.selected.highlighted.focus {
  color: #fff;
  background-color: #5e5e5e;
  border-color: #161616;
}

.datepicker table tr td.selected:hover,
.datepicker table tr td.selected.highlighted:hover {
  color: #fff;
  background-color: #5e5e5e;
  border-color: #373737;
}

.datepicker table tr td.selected:active,
.datepicker table tr td.selected.highlighted:active,
.datepicker table tr td.selected.active,
.datepicker table tr td.selected.highlighted.active {
  color: #fff;
  background-color: #5e5e5e;
  border-color: #373737;
}

.datepicker table tr td.selected:active:hover,
.datepicker table tr td.selected.highlighted:active:hover,
.datepicker table tr td.selected.active:hover,
.datepicker table tr td.selected.highlighted.active:hover,
.datepicker table tr td.selected:active:focus,
.datepicker table tr td.selected.highlighted:active:focus,
.datepicker table tr td.selected.active:focus,
.datepicker table tr td.selected.highlighted.active:focus,
.datepicker table tr td.selected:active.focus,
.datepicker table tr td.selected.highlighted:active.focus,
.datepicker table tr td.selected.active.focus,
.datepicker table tr td.selected.highlighted.active.focus {
  color: #fff;
  background-color: #4c4c4c;
  border-color: #161616;
}

.datepicker table tr td.selected.disabled:hover,
.datepicker table tr td.selected.highlighted.disabled:hover,
.datepicker table tr td.selected[disabled]:hover,
.datepicker table tr td.selected.highlighted[disabled]:hover,
fieldset[disabled] .datepicker table tr td.selected:hover,
fieldset[disabled] .datepicker table tr td.selected.highlighted:hover,
.datepicker table tr td.selected.disabled:focus,
.datepicker table tr td.selected.highlighted.disabled:focus,
.datepicker table tr td.selected[disabled]:focus,
.datepicker table tr td.selected.highlighted[disabled]:focus,
fieldset[disabled] .datepicker table tr td.selected:focus,
fieldset[disabled] .datepicker table tr td.selected.highlighted:focus,
.datepicker table tr td.selected.disabled.focus,
.datepicker table tr td.selected.highlighted.disabled.focus,
.datepicker table tr td.selected[disabled].focus,
.datepicker table tr td.selected.highlighted[disabled].focus,
fieldset[disabled] .datepicker table tr td.selected.focus,
fieldset[disabled] .datepicker table tr td.selected.highlighted.focus {
  background-color: #777777;
  border-color: #555555;
}

.datepicker table tr td.active,
.datepicker table tr td.active.highlighted {
  color: #fff;
  background-color: #337ab7;
  border-color: #2e6da4;
  text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
}

.datepicker table tr td.active:focus,
.datepicker table tr td.active.highlighted:focus,
.datepicker table tr td.active.focus,
.datepicker table tr td.active.highlighted.focus {
  color: #fff;
  background-color: #286090;
  border-color: #122b40;
}

.datepicker table tr td.active:hover,
.datepicker table tr td.active.highlighted:hover {
  color: #fff;
  background-color: #286090;
  border-color: #204d74;
}

.datepicker table tr td.active:active,
.datepicker table tr td.active.highlighted:active,
.datepicker table tr td.active.active,
.datepicker table tr td.active.highlighted.active {
  color: #fff;
  background-color: #286090;
  border-color: #204d74;
}

.datepicker table tr td.active:active:hover,
.datepicker table tr td.active.highlighted:active:hover,
.datepicker table tr td.active.active:hover,
.datepicker table tr td.active.highlighted.active:hover,
.datepicker table tr td.active:active:focus,
.datepicker table tr td.active.highlighted:active:focus,
.datepicker table tr td.active.active:focus,
.datepicker table tr td.active.highlighted.active:focus,
.datepicker table tr td.active:active.focus,
.datepicker table tr td.active.highlighted:active.focus,
.datepicker table tr td.active.active.focus,
.datepicker table tr td.active.highlighted.active.focus {
  color: #fff;
  background-color: #204d74;
  border-color: #122b40;
}

.datepicker table tr td.active.disabled:hover,
.datepicker table tr td.active.highlighted.disabled:hover,
.datepicker table tr td.active[disabled]:hover,
.datepicker table tr td.active.highlighted[disabled]:hover,
fieldset[disabled] .datepicker table tr td.active:hover,
fieldset[disabled] .datepicker table tr td.active.highlighted:hover,
.datepicker table tr td.active.disabled:focus,
.datepicker table tr td.active.highlighted.disabled:focus,
.datepicker table tr td.active[disabled]:focus,
.datepicker table tr td.active.highlighted[disabled]:focus,
fieldset[disabled] .datepicker table tr td.active:focus,
fieldset[disabled] .datepicker table tr td.active.highlighted:focus,
.datepicker table tr td.active.disabled.focus,
.datepicker table tr td.active.highlighted.disabled.focus,
.datepicker table tr td.active[disabled].focus,
.datepicker table tr td.active.highlighted[disabled].focus,
fieldset[disabled] .datepicker table tr td.active.focus,
fieldset[disabled] .datepicker table tr td.active.highlighted.focus {
  background-color: #337ab7;
  border-color: #2e6da4;
}

.datepicker table tr td span {
  display: block;
  width: 23%;
  height: 54px;
  line-height: 54px;
  float: left;
  margin: 1%;
  cursor: pointer;
  border-radius: 4px;
}

.datepicker table tr td span:hover,
.datepicker table tr td span.focused {
  background: #eeeeee;
}

.datepicker table tr td span.disabled,
.datepicker table tr td span.disabled:hover {
  background: none;
  color: #777777;
  cursor: default;
}

.datepicker table tr td span.active,
.datepicker table tr td span.active:hover,
.datepicker table tr td span.active.disabled,
.datepicker table tr td span.active.disabled:hover {
  color: #fff;
  background-color: #337ab7;
  border-color: #2e6da4;
  text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
}

.datepicker table tr td span.active:focus,
.datepicker table tr td span.active:hover:focus,
.datepicker table tr td span.active.disabled:focus,
.datepicker table tr td span.active.disabled:hover:focus,
.datepicker table tr td span.active.focus,
.datepicker table tr td span.active:hover.focus,
.datepicker table tr td span.active.disabled.focus,
.datepicker table tr td span.active.disabled:hover.focus {
  color: #fff;
  background-color: #286090;
  border-color: #122b40;
}

.datepicker table tr td span.active:hover,
.datepicker table tr td span.active:hover:hover,
.datepicker table tr td span.active.disabled:hover,
.datepicker table tr td span.active.disabled:hover:hover {
  color: #fff;
  background-color: #286090;
  border-color: #204d74;
}

.datepicker table tr td span.active:active,
.datepicker table tr td span.active:hover:active,
.datepicker table tr td span.active.disabled:active,
.datepicker table tr td span.active.disabled:hover:active,
.datepicker table tr td span.active.active,
.datepicker table tr td span.active:hover.active,
.datepicker table tr td span.active.disabled.active,
.datepicker table tr td span.active.disabled:hover.active {
  color: #fff;
  background-color: #286090;
  border-color: #204d74;
}

.datepicker table tr td span.active:active:hover,
.datepicker table tr td span.active:hover:active:hover,
.datepicker table tr td span.active.disabled:active:hover,
.datepicker table tr td span.active.disabled:hover:active:hover,
.datepicker table tr td span.active.active:hover,
.datepicker table tr td span.active:hover.active:hover,
.datepicker table tr td span.active.disabled.active:hover,
.datepicker table tr td span.active.disabled:hover.active:hover,
.datepicker table tr td span.active:active:focus,
.datepicker table tr td span.active:hover:active:focus,
.datepicker table tr td span.active.disabled:active:focus,
.datepicker table tr td span.active.disabled:hover:active:focus,
.datepicker table tr td span.active.active:focus,
.datepicker table tr td span.active:hover.active:focus,
.datepicker table tr td span.active.disabled.active:focus,
.datepicker table tr td span.active.disabled:hover.active:focus,
.datepicker table tr td span.active:active.focus,
.datepicker table tr td span.active:hover:active.focus,
.datepicker table tr td span.active.disabled:active.focus,
.datepicker table tr td span.active.disabled:hover:active.focus,
.datepicker table tr td span.active.active.focus,
.datepicker table tr td span.active:hover.active.focus,
.datepicker table tr td span.active.disabled.active.focus,
.datepicker table tr td span.active.disabled:hover.active.focus {
  color: #fff;
  background-color: #204d74;
  border-color: #122b40;
}

.datepicker table tr td span.active.disabled:hover,
.datepicker table tr td span.active:hover.disabled:hover,
.datepicker table tr td span.active.disabled.disabled:hover,
.datepicker table tr td span.active.disabled:hover.disabled:hover,
.datepicker table tr td span.active[disabled]:hover,
.datepicker table tr td span.active:hover[disabled]:hover,
.datepicker table tr td span.active.disabled[disabled]:hover,
.datepicker table tr td span.active.disabled:hover[disabled]:hover,
fieldset[disabled] .datepicker table tr td span.active:hover,
fieldset[disabled] .datepicker table tr td span.active:hover:hover,
fieldset[disabled] .datepicker table tr td span.active.disabled:hover,
fieldset[disabled] .datepicker table tr td span.active.disabled:hover:hover,
.datepicker table tr td span.active.disabled:focus,
.datepicker table tr td span.active:hover.disabled:focus,
.datepicker table tr td span.active.disabled.disabled:focus,
.datepicker table tr td span.active.disabled:hover.disabled:focus,
.datepicker table tr td span.active[disabled]:focus,
.datepicker table tr td span.active:hover[disabled]:focus,
.datepicker table tr td span.active.disabled[disabled]:focus,
.datepicker table tr td span.active.disabled:hover[disabled]:focus,
fieldset[disabled] .datepicker table tr td span.active:focus,
fieldset[disabled] .datepicker table tr td span.active:hover:focus,
fieldset[disabled] .datepicker table tr td span.active.disabled:focus,
fieldset[disabled] .datepicker table tr td span.active.disabled:hover:focus,
.datepicker table tr td span.active.disabled.focus,
.datepicker table tr td span.active:hover.disabled.focus,
.datepicker table tr td span.active.disabled.disabled.focus,
.datepicker table tr td span.active.disabled:hover.disabled.focus,
.datepicker table tr td span.active[disabled].focus,
.datepicker table tr td span.active:hover[disabled].focus,
.datepicker table tr td span.active.disabled[disabled].focus,
.datepicker table tr td span.active.disabled:hover[disabled].focus,
fieldset[disabled] .datepicker table tr td span.active.focus,
fieldset[disabled] .datepicker table tr td span.active:hover.focus,
fieldset[disabled] .datepicker table tr td span.active.disabled.focus,
fieldset[disabled] .datepicker table tr td span.active.disabled:hover.focus {
  background-color: #337ab7;
  border-color: #2e6da4;
}

.datepicker table tr td span.old,
.datepicker table tr td span.new {
  color: #777777;
}

.datepicker .datepicker-switch {
  width: 145px;
}

.datepicker .datepicker-switch,
.datepicker .prev,
.datepicker .next,
.datepicker tfoot tr th {
  cursor: pointer;
}

.datepicker .datepicker-switch:hover,
.datepicker .prev:hover,
.datepicker .next:hover,
.datepicker tfoot tr th:hover {
  background: #eeeeee;
}

.datepicker .cw {
  font-size: 10px;
  width: 12px;
  padding: 0 2px 0 5px;
  vertical-align: middle;
}

.input-group.date .input-group-addon {
  cursor: pointer;
}

.input-daterange {
  width: 100%;
}

.input-daterange input {
  text-align: center;
}

.input-daterange input:first-child {
  border-radius: 3px 0 0 3px;
}

.input-daterange input:last-child {
  border-radius: 0 3px 3px 0;
}

.input-daterange .input-group-addon {
  width: auto;
  min-width: 16px;
  padding: 4px 5px;
  line-height: 1.42857143;
  text-shadow: 0 1px 0 #fff;
  border-width: 1px 0;
  margin-left: -5px;
  margin-right: -5px;
}

.datepicker.dropdown-menu {
  position: absolute;
  top: 100%;
  left: 0;
  z-index: 1000;
  display: none;
  float: left;
  min-width: 160px;
  list-style: none;
  background-color: #fff;
  border: 1px solid #ccc;
  border: 1px solid rgba(0, 0, 0, 0.15);
  border-radius: 4px;
  -webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175);
  -moz-box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175);
  box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175);
  -webkit-background-clip: padding-box;
  -moz-background-clip: padding;
  background-clip: padding-box;
  color: #333333;
  font-size: 13px;
  line-height: 1.42857143;
}

.datepicker.dropdown-menu th,
.datepicker.datepicker-inline th,
.datepicker.dropdown-menu td,
.datepicker.datepicker-inline td {
  padding: 0px 5px;
}

/*# sourceMappingURL=bootstrap-datepicker3.standalone.css.map */
/*!
 * animate.css -http://daneden.me/animate
 * Version - 3.5.1
 * Licensed under the MIT license - http://opensource.org/licenses/MIT
 *
 * Copyright (c) 2016 Daniel Eden
 */
.animated, .jugador figure aside, .autoridad figure aside {
  -webkit-animation-duration: 1s;
  animation-duration: 1s;
  -webkit-animation-fill-mode: both;
  animation-fill-mode: both;
}

.animated.infinite, .jugador figure aside.infinite, .autoridad figure aside.infinite {
  -webkit-animation-iteration-count: infinite;
  animation-iteration-count: infinite;
}

.animated.hinge, .jugador figure aside.hinge, .autoridad figure aside.hinge {
  -webkit-animation-duration: 2s;
  animation-duration: 2s;
}

.animated.bounceIn, .jugador figure aside.bounceIn, .autoridad figure aside.bounceIn, .animated.bounceOut, .jugador figure aside.bounceOut, .autoridad figure aside.bounceOut, .animated.flipOutX, .jugador figure aside.flipOutX, .autoridad figure aside.flipOutX, .animated.flipOutY, .jugador figure aside.flipOutY, .autoridad figure aside.flipOutY {
  -webkit-animation-duration: 0.75s;
  animation-duration: 0.75s;
}

@-webkit-keyframes bounce {
  0%, 20%, 53%, 80%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  40%, 43% {
    -webkit-transform: translate3d(0, -30px, 0);
    transform: translate3d(0, -30px, 0);
  }
  40%, 43%, 70% {
    -webkit-animation-timing-function: cubic-bezier(0.755, 0.05, 0.855, 0.06);
    animation-timing-function: cubic-bezier(0.755, 0.05, 0.855, 0.06);
  }
  70% {
    -webkit-transform: translate3d(0, -15px, 0);
    transform: translate3d(0, -15px, 0);
  }
  90% {
    -webkit-transform: translate3d(0, -4px, 0);
    transform: translate3d(0, -4px, 0);
  }
}
@keyframes bounce {
  0%, 20%, 53%, 80%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  40%, 43% {
    -webkit-transform: translate3d(0, -30px, 0);
    transform: translate3d(0, -30px, 0);
  }
  40%, 43%, 70% {
    -webkit-animation-timing-function: cubic-bezier(0.755, 0.05, 0.855, 0.06);
    animation-timing-function: cubic-bezier(0.755, 0.05, 0.855, 0.06);
  }
  70% {
    -webkit-transform: translate3d(0, -15px, 0);
    transform: translate3d(0, -15px, 0);
  }
  90% {
    -webkit-transform: translate3d(0, -4px, 0);
    transform: translate3d(0, -4px, 0);
  }
}
.bounce {
  -webkit-animation-name: bounce;
  animation-name: bounce;
  -webkit-transform-origin: center bottom;
  transform-origin: center bottom;
}

@-webkit-keyframes flash {
  0%, 50%, to {
    opacity: 1;
  }
  25%, 75% {
    opacity: 0;
  }
}
@keyframes flash {
  0%, 50%, to {
    opacity: 1;
  }
  25%, 75% {
    opacity: 0;
  }
}
.flash {
  -webkit-animation-name: flash;
  animation-name: flash;
}

@-webkit-keyframes pulse {
  0% {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
  50% {
    -webkit-transform: scale3d(1.05, 1.05, 1.05);
    transform: scale3d(1.05, 1.05, 1.05);
  }
  to {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
@keyframes pulse {
  0% {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
  50% {
    -webkit-transform: scale3d(1.05, 1.05, 1.05);
    transform: scale3d(1.05, 1.05, 1.05);
  }
  to {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
.pulse {
  -webkit-animation-name: pulse;
  animation-name: pulse;
}

@-webkit-keyframes rubberBand {
  0% {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
  30% {
    -webkit-transform: scale3d(1.25, 0.75, 1);
    transform: scale3d(1.25, 0.75, 1);
  }
  40% {
    -webkit-transform: scale3d(0.75, 1.25, 1);
    transform: scale3d(0.75, 1.25, 1);
  }
  50% {
    -webkit-transform: scale3d(1.15, 0.85, 1);
    transform: scale3d(1.15, 0.85, 1);
  }
  65% {
    -webkit-transform: scale3d(0.95, 1.05, 1);
    transform: scale3d(0.95, 1.05, 1);
  }
  75% {
    -webkit-transform: scale3d(1.05, 0.95, 1);
    transform: scale3d(1.05, 0.95, 1);
  }
  to {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
@keyframes rubberBand {
  0% {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
  30% {
    -webkit-transform: scale3d(1.25, 0.75, 1);
    transform: scale3d(1.25, 0.75, 1);
  }
  40% {
    -webkit-transform: scale3d(0.75, 1.25, 1);
    transform: scale3d(0.75, 1.25, 1);
  }
  50% {
    -webkit-transform: scale3d(1.15, 0.85, 1);
    transform: scale3d(1.15, 0.85, 1);
  }
  65% {
    -webkit-transform: scale3d(0.95, 1.05, 1);
    transform: scale3d(0.95, 1.05, 1);
  }
  75% {
    -webkit-transform: scale3d(1.05, 0.95, 1);
    transform: scale3d(1.05, 0.95, 1);
  }
  to {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
.rubberBand {
  -webkit-animation-name: rubberBand;
  animation-name: rubberBand;
}

@-webkit-keyframes shake {
  0%, to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  10%, 30%, 50%, 70%, 90% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }
  20%, 40%, 60%, 80% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }
}
@keyframes shake {
  0%, to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  10%, 30%, 50%, 70%, 90% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }
  20%, 40%, 60%, 80% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }
}
.shake {
  -webkit-animation-name: shake;
  animation-name: shake;
}

@-webkit-keyframes headShake {
  0% {
    -webkit-transform: translateX(0);
    transform: translateX(0);
  }
  6.5% {
    -webkit-transform: translateX(-6px) rotateY(-9deg);
    transform: translateX(-6px) rotateY(-9deg);
  }
  18.5% {
    -webkit-transform: translateX(5px) rotateY(7deg);
    transform: translateX(5px) rotateY(7deg);
  }
  31.5% {
    -webkit-transform: translateX(-3px) rotateY(-5deg);
    transform: translateX(-3px) rotateY(-5deg);
  }
  43.5% {
    -webkit-transform: translateX(2px) rotateY(3deg);
    transform: translateX(2px) rotateY(3deg);
  }
  50% {
    -webkit-transform: translateX(0);
    transform: translateX(0);
  }
}
@keyframes headShake {
  0% {
    -webkit-transform: translateX(0);
    transform: translateX(0);
  }
  6.5% {
    -webkit-transform: translateX(-6px) rotateY(-9deg);
    transform: translateX(-6px) rotateY(-9deg);
  }
  18.5% {
    -webkit-transform: translateX(5px) rotateY(7deg);
    transform: translateX(5px) rotateY(7deg);
  }
  31.5% {
    -webkit-transform: translateX(-3px) rotateY(-5deg);
    transform: translateX(-3px) rotateY(-5deg);
  }
  43.5% {
    -webkit-transform: translateX(2px) rotateY(3deg);
    transform: translateX(2px) rotateY(3deg);
  }
  50% {
    -webkit-transform: translateX(0);
    transform: translateX(0);
  }
}
.headShake {
  -webkit-animation-timing-function: ease-in-out;
  animation-timing-function: ease-in-out;
  -webkit-animation-name: headShake;
  animation-name: headShake;
}

@-webkit-keyframes swing {
  20% {
    -webkit-transform: rotate(15deg);
    transform: rotate(15deg);
  }
  40% {
    -webkit-transform: rotate(-10deg);
    transform: rotate(-10deg);
  }
  60% {
    -webkit-transform: rotate(5deg);
    transform: rotate(5deg);
  }
  80% {
    -webkit-transform: rotate(-5deg);
    transform: rotate(-5deg);
  }
  to {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg);
  }
}
@keyframes swing {
  20% {
    -webkit-transform: rotate(15deg);
    transform: rotate(15deg);
  }
  40% {
    -webkit-transform: rotate(-10deg);
    transform: rotate(-10deg);
  }
  60% {
    -webkit-transform: rotate(5deg);
    transform: rotate(5deg);
  }
  80% {
    -webkit-transform: rotate(-5deg);
    transform: rotate(-5deg);
  }
  to {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg);
  }
}
.swing {
  -webkit-transform-origin: top center;
  transform-origin: top center;
  -webkit-animation-name: swing;
  animation-name: swing;
}

@-webkit-keyframes tada {
  0% {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
  10%, 20% {
    -webkit-transform: scale3d(0.9, 0.9, 0.9) rotate(-3deg);
    transform: scale3d(0.9, 0.9, 0.9) rotate(-3deg);
  }
  30%, 50%, 70%, 90% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate(3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate(3deg);
  }
  40%, 60%, 80% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate(-3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate(-3deg);
  }
  to {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
@keyframes tada {
  0% {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
  10%, 20% {
    -webkit-transform: scale3d(0.9, 0.9, 0.9) rotate(-3deg);
    transform: scale3d(0.9, 0.9, 0.9) rotate(-3deg);
  }
  30%, 50%, 70%, 90% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate(3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate(3deg);
  }
  40%, 60%, 80% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate(-3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate(-3deg);
  }
  to {
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
.tada {
  -webkit-animation-name: tada;
  animation-name: tada;
}

@-webkit-keyframes wobble {
  0% {
    -webkit-transform: none;
    transform: none;
  }
  15% {
    -webkit-transform: translate3d(-25%, 0, 0) rotate(-5deg);
    transform: translate3d(-25%, 0, 0) rotate(-5deg);
  }
  30% {
    -webkit-transform: translate3d(20%, 0, 0) rotate(3deg);
    transform: translate3d(20%, 0, 0) rotate(3deg);
  }
  45% {
    -webkit-transform: translate3d(-15%, 0, 0) rotate(-3deg);
    transform: translate3d(-15%, 0, 0) rotate(-3deg);
  }
  60% {
    -webkit-transform: translate3d(10%, 0, 0) rotate(2deg);
    transform: translate3d(10%, 0, 0) rotate(2deg);
  }
  75% {
    -webkit-transform: translate3d(-5%, 0, 0) rotate(-1deg);
    transform: translate3d(-5%, 0, 0) rotate(-1deg);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes wobble {
  0% {
    -webkit-transform: none;
    transform: none;
  }
  15% {
    -webkit-transform: translate3d(-25%, 0, 0) rotate(-5deg);
    transform: translate3d(-25%, 0, 0) rotate(-5deg);
  }
  30% {
    -webkit-transform: translate3d(20%, 0, 0) rotate(3deg);
    transform: translate3d(20%, 0, 0) rotate(3deg);
  }
  45% {
    -webkit-transform: translate3d(-15%, 0, 0) rotate(-3deg);
    transform: translate3d(-15%, 0, 0) rotate(-3deg);
  }
  60% {
    -webkit-transform: translate3d(10%, 0, 0) rotate(2deg);
    transform: translate3d(10%, 0, 0) rotate(2deg);
  }
  75% {
    -webkit-transform: translate3d(-5%, 0, 0) rotate(-1deg);
    transform: translate3d(-5%, 0, 0) rotate(-1deg);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
.wobble {
  -webkit-animation-name: wobble;
  animation-name: wobble;
}

@-webkit-keyframes jello {
  0%, 11.1%, to {
    -webkit-transform: none;
    transform: none;
  }
  22.2% {
    -webkit-transform: skewX(-12.5deg) skewY(-12.5deg);
    transform: skewX(-12.5deg) skewY(-12.5deg);
  }
  33.3% {
    -webkit-transform: skewX(6.25deg) skewY(6.25deg);
    transform: skewX(6.25deg) skewY(6.25deg);
  }
  44.4% {
    -webkit-transform: skewX(-3.125deg) skewY(-3.125deg);
    transform: skewX(-3.125deg) skewY(-3.125deg);
  }
  55.5% {
    -webkit-transform: skewX(1.5625deg) skewY(1.5625deg);
    transform: skewX(1.5625deg) skewY(1.5625deg);
  }
  66.6% {
    -webkit-transform: skewX(-0.78125deg) skewY(-0.78125deg);
    transform: skewX(-0.78125deg) skewY(-0.78125deg);
  }
  77.7% {
    -webkit-transform: skewX(0.390625deg) skewY(0.390625deg);
    transform: skewX(0.390625deg) skewY(0.390625deg);
  }
  88.8% {
    -webkit-transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
    transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
  }
}
@keyframes jello {
  0%, 11.1%, to {
    -webkit-transform: none;
    transform: none;
  }
  22.2% {
    -webkit-transform: skewX(-12.5deg) skewY(-12.5deg);
    transform: skewX(-12.5deg) skewY(-12.5deg);
  }
  33.3% {
    -webkit-transform: skewX(6.25deg) skewY(6.25deg);
    transform: skewX(6.25deg) skewY(6.25deg);
  }
  44.4% {
    -webkit-transform: skewX(-3.125deg) skewY(-3.125deg);
    transform: skewX(-3.125deg) skewY(-3.125deg);
  }
  55.5% {
    -webkit-transform: skewX(1.5625deg) skewY(1.5625deg);
    transform: skewX(1.5625deg) skewY(1.5625deg);
  }
  66.6% {
    -webkit-transform: skewX(-0.78125deg) skewY(-0.78125deg);
    transform: skewX(-0.78125deg) skewY(-0.78125deg);
  }
  77.7% {
    -webkit-transform: skewX(0.390625deg) skewY(0.390625deg);
    transform: skewX(0.390625deg) skewY(0.390625deg);
  }
  88.8% {
    -webkit-transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
    transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
  }
}
.jello {
  -webkit-animation-name: jello;
  animation-name: jello;
  -webkit-transform-origin: center;
  transform-origin: center;
}

@-webkit-keyframes bounceIn {
  0%, 20%, 40%, 60%, 80%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
  20% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }
  40% {
    -webkit-transform: scale3d(0.9, 0.9, 0.9);
    transform: scale3d(0.9, 0.9, 0.9);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(1.03, 1.03, 1.03);
    transform: scale3d(1.03, 1.03, 1.03);
  }
  80% {
    -webkit-transform: scale3d(0.97, 0.97, 0.97);
    transform: scale3d(0.97, 0.97, 0.97);
  }
  to {
    opacity: 1;
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
@keyframes bounceIn {
  0%, 20%, 40%, 60%, 80%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
  20% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }
  40% {
    -webkit-transform: scale3d(0.9, 0.9, 0.9);
    transform: scale3d(0.9, 0.9, 0.9);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(1.03, 1.03, 1.03);
    transform: scale3d(1.03, 1.03, 1.03);
  }
  80% {
    -webkit-transform: scale3d(0.97, 0.97, 0.97);
    transform: scale3d(0.97, 0.97, 0.97);
  }
  to {
    opacity: 1;
    -webkit-transform: scaleX(1);
    transform: scaleX(1);
  }
}
.bounceIn {
  -webkit-animation-name: bounceIn;
  animation-name: bounceIn;
}

@-webkit-keyframes bounceInDown {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -3000px, 0);
    transform: translate3d(0, -3000px, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, 25px, 0);
    transform: translate3d(0, 25px, 0);
  }
  75% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }
  90% {
    -webkit-transform: translate3d(0, 5px, 0);
    transform: translate3d(0, 5px, 0);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes bounceInDown {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -3000px, 0);
    transform: translate3d(0, -3000px, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, 25px, 0);
    transform: translate3d(0, 25px, 0);
  }
  75% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }
  90% {
    -webkit-transform: translate3d(0, 5px, 0);
    transform: translate3d(0, 5px, 0);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
.bounceInDown {
  -webkit-animation-name: bounceInDown;
  animation-name: bounceInDown;
}

@-webkit-keyframes bounceInLeft {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-3000px, 0, 0);
    transform: translate3d(-3000px, 0, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(25px, 0, 0);
    transform: translate3d(25px, 0, 0);
  }
  75% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }
  90% {
    -webkit-transform: translate3d(5px, 0, 0);
    transform: translate3d(5px, 0, 0);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes bounceInLeft {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-3000px, 0, 0);
    transform: translate3d(-3000px, 0, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(25px, 0, 0);
    transform: translate3d(25px, 0, 0);
  }
  75% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }
  90% {
    -webkit-transform: translate3d(5px, 0, 0);
    transform: translate3d(5px, 0, 0);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
.bounceInLeft {
  -webkit-animation-name: bounceInLeft;
  animation-name: bounceInLeft;
}

@-webkit-keyframes bounceInRight {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(3000px, 0, 0);
    transform: translate3d(3000px, 0, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(-25px, 0, 0);
    transform: translate3d(-25px, 0, 0);
  }
  75% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }
  90% {
    -webkit-transform: translate3d(-5px, 0, 0);
    transform: translate3d(-5px, 0, 0);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes bounceInRight {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(3000px, 0, 0);
    transform: translate3d(3000px, 0, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(-25px, 0, 0);
    transform: translate3d(-25px, 0, 0);
  }
  75% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }
  90% {
    -webkit-transform: translate3d(-5px, 0, 0);
    transform: translate3d(-5px, 0, 0);
  }
  to {
    -webkit-transform: none;
    transform: none;
  }
}
.bounceInRight {
  -webkit-animation-name: bounceInRight;
  animation-name: bounceInRight;
}

@-webkit-keyframes bounceInUp {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 3000px, 0);
    transform: translate3d(0, 3000px, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }
  75% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }
  90% {
    -webkit-transform: translate3d(0, -5px, 0);
    transform: translate3d(0, -5px, 0);
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
@keyframes bounceInUp {
  0%, 60%, 75%, 90%, to {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
    animation-timing-function: cubic-bezier(0.215, 0.61, 0.355, 1);
  }
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 3000px, 0);
    transform: translate3d(0, 3000px, 0);
  }
  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }
  75% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }
  90% {
    -webkit-transform: translate3d(0, -5px, 0);
    transform: translate3d(0, -5px, 0);
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
.bounceInUp {
  -webkit-animation-name: bounceInUp;
  animation-name: bounceInUp;
}

@-webkit-keyframes bounceOut {
  20% {
    -webkit-transform: scale3d(0.9, 0.9, 0.9);
    transform: scale3d(0.9, 0.9, 0.9);
  }
  50%, 55% {
    opacity: 1;
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }
  to {
    opacity: 0;
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
}
@keyframes bounceOut {
  20% {
    -webkit-transform: scale3d(0.9, 0.9, 0.9);
    transform: scale3d(0.9, 0.9, 0.9);
  }
  50%, 55% {
    opacity: 1;
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }
  to {
    opacity: 0;
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
}
.bounceOut {
  -webkit-animation-name: bounceOut;
  animation-name: bounceOut;
}

@-webkit-keyframes bounceOutDown {
  20% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }
  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}
@keyframes bounceOutDown {
  20% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }
  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}
.bounceOutDown {
  -webkit-animation-name: bounceOutDown;
  animation-name: bounceOutDown;
}

@-webkit-keyframes bounceOutLeft {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(20px, 0, 0);
    transform: translate3d(20px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}
@keyframes bounceOutLeft {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(20px, 0, 0);
    transform: translate3d(20px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}
.bounceOutLeft {
  -webkit-animation-name: bounceOutLeft;
  animation-name: bounceOutLeft;
}

@-webkit-keyframes bounceOutRight {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(-20px, 0, 0);
    transform: translate3d(-20px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}
@keyframes bounceOutRight {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(-20px, 0, 0);
    transform: translate3d(-20px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}
.bounceOutRight {
  -webkit-animation-name: bounceOutRight;
  animation-name: bounceOutRight;
}

@-webkit-keyframes bounceOutUp {
  20% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }
  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, 20px, 0);
    transform: translate3d(0, 20px, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}
@keyframes bounceOutUp {
  20% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }
  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, 20px, 0);
    transform: translate3d(0, 20px, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}
.bounceOutUp {
  -webkit-animation-name: bounceOutUp;
  animation-name: bounceOutUp;
}

@-webkit-keyframes fadeIn {
  0% {
    opacity: 0;
  }
  to {
    opacity: 1;
  }
}
@keyframes fadeIn {
  0% {
    opacity: 0;
  }
  to {
    opacity: 1;
  }
}
.fadeIn {
  -webkit-animation-name: fadeIn;
  animation-name: fadeIn;
}

@-webkit-keyframes fadeInDown {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInDown {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInDown {
  -webkit-animation-name: fadeInDown;
  animation-name: fadeInDown;
}

@-webkit-keyframes fadeInDownBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInDownBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInDownBig {
  -webkit-animation-name: fadeInDownBig;
  animation-name: fadeInDownBig;
}

@-webkit-keyframes fadeInLeft {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInLeft {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInLeft {
  -webkit-animation-name: fadeInLeft;
  animation-name: fadeInLeft;
}

@-webkit-keyframes fadeInLeftBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInLeftBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInLeftBig {
  -webkit-animation-name: fadeInLeftBig;
  animation-name: fadeInLeftBig;
}

@-webkit-keyframes fadeInRight {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInRight {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInRight {
  -webkit-animation-name: fadeInRight;
  animation-name: fadeInRight;
}

@-webkit-keyframes fadeInRightBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInRightBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInRightBig {
  -webkit-animation-name: fadeInRightBig;
  animation-name: fadeInRightBig;
}

@-webkit-keyframes fadeInUp {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInUp {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInUp {
  -webkit-animation-name: fadeInUp;
  animation-name: fadeInUp;
}

@-webkit-keyframes fadeInUpBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes fadeInUpBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.fadeInUpBig {
  -webkit-animation-name: fadeInUpBig;
  animation-name: fadeInUpBig;
}

@-webkit-keyframes fadeOut {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
  }
}
@keyframes fadeOut {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
  }
}
.fadeOut {
  -webkit-animation-name: fadeOut;
  animation-name: fadeOut;
}

@-webkit-keyframes fadeOutDown {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}
@keyframes fadeOutDown {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}
.fadeOutDown {
  -webkit-animation-name: fadeOutDown;
  animation-name: fadeOutDown;
}

@-webkit-keyframes fadeOutDownBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}
@keyframes fadeOutDownBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}
.fadeOutDownBig {
  -webkit-animation-name: fadeOutDownBig;
  animation-name: fadeOutDownBig;
}

@-webkit-keyframes fadeOutLeft {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}
@keyframes fadeOutLeft {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}
.fadeOutLeft {
  -webkit-animation-name: fadeOutLeft;
  animation-name: fadeOutLeft;
}

@-webkit-keyframes fadeOutLeftBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}
@keyframes fadeOutLeftBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}
.fadeOutLeftBig {
  -webkit-animation-name: fadeOutLeftBig;
  animation-name: fadeOutLeftBig;
}

@-webkit-keyframes fadeOutRight {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}
@keyframes fadeOutRight {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}
.fadeOutRight {
  -webkit-animation-name: fadeOutRight;
  animation-name: fadeOutRight;
}

@-webkit-keyframes fadeOutRightBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}
@keyframes fadeOutRightBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}
.fadeOutRightBig {
  -webkit-animation-name: fadeOutRightBig;
  animation-name: fadeOutRightBig;
}

@-webkit-keyframes fadeOutUp {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}
@keyframes fadeOutUp {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}
.fadeOutUp {
  -webkit-animation-name: fadeOutUp;
  animation-name: fadeOutUp;
}

@-webkit-keyframes fadeOutUpBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}
@keyframes fadeOutUpBig {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}
.fadeOutUpBig {
  -webkit-animation-name: fadeOutUpBig;
  animation-name: fadeOutUpBig;
}

@-webkit-keyframes flip {
  0% {
    -webkit-transform: perspective(400px) rotateY(-1turn);
    transform: perspective(400px) rotateY(-1turn);
  }
  0%, 40% {
    -webkit-animation-timing-function: ease-out;
    animation-timing-function: ease-out;
  }
  40% {
    -webkit-transform: perspective(400px) translateZ(150px) rotateY(-190deg);
    transform: perspective(400px) translateZ(150px) rotateY(-190deg);
  }
  50% {
    -webkit-transform: perspective(400px) translateZ(150px) rotateY(-170deg);
    transform: perspective(400px) translateZ(150px) rotateY(-170deg);
  }
  50%, 80% {
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
  80% {
    -webkit-transform: perspective(400px) scale3d(0.95, 0.95, 0.95);
    transform: perspective(400px) scale3d(0.95, 0.95, 0.95);
  }
  to {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
}
@keyframes flip {
  0% {
    -webkit-transform: perspective(400px) rotateY(-1turn);
    transform: perspective(400px) rotateY(-1turn);
  }
  0%, 40% {
    -webkit-animation-timing-function: ease-out;
    animation-timing-function: ease-out;
  }
  40% {
    -webkit-transform: perspective(400px) translateZ(150px) rotateY(-190deg);
    transform: perspective(400px) translateZ(150px) rotateY(-190deg);
  }
  50% {
    -webkit-transform: perspective(400px) translateZ(150px) rotateY(-170deg);
    transform: perspective(400px) translateZ(150px) rotateY(-170deg);
  }
  50%, 80% {
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
  80% {
    -webkit-transform: perspective(400px) scale3d(0.95, 0.95, 0.95);
    transform: perspective(400px) scale3d(0.95, 0.95, 0.95);
  }
  to {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
}
.animated.flip, .jugador figure aside.flip, .autoridad figure aside.flip {
  -webkit-backface-visibility: visible;
  backface-visibility: visible;
  -webkit-animation-name: flip;
  animation-name: flip;
}

@-webkit-keyframes flipInX {
  0% {
    -webkit-transform: perspective(400px) rotateX(90deg);
    transform: perspective(400px) rotateX(90deg);
    opacity: 0;
  }
  0%, 40% {
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
  40% {
    -webkit-transform: perspective(400px) rotateX(-20deg);
    transform: perspective(400px) rotateX(-20deg);
  }
  60% {
    -webkit-transform: perspective(400px) rotateX(10deg);
    transform: perspective(400px) rotateX(10deg);
    opacity: 1;
  }
  80% {
    -webkit-transform: perspective(400px) rotateX(-5deg);
    transform: perspective(400px) rotateX(-5deg);
  }
  to {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}
@keyframes flipInX {
  0% {
    -webkit-transform: perspective(400px) rotateX(90deg);
    transform: perspective(400px) rotateX(90deg);
    opacity: 0;
  }
  0%, 40% {
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
  40% {
    -webkit-transform: perspective(400px) rotateX(-20deg);
    transform: perspective(400px) rotateX(-20deg);
  }
  60% {
    -webkit-transform: perspective(400px) rotateX(10deg);
    transform: perspective(400px) rotateX(10deg);
    opacity: 1;
  }
  80% {
    -webkit-transform: perspective(400px) rotateX(-5deg);
    transform: perspective(400px) rotateX(-5deg);
  }
  to {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}
.flipInX {
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
  -webkit-animation-name: flipInX;
  animation-name: flipInX;
}

@-webkit-keyframes flipInY {
  0% {
    -webkit-transform: perspective(400px) rotateY(90deg);
    transform: perspective(400px) rotateY(90deg);
    opacity: 0;
  }
  0%, 40% {
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
  40% {
    -webkit-transform: perspective(400px) rotateY(-20deg);
    transform: perspective(400px) rotateY(-20deg);
  }
  60% {
    -webkit-transform: perspective(400px) rotateY(10deg);
    transform: perspective(400px) rotateY(10deg);
    opacity: 1;
  }
  80% {
    -webkit-transform: perspective(400px) rotateY(-5deg);
    transform: perspective(400px) rotateY(-5deg);
  }
  to {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}
@keyframes flipInY {
  0% {
    -webkit-transform: perspective(400px) rotateY(90deg);
    transform: perspective(400px) rotateY(90deg);
    opacity: 0;
  }
  0%, 40% {
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
  40% {
    -webkit-transform: perspective(400px) rotateY(-20deg);
    transform: perspective(400px) rotateY(-20deg);
  }
  60% {
    -webkit-transform: perspective(400px) rotateY(10deg);
    transform: perspective(400px) rotateY(10deg);
    opacity: 1;
  }
  80% {
    -webkit-transform: perspective(400px) rotateY(-5deg);
    transform: perspective(400px) rotateY(-5deg);
  }
  to {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}
.flipInY {
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
  -webkit-animation-name: flipInY;
  animation-name: flipInY;
}

@-webkit-keyframes flipOutX {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
  30% {
    -webkit-transform: perspective(400px) rotateX(-20deg);
    transform: perspective(400px) rotateX(-20deg);
    opacity: 1;
  }
  to {
    -webkit-transform: perspective(400px) rotateX(90deg);
    transform: perspective(400px) rotateX(90deg);
    opacity: 0;
  }
}
@keyframes flipOutX {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
  30% {
    -webkit-transform: perspective(400px) rotateX(-20deg);
    transform: perspective(400px) rotateX(-20deg);
    opacity: 1;
  }
  to {
    -webkit-transform: perspective(400px) rotateX(90deg);
    transform: perspective(400px) rotateX(90deg);
    opacity: 0;
  }
}
.flipOutX {
  -webkit-animation-name: flipOutX;
  animation-name: flipOutX;
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
}

@-webkit-keyframes flipOutY {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
  30% {
    -webkit-transform: perspective(400px) rotateY(-15deg);
    transform: perspective(400px) rotateY(-15deg);
    opacity: 1;
  }
  to {
    -webkit-transform: perspective(400px) rotateY(90deg);
    transform: perspective(400px) rotateY(90deg);
    opacity: 0;
  }
}
@keyframes flipOutY {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
  30% {
    -webkit-transform: perspective(400px) rotateY(-15deg);
    transform: perspective(400px) rotateY(-15deg);
    opacity: 1;
  }
  to {
    -webkit-transform: perspective(400px) rotateY(90deg);
    transform: perspective(400px) rotateY(90deg);
    opacity: 0;
  }
}
.flipOutY {
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
  -webkit-animation-name: flipOutY;
  animation-name: flipOutY;
}

@-webkit-keyframes lightSpeedIn {
  0% {
    -webkit-transform: translate3d(100%, 0, 0) skewX(-30deg);
    transform: translate3d(100%, 0, 0) skewX(-30deg);
    opacity: 0;
  }
  60% {
    -webkit-transform: skewX(20deg);
    transform: skewX(20deg);
  }
  60%, 80% {
    opacity: 1;
  }
  80% {
    -webkit-transform: skewX(-5deg);
    transform: skewX(-5deg);
  }
  to {
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
@keyframes lightSpeedIn {
  0% {
    -webkit-transform: translate3d(100%, 0, 0) skewX(-30deg);
    transform: translate3d(100%, 0, 0) skewX(-30deg);
    opacity: 0;
  }
  60% {
    -webkit-transform: skewX(20deg);
    transform: skewX(20deg);
  }
  60%, 80% {
    opacity: 1;
  }
  80% {
    -webkit-transform: skewX(-5deg);
    transform: skewX(-5deg);
  }
  to {
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
.lightSpeedIn {
  -webkit-animation-name: lightSpeedIn;
  animation-name: lightSpeedIn;
  -webkit-animation-timing-function: ease-out;
  animation-timing-function: ease-out;
}

@-webkit-keyframes lightSpeedOut {
  0% {
    opacity: 1;
  }
  to {
    -webkit-transform: translate3d(100%, 0, 0) skewX(30deg);
    transform: translate3d(100%, 0, 0) skewX(30deg);
    opacity: 0;
  }
}
@keyframes lightSpeedOut {
  0% {
    opacity: 1;
  }
  to {
    -webkit-transform: translate3d(100%, 0, 0) skewX(30deg);
    transform: translate3d(100%, 0, 0) skewX(30deg);
    opacity: 0;
  }
}
.lightSpeedOut {
  -webkit-animation-name: lightSpeedOut;
  animation-name: lightSpeedOut;
  -webkit-animation-timing-function: ease-in;
  animation-timing-function: ease-in;
}

@-webkit-keyframes rotateIn {
  0% {
    transform-origin: center;
    -webkit-transform: rotate(-200deg);
    transform: rotate(-200deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: center;
  }
  to {
    transform-origin: center;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
@keyframes rotateIn {
  0% {
    transform-origin: center;
    -webkit-transform: rotate(-200deg);
    transform: rotate(-200deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: center;
  }
  to {
    transform-origin: center;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
.rotateIn {
  -webkit-animation-name: rotateIn;
  animation-name: rotateIn;
}

@-webkit-keyframes rotateInDownLeft {
  0% {
    transform-origin: left bottom;
    -webkit-transform: rotate(-45deg);
    transform: rotate(-45deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
@keyframes rotateInDownLeft {
  0% {
    transform-origin: left bottom;
    -webkit-transform: rotate(-45deg);
    transform: rotate(-45deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
.rotateInDownLeft {
  -webkit-animation-name: rotateInDownLeft;
  animation-name: rotateInDownLeft;
}

@-webkit-keyframes rotateInDownRight {
  0% {
    transform-origin: right bottom;
    -webkit-transform: rotate(45deg);
    transform: rotate(45deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
@keyframes rotateInDownRight {
  0% {
    transform-origin: right bottom;
    -webkit-transform: rotate(45deg);
    transform: rotate(45deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
.rotateInDownRight {
  -webkit-animation-name: rotateInDownRight;
  animation-name: rotateInDownRight;
}

@-webkit-keyframes rotateInUpLeft {
  0% {
    transform-origin: left bottom;
    -webkit-transform: rotate(45deg);
    transform: rotate(45deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
@keyframes rotateInUpLeft {
  0% {
    transform-origin: left bottom;
    -webkit-transform: rotate(45deg);
    transform: rotate(45deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
.rotateInUpLeft {
  -webkit-animation-name: rotateInUpLeft;
  animation-name: rotateInUpLeft;
}

@-webkit-keyframes rotateInUpRight {
  0% {
    transform-origin: right bottom;
    -webkit-transform: rotate(-90deg);
    transform: rotate(-90deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
@keyframes rotateInUpRight {
  0% {
    transform-origin: right bottom;
    -webkit-transform: rotate(-90deg);
    transform: rotate(-90deg);
    opacity: 0;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}
.rotateInUpRight {
  -webkit-animation-name: rotateInUpRight;
  animation-name: rotateInUpRight;
}

@-webkit-keyframes rotateOut {
  0% {
    transform-origin: center;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: center;
  }
  to {
    transform-origin: center;
    -webkit-transform: rotate(200deg);
    transform: rotate(200deg);
    opacity: 0;
  }
}
@keyframes rotateOut {
  0% {
    transform-origin: center;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: center;
  }
  to {
    transform-origin: center;
    -webkit-transform: rotate(200deg);
    transform: rotate(200deg);
    opacity: 0;
  }
}
.rotateOut {
  -webkit-animation-name: rotateOut;
  animation-name: rotateOut;
}

@-webkit-keyframes rotateOutDownLeft {
  0% {
    transform-origin: left bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: rotate(45deg);
    transform: rotate(45deg);
    opacity: 0;
  }
}
@keyframes rotateOutDownLeft {
  0% {
    transform-origin: left bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: rotate(45deg);
    transform: rotate(45deg);
    opacity: 0;
  }
}
.rotateOutDownLeft {
  -webkit-animation-name: rotateOutDownLeft;
  animation-name: rotateOutDownLeft;
}

@-webkit-keyframes rotateOutDownRight {
  0% {
    transform-origin: right bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: rotate(-45deg);
    transform: rotate(-45deg);
    opacity: 0;
  }
}
@keyframes rotateOutDownRight {
  0% {
    transform-origin: right bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: rotate(-45deg);
    transform: rotate(-45deg);
    opacity: 0;
  }
}
.rotateOutDownRight {
  -webkit-animation-name: rotateOutDownRight;
  animation-name: rotateOutDownRight;
}

@-webkit-keyframes rotateOutUpLeft {
  0% {
    transform-origin: left bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: rotate(-45deg);
    transform: rotate(-45deg);
    opacity: 0;
  }
}
@keyframes rotateOutUpLeft {
  0% {
    transform-origin: left bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: left bottom;
  }
  to {
    transform-origin: left bottom;
    -webkit-transform: rotate(-45deg);
    transform: rotate(-45deg);
    opacity: 0;
  }
}
.rotateOutUpLeft {
  -webkit-animation-name: rotateOutUpLeft;
  animation-name: rotateOutUpLeft;
}

@-webkit-keyframes rotateOutUpRight {
  0% {
    transform-origin: right bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: rotate(90deg);
    transform: rotate(90deg);
    opacity: 0;
  }
}
@keyframes rotateOutUpRight {
  0% {
    transform-origin: right bottom;
    opacity: 1;
  }
  0%, to {
    -webkit-transform-origin: right bottom;
  }
  to {
    transform-origin: right bottom;
    -webkit-transform: rotate(90deg);
    transform: rotate(90deg);
    opacity: 0;
  }
}
.rotateOutUpRight {
  -webkit-animation-name: rotateOutUpRight;
  animation-name: rotateOutUpRight;
}

@-webkit-keyframes hinge {
  0% {
    transform-origin: top left;
  }
  0%, 20%, 60% {
    -webkit-transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
  }
  20%, 60% {
    -webkit-transform: rotate(80deg);
    transform: rotate(80deg);
    transform-origin: top left;
  }
  40%, 80% {
    -webkit-transform: rotate(60deg);
    transform: rotate(60deg);
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
    opacity: 1;
  }
  to {
    -webkit-transform: translate3d(0, 700px, 0);
    transform: translate3d(0, 700px, 0);
    opacity: 0;
  }
}
@keyframes hinge {
  0% {
    transform-origin: top left;
  }
  0%, 20%, 60% {
    -webkit-transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
  }
  20%, 60% {
    -webkit-transform: rotate(80deg);
    transform: rotate(80deg);
    transform-origin: top left;
  }
  40%, 80% {
    -webkit-transform: rotate(60deg);
    transform: rotate(60deg);
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
    opacity: 1;
  }
  to {
    -webkit-transform: translate3d(0, 700px, 0);
    transform: translate3d(0, 700px, 0);
    opacity: 0;
  }
}
.hinge {
  -webkit-animation-name: hinge;
  animation-name: hinge;
}

@-webkit-keyframes rollIn {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0) rotate(-120deg);
    transform: translate3d(-100%, 0, 0) rotate(-120deg);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
@keyframes rollIn {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0) rotate(-120deg);
    transform: translate3d(-100%, 0, 0) rotate(-120deg);
  }
  to {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}
.rollIn {
  -webkit-animation-name: rollIn;
  animation-name: rollIn;
}

@-webkit-keyframes rollOut {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0) rotate(120deg);
    transform: translate3d(100%, 0, 0) rotate(120deg);
  }
}
@keyframes rollOut {
  0% {
    opacity: 1;
  }
  to {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0) rotate(120deg);
    transform: translate3d(100%, 0, 0) rotate(120deg);
  }
}
.rollOut {
  -webkit-animation-name: rollOut;
  animation-name: rollOut;
}

@-webkit-keyframes zoomIn {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
  50% {
    opacity: 1;
  }
}
@keyframes zoomIn {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
  50% {
    opacity: 1;
  }
}
.zoomIn {
  -webkit-animation-name: zoomIn;
  animation-name: zoomIn;
}

@-webkit-keyframes zoomInDown {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -1000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
@keyframes zoomInDown {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -1000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
.zoomInDown {
  -webkit-animation-name: zoomInDown;
  animation-name: zoomInDown;
}

@-webkit-keyframes zoomInLeft {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(-1000px, 0, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(-1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(10px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
@keyframes zoomInLeft {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(-1000px, 0, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(-1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(10px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
.zoomInLeft {
  -webkit-animation-name: zoomInLeft;
  animation-name: zoomInLeft;
}

@-webkit-keyframes zoomInRight {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(1000px, 0, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(-10px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(-10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
@keyframes zoomInRight {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(1000px, 0, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(-10px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(-10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
.zoomInRight {
  -webkit-animation-name: zoomInRight;
  animation-name: zoomInRight;
}

@-webkit-keyframes zoomInUp {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 1000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
@keyframes zoomInUp {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 1000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  60% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
.zoomInUp {
  -webkit-animation-name: zoomInUp;
  animation-name: zoomInUp;
}

@-webkit-keyframes zoomOut {
  0% {
    opacity: 1;
  }
  50% {
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
  50%, to {
    opacity: 0;
  }
}
@keyframes zoomOut {
  0% {
    opacity: 1;
  }
  50% {
    -webkit-transform: scale3d(0.3, 0.3, 0.3);
    transform: scale3d(0.3, 0.3, 0.3);
  }
  50%, to {
    opacity: 0;
  }
}
.zoomOut {
  -webkit-animation-name: zoomOut;
  animation-name: zoomOut;
}

@-webkit-keyframes zoomOutDown {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  to {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 2000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
@keyframes zoomOutDown {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  to {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 2000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, 2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
.zoomOutDown {
  -webkit-animation-name: zoomOutDown;
  animation-name: zoomOutDown;
}

@-webkit-keyframes zoomOutLeft {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(42px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(42px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: scale(0.1) translate3d(-2000px, 0, 0);
    transform: scale(0.1) translate3d(-2000px, 0, 0);
    -webkit-transform-origin: left center;
    transform-origin: left center;
  }
}
@keyframes zoomOutLeft {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(42px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(42px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: scale(0.1) translate3d(-2000px, 0, 0);
    transform: scale(0.1) translate3d(-2000px, 0, 0);
    -webkit-transform-origin: left center;
    transform-origin: left center;
  }
}
.zoomOutLeft {
  -webkit-animation-name: zoomOutLeft;
  animation-name: zoomOutLeft;
}

@-webkit-keyframes zoomOutRight {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(-42px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(-42px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: scale(0.1) translate3d(2000px, 0, 0);
    transform: scale(0.1) translate3d(2000px, 0, 0);
    -webkit-transform-origin: right center;
    transform-origin: right center;
  }
}
@keyframes zoomOutRight {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(-42px, 0, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(-42px, 0, 0);
  }
  to {
    opacity: 0;
    -webkit-transform: scale(0.1) translate3d(2000px, 0, 0);
    transform: scale(0.1) translate3d(2000px, 0, 0);
    -webkit-transform-origin: right center;
    transform-origin: right center;
  }
}
.zoomOutRight {
  -webkit-animation-name: zoomOutRight;
  animation-name: zoomOutRight;
}

@-webkit-keyframes zoomOutUp {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  to {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -2000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
@keyframes zoomOutUp {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    transform: scale3d(0.475, 0.475, 0.475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
    animation-timing-function: cubic-bezier(0.55, 0.055, 0.675, 0.19);
  }
  to {
    opacity: 0;
    -webkit-transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -2000px, 0);
    transform: scale3d(0.1, 0.1, 0.1) translate3d(0, -2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.32, 1);
  }
}
.zoomOutUp {
  -webkit-animation-name: zoomOutUp;
  animation-name: zoomOutUp;
}

@-webkit-keyframes slideInDown {
  0% {
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
@keyframes slideInDown {
  0% {
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
.slideInDown {
  -webkit-animation-name: slideInDown;
  animation-name: slideInDown;
}

@-webkit-keyframes slideInLeft {
  0% {
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
@keyframes slideInLeft {
  0% {
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
.slideInLeft {
  -webkit-animation-name: slideInLeft;
  animation-name: slideInLeft;
}

@-webkit-keyframes slideInRight {
  0% {
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
@keyframes slideInRight {
  0% {
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
.slideInRight {
  -webkit-animation-name: slideInRight;
  animation-name: slideInRight;
}

@-webkit-keyframes slideInUp {
  0% {
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
@keyframes slideInUp {
  0% {
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
    visibility: visible;
  }
  to {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
.slideInUp, .jugador figure aside, .autoridad figure aside {
  -webkit-animation-name: slideInUp;
  animation-name: slideInUp;
}

@-webkit-keyframes slideOutDown {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}
@keyframes slideOutDown {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}
.slideOutDown {
  -webkit-animation-name: slideOutDown;
  animation-name: slideOutDown;
}

@-webkit-keyframes slideOutLeft {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}
@keyframes slideOutLeft {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}
.slideOutLeft {
  -webkit-animation-name: slideOutLeft;
  animation-name: slideOutLeft;
}

@-webkit-keyframes slideOutRight {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}
@keyframes slideOutRight {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}
.slideOutRight {
  -webkit-animation-name: slideOutRight;
  animation-name: slideOutRight;
}

@-webkit-keyframes slideOutUp {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}
@keyframes slideOutUp {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
  to {
    visibility: hidden;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}
.slideOutUp {
  -webkit-animation-name: slideOutUp;
  animation-name: slideOutUp;
}

@-ms-viewport {
  width: device-width;
}
.visible-xs {
  display: none;
}

.visible-sm {
  display: none;
}

.visible-md {
  display: none;
}

.visible-lg {
  display: none;
}

.visible-xs-block,
.visible-xs-inline,
.visible-xs-inline-block,
.visible-sm-block,
.visible-sm-inline,
.visible-sm-inline-block,
.visible-md-block,
.visible-md-inline,
.visible-md-inline-block,
.visible-lg-block,
.visible-lg-inline,
.visible-lg-inline-block {
  display: none !important;
}

@media (max-width: 480px) {
  .visible-xs {
    display: block;
  }

  table.visible-xs {
    display: table;
  }

  tr.visible-xs {
    display: table-row;
  }

  th.visible-xs,
td.visible-xs {
    display: table-cell;
  }
}
@media (max-width: 480px) {
  .visible-xs-block {
    display: block !important;
  }
}

@media (max-width: 480px) {
  .visible-xs-inline {
    display: inline !important;
  }
}

@media (max-width: 480px) {
  .visible-xs-inline-block {
    display: inline-block !important;
  }
}

@media (max-width: 768px) {
  .visible-sm {
    display: block;
  }

  table.visible-sm {
    display: table;
  }

  tr.visible-sm {
    display: table-row;
  }

  th.visible-sm,
td.visible-sm {
    display: table-cell;
  }
}
@media (max-width: 768px) {
  .visible-sm-block {
    display: block !important;
  }
}

@media (max-width: 768px) {
  .visible-sm-inline {
    display: inline !important;
  }
}

@media (max-width: 768px) {
  .visible-sm-inline-block {
    display: inline-block !important;
  }
}

@media (max-width: 1024px) {
  .visible-md {
    display: block;
  }

  table.visible-md {
    display: table;
  }

  tr.visible-md {
    display: table-row;
  }

  th.visible-md,
td.visible-md {
    display: table-cell;
  }
}
@media (max-width: 1024px) {
  .visible-md-block {
    display: block !important;
  }
}

@media (max-width: 1024px) {
  .visible-md-inline {
    display: inline !important;
  }
}

@media (max-width: 1024px) {
  .visible-md-inline-block {
    display: inline-block !important;
  }
}

@media (min-width: 1200px) {
  .visible-lg {
    display: block;
  }

  table.visible-lg {
    display: table;
  }

  tr.visible-lg {
    display: table-row;
  }

  th.visible-lg,
td.visible-lg {
    display: table-cell;
  }
}
@media (min-width: 1200px) {
  .visible-lg-block {
    display: block !important;
  }
}

@media (min-width: 1200px) {
  .visible-lg-inline {
    display: inline !important;
  }
}

@media (min-width: 1200px) {
  .visible-lg-inline-block {
    display: inline-block !important;
  }
}

@media (max-width: 480px) {
  .hidden-xs {
    display: none;
  }
}
@media (max-width: 768px) {
  .hidden-sm {
    display: none;
  }
}
@media (max-width: 1024px) {
  .hidden-md {
    display: none;
  }
}
@media (min-width: 1200px) {
  .hidden-lg {
    display: none;
  }
}
.visible-print {
  display: none;
}

@media print {
  .visible-print {
    display: block;
  }

  table.visible-print {
    display: table;
  }

  tr.visible-print {
    display: table-row;
  }

  th.visible-print,
td.visible-print {
    display: table-cell;
  }
}
.visible-print-block {
  display: none !important;
}
@media print {
  .visible-print-block {
    display: block !important;
  }
}

.visible-print-inline {
  display: none !important;
}
@media print {
  .visible-print-inline {
    display: inline !important;
  }
}

.visible-print-inline-block {
  display: none !important;
}
@media print {
  .visible-print-inline-block {
    display: inline-block !important;
  }
}

@media print {
  .hidden-print {
    display: none;
  }
}
@media (max-width: 1300px) {
  .flex-off-xlg {
    -webkit-display: block;
    -moz-display: block;
    -ms-display: block;
    display: block;
  }

  .nofloat-xlg {
    float: none;
  }

  .der-xlg {
    float: right;
  }

  .izq-xlg {
    float: left;
  }

  .full-xlg {
    width: 100%;
  }

  .full-xlg-i {
    width: 100% !important;
  }

  .full-img-xlg img {
    width: 100%;
  }

  .position-off-xlg {
    position: static;
  }

  .centrarHorizontal-off-xlg, .centrarVertical-off-xlg {
    position: static;
    transform: initial;
  }

  .columnas-txt-xlg-off {
    column-count: auto;
  }

  .text-center-xlg, .t-c-xlg {
    text-align: center;
  }

  .text-left-xlg, .t-l-xlg {
    text-align: left;
  }

  .text-right-xlg, .t-r-xlg {
    text-align: right;
  }
}
@media (max-width: 1200px) {
  .flex-off-lg {
    -webkit-display: block;
    -moz-display: block;
    -ms-display: block;
    display: block;
  }

  .nofloat-lg {
    float: none;
  }

  .der-lg {
    float: right;
  }

  .izq-lg {
    float: left;
  }

  .full-lg {
    width: 100%;
  }

  .full-lg-i {
    width: 100% !important;
  }

  .full-img-lg img {
    width: 100%;
  }

  .position-off-lg {
    position: static;
  }

  .centrarHorizontal-off-lg, .centrarVertical-off-lg {
    position: static;
    transform: initial;
  }

  .columnas-txt-lg-off {
    column-count: auto;
  }

  .text-center-lg, .t-c-lg {
    text-align: center;
  }

  .text-left-lg, .t-l-lg {
    text-align: left;
  }

  .text-right-lg, .t-r-lg {
    text-align: right;
  }

  /* CENTRAR IMAGENES */
  .img-lg-spa-0 img {
    margin: 0;
  }

  .centrar-img-lg img,
div.centrar-img-lg img,
div.centrar-img-lg .imagenIz,
div.centrar-img-lg .imagenDer {
    margin: 0 auto;
    display: block;
  }

  .centrar-img-lg img[align],
div.centrar-img-lg img[align] {
    float: none;
    text-align: center;
  }

  .centrar-img-lg img[align],
div.centrar-img-lg img[align] {
    float: none;
    margin: 0 auto;
    margin-bottom: 15px;
  }
}
@media (max-width: 1024px) {
  .text-center-md, .t-c-md {
    text-align: center;
  }

  .text-left-md, .t-l-md {
    text-align: left;
  }

  .text-right-md, .t-r-md {
    text-align: right;
  }

  .position-off-md {
    position: static;
  }

  .centrarHorizontal-off-md, .centrarVertical-off-md {
    position: static;
    transform: initial;
  }

  .columnas-txt-md-off {
    column-count: auto;
  }

  .flex-off-md {
    -webkit-display: block;
    -moz-display: block;
    -ms-display: block;
    display: block;
  }

  .nofloat-md {
    float: none;
  }

  .der-md {
    float: right;
  }

  .izq-md {
    float: left;
  }

  .full-md {
    width: 100%;
  }

  .full-md-i {
    width: 100% !important;
  }

  .full-img-md img {
    width: 100%;
  }

  /* CENTRAR IMAGENES */
  .img-md-spa-0 img {
    margin: 0;
  }

  .centrar-img-md img,
div.centrar-img-md img,
div.centrar-img-md .imagenIz,
div.centrar-img-md .imagenDer {
    margin: 0 auto;
    display: block;
  }

  .centrar-img-md img[align],
div.centrar-img-md img[align] {
    float: none;
    text-align: center;
  }

  .centrar-img-md img[align],
div.centrar-img-md img[align] {
    float: none;
    margin: 0 auto;
    margin-bottom: 15px;
  }
}
@media (max-width: 768px) {
  /* CENTRAR IMAGENES */
  .img-sm-spa-0 img {
    margin: 0;
  }

  .centrar-img-sm img,
div.centrar-img-sm img,
div.centrar-img-sm .imagenIz,
div.centrar-img-sm .imagenDer {
    margin: 0 auto;
    display: block;
  }

  .centrar-img-sm img[align],
div.centrar-img-sm img[align] {
    float: none;
    text-align: center;
  }

  .centrar-img-sm img[align],
div.centrar-img-sm img[align] {
    float: none;
    margin: 0 auto;
    margin-bottom: 15px;
  }

  .text-center-sm, .t-c-sm {
    text-align: center;
  }

  .text-left-sm, .t-l-sm {
    text-align: left;
  }

  .text-right-sm, .t-r-sm {
    text-align: right;
  }

  .position-off-sm {
    position: static;
  }

  .centrarHorizontal-off-sm, .centrarVertical-off-sm {
    position: static;
    transform: initial;
  }

  .columnas-txt-sm-off {
    column-count: auto;
  }

  .flex-off-sm {
    -webkit-display: block;
    -moz-display: block;
    -ms-display: block;
    display: block;
  }

  .nofloat-sm {
    float: none;
  }

  .der-sm {
    float: right;
  }

  .izq-sm {
    float: left;
  }

  .full-sm {
    width: 100%;
  }

  .full-sm-i {
    width: 100% !important;
  }

  .full-img-sm img {
    width: 100%;
  }

  .imagenIz {
    margin-bottom: 20px;
  }

  .imagenDer {
    margin-bottom: 20px;
  }

  .quita-spa-img img {
    margin: 0 !important;
  }
}
@media (max-width: 480px) {
  /* CENTRAR IMAGENES */
  .img-xs-spa-0 img {
    margin: 0;
  }

  .centrar-img-xs img,
div.centrar-img-xs img,
div.centrar-img-xs .imagenIz,
div.centrar-img-xs .imagenDer {
    margin: 0 auto;
    display: block;
  }

  .centrar-img-xs img[align],
div.centrar-img-xs img[align] {
    float: none;
    text-align: center;
  }

  .centrar-img-xs img[align],
div.centrar-img-xs img[align] {
    float: none;
    margin: 0 auto;
    margin-bottom: 15px;
  }

  .medio {
    float: none;
    width: 100%;
  }

  .text-center-xs, .t-c-xs {
    text-align: center;
  }

  .text-left-xs, .t-l-xs {
    text-align: left;
  }

  .text-right-xs, .t-r-xs {
    text-align: right;
  }

  .visible-in-xs {
    display: inline-block;
  }

  .position-off {
    position: static;
  }

  .position-off-xs {
    position: static;
  }

  .centrarHorizontal-off-xs, .centrarVertical-off-xs {
    position: static;
    transform: initial;
  }

  .columnas-txt-xs-off {
    column-count: auto;
  }

  .flex-off-xs {
    -webkit-display: block;
    -moz-display: block;
    -ms-display: block;
    display: block;
  }

  .nofloat-xs {
    float: none;
  }

  .der-xs {
    float: right;
  }

  .izq-xs {
    float: left;
  }

  .full-xs {
    width: 100%;
  }

  .full-xs-i {
    width: 100% !important;
  }

  .full-img-xs img {
    width: 100%;
  }

  .rotar-90-xs {
    -ms-transform: rotate(-90deg);
    -webkit-transform: rotate(-90deg);
    transform: rotate(-90deg);
  }

  img.imagenIz, img.imagenDer {
    margin: 0 auto;
    display: block;
  }

  img[align].imagenIz, img[align].imagenDer {
    float: none;
    text-align: center;
  }

  img[align].imagenIz, img[align].imagenDer {
    float: none;
    margin: 0 auto;
    margin-bottom: 15px;
  }
}
@media (max-width: 1200px) {
  /* PORTADA A */
  div.corte img {
    max-width: none;
    position: absolute;
    left: 0;
    left: calc(50% - 960px);
    top: 0;
  }

  div.corte {
    height: 50px;
    overflow: hidden;
    position: relative;
  }

  .pie_horario {
    padding-left: 45px;
  }
}
@media (max-width: 1024px) {
  header .container {
    max-width: 930px;
  }

  div#cont_menu_a_rsp {
    width: 100%;
    background: #42b6e5;
  }

  .slicknav_menu {
    display: block;
  }

  .mini-foto-producto img {
    width: auto;
    height: auto;
  }

  .btn_carrito {
    font-size: 38px;
    margin-top: -14px;
  }

  .pie_horario {
    padding-left: 20px;
  }

  .menu .menu-nivel1 a {
    margin-right: 30px;
  }

  .contenido_presentacion {
    position: static;
    text-align: center;
  }
  .contenido_presentacion h1 {
    color: #076694;
  }
  .contenido_presentacion h2 {
    color: #076694;
  }
  .contenido_presentacion a {
    color: #076694;
  }
  .contenido_presentacion strong {
    color: #076694;
  }
  .contenido_presentacion div {
    color: #076694;
  }
}
@media (max-width: 768px) {
  nav {
    display: none;
  }

  header .cont-cabezal .titulo {
    font-size: 20px;
  }

  header .cont-cabezal .redes {
    margin-top: 70px;
  }

  header .cont-cabezal .redes div .escudo {
    font-size: 38px;
  }

  header .cont-cabezal .redes div .red {
    font-size: 15px;
  }

  header .cont-cabezal .redes div .icono-red-face {
    top: 14px;
    left: 12px;
  }

  header .cont-cabezal .redes div .icono-red-twit {
    top: 15px;
    left: 8px;
    font-size: 13px;
  }

  header .cont-cabezal .redes div .icono-red-yout {
    top: 13px;
    left: 7px;
  }

  header .cont-cabezal .redes div .icono-red-inst {
    top: 13px;
    left: 8px;
  }

  header .cont-cabezal .redes div .icono-red-goog {
    top: 13px;
    left: 7px;
  }

  footer .columna_1 {
    text-align: center;
    float: none;
  }
  footer .columna_1 img {
    margin: 0 10px;
  }

  footer .columna_2 {
    display: none;
  }

  footer .columna_2_resp {
    text-align: center;
    margin-top: 20px;
  }
  footer .columna_2_resp a {
    font-size: 15px;
    color: #ffffff;
  }

  .bg_cabezal_fijo {
    background-image: url(/../imagenes/img_presentacion/cabezal.jpg);
    background-repeat: no-repeat;
    background-position: center;
    background-size: cover;
  }

  .menu-escritorio {
    width: 150px !important;
    right: -10px;
  }

  .cont-menu-resp {
    display: block;
  }

  .menu_pie_item {
    margin: 0 5px;
    display: inline-block;
  }

  /*///////////////////////////////////////////////////////////////////////*/
  /* PRESENTACION */
  /*///////////////////////////////////////////////////////////////////////*/
  .cont_slide_contenido.login {
    height: auto;
  }
  .cont_slide_contenido.login .slide_contenido {
    position: static;
    transform: none;
  }
  .cont_slide_contenido.proyecto {
    height: 250px;
  }

  .buscador-cerrar {
    position: fixed;
    top: 0;
    right: 0;
    margin: 25px;
    margin-top: 65px;
  }

  .menu-a {
    font-size: 13px;
  }

  .imagenIz {
    margin-bottom: 0;
  }
}
@media (max-width: 480px) {
  header .cont-cabezal .redes {
    display: none;
  }

  header .cont-cabezal .titulo {
    float: none;
    margin-top: 10px;
    font-size: 16px;
    text-align: center;
  }

  header .cont-cabezal .logo {
    margin-top: 10px;
  }

  header .cont-cabezal .logo img {
    height: 110px;
  }

  .cont-menu-resp .columna_1 p {
    display: none;
  }

  .cont-menu-resp .columna_2 .redes-resp {
    display: inline-block;
  }

  .icono-menu {
    margin-top: 3px;
    display: inline-block;
  }

  .precio-tabla {
    padding-top: 20px;
  }

  /* ul.pagination li:not(.flechas_paginacion) {
  	display: none
  } */
  .slide_contenido {
    font-size: 80%;
  }

  #slides {
    height: 230px;
  }

  .dato-especial img {
    width: 100%;
    border-right: none;
  }

  .zoomContainer {
    display: none !important;
    position: static !important;
  }

  .cont_img_producto {
    z-index: 1;
  }

  #img_producto img {
    z-index: -1;
  }

  a.link_pie {
    padding: 5px 5px;
    color: #ffffff;
    background-color: #42b6e5;
  }

  a.link_pie:hover {
    color: #bf1a1e;
    background-color: #afd5ef;
  }

  .btn_carrito {
    font-size: 20px;
    margin-top: -2px;
  }

  .menu-a a {
    border-right: none;
    padding: 0;
    margin-right: 0;
    margin-bottom: 0;
  }

  /* .paginacion_contenedor {
  	text-align: center;
  }
  .paginacion {
  // float: left;
  display: inline-block;
  li{ 
  	display: inline-block;

  	a:hover{
  		background-color: $colorNegro;
  		color: $colorBlanco;
  	}

  }
  a, &.activo {
  	display: inline-block; 
  	margin: 0 $espacioMini;
  	@include color($colorGris);
  	font-size: $textoExtra;
  	padding: $espacioMedio $espacioGrande;
  	border-radius: 3px;
  	@include transition(.2s);
  	// @include color($colorGrisClaro,true);
  	border: 1px solid $colorGrisClaro;

  }
  }	

  .flechas_paginacion {
  	a {
  		@include color($colorBlanco);
  		background: $colorSecundario; 
  		margin: 0px $espacioChico;
  		border: 0;
  		font-size: $tituloChico;
  		&:hover {
  			@include color($colorSecundario);
  			background: none;
  			border: none;
  		} 
  	}
  	&.activo {
  		@include color($colorBlanco);
  		@include color($colorSecundario,true);
  		border: 1px solid $colorSecundario;
  	}
  }
   */
  .active a {
    background-color: #000;
    color: #ffffff;
  }

  img[align].imagenIz, img[align].imagenDer {
    margin-bottom: 0;
  }
}

/*# sourceMappingURL=estilos.css.map */